Mifepristone
drugOn this page
Also known as KorlymMifegyneMifeprexMifepristonaNSC-759862RU 38486RU 486RU-38486RU-486RU486SID11533034SID26752198SID26752199SID50104862SID90341299SID56424093SID50104863SID50124354Mifepristone (RU486)
Summary
Mifepristone (CHEMBL1276308) is an approved small-molecule contraceptive drug (ATC G03XB01) targeting NR1I2, NR3C1, and PGR; indicated across 38 conditions including cushing syndrome and uterine corpus leiomyoma.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G03XB01 (+1 more)
- Targets: 4 (NR1I2, NR3C1, PGR…)
- Indications: 38 conditions
- Clinical trials: 150
- Chemistry: 429.6 Da · C29H35NO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1276308 |
| Name | Mifepristone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 55245 |
| ChEBI | CHEBI:50692 |
| ATC | G03XB01, G03XB51 |
| Molecular formula | C29H35NO2 |
| Molecular weight | 429.6 |
| InChIKey | VKHAHZOOUSRJNA-GCNJZUOMSA-N |
SMILES: CC#C[C@@]1(CC[C@@H]2[C@@]1(C[C@@H](C3=C4CCC(=O)C=C4CC[C@@H]23)C5=CC=C(C=C5)N(C)C)C)O
IUPAC name: (8S,11R,13S,14S,17S)-11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one
Pharmacological roles (ChEBI): abortifacient, contraceptive drug, synthetic oral contraceptive, hormone antagonist.
Also known as: Korlym, Mifegyne, Mifeprex, Mifepristona, Mifepristone, NSC-759862, RU 38486, RU 486, RU-38486, RU-486, RU486, mifepristone
Patent coverage: 8,252 distinct patent families (30,535 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR1I2 | Pregnane X receptor | Agonist | 5 | 0.3% | O75469 |
| NR3C1 | Glucocorticoid receptor | Antagonist | 9.4 | 0.9% | P04150 |
| PGR | Progesterone receptor | Mixed | 8.96 | 0.1% | P06401 |
| AR | Androgen receptor | Antagonist | 9.19 | P10275 |
Broader ChEMBL bioactivity targets: 45 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Nuclear receptor ROR-gamma, Survival motor neuron protein, Prelamin-A/C, RecQ-like DNA helicase BLM, Inositol monophosphatase 1, Ferritin light chain, Geminin, Endonuclease 4, Peripheral myelin protein 22.
Bioactivity
ChEMBL activities: 214 potent at pChembl ≥ 5 of 251 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| PGR | 10.68 | IC50 | 0.02 | nM | CHEMBL_ACT_2391144 |
| PGR | 10.6 | IC50 | 0.03 | nM | CHEMBL_ACT_184565 |
| PGR | 10.55 | IC50 | 0.03 | nM | CHEMBL_ACT_184563 |
| PGR | 10.35 | IC50 | 0.04 | nM | CHEMBL_ACT_2391063 |
| PGR | 10.3 | IC50 | 0.05 | nM | CHEMBL_ACT_3125135 |
| PGR | 10.27 | IC50 | 0.05 | nM | CHEMBL_ACT_2046181 |
| PGR | 10.14 | IC50 | 0.07 | nM | CHEMBL_ACT_18407048 |
| NR3C1 | 10.05 | Ki | 0.09 | nM | CHEMBL_ACT_18235952 |
| PGR | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_1170993 |
| NR3C1 | 10 | Ki | 0.1 | nM | CHEMBL_ACT_1463070 |
| PGR | 9.89 | IC50 | 0.13 | nM | CHEMBL_ACT_1002415 |
| PGR | 9.74 | IC50 | 0.18 | nM | CHEMBL_ACT_493315 |
| PGR | 9.74 | IC50 | 0.18 | nM | CHEMBL_ACT_540698 |
| PGR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_2119997 |
| PGR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_2369837 |
| PGR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_2463066 |
| PGR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_3383449 |
| PGR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_402714 |
| PGR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_824254 |
| NR3C1 | 9.62 | Ki | 0.24 | nM | CHEMBL_ACT_275737 |
| NR3C1 | 9.62 | Ki | 0.24 | nM | CHEMBL_ACT_3252319 |
| PGR | 9.6 | Ki | 0.25 | nM | CHEMBL_ACT_1481479 |
| PGR | 9.6 | IC50 | 0.25 | nM | CHEMBL_ACT_1742825 |
| NR3C1 | 9.53 | IC50 | 0.3 | nM | CHEMBL_ACT_15684859 |
| PGR | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_1002414 |
| PGR | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_1002418 |
| NR3C1 | 9.52 | Ki | 0.3 | nM | CHEMBL_ACT_15684193 |
| PGR | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_18407140 |
| PGR | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_338277 |
| PGR | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_641296 |
Target pathways
Aggregated over 4 target gene(s): NR1I2, NR3C1, PGR, AR.
Top Reactome pathways
32 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 4 | AR, NR1I2, NR3C1, PGR |
| SUMOylation of intracellular receptors | 4 | AR, NR1I2, NR3C1, PGR |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 3 | AR, NR3C1, PGR |
| Nuclear signaling by ERBB4 | 1 | PGR |
| Signal Transduction | 1 | AR |
| Signaling by Rho GTPases | 1 | AR |
| RHO GTPase Effectors | 1 | AR |
| Generic Transcription Pathway | 1 | AR |
| Cellular responses to stress | 1 | AR |
| SUMOylation | 1 | AR |
| SUMO E3 ligases SUMOylate target proteins | 1 | AR |
| Metabolism of proteins | 1 | AR |
| RHO GTPases activate PKNs | 1 | AR |
| Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3 | 1 | AR |
| Deubiquitination | 1 | AR |
| Ub-specific processing proteases | 1 | AR |
| Post-translational protein modification | 1 | AR |
| RNA Polymerase II Transcription | 1 | AR |
| Gene expression (Transcription) | 1 | AR |
| PTK6 Expression | 1 | NR3C1 |
| Transcriptional regulation by RUNX2 | 1 | AR |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| RUNX2 regulates osteoblast differentiation | 1 | AR |
| RUNX2 regulates bone development | 1 | AR |
| Cellular responses to stimuli | 1 | AR |
| Estrogen-dependent gene expression | 1 | PGR |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Signaling by Rho GTPases, Miro GTPases and RHOBTB3 | 1 | AR |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of DNA-templated transcription | 4 |
| signal transduction | 4 |
| positive regulation of transcription by RNA polymerase II | 4 |
| negative regulation of transcription by RNA polymerase II | 3 |
| gene expression | 3 |
| positive regulation of gene expression | 3 |
| positive regulation of DNA-templated transcription | 3 |
| regulation of transcription by RNA polymerase II | 3 |
| nuclear receptor-mediated steroid hormone signaling pathway | 3 |
| intracellular receptor signaling pathway | 2 |
| negative regulation of DNA-templated transcription | 2 |
| cellular response to steroid hormone stimulus | 2 |
| positive regulation of miRNA transcription | 2 |
| response to ketone | 2 |
| cell-cell signaling | 2 |
Indications & clinical
Indications
38 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| Cushing syndrome | 4 | MONDO:0018912 | EFO:0003099 |
| uterine corpus leiomyoma | 3 | MONDO:0007886 | EFO:0000731 |
| ACTH-dependent Cushing syndrome | 3 | MONDO:0020528 | EFO:1001110 |
| leiomyoma | 3 | MONDO:0001572 | MONDO:0001572 |
| major depressive disorder | 3 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| meningioma | 3 | MONDO:0016642 | MONDO:0016642 |
| mental disorder | 3 | MONDO:0005084 | EFO:0000677 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| hepatitis C virus infection | 2 | MONDO:0005231 | EFO:0003047 |
| post-traumatic stress disorder | 2 | MONDO:0005146 | EFO:0001358 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| endometriosis | 2 | MONDO:0005133 | EFO:0001065 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| borderline personality disorder | 2 | MONDO:0001156 | HP:0012076 |
| adenomyosis | 2 | MONDO:0010888 | EFO:1001757 |
| central serous chorioretinopathy | 2 | MONDO:0018616 | EFO:0009784 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0002046 |
| peritoneal neoplasm | 2 | MONDO:0006901 | MONDO:0002087 |
| fallopian tube neoplasm | 2 | MONDO:0021092 | MONDO:0002158 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| endometrium neoplasm | 2 | MONDO:0021251 | MONDO:0011962 |
| Alzheimer disease | 2 | MONDO:0004975 | MONDO:0004975 |
| bipolar disorder | 2 | MONDO:0004985 | MONDO:0004985 |
| anxiety | 1 | MONDO:0011918 | EFO:0005230 |
| male breast carcinoma | 1 | MONDO:0005628 | EFO:0006861 |
| diabetes mellitus | 1 | MONDO:0005015 | EFO:0000400 |
| persian gulf syndrome | 1 | MONDO:0005907 | EFO:0007430 |
| ductal breast carcinoma in situ | 0 | MONDO:0005023 | EFO:0000432 |
| nicotine dependence | 0 | MONDO:0008575 | EFO:0003768 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 150.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 34 |
| Not specified | 31 |
| PHASE2 | 27 |
| PHASE3 | 26 |
| PHASE1 | 13 |
| PHASE1/PHASE2 | 8 |
| PHASE2/PHASE3 | 7 |
| EARLY_PHASE1 | 4 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05341817 | PHASE4 | RECRUITING | The Use of Letrozole or Mifepristone for Pretreatment of Medical Termination of Pregnancy |
| NCT00177372 | PHASE4 | COMPLETED | Mifepristone and Misoprostol for Fetal Demise |
| NCT00269568 | PHASE4 | COMPLETED | Mifepristone at Same Time Multicenter Study |
| NCT00410345 | PHASE4 | COMPLETED | Cervical Rippening With Antiprogesterone in Midtrimester Abortions |
| NCT00691067 | PHASE4 | COMPLETED | A Controlled Trial of Mifepristone in Gulf War Veterans With Chronic Multisymptom Illness |
| NCT00784797 | PHASE4 | COMPLETED | Misopristol Versus Pitocin for Second Trimester Abortion |
| NCT00997347 | PHASE4 | COMPLETED | The Extended Gestational Age Medical Abortion Study |
| NCT01490697 | PHASE4 | COMPLETED | Developing Memory Reconsolidation Blockers as Novel Posttraumatic Stress Disorder (PTSD) Treatments |
| NCT01631682 | PHASE4 | COMPLETED | Pilot Study of Pharmaceutical and Behavioral Interventions to Treat Anxiety Disorders |
| NCT01768299 | PHASE4 | COMPLETED | Medical Abortion With Mifepristone + Misoprostol (13 - 22 Weeks) |
| NCT01798017 | PHASE4 | COMPLETED | Introducing Mifepristone-Misoprostol for Menstrual Regulation in Public Sector Facilities in Bangladesh |
| NCT01856985 | PHASE4 | COMPLETED | Acceptability of an Out-patient Regimen of Medical Abortion With Mifepristone and 800 Mcg Misoprostol Administered at 78-84 Days Gestation |
| NCT01920022 | PHASE4 | COMPLETED | Quickstart of Nexplanon® at Medical Abortion |
| NCT01990560 | PHASE4 | COMPLETED | Glucocorticoid Receptor Blockade With Mifepristone in Patients With Mild Adrenal Hypercortisolism |
| NCT02342002 | PHASE4 | TERMINATED | Mifepristone and Misoprostol Versus Misoprostol Alone for Missed Abortion: A Randomized-controlled Trial |
| NCT02412618 | PHASE4 | COMPLETED | Same-Day Mifepristone-Misoprostol Compared to Misoprostol Only for Surgical Abortion Cervical Preparation |
| NCT02620904 | PHASE4 | TERMINATED | Mifepristone Induction for Fetal Demise |
| NCT02704481 | PHASE4 | TERMINATED | Non-surgical Alternatives to Treatment of Failed Medical Abortion |
| NCT02708446 | PHASE4 | UNKNOWN | A Comparison of Sublingual and Buccal Misoprostol Regimens After Mifepristone for Mid-trimester Abortion |
| NCT02720991 | PHASE4 | COMPLETED | A Pilot of an Outpatient Regimen of Medical Abortion With Mifepristone and Sublingual Misoprostol in the 11 and 12 Weeks |
| NCT02745093 | PHASE4 | UNKNOWN | Medical Abortion at Gestational Age of 8 to ≤9 Weeks Versus >9 to ≤12 Weeks |
| NCT02981030 | PHASE4 | COMPLETED | Acceptability and Feasibility of a Simplified Medical Abortion Service Delivery in Western Ukraine |
| NCT03044093 | PHASE4 | UNKNOWN | Mifepristone and Misoprostol Compared With Misoprostol Alone for Second Trimester Abortion |
| NCT03210324 | PHASE4 | TERMINATED | A Study on the Mifepristone Tablets in the Treatment of Symptomatic Uterine Fibroids With Safety and Efficacy |
| NCT03212352 | PHASE4 | TERMINATED | Comparing Two Medical Treatments for Early Pregnancy Failure. |
| NCT03320057 | PHASE4 | COMPLETED | Medication Abortion Via Pharmacy Dispensing |
| NCT03346629 | PHASE4 | COMPLETED | Outpatient Service for Mid-trimester Termination of Pregnancy |
| NCT03913104 | PHASE4 | COMPLETED | Mail Order Mifepristone Study |
| NCT04063904 | PHASE4 | TERMINATED | Pilot Study of an Ambulatory Medical Abortion Service at 13-18 Weeks of Gestation in Colombia |
| NCT04458558 | PHASE4 | UNKNOWN | Improving Access to Abortion in the Republic of Georgia |
| NCT05046041 | PHASE4 | COMPLETED | Assessing Outpatient ‘Day Procedure’ for Second-trimester Medical Abortion at Two Public Sector Hospitals in Nepal |
| NCT05119439 | PHASE4 | TERMINATED | Mifepristone and Two Doses of Misoprostol for Abortion at 11&12 Weeks |
| NCT05124314 | PHASE4 | UNKNOWN | Comparison of Two Different Drug Regimens for Medical Treatment of Early Pregnancy Loss |
| NCT05322252 | PHASE4 | COMPLETED | Simultaneous Mifepristone and Misoprostol Versus Misoprostol Alone for Induction of Labor of Nonviable Second Trimester Pregnancy: a Pilot Randomized Controlled Trial |
| NCT06394999 | PHASE3 | RECRUITING | Efficacy, Safety, and Acceptability of Mifepristone 50 mg Once-weekly as a Contraceptive |
| NCT06492889 | PHASE2/PHASE3 | NOT_YET_RECRUITING | Assessing the Efficacy and Acceptability of Two Missed Period Pills Regimens |
| NCT07506512 | PHASE3 | NOT_YET_RECRUITING | Optimal Time Interval Between Mifepristone and Misoprostol Administration for Early Pregnancy Loss |
| NCT00128479 | PHASE3 | COMPLETED | A United States Study of the Safety and Tolerability of Corlux for Psychotic Symptoms in Psychotic Major Depression |
| NCT00128505 | PHASE3 | COMPLETED | An International Extension Study of Corlux for Recurrent Psychotic Symptoms in Psychotic Major Depression |
| NCT00130676 | PHASE3 | COMPLETED | A United States Study of Corlux for Psychotic Symptoms in Psychotic Major Depression |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
519 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| ENZALUTAMIDE | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| METHYLPREDNISOLONE | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| TESTOSTERONE PROPIONATE | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | AR, NR1I2, NR3C1, PGR |
| Pyrazinamide | PubChem | Approved | AR, NR1I2, NR3C1, PGR |
| BOSENTAN | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| MEGESTROL | ChEMBL + PubChem | Phase 4 (approved) | AR, NR3C1, PGR |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | AR, NR3C1, PGR |
| TADALAFIL | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| BITHIONOL | ChEMBL | Phase 4 (approved) | AR, NR1I2, PGR |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| EPLERENONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| ESTRIOL | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| FELODIPINE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| FLUOCINOLONE ACETONIDE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| FLUOCINONIDE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| FLUOROMETHOLONE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| FLUOXYMESTERONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| FLURANDRENOLIDE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| HALCINONIDE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| HYDROXYPROGESTERONE CAPROATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| ISOCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| LOTEPREDNOL ETABONATE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| MITOTANE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| MOMETASONE FUROATE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| NISOLDIPINE | ChEMBL | Phase 4 (approved) | NR1I2, NR3C1, PGR |
| NOMEGESTROL | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
| NORETHINDRONE | ChEMBL | Phase 4 (approved) | AR, NR3C1, PGR |
Related Atlas pages
- Genes: NR1I2, NR3C1, PGR, AR
- Diseases: Cushing syndrome, uterine corpus leiomyoma, ACTH-dependent Cushing syndrome, leiomyoma, major depressive disorder, depressive disorder, breast neoplasm, meningioma, mental disorder
- Drugs: Regorafenib, Desogestrel, Desoximetasone, Diethylstilbestrol, Enzalutamide, Ethinyl Estradiol, Fluticasone Propionate, Methylprednisolone, Progesterone, Testosterone Propionate, Troglitazone, Pyrazinamide, Bosentan, Desoxycorticosterone Pivalate, Fidaxomicin, Fulvestrant, Megestrol, Podofilox, Tadalafil, Beclomethasone Dipropionate, Benzbromarone, Betamethasone, Betamethasone Dipropionate, Bithionol, Budesonide, Butoconazole, Candesartan Cilexetil, Chlormadinone, Ciclesonide, Clobetasol Propionate, Danazol, Daunorubicin, Dexamethasone, Diflorasone Diacetate, Drospirenone, Econazole, Efavirenz, Eplerenone, Estradiol, Estriol, Felodipine, Fluocinolone Acetonide, Fluocinonide, Fluorometholone, Fluoxymesterone, Flurandrenolide, Fluticasone Furoate, Halcinonide, Hydrocortisone, Hydroxyprogesterone Caproate, Isoconazole, Loteprednol Etabonate, Masoprocol, Medroxyprogesterone, Mitotane, Mometasone Furoate, Nisoldipine, Norethindrone