Midazolam
drugOn this page
Also known as Midazolam civMidazolam in 0.8% sodium chlorideMidazolam in 0.9% sodium chlorideNayzilamUSL-261USL261SID50113067[3H]-Midazolam
Summary
Midazolam (CHEMBL655) is an approved small-molecule GABAA receptor agonist (ATC N05CD08) targeting ADRA1B and TRHR; indicated across 115 conditions including epilepsy and hypertensive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05CD08
- Targets: 2 (ADRA1B, TRHR)
- Indications: 115 conditions
- Clinical trials: 943
- Chemistry: 325.8 Da · C18H13ClFN3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL655 |
| Name | Midazolam |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4192 |
| ChEBI | CHEBI:6931 |
| ATC | N05CD08 |
| Molecular formula | C18H13ClFN3 |
| Molecular weight | 325.8 |
| InChIKey | DDLIGBOFAVUZHB-UHFFFAOYSA-N |
SMILES: CC1=NC=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4F
IUPAC name: 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine
ChEBI definition: An imidazobenzodiazepine that is 4H-imidazo[1,5-a][1,4]benzodiazepine which is substituted by a methyl, 2-fluorophenyl and chloro groups at positions 1, 6 and 8, respectively.
Pharmacological roles (ChEBI): GABAA receptor agonist, anticonvulsant, anxiolytic drug, apoptosis inducer, antineoplastic agent, muscle relaxant, sedative, general anaesthetic, central nervous system depressant.
Also known as: Midazolam, Midazolam civ, Midazolam in 0.8% sodium chloride, Midazolam in 0.9% sodium chloride, Nayzilam, USL-261, USL261, midazolam, SID50113067, [3H]-Midazolam, MIDAZOLAM
Parent form; salt/anhydrous children: CHEMBL1200420, CHEMBL2106922
Patent coverage: 8,732 distinct patent families (32,889 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 32,504 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA1B | α1B-adrenoceptor | Positive | 3.7 | 0% | P35368 |
| TRHR | TRH1 receptor | Antagonist | 5.49 | 0% | P34981 |
Broader ChEMBL bioactivity targets: 10 (assay-derived). Sample: GABA-A receptor; anion channel, D(3) dopamine receptor, Kappa-type opioid receptor, 3’,5’-cyclic-AMP phosphodiesterase 4D, Cytochrome P450 3A4, Gamma-aminobutyric acid receptor subunit alpha-1, ATP-dependent translocase ABCB1, Translocator protein, Solute carrier family 22 member 1, Bile salt export pump.
Bioactivity
ChEMBL activities: 14 potent at pChembl ≥ 5 of 19 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P16257 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_371260 |
| O09028 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_520131 |
| P62813 | 8.6 | AC50 | 2.5 | nM | CHEMBL_ACT_25131168 |
| CYP3A4 | 7.33 | IC50 | 47 | nM | CHEMBL_ACT_26109725 |
| CYP3A4 | 7.21 | IC50 | 61.8 | nM | CHEMBL_ACT_24740415 |
| CYP3A4 | 7.18 | IC50 | 66.2 | nM | CHEMBL_ACT_24822376 |
| CYP3A4 | 7.18 | IC50 | 66 | nM | CHEMBL_ACT_25593413 |
| CYP3A4 | 7.1 | IC50 | 80 | nM | CHEMBL_ACT_25502139 |
| OPRK1 | 5.92 | AC50 | 1192 | nM | CHEMBL_ACT_25129968 |
| CYP3A4 | 5.61 | Ki | 2470 | nM | CHEMBL_ACT_15152431 |
| SLC22A1 | 5.43 | Ki | 3700 | nM | CHEMBL_ACT_11002867 |
| CYP3A4 | 5.09 | IC50 | 8100 | nM | CHEMBL_ACT_1160708 |
| PDE4D | 5 | AC50 | 10000 | nM | CHEMBL_ACT_25185923 |
| DRD3 | 5 | AC50 | 10000 | nM | CHEMBL_ACT_25194109 |
Target pathways
Aggregated over 2 target gene(s): ADRA1B, TRHR.
Top Reactome pathways
10 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| G alpha (q) signalling events | 2 | ADRA1B, TRHR |
| Signal Transduction | 1 | ADRA1B |
| Signaling by GPCR | 1 | ADRA1B |
| Class A/1 (Rhodopsin-like receptors) | 1 | ADRA1B |
| Peptide ligand-binding receptors | 1 | TRHR |
| Amine ligand-binding receptors | 1 | ADRA1B |
| GPCR downstream signalling | 1 | ADRA1B |
| Adrenoceptors | 1 | ADRA1B |
| G alpha (12/13) signalling events | 1 | ADRA1B |
| GPCR ligand binding | 1 | ADRA1B |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 2 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 2 |
| signal transduction | 2 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| cell-cell signaling | 1 |
| positive regulation of cardiac muscle hypertrophy | 1 |
| regulation of vasoconstriction | 1 |
| intracellular signal transduction | 1 |
| positive regulation of MAPK cascade | 1 |
| regulation of cardiac muscle contraction | 1 |
| adenylate cyclase-activating adrenergic receptor signaling pathway | 1 |
| neuron-glial cell signaling | 1 |
| regulation of muscle contraction | 1 |
| adrenergic receptor signaling pathway | 1 |
Indications & clinical
Indications
115 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| epilepsy | 4 | MONDO:0005027 | EFO:0000474 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| cirrhosis of liver | 3 | MONDO:0005155 | EFO:0001422 |
| relapsing-remitting multiple sclerosis | 3 | MONDO:0005314 | EFO:0003929 |
| bone fracture | 3 | MONDO:0005315 | EFO:0003931 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| toxic shock syndrome | 3 | MONDO:0001881 | EFO:0006834 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| delirium | 3 | MONDO:0045057 | EFO:0009267 |
| respiratory failure | 3 | MONDO:0021113 | EFO:0009686 |
| infertility disorder | 3 | MONDO:0005047 | EFO:0000545 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| brain injury | 3 | MONDO:0043510 | MONDO:0043510 |
| lung disorder | 3 | MONDO:0005275 | EFO:0003818 |
| subarachnoid hemorrhage | 2 | MONDO:0005099 | EFO:0000713 |
| post-traumatic stress disorder | 2 | MONDO:0005146 | EFO:0001358 |
| breast neoplasm | 2 | MONDO:0021100 | EFO:0003869 |
| obsessive-compulsive disorder | 2 | MONDO:0008114 | EFO:0004242 |
| hypotensive disorder | 2 | MONDO:0005468 | EFO:0005251 |
| visual epilepsy | 2 | MONDO:0001386 | HP:0001250 |
| borderline personality disorder | 2 | MONDO:0001156 | HP:0012076 |
| pulmonary tuberculosis | 2 | MONDO:0006052 | EFO:1000049 |
| major depressive disorder | 2 | MONDO:0002009 | MONDO:0002009 |
| cataract | 2 | MONDO:0005129 | MONDO:0005129 |
| bipolar disorder | 2 | MONDO:0004985 | MONDO:0004985 |
| complex regional pain syndrome | 2 | MONDO:0019369 | EFO:1001998 |
| tonsillitis | 2 | MONDO:0001039 | MONDO:0001039 |
| B-cell chronic lymphocytic leukemia | 1 | MONDO:0004948 | EFO:0000095 |
| atopic eczema | 1 | MONDO:0004980 | EFO:0000274 |
| Crohn disease | 1 | MONDO:0005011 | EFO:0000384 |
| mesothelioma | 1 | MONDO:0005065 | EFO:0000588 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| prostate adenocarcinoma | 1 | MONDO:0005082 | EFO:0000673 |
| psoriasis | 1 | MONDO:0005083 | EFO:0000676 |
| rheumatoid arthritis | 1 | MONDO:0008383 | EFO:0000685 |
| skin disorder | 1 | MONDO:0005093 | EFO:0000701 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| endometriosis | 1 | MONDO:0005133 | EFO:0001065 |
| plasma cell myeloma | 1 | MONDO:0009693 | EFO:0001378 |
| cocaine dependence | 1 | MONDO:0005186 | EFO:0002610 |
| hepatitis C virus infection | 1 | MONDO:0005231 | EFO:0003047 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| heart failure | 1 | MONDO:0005252 | EFO:0003144 |
| postmenopausal osteoporosis | 1 | MONDO:0008159 | EFO:0003854 |
| drug dependence | 1 | MONDO:0005303 | EFO:0003890 |
| atherosclerosis | 1 | MONDO:0005311 | EFO:0003914 |
| chronic hepatitis C virus infection | 1 | MONDO:0005354 | EFO:0004220 |
| chronic hepatitis B virus infection | 1 | MONDO:0005366 | EFO:0004239 |
| anemia | 1 | MONDO:0002280 | EFO:0004272 |
| schizoaffective disorder | 1 | MONDO:0005487 | EFO:0005411 |
| infectious disease | 1 | MONDO:0005550 | EFO:0005741 |
| non-Hodgkin lymphoma | 1 | MONDO:0018908 | EFO:0005952 |
| aspergillosis | 1 | MONDO:0005657 | EFO:0007157 |
| metabolic dysfunction-associated steatohepatitis | 1 | MONDO:0007027 | EFO:1001249 |
| acute myeloid leukemia | 1 | MONDO:0018874 | EFO:0000222 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
| nicotine dependence | 1 | MONDO:0008575 | EFO:0003768 |
| respiratory syncytial virus infectious disease | 1 | MONDO:0001577 | EFO:1001413 |
| influenza | 1 | MONDO:0005812 | EFO:0007328 |
| kidney failure | 1 | MONDO:0001106 | HP:0000083 |
| cardiovascular disorder | 1 | MONDO:0004995 | EFO:0000319 |
| ulcerative colitis | 1 | MONDO:0005101 | EFO:0000729 |
| obesity disorder | 1 | MONDO:0011122 | EFO:0001073 |
| malaria | 1 | MONDO:0005136 | EFO:0001068 |
| Alzheimer disease | 1 | MONDO:0004975 | MONDO:0004975 |
| amyotrophic lateral sclerosis | 1 | MONDO:0004976 | MONDO:0004976 |
| type 2 diabetes mellitus | 1 | MONDO:0005148 | MONDO:0005148 |
| Parkinson disease | 1 | MONDO:0005180 | MONDO:0005180 |
| myositis ossificans | 1 | MONDO:0003964 | MONDO:0007606 |
| sickle cell disease | 1 | MONDO:0011382 | MONDO:0011382 |
| gastrointestinal stromal tumor | 1 | MONDO:0011719 | MONDO:0011719 |
| tuberculosis | 1 | MONDO:0018076 | MONDO:0018076 |
| inborn mitochondrial metabolism disorder | 1 | MONDO:0004069 | MONDO:0044970 |
| severe acute respiratory syndrome | 1 | MONDO:0005091 | MONDO:0100096 |
| melanoma | 1 | MONDO:0005105 | EFO:0000756 |
| urinary tract infection | 1 | MONDO:0100338 | EFO:0003103 |
| trypanosomiasis | 1 | MONDO:0000940 | DOID:10113 |
| chronic obstructive pulmonary disease | 1 | MONDO:0005002 | EFO:0000341 |
| anti-neutrophil antibody associated vasculitis | 1 | MONDO:0005435 | EFO:0004826 |
| burn | 1 | MONDO:0043519 | EFO:0009516 |
| autosomal dominant polycystic kidney disease | 1 | MONDO:0004691 | EFO:1001496 |
| cystic fibrosis | 1 | MONDO:0009061 | MONDO:0009061 |
| spinal muscular atrophy | 1 | MONDO:0001516 | MONDO:0019079 |
| lung neoplasm | 1 | MONDO:0021117 | MONDO:0021117 |
| neuralgia | 0 | MONDO:0021667 | EFO:0005762 |
29 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 943.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 352 |
| PHASE4 | 215 |
| Not specified | 181 |
| PHASE3 | 73 |
| PHASE2 | 57 |
| PHASE2/PHASE3 | 24 |
| PHASE1/PHASE2 | 23 |
| EARLY_PHASE1 | 18 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00577200 | PHASE4 | ACTIVE_NOT_RECRUITING | Safety of Driving After Minor Surgery With Monitored Anesthesia Care |
| NCT02078336 | PHASE4 | ACTIVE_NOT_RECRUITING | Optimization of Procedural Sedation Protocol Used for Dental Care Delivery in People With Mental Disability |
| NCT04119180 | PHASE4 | RECRUITING | Sedation Versus Protective Stabilization for Pediatric Dental Treatment |
| NCT04669457 | PHASE4 | ENROLLING_BY_INVITATION | Pediatric Delirium |
| NCT05602636 | PHASE4 | RECRUITING | Analgesic Effect of Supraclavicular Block and Interscalene Analgesia Versus an Intercostobrachial Nerve Block Versus PCA in Forearm Surgery |
| NCT05934669 | PHASE4 | RECRUITING | IN Midazolam vs IN Dexmedetomidine vs IN Ketamine During Minimal Procedures in Pediatric ED |
| NCT05980117 | PHASE4 | RECRUITING | Remimazolam for Cataract Surgery |
| NCT06139692 | PHASE4 | RECRUITING | Comparison of Perioperative Conscious Sedation During Endovascular Thrombectomy in Acute Ischemic Stroke |
| NCT06144177 | PHASE4 | RECRUITING | Induction in the Dark |
| NCT06614036 | PHASE4 | RECRUITING | Remimazolam Versus Midazolam for Sedation During Upper GI Endoscopy: a Randomized Controlled Trial |
| NCT06731088 | PHASE4 | ENROLLING_BY_INVITATION | Effect of Remazolam Besylate Combined With Remifentanil Analgesic Sedation on the Prognosis of Patients With Sepsis |
| NCT06736938 | PHASE4 | NOT_YET_RECRUITING | Balanced Analgosedation in Bronchoscopy: Propofol/Pethidine Versus Midazolam/Pethidine |
| NCT06763705 | PHASE4 | RECRUITING | Comparison of Safety and Efficacy for Different Sedation Regimens During Colonoscopy |
| NCT06784479 | PHASE4 | ACTIVE_NOT_RECRUITING | Combination of Remimazolam and Propofol During Drug-induced Sleep Endoscopy |
| NCT06934811 | PHASE4 | NOT_YET_RECRUITING | Ciprofol’s Impact on Oxygenator Function in Extracorporeal Membrane Oxygenation (ECMO) Patients |
| NCT07177235 | PHASE4 | NOT_YET_RECRUITING | Ketamine for the Treatment of Refractory Status Epilepticus |
| NCT07190612 | PHASE4 | NOT_YET_RECRUITING | Efficacy of Propofol Combination With Either Ketamine, Dexmedetomidine or Midazolam for Sedation During Upper Gastrointestinal Endoscopic Procedures |
| NCT07265128 | PHASE4 | NOT_YET_RECRUITING | Remimazolam vs Midazolam to Reduce Delirium in Adults ≥65 Undergoing CPB Valve Surgery |
| NCT07300826 | PHASE4 | NOT_YET_RECRUITING | Intravenous Dexmedetomidine Versus Midazolam in Preventing Shivering in Trauma Patients Undergoing Lower Limb Orthopedic Surgery Under Spinal Anesthesia |
| NCT07425444 | PHASE4 | NOT_YET_RECRUITING | Attenuate the Stress Response in Laparoscopic Cholecystectomy |
| NCT07427446 | PHASE4 | RECRUITING | Dexmedetomidine-Midazolam vs. Ketamine-Midazolam on Emergence Delirium |
| NCT07556523 | PHASE4 | RECRUITING | Patient Quality of Recovery After TAVR With Different Sedation Regimens |
| NCT00050180 | PHASE4 | COMPLETED | Influence of the MDR1 Genotype on Blood Levels of Indinavir and Saquinavir in Healthy Volunteers |
| NCT00158873 | PHASE4 | COMPLETED | Pharmaco-Economic Study Of Ultiva In Intensive Care Unit(ICU)Subjects |
| NCT00188227 | PHASE4 | COMPLETED | Comparison of Three Different Pain and Anxiety Reducing Methods in Adult Patients Undergoing Bone Marrow Puncture |
| NCT00216190 | PHASE4 | COMPLETED | A Safety and Efficacy Study of Dexmedetomidine in ICU Patients Requiring Continuous Sedation |
| NCT00333632 | PHASE4 | WITHDRAWN | Effect of Dexmedetomidine Upon Sleep Postoperatively |
| NCT00376831 | PHASE4 | COMPLETED | The Efficacy of Midazolam & Ketamine Versus Midazolam & Fentanyl for Sedation in Ambulatory Colonoscopies |
| NCT00440960 | PHASE4 | COMPLETED | Anesthesia in Flexible Bronchoscopy for Lung Cancer Diagnostic |
| NCT00446420 | PHASE4 | COMPLETED | Cognitive Impairment Following Sedation for Colonoscopy With Propofol, Midazolam and Fentanyl Combinations |
| NCT00596050 | PHASE4 | COMPLETED | Ketamine Versus Etomidate for Procedural Sedation for Pediatric Orthopedic Reductions |
| NCT00596414 | PHASE4 | COMPLETED | Sedation and Analgesia for Transjugular Liver Biopsy: A Randomized Double Blind Placebo Controlled Trial |
| NCT00636428 | PHASE4 | COMPLETED | Clinical Trial of Oral Midazolam in Pediatric Endoscopy |
| NCT00667043 | PHASE4 | COMPLETED | Remifentanil and Propofol Versus Fentanyl and Midazolam for Sedation During Therapeutic Hypothermia. A Randomised, Controlled Trial |
| NCT00724035 | PHASE4 | COMPLETED | Ultrasound-Guided Axillary or Infraclavicular Nerve Block for Upper Limb Surgery |
| NCT00784498 | PHASE4 | COMPLETED | Procedural Sedation Using Propofol Versus Midazolam/Ketamine in the Adult Emergency Department |
| NCT00789386 | PHASE4 | UNKNOWN | The Effect of Remifentanil on Established Capsaicin-Induced Hyperalgesia in Human Volunteers |
| NCT00808184 | PHASE4 | COMPLETED | Pharmacokinetic Study of CPT-11, Raltegravir and Midazolam With Characterisation of UGT1A1 Genotype |
| NCT00811837 | PHASE4 | UNKNOWN | The Effect of Remifentanil on Established Sunburn-induced Hyperalgesia in Human Volunteers |
| NCT00839371 | PHASE4 | COMPLETED | Bronchoscopy and Bispectral Index (BIS) - Guided Sedation |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 7 clinical and 30 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
78 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA1B |
| PROTIRELIN | ChEMBL + PubChem | Phase 4 (approved) | TRHR |
| ALFUZOSIN | ChEMBL | Phase 4 (approved) | ADRA1B |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| APRACLONIDINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA1B |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| ATENOLOL | ChEMBL | Phase 4 (approved) | ADRA1B |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA1B |
| BRIMONIDINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | ADRA1B |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| CINACALCET | ChEMBL | Phase 4 (approved) | ADRA1B |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA1B |
| CLONIDINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| DEXMEDETOMIDINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| DOPAMINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | ADRA1B |
| EBASTINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| EPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| FENOLDOPAM | ChEMBL | Phase 4 (approved) | ADRA1B |
| FENTANYL | ChEMBL | Phase 4 (approved) | ADRA1B |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | ADRA1B |
| INDACATEROL | ChEMBL | Phase 4 (approved) | ADRA1B |
| INDORAMIN | ChEMBL | Phase 4 (approved) | ADRA1B |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | ADRA1B |
| LABETALOL | ChEMBL | Phase 4 (approved) | ADRA1B |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | ADRA1B |
| LUMATEPERONE TOSYLATE | ChEMBL | Phase 4 (approved) | ADRA1B |
| MOXISYLYTE | ChEMBL | Phase 4 (approved) | ADRA1B |
| NAFTOPIDIL | ChEMBL | Phase 4 (approved) | ADRA1B |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | ADRA1B |
| NOREPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| OXYMETAZOLINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| PHENTOLAMINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| PHENYLEPHRINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| PRAZOSIN | ChEMBL | Phase 4 (approved) | ADRA1B |
| QUETIAPINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | ADRA1B |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | ADRA1B |
| SILODOSIN | ChEMBL | Phase 4 (approved) | ADRA1B |
| TAMSULOSIN | ChEMBL | Phase 4 (approved) | ADRA1B |
| TEGASEROD | ChEMBL | Phase 4 (approved) | ADRA1B |
| TERAZOSIN | ChEMBL | Phase 4 (approved) | ADRA1B |
| TERFENADINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| TOLAZOLINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| VERAPAMIL | ChEMBL | Phase 4 (approved) | ADRA1B |
| VILAZODONE | ChEMBL | Phase 4 (approved) | ADRA1B |
| XYLOMETAZOLINE | ChEMBL | Phase 4 (approved) | ADRA1B |
| ZIPRASIDONE | ChEMBL | Phase 4 (approved) | ADRA1B |
| BUNAZOSIN | ChEMBL | Phase 3 | ADRA1B |
| IDAZOXAN | ChEMBL | Phase 3 | ADRA1B |
| LATREPIRDINE | ChEMBL | Phase 3 | ADRA1B |
| MEDETOMIDINE | ChEMBL | Phase 3 | ADRA1B |
| VOLINANSERIN | ChEMBL | Phase 3 | ADRA1B |
| YOHIMBINE | ChEMBL | Phase 3 | ADRA1B |
| ABANOQUIL | ChEMBL | Phase 2 | ADRA1B |
Related Atlas pages
- Genes: ADRA1B, TRHR
- Diseases: epilepsy, hypertensive disorder, injury, cirrhosis of liver, relapsing-remitting multiple sclerosis, bone fracture, anxiety, toxic shock syndrome, dementia, delirium, respiratory failure, infertility disorder, depressive disorder, brain injury, lung disorder
- Drugs: Dihydroergotamine, Protirelin, Alfuzosin, Amlodipine, Apraclonidine, Aripiprazole, Asenapine, Atenolol, Azelastine, Brexpiprazole, Brimonidine, Buspirone, Cariprazine, Cinacalcet, Cisapride, Clonidine, Clozapine, Dexmedetomidine, Dopamine, Doxazosin, Ebastine, Epinephrine, Fenoldopam, Fentanyl, Haloperidol, Indacaterol, Indoramin, Isoproterenol, Labetalol, Loperamide, Lumateperone Tosylate, Moxisylyte, Naftopidil, Nefazodone, Norepinephrine, Olanzapine, Oxymetazoline, Phentolamine, Phenylephrine, Prazosin, Quetiapine, Risperidone, Sertindole, Silodosin, Tamsulosin, Tegaserod, Terazosin, Terfenadine, Tolazoline, Verapamil, Vilazodone, Xylometazoline, Ziprasidone, Bunazosin, Idazoxan, Latrepirdine, Volinanserin, Yohimbine