Mirtazapine
drugOn this page
Also known as AvanzaMiratazMirtazapinMirtazapinaMirtazapine anhydrousNorsetORG 3770ORG-3770PromyrtilRemeronRemeron soltabRexerZispinSID11114267SID49666401SID29215050SID49648465SID144204516Azamianserin
Summary
Mirtazapine (CHEMBL654) is an approved small-molecule α-adrenergic antagonist (ATC N06AX11) targeting ADRA2A, ADRA2B, and ADRA2C; indicated across 23 conditions including major depressive disorder and depressive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AX11
- Targets: 5 (ADRA2A, ADRA2B, ADRA2C…)
- Indications: 23 conditions
- Clinical trials: 82
- Chemistry: 265.35 Da · C17H19N3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL654 |
| Name | Mirtazapine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4205 |
| ChEBI | CHEBI:6950 |
| ATC | N06AX11 |
| Molecular formula | C17H19N3 |
| Molecular weight | 265.35 |
| InChIKey | RONZAEMNMFQXRA-UHFFFAOYSA-N |
SMILES: CN1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4
IUPAC name: 5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene
Pharmacological roles (ChEBI): α-adrenergic antagonist, serotonergic antagonist, histamine antagonist, anxiolytic drug, H1-receptor antagonist, oneirogen.
Also known as: Avanza, Mirataz, Mirtazapin, Mirtazapina, Mirtazapine, Mirtazapine anhydrous, Norset, ORG 3770, ORG-3770, Promyrtil, Remeron, Remeron soltab
Parent form; salt/anhydrous children: CHEMBL5315116
Patent coverage: 5,893 distinct patent families (20,324 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 20,239 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA2A | α2A-adrenoceptor | Antagonist | 7.1 | 0.1% | P08913 |
| ADRA2B | α2B-adrenoceptor | Antagonist | 6.7 | 0.2% | P18089 |
| ADRA2C | α2C-adrenoceptor | Antagonist | 6.7 | 0% | P18825 |
| HTR2A | 5-HT2A receptor | Antagonist | 7.16 | 0% | P28223 |
| HTR2C | 5-HT2C receptor | Antagonist | 7.41 | 0% | P28335 |
Broader ChEMBL bioactivity targets: 26 (assay-derived). Sample: 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, 5-hydroxytryptamine receptor 3A, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, Thyrotropin receptor, Beta-lactamase, D(1A) dopamine receptor, Muscarinic acetylcholine receptor M2.
Bioactivity
ChEMBL activities: 37 potent at pChembl ≥ 5 of 43 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HRH1 | 8.8 | Ki | 1.6 | nM | CHEMBL_ACT_1518470 |
| P14842 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_1066122 |
| P08909 | 8.26 | Ki | 5.5 | nM | CHEMBL_ACT_1066123 |
| HRH1 | 8.19 | AC50 | 6.5 | nM | CHEMBL_ACT_25212907 |
| HTR2A | 8.09 | Ki | 8.2 | nM | CHEMBL_ACT_19101891 |
| P14842 | 7.83 | Ki | 14.8 | nM | CHEMBL_ACT_459720 |
| ADRA2C | 7.75 | Ki | 18 | nM | CHEMBL_ACT_1518457 |
| HTR1A | 7.75 | Ki | 18 | nM | CHEMBL_ACT_19101892 |
| ADRA2A | 7.7 | Ki | 20 | nM | CHEMBL_ACT_1518456 |
| HTR2C | 7.41 | Ki | 39 | nM | CHEMBL_ACT_1518468 |
| CYP2C19 | 7.3 | Potency | 50.1 | nM | CHEMBL_ACT_4006301 |
| CYP2C9 | 7.3 | Potency | 50.1 | nM | CHEMBL_ACT_5033462 |
| CYP2C9 | 7.3 | AC50 | 50.12 | nM | CHEMBL_ACT_6002426 |
| CYP2C19 | 7.3 | AC50 | 50.12 | nM | CHEMBL_ACT_6044291 |
| HTR2A | 7.16 | Ki | 69 | nM | CHEMBL_ACT_1518466 |
| ADRA2A | 7.07 | IC50 | 85.11 | nM | CHEMBL_ACT_983880 |
| ADRA2C | 6.7 | IC50 | 199.5 | nM | CHEMBL_ACT_983882 |
| ADRA2B | 6.65 | IC50 | 223.9 | nM | CHEMBL_ACT_983881 |
| HTR7 | 6.58 | Ki | 265 | nM | CHEMBL_ACT_1518467 |
| HTR2A | 6.46 | AC50 | 350 | nM | CHEMBL_ACT_25225527 |
| ADRA2A | 6.41 | AC50 | 388.3 | nM | CHEMBL_ACT_25157092 |
| CYP2D6 | 6.3 | Potency | 501.2 | nM | CHEMBL_ACT_5006422 |
| CYP2D6 | 6.3 | AC50 | 501.2 | nM | CHEMBL_ACT_6067216 |
| ADRA2C | 6.25 | AC50 | 555.6 | nM | CHEMBL_ACT_25148275 |
| P15823 | 6.22 | Ki | 608 | nM | CHEMBL_ACT_1518471 |
| P15823 | 5.98 | Ki | 1050 | nM | CHEMBL_ACT_1066125 |
| ADRA2B | 5.85 | AC50 | 1400 | nM | CHEMBL_ACT_25144085 |
| P61169 | 5.84 | Ki | 1460 | nM | CHEMBL_ACT_1066117 |
| ADRA2A | 5.8 | AC50 | 1600 | nM | CHEMBL_ACT_25220265 |
| HTR3A | 5.54 | Ki | 2900 | nM | CHEMBL_ACT_13489298 |
Target pathways
Aggregated over 5 target gene(s): ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C.
Top Reactome pathways
21 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 5 | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| Signaling by GPCR | 5 | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| Class A/1 (Rhodopsin-like receptors) | 5 | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| Amine ligand-binding receptors | 5 | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| GPCR downstream signalling | 5 | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| GPCR ligand binding | 5 | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| Hemostasis | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenoceptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenaline signalling through Alpha-2 adrenergic receptor | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (i) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (z) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet activation, signaling and aggregation | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet Aggregation (Plug Formation) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Metabolism | 2 | ADRA2A, ADRA2C |
| Integration of energy metabolism | 2 | ADRA2A, ADRA2C |
| Serotonin receptors | 2 | HTR2A, HTR2C |
| Metabolism of proteins | 2 | ADRA2A, ADRA2C |
| Adrenaline,noradrenaline inhibits insulin secretion | 2 | ADRA2A, ADRA2C |
| G alpha (q) signalling events | 2 | HTR2A, HTR2C |
| Regulation of insulin secretion | 2 | ADRA2A, ADRA2C |
| Surfactant metabolism | 2 | ADRA2A, ADRA2C |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 5 |
| signal transduction | 5 |
| epidermal growth factor receptor signaling pathway | 3 |
| negative regulation of norepinephrine secretion | 3 |
| regulation of vasoconstriction | 3 |
| platelet activation | 3 |
| negative regulation of epinephrine secretion | 3 |
| positive regulation of MAPK cascade | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| adrenergic receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting adrenergic receptor signaling pathway | 3 |
| regulation of smooth muscle contraction | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| female pregnancy | 2 |
| positive regulation of cell population proliferation | 2 |
Indications & clinical
Indications
23 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| major depressive disorder | 4 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 4 | MONDO:0002050 | MONDO:0002050 |
| insomnia | 4 | MONDO:0013600 | EFO:0004698 |
| autism spectrum disorder | 3 | MONDO:0005258 | EFO:0003756 |
| heroin dependence | 3 | MONDO:0005367 | EFO:0004240 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| fibromyalgia | 2 | MONDO:0005546 | EFO:0005687 |
| drug dependence | 2 | MONDO:0005303 | EFO:0003890 |
| substance-related disorder | 2 | MONDO:0002494 | MONDO:0002491 |
| methamphetamine dependence | 2 | MONDO:0005419 | EFO:0004701 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0007079 |
| anorexia nervosa | 2 | MONDO:0005351 | MONDO:0005351 |
| paraganglioma | 2 | MONDO:0000448 | EFO:1000453 |
| obstructive sleep apnea syndrome | 1 | MONDO:0007147 | EFO:0003918 |
| stomach disorder | 1 | MONDO:0004298 | EFO:0009608 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 82.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 24 |
| PHASE2 | 24 |
| Not specified | 14 |
| PHASE3 | 9 |
| PHASE1 | 5 |
| EARLY_PHASE1 | 4 |
| PHASE2/PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00021528 | PHASE4 | COMPLETED | Sequenced Treatment Alternatives to Relieve Depression (STAR*D) |
| NCT00150839 | PHASE4 | COMPLETED | Hippocampal Volume in Young Patients With Major Depression Before and After Combined Antidepressive Therapy |
| NCT00177567 | PHASE4 | COMPLETED | Treatment of Geriatric Bipolar Mood Disorders: A Pilot Study |
| NCT00288782 | PHASE4 | COMPLETED | PET Neuroimaging of [11C]Mirtazapine |
| NCT00302107 | PHASE4 | COMPLETED | A Placebo-Controlled Study of Mirtazapine for PTSD |
| NCT00590863 | PHASE4 | COMPLETED | Combining Medications to Enhance Depression Outcomes |
| NCT00926835 | PHASE4 | TERMINATED | Effect of Antidepressants on the Treatment for Korean Major Depressive Disorder Patients |
| NCT01109693 | PHASE4 | COMPLETED | Strategic Use of New Generation Antidepressants for Depression |
| NCT01178671 | PHASE4 | COMPLETED | Combined Mirtazapine and SSRI Treatment of PTSD: A Placebo-Controlled Trial |
| NCT01240096 | PHASE4 | COMPLETED | Mirtazapine Versus Placebo in Functional Dyspepsia |
| NCT01263080 | PHASE4 | COMPLETED | Evaluation of Mirtazapine and Folic Acid for Schizophrenia: |
| NCT01458626 | PHASE4 | COMPLETED | Effectiveness Study of Mirtazapine Combined With Paroxetine in Major Depressive Patients Without Early Improvement |
| NCT01465919 | PHASE4 | TERMINATED | Efficacy Study of Mirtazapine to Treat Interferon-related Depression During Antiviral Therapy for Hepatitis C |
| NCT01601002 | PHASE4 | COMPLETED | LEPR Polymorphism Weight Gain by Mirtazapine in Late Life Depression |
| NCT01764867 | PHASE4 | UNKNOWN | Algorithm Guided Treatment Strategies for Major Depressive Disorder |
| NCT02191124 | PHASE4 | COMPLETED | The Measurement-based Care in Patients With Depressive Disorder: A Randomized Controlled Trial |
| NCT03219008 | PHASE4 | UNKNOWN | Multi-Dimensional Diagnosis,Individualized Therapy,and Management Technique for Major Depressive Disorder:Based on Clinical and Pathological Characteristics |
| NCT03675555 | PHASE4 | COMPLETED | Prophylactic Mirtazapine or Dexamethasone for Post-spinal Anesthesia Shivering |
| NCT03679052 | PHASE4 | COMPLETED | Prophylactic Mirtazapine or Clonidine for Post-spinal Anesthesia Shivering |
| NCT04013386 | PHASE4 | COMPLETED | Effects of Aprepitant/Dexamethasone Versus Mertazepine /Dexamethasone on Postoperative Nausea and Vomiting |
| NCT04155008 | PHASE4 | TERMINATED | Nutrition and Pharmacological Algorithm for Oncology Patients Study |
| NCT04908605 | PHASE4 | COMPLETED | Emergence Agitation After Nasal Surgery: a Randomized Controlled Comparison Between Melatonin and Mirtazapine |
| NCT05108688 | PHASE4 | COMPLETED | Mirtazapine vs Sumatriptan in the Treatment of Postdural Puncture Headache |
| NCT05978219 | PHASE4 | COMPLETED | Efficacy of Mirtazapine in Major Depressive Disorder With Insomnia |
| NCT00080158 | PHASE2/PHASE3 | COMPLETED | Treatment of Adolescent Suicide Attempters (TASA) |
| NCT00782405 | PHASE3 | COMPLETED | Effect of Quetiapine XR on Sleep in Patients With Major Depression, as Compared With Mirtazapine |
| NCT01302964 | PHASE3 | COMPLETED | Mirtazapine Treatment of Anxiety in Children and Adolescents With Pervasive Developmental Disorders |
| NCT01867775 | PHASE3 | UNKNOWN | Mirtazapine for Sleep Disorders in Alzheimer’s Disease |
| NCT02336750 | PHASE3 | COMPLETED | Adding Mirtazapine to Dexamethasone and Aprepitant for Delayed Emesis |
| NCT02374567 | PHASE3 | TERMINATED | Pharmacovigilance in Gerontopsychiatric Patients |
| NCT02541526 | PHASE3 | UNKNOWN | Mirtazapine as a Treatment for Co-Occurring Opioid and ATS Dependence in Malaysia |
| NCT03031184 | PHASE3 | COMPLETED | Study of Mirtazapine for Agitation in Dementia |
| NCT03852160 | PHASE3 | WITHDRAWN | A Study of Esketamine Nasal Spray Plus a New Standard-of-care Oral Antidepressant or Placebo Nasal Spray Plus a New Standard-of-care Oral Antidepressant in Adult and Elderly Participants With Treatment-resistant Depression |
| NCT04763135 | PHASE3 | TERMINATED | Mirtazapine in Cancer-related Poly-symptomatology |
| NCT00488072 | PHASE2 | ACTIVE_NOT_RECRUITING | Effects of Mirtazapine on Appetite in Advanced Cancer Patients |
| NCT03935685 | PHASE2 | ACTIVE_NOT_RECRUITING | Pilot Study of Mirtazapine for the Dual Tx of Depression and CINV in High-Grade Glioma Pts on TMZ |
| NCT05170919 | PHASE2 | ENROLLING_BY_INVITATION | Comparing Olanzapine and Mirtazapine in the Improvement of Unintentional Weight Loss for Patients with Advanced Stage Cancer |
| NCT06309472 | PHASE2 | RECRUITING | Trial of Mirtazapine for Depression in IBD |
| NCT06323837 | PHASE2 | RECRUITING | Mirtazapine for the Treatment of Methamphetamine Use in Opioid Use Disorder Patients Receiving Medication Assisted Treatment |
| NCT06530290 | PHASE2 | RECRUITING | Evaluating the Effect of Mirtazapine on Anxiety in Parkinson’s Disease Patients |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (2) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for mirtazapine and CYP2D6 | DPWG | CYP2D6 | ||
| Annotation of DPWG Guideline for mirtazapine and CYP2C19 | DPWG | CYP2C19 |
PharmGKB also curates 10 clinical and 33 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
755 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DOXEPIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| DROPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| EBASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| GUANABENZ | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| GUANFACINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| HALOPROGIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| IPRINDOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| KETOTIFEN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| LORCASERIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| LOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| LURASIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| MAPROTILINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| METHYLERGONOVINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| MIANSERIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| NEBIVOLOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C |
Related Atlas pages
- Genes: ADRA2A, ADRA2B, ADRA2C, HTR2A, HTR2C
- Diseases: major depressive disorder, depressive disorder, insomnia, autism spectrum disorder, heroin dependence, anxiety, dementia
- Drugs: Afatinib, Chenodiol, Clozapine, Desloratadine, Dihydroergotamine, Fidaxomicin, Olanzapine, Paliperidone, Propoxyphene, Tegaserod, Amitriptyline, Amoxapine, Apomorphine, Aripiprazole, Asenapine, Astemizole, Azelastine, Benfluorex, Benperidol, Benzquinamide, Benztropine, Brexpiprazole, Bromocriptine, Cariprazine, Carvedilol, Chlorhexidine, Chlorpromazine, Cisapride, Clemastine, Clomipramine, Clonidine, Clotrimazole, Cyproheptadine, Diethylstilbestrol, Domperidone, Dothiepin, Doxazosin, Doxepin, Droperidol, Ebastine, Econazole, Ergotamine, Fluphenazine, Guanabenz, Guanfacine, Haloperidol, Haloprogin, Iloperidone, Iprindole, Ketotifen, Lasofoxifene, Lorcaserin, Loxapine, Lurasidone, Maprotiline, Methylergonovine, Methysergide, Mianserin, Nebivolol, Nefazodone