Methylpromazine
drug drugOn this page
Also known as AlimemazinaAlimemazineBAYER-1219Dl-trimeprazineRP-6549TrimeprazineTRIMEPRAZINE TARTRATE
Summary
Methylpromazine (CHEMBL829) is an approved small molecule (ATC R06AD01) targeting HRH1; indicated across 1 condition including allergic disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: R06AD01
- Targets: 1 (HRH1)
- Indications: 1 condition
- Chemistry: 298.4 Da · C18H22N2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL829 |
| Name | Methylpromazine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 5574 |
| ATC | R06AD01 |
| Molecular formula | C18H22N2S |
| Molecular weight | 298.4 |
| InChIKey | ZZHLYYDVIOPZBE-UHFFFAOYSA-N |
SMILES: CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)CN(C)C
IUPAC name: N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine
Also known as: Alimemazina, Alimemazine, BAYER-1219, Dl-trimeprazine, RP-6549, Trimeprazine, Methylpromazine, METHYLPROMAZINE, TRIMEPRAZINE, alimemazine, trimeprazine, TRIMEPRAZINE TARTRATE
Parent form; salt/anhydrous children: CHEMBL1713082, CHEMBL3989885, CHEMBL4785767
Patent coverage: 2,426 distinct patent families (8,445 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 8,294 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HRH1 | H1 receptor | Antagonist | 9.14 | 0% | P35367 |
Broader ChEMBL bioactivity targets: 15 (assay-derived). Sample: Alpha-2A adrenergic receptor, D(1A) dopamine receptor, Thromboxane A2 receptor, Muscarinic acetylcholine receptor M2, 5-hydroxytryptamine receptor 1A, Muscarinic acetylcholine receptor M1, Sodium-dependent noradrenaline transporter, Sodium-dependent serotonin transporter, Alpha-1A adrenergic receptor, Mu-type opioid receptor, D(3) dopamine receptor, Sodium-dependent dopamine transporter, Voltage-gated inwardly rectifying potassium channel KCNH2, Histamine H3 receptor, Bile salt export pump.
Bioactivity
ChEMBL activities: 11 potent at pChembl ≥ 5 of 15 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DRD3 | 7.54 | AC50 | 28.8 | nM | CHEMBL_ACT_25194773 |
| ADRA1A | 7.53 | AC50 | 29.6 | nM | CHEMBL_ACT_25219065 |
| DRD1 | 6.87 | AC50 | 136.3 | nM | CHEMBL_ACT_25115467 |
| CHRM1 | 6.51 | AC50 | 307 | nM | CHEMBL_ACT_25210426 |
| CHRM2 | 6.47 | AC50 | 334.6 | nM | CHEMBL_ACT_25195993 |
| ADRA2A | 6.04 | AC50 | 909.3 | nM | CHEMBL_ACT_25156686 |
| SLC6A2 | 5.77 | AC50 | 1706 | nM | CHEMBL_ACT_25146257 |
| SLC6A4 | 5.63 | AC50 | 2353 | nM | CHEMBL_ACT_25151584 |
| HTR1A | 5.6 | AC50 | 2514 | nM | CHEMBL_ACT_25165281 |
| KCNH2 | 5.35 | AC50 | 4500 | nM | CHEMBL_ACT_25118124 |
| OPRM1 | 5.3 | AC50 | 4977 | nM | CHEMBL_ACT_25158432 |
Target pathways
Aggregated over 1 target gene(s): HRH1.
Top Reactome pathways
2 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Histamine receptors | 1 | HRH1 |
| G alpha (q) signalling events | 1 | HRH1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| inflammatory response | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| chemical synaptic transmission | 1 |
| memory | 1 |
| visual learning | 1 |
| regulation of vascular permeability | 1 |
| positive regulation of vasoconstriction | 1 |
| regulation of synaptic plasticity | 1 |
| cellular response to histamine | 1 |
| signal transduction | 1 |
| phospholipase C-activating serotonin receptor signaling pathway | 1 |
Indications & clinical
Indications
1 approved indication. FDA phase 4, plus an anticancer drug’s labelled cancer uses (which ChEMBL often logs at phase 3).
| Indication | Phase | MONDO | EFO |
|---|---|---|---|
| allergic disease | 4 | MONDO:0005271 | MONDO:0005271 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
296 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | HRH1 |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | HRH1 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HRH1 |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HRH1 |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | HRH1 |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | HRH1 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| ACRIVASTINE | ChEMBL | Phase 4 (approved) | HRH1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | HRH1 |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | HRH1 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | HRH1 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HRH1 |
| AMSACRINE | ChEMBL | Phase 4 (approved) | HRH1 |
| ANTAZOLINE | ChEMBL | Phase 4 (approved) | HRH1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | HRH1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HRH1 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | HRH1 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HRH1 |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | HRH1 |
| AZATADINE | ChEMBL | Phase 4 (approved) | HRH1 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HRH1 |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | HRH1 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | HRH1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | HRH1 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | HRH1 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | HRH1 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | HRH1 |
| BIPERIDEN | ChEMBL | Phase 4 (approved) | HRH1 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HRH1 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | HRH1 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| BUCLIZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| BUPROPION | ChEMBL | Phase 4 (approved) | HRH1 |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | HRH1 |
| BUTRIPTYLINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | HRH1 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | HRH1 |
| CARBINOXAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CETIRIZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CHLORDIAZEPOXIDE | ChEMBL | Phase 4 (approved) | HRH1 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CHLORPHENTERMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | HRH1 |
| CINACALCET | ChEMBL | Phase 4 (approved) | HRH1 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | HRH1 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | HRH1 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | HRH1 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CYCLIZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | HRH1 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | HRH1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | HRH1 |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| DEXBROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| DEXCHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | HRH1 |
| DICYCLOMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| DIETHYLPROPION | ChEMBL | Phase 4 (approved) | HRH1 |
| DIMENHYDRINATE | ChEMBL | Phase 4 (approved) | HRH1 |
| DIPHEMANIL | ChEMBL | Phase 4 (approved) | HRH1 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | HRH1 |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | HRH1 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | HRH1 |
| DROPERIDOL | ChEMBL | Phase 4 (approved) | HRH1 |
| DULOXETINE | ChEMBL | Phase 4 (approved) | HRH1 |
| DYCLONINE | ChEMBL | Phase 4 (approved) | HRH1 |
| EBASTINE | ChEMBL | Phase 4 (approved) | HRH1 |
| EPALRESTAT | ChEMBL | Phase 4 (approved) | HRH1 |
| ESCITALOPRAM | ChEMBL | Phase 4 (approved) | HRH1 |
| FENTANYL | ChEMBL | Phase 4 (approved) | HRH1 |
| FEXOFENADINE | ChEMBL | Phase 4 (approved) | HRH1 |
| FLUDROCORTISONE | ChEMBL | Phase 4 (approved) | HRH1 |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | HRH1 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | HRH1 |
| GLYCOPYRRONIUM BROMIDE | ChEMBL | Phase 4 (approved) | HRH1 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | HRH1 |
| HISTAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| HYDROXOCOBALAMIN | ChEMBL | Phase 4 (approved) | HRH1 |
| HYDROXYZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| IDARUBICIN | ChEMBL | Phase 4 (approved) | HRH1 |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | HRH1 |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| INDOCYANINE GREEN ACID FORM | ChEMBL | Phase 4 (approved) | HRH1 |
| IPRINDOLE | ChEMBL | Phase 4 (approved) | HRH1 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HRH1 |
| KETOTIFEN | ChEMBL | Phase 4 (approved) | HRH1 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | HRH1 |
| LEVOCETIRIZINE | ChEMBL | Phase 4 (approved) | HRH1 |
| LOFEPRAMINE | ChEMBL | Phase 4 (approved) | HRH1 |
| LORATADINE | ChEMBL | Phase 4 (approved) | HRH1 |
| LORCASERIN | ChEMBL | Phase 4 (approved) | HRH1 |
Related Atlas pages
- Genes: HRH1
- Indicated for: allergic disease
- Drugs: Aclidinium Bromide, Desloratadine, Dihydroergotamine, Paliperidone, Pramipexole, Abemaciclib, Acetophenazine, Acrivastine, Amiodarone, Amisulpride, Amitriptyline, Amoxapine, Amsacrine, Antazoline, Apomorphine, Aripiprazole, Asenapine, Astemizole, Atomoxetine, Azatadine, Azelastine, Benfluorex, Benperidol, Benzbromarone, Benztropine, Bepridil, Betamethasone Phosphoric Acid, Biperiden, Brexpiprazole, Bromperidol, Brompheniramine, Buclizine, Bupropion, Buspirone, Butriptyline, Cabergoline, Candesartan Cilexetil, Captopril, Carbinoxamine, Cariprazine, Cetirizine, Chlordiazepoxide, Chlorpheniramine, Chlorphentermine, Chlorpromazine, Chlorprothixene, Cinacalcet, Cinnarizine, Cisapride, Citalopram, Clemastine, Clofazimine, Clomipramine, Clotrimazole, Clozapine, Cyclizine, Cyclobenzaprine, Cyproheptadine, Daunorubicin, Desipramine, Dexbrompheniramine, Dibenzepin, Dicyclomine, Diethylpropion, Dimenhydrinate, Diphemanil, Diphenhydramine, Domperidone, Dothiepin, Doxepin, Droperidol, Duloxetine, Dyclonine, Ebastine, Epalrestat, Fentanyl, Fexofenadine, Fludrocortisone, Fluoxetine, Fluphenazine, Fluspirilene, Glycopyrronium Bromide, Haloperidol, Histamine, Hydroxocobalamin, Hydroxyzine, Idarubicin, Iloperidone, Imipramine, Indocyanine Green Acid Form, Iprindole, Ketanserin, Ketotifen, Lasofoxifene, Lofepramine, Loratadine, Lorcaserin