Mobocertinib
drugOn this page
Also known as AP-32788AP32788Tak-788US10227342Example 10Moboceritinib
Summary
Mobocertinib (CHEMBL4650319) is an approved small molecule (ATC L01EB10) targeting EGFR; indicated across 5 conditions including neoplasm and non-small cell lung carcinoma; with CIViC clinical evidence for 4 variant-indication associations (e.g. EGFR Exon 20 Insertion in lung non-small cell carcinoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EB10
- Targets: 1 (EGFR)
- Indications: 5 conditions
- Clinical trials: 12
- Precision-oncology evidence (CIViC): 4 variant–indication associations
- Chemistry: 585.7 Da · C32H39N7O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4650319 |
| Name | Mobocertinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 118607832 |
| ATC | L01EB10 |
| Molecular formula | C32H39N7O4 |
| Molecular weight | 585.7 |
| InChIKey | AZSRSNUQCUDCGG-UHFFFAOYSA-N |
SMILES: CC(C)OC(=O)C1=CN=C(N=C1C2=CN(C3=CC=CC=C32)C)NC4=C(C=C(C(=C4)NC(=O)C=C)N(C)CCN(C)C)OC
IUPAC name: propan-2-yl 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-(prop-2-enoylamino)anilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate
Also known as: AP-32788, AP32788, Mobocertinib, Tak-788, TAK-788, MOBOCERTINIB, US10227342, Example 10, Moboceritinib
Parent form; salt/anhydrous children: CHEMBL4802239
Patent coverage: 412 distinct patent families (929 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 926 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| EGFR | epidermal growth factor receptor | Inhibition | 7 | 17.5% | P00533 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: Epidermal growth factor receptor, Epidermal growth factor receptor.
Bioactivity
ChEMBL activities: 18 potent at pChembl ≥ 5 of 18 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| EGFR | 11 | IC50 | 0.01 | nM | CHEMBL_ACT_25098086 |
| EGFR | 10.7 | IC50 | 0.02 | nM | CHEMBL_ACT_29113771 |
| EGFR | 10.6 | IC50 | 0.03 | nM | CHEMBL_ACT_25098080 |
| EGFR | 9 | IC50 | 1 | nM | CHEMBL_ACT_25866006 |
| EGFR | 8.48 | IC50 | 3.3 | nM | CHEMBL_ACT_25018489 |
| EGFR | 8.1 | IC50 | 7.94 | nM | CHEMBL_ACT_29225394 |
| EGFR | 7.7 | IC50 | 19.95 | nM | CHEMBL_ACT_29225445 |
| EGFR | 7.66 | IC50 | 22 | nM | CHEMBL_ACT_25866312 |
| EGFR | 7.6 | IC50 | 25 | nM | CHEMBL_ACT_25098101 |
| EGFR | 7.6 | IC50 | 25.12 | nM | CHEMBL_ACT_29225377 |
| EGFR | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_25866304 |
| EGFR | 7.51 | IC50 | 31 | nM | CHEMBL_ACT_25018392 |
| EGFR | 7.5 | IC50 | 31.62 | nM | CHEMBL_ACT_29224923 |
| EGFR | 7.47 | IC50 | 34 | nM | CHEMBL_ACT_25866190 |
| EGFR | 7.46 | IC50 | 34.5 | nM | CHEMBL_ACT_25018495 |
| EGFR | 7.43 | IC50 | 37 | nM | CHEMBL_ACT_25866129 |
| EGFR | 6.44 | IC50 | 364 | nM | CHEMBL_ACT_25098109 |
| EGFR | 6.44 | IC50 | 364 | nM | CHEMBL_ACT_29113811 |
Target pathways
Aggregated over 1 target gene(s): EGFR.
Top Reactome pathways
37 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signaling by ERBB2 | 1 | EGFR |
| Constitutive Signaling by Ligand-Responsive EGFR Cancer Variants | 1 | EGFR |
| Signaling by ERBB4 | 1 | EGFR |
| SHC1 events in ERBB2 signaling | 1 | EGFR |
| PLCG1 events in ERBB2 signaling | 1 | EGFR |
| PIP3 activates AKT signaling | 1 | EGFR |
| Signaling by EGFR | 1 | EGFR |
| GRB2 events in EGFR signaling | 1 | EGFR |
| GAB1 signalosome | 1 | EGFR |
| SHC1 events in EGFR signaling | 1 | EGFR |
| EGFR downregulation | 1 | EGFR |
| GRB2 events in ERBB2 signaling | 1 | EGFR |
| PI3K events in ERBB2 signaling | 1 | EGFR |
| EGFR interacts with phospholipase C-gamma | 1 | EGFR |
| EGFR Transactivation by Gastrin | 1 | EGFR |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | EGFR |
| Signal transduction by L1 | 1 | EGFR |
| Constitutive Signaling by EGFRvIII | 1 | EGFR |
| Inhibition of Signaling by Overexpressed EGFR | 1 | EGFR |
| RAF/MAP kinase cascade | 1 | EGFR |
| ERBB2 Regulates Cell Motility | 1 | EGFR |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | EGFR |
| ERBB2 Activates PTK6 Signaling | 1 | EGFR |
| Cargo recognition for clathrin-mediated endocytosis | 1 | EGFR |
| Clathrin-mediated endocytosis | 1 | EGFR |
| PTK6 promotes HIF1A stabilization | 1 | EGFR |
| Downregulation of ERBB2 signaling | 1 | EGFR |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | EGFR |
| Extra-nuclear estrogen signaling | 1 | EGFR |
| NOTCH3 Activation and Transmission of Signal to the Nucleus | 1 | EGFR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| cell morphogenesis | 1 |
| ossification | 1 |
| embryonic placenta development | 1 |
| positive regulation of protein phosphorylation | 1 |
| hair follicle development | 1 |
| ubiquitin-dependent protein catabolic process | 1 |
| signal transduction | 1 |
| cell surface receptor signaling pathway | 1 |
| epidermal growth factor receptor signaling pathway | 1 |
| salivary gland morphogenesis | 1 |
| learning or memory | 1 |
| positive regulation of cell population proliferation | 1 |
| gene expression | 1 |
| protein ubiquitination | 1 |
| cerebral cortex cell migration | 1 |
Indications & clinical
Indications
5 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
| lung neoplasm | 1 | MONDO:0021117 | MONDO:0021117 |
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 8 |
| PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
| PHASE2 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04129502 | PHASE3 | ACTIVE_NOT_RECRUITING | TAK-788 as First-Line Treatment Versus Platinum-Based Chemotherapy for Non-Small Cell Lung Cancer (NSCLC) With EGFR Exon 20 Insertion Mutations |
| NCT02716116 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | A Study of TAK-788 in Adults With Non-Small Cell Lung Cancer |
| NCT04576208 | PHASE2 | WITHDRAWN | A Study to Evaluate the Impact of Management Strategies on Gastrointestinal-Related Adverse Events in Participants With Non-Small Cell Lung Cancer Harboring Epidermal Growth Factor Receptor (EGFR) Exon 20 Insertion Mutations Receiving TAK-788 |
| NCT03807778 | PHASE1 | ACTIVE_NOT_RECRUITING | A Study of Mobocertinib in Japanese Adults With Non-Small Cell Lung Cancer |
| NCT03482453 | PHASE1 | COMPLETED | A Study to Evaluate the Pharmacokinetics (PK), Safety and Tolerability of TAK-788 Followed by Evaluation of the Effects of a Low-Fat Meal on TAK-788 PK and Evaluation of Relative Bioavailability of TAK-788 Capsules in Healthy Participants |
| NCT03811834 | PHASE1 | COMPLETED | A Study to Assess Absolute Bioavailability (ABA) of Mobocertinib (TAK-788) and to Characterize Mass Balance, Pharmacokinetics (PK), Metabolism, and Excretion of Carbon-14 ([14C])-Mobocertinib in Male Healthy Participants |
| NCT03928327 | PHASE1 | COMPLETED | A Study to Evaluate Drug-Drug Interaction of TAK-788 With Itraconazole and Rifampin in Healthy Adult Participants |
| NCT04051827 | PHASE1 | COMPLETED | Drug-Drug Interaction Study of TAK-788 and Midazolam in Participants With Advanced Non-small Cell Lung Cancer (NSCLC) |
| NCT04056455 | PHASE1 | COMPLETED | A Study of Mobocertinib Capsules in People With Severe Kidney Problems and People With Healthy Kidneys |
| NCT04056468 | PHASE1 | COMPLETED | A Study to Evaluate Pharmacokinetics (PK) and Safety of Oral Mobocertinib in Participants With Moderate or Severe Hepatic Impairment (HI) and Normal Hepatic Function |
| NCT04441255 | PHASE1 | COMPLETED | A Study to Evaluate the Effect of High-Fat Meal on TAK-788 Pharmacokinetics (PK) in Healthy Adult Participants |
| NCT04535557 | Not specified | APPROVED_FOR_MARKETING | An Expanded Access Protocol for Mobocertinib in Refractory Non-small Cell Lung Cancer (NSCLC) Participants With Epidermal Growth Factor Receptor (EGFR) Exon20 Insertion Mutations |
Clinical evidence (CIViC)
Variant × indication × effect (4 predictive associations from 4 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| EGFR Exon 20 Insertion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Mobocertinib | CIViC A | EID11228 |
| EGFR Exon 20 Insertion | Lung Non-small Cell Carcinoma | Sensitivity/Response | TAK-788 | CIViC B | EID7273 |
| EGFR::ERBB4 Fusion | Lung Adenocarcinoma | Sensitivity/Response | Osimertinib + Mobocertinib + Trastuzumab Deruxtecan + Tarloxotinib | CIViC C | EID12373 |
| EGFR D770_P772dup | Cancer | Sensitivity/Response | Mobocertinib | CIViC D | EID12303 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
157 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR |
| SELUMETINIB | ChEMBL + PubChem | Phase 4 (approved) | EGFR |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | EGFR |
| ACALABRUTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| AFATINIB DIMALEATE | ChEMBL | Phase 4 (approved) | EGFR |
| ALECTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | EGFR |
| AXITINIB | ChEMBL | Phase 4 (approved) | EGFR |
| BACITRACIN | ChEMBL | Phase 4 (approved) | EGFR |
| BITHIONOL | ChEMBL | Phase 4 (approved) | EGFR |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| CERITINIB | ChEMBL | Phase 4 (approved) | EGFR |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | EGFR |
| CHROMIC CHLORIDE | ChEMBL | Phase 4 (approved) | EGFR |
| CISPLATIN | ChEMBL | Phase 4 (approved) | EGFR |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | EGFR |
| COLISTIN | ChEMBL | Phase 4 (approved) | EGFR |
| CRIZOTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| DACOMITINIB | ChEMBL | Phase 4 (approved) | EGFR |
| DASATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | EGFR |
| DOCETAXEL | ChEMBL | Phase 4 (approved) | EGFR |
| EBASTINE | ChEMBL | Phase 4 (approved) | EGFR |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | EGFR |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | EGFR |
| GEFITINIB | ChEMBL | Phase 4 (approved) | EGFR |
| GENTIAN VIOLET | ChEMBL | Phase 4 (approved) | EGFR |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | EGFR |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | EGFR |
| IBRUTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| IMATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| LAPATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| LAPATINIB DITOSYLATE | ChEMBL | Phase 4 (approved) | EGFR |
| LAZERTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| LEVODOPA | ChEMBL | Phase 4 (approved) | EGFR |
| LORLATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| METHYLDOPA | ChEMBL | Phase 4 (approved) | EGFR |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | EGFR |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | EGFR |
| MITOXANTRONE | ChEMBL | Phase 4 (approved) | EGFR |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | EGFR |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | EGFR |
| NERATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| NICLOSAMIDE | ChEMBL | Phase 4 (approved) | EGFR |
| OLMUTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| OSIMERTINIB | ChEMBL | Phase 4 (approved) | EGFR |
| PERHEXILINE | ChEMBL | Phase 4 (approved) | EGFR |
| PONATINIB | ChEMBL | Phase 4 (approved) | EGFR |
| SORAFENIB | ChEMBL | Phase 4 (approved) | EGFR |
| SULOCTIDIL | ChEMBL | Phase 4 (approved) | EGFR |
| SUNITINIB | ChEMBL | Phase 4 (approved) | EGFR |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | EGFR |
| TERFENADINE | ChEMBL | Phase 4 (approved) | EGFR |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | EGFR |
| TRIBROMSALAN | ChEMBL | Phase 4 (approved) | EGFR |
| TUCATINIB | ChEMBL | Phase 4 (approved) | EGFR |
Related Atlas pages
- Genes: EGFR
- Diseases: neoplasm, non-small cell lung carcinoma, lung adenocarcinoma, cancer
- Drugs: Afatinib, Selumetinib, Abemaciclib, Acalabrutinib, Alectinib, Astemizole, Axitinib, Bacitracin, Bithionol, Bosutinib, Brigatinib, Cabozantinib, Ceritinib, Chlorpromazine, Chromic Chloride, Cisplatin, Clotrimazole, Colistin, Crizotinib, Dacomitinib, Dasatinib, Dobutamine, Docetaxel, Ebastine, Econazole, Erlotinib, Fedratinib, Fluphenazine, Gefitinib, Gilteritinib, Hexachlorophene, Ibrutinib, Imatinib, Lapatinib, Lazertinib, Levodopa, Lorlatinib, Methyldopa, Miconazole, Midostaurin, Mitoxantrone, Montelukast, Nelfinavir, Neratinib, Niclosamide, Olmutinib, Osimertinib, Perhexiline, Ponatinib, Sorafenib, Suloctidil, Sunitinib, Tamoxifen, Terfenadine, Thioridazine, Tribromsalan, Tucatinib