Modafinil
drugOn this page
Also known as CEP 1538CEP-1538CRC-40476CRL 40476CRL-40476DEP-1538Modafinil civMODAFINIL COMPONENT OF THN-102MODAFINIL COMPONENT OF THN102ModafiniloModaphonilModiodalNSC-751178NSC-759110ProvigilSID26719679SID26749058SID26753746SID144205023
Summary
Modafinil (CHEMBL1373) is an approved small molecule (ATC N06BA07) targeting SLC6A3; indicated across 36 conditions including attention deficit-hyperactivity disorder and obstructive sleep apnea syndrome.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06BA07
- Targets: 1 (SLC6A3)
- Indications: 36 conditions
- Clinical trials: 143
- Chemistry: 273.4 Da · C15H15NO2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1373 |
| Name | Modafinil |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4236 |
| ChEBI | CHEBI:77585 |
| ATC | N06BA07 |
| Molecular formula | C15H15NO2S |
| Molecular weight | 273.4 |
| InChIKey | YFGHCGITMMYXAQ-UHFFFAOYSA-N |
SMILES: C1=CC=C(C=C1)C(C2=CC=CC=C2)S(=O)CC(=O)N
IUPAC name: 2-benzhydrylsulfinylacetamide
ChEBI definition: A sulfoxide that is dimethylsulfoxide in which two hydrogens attached to one of the methyl groups are replaced by phenyl groups, while one hydrogen attached to the other methyl group is replaced by a carbamoyl (aminocarbonyl) group.
Also known as: CEP 1538, CEP-1538, CRC-40476, CRL 40476, CRL-40476, DEP-1538, Modafinil, Modafinil civ, MODAFINIL COMPONENT OF THN-102, MODAFINIL COMPONENT OF THN102, Modafinilo, Modaphonil
Patent coverage: 3,722 distinct patent families (14,293 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC6A3 | DAT | Inhibition | 5.42 | 0.2% | Q01959 |
Broader ChEMBL bioactivity targets: 11 (assay-derived). Sample: Prelamin-A/C, Endothelin receptor type B, D(3) dopamine receptor, Sodium-dependent dopamine transporter, Adenosine receptor A3, Melanocortin receptor 4, Sodium-dependent serotonin transporter, Sodium-dependent dopamine transporter, Cytochrome P450 2C19, Mitogen-activated protein kinase 1.
Bioactivity
ChEMBL activities: 20 potent at pChembl ≥ 5 of 33 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| LMNA | 8.74 | Potency | 1.8 | nM | CHEMBL_ACT_3642546 |
| SLC6A3 | 6.03 | Ki | 927 | nM | CHEMBL_ACT_16772105 |
| SLC6A3 | 5.84 | Ki | 1456 | nM | CHEMBL_ACT_7754236 |
| SLC6A3 | 5.74 | IC50 | 1832 | nM | CHEMBL_ACT_7754235 |
| SLC6A3 | 5.7 | Ki | 2000 | nM | CHEMBL_ACT_16771864 |
| P23977 | 5.6 | Ki | 2520 | nM | CHEMBL_ACT_27439070 |
| P23977 | 5.6 | Ki | 2520 | nM | CHEMBL_ACT_28241264 |
| P23977 | 5.6 | Ki | 2520 | nM | CHEMBL_ACT_28904291 |
| P23977 | 5.6 | Ki | 2520 | nM | CHEMBL_ACT_5208035 |
| P23977 | 5.58 | Ki | 2600 | nM | CHEMBL_ACT_13943515 |
| SLC6A3 | 5.51 | Ki | 3090 | nM | CHEMBL_ACT_13941682 |
| P23977 | 5.43 | IC50 | 3700 | nM | CHEMBL_ACT_10891454 |
| P23977 | 5.43 | IC50 | 3700 | nM | CHEMBL_ACT_10926091 |
| P23977 | 5.43 | IC50 | 3700 | nM | CHEMBL_ACT_8060565 |
| P23977 | 5.42 | Ki | 3800 | nM | CHEMBL_ACT_1489157 |
| P23977 | 5.37 | IC50 | 4300 | nM | CHEMBL_ACT_10926961 |
| P23977 | 5.37 | IC50 | 4300 | nM | CHEMBL_ACT_8060563 |
| P23977 | 5.09 | Ki | 8160 | nM | CHEMBL_ACT_20645100 |
| P23977 | 5.09 | Ki | 8160 | nM | CHEMBL_ACT_22798420 |
| SLC6A3 | 5.03 | AC50 | 9350 | nM | CHEMBL_ACT_25124440 |
Target pathways
Aggregated over 1 target gene(s): SLC6A3.
Top Reactome pathways
13 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neurotransmitter clearance | 1 | SLC6A3 |
| Transmission across Chemical Synapses | 1 | SLC6A3 |
| Neuronal System | 1 | SLC6A3 |
| Disease | 1 | SLC6A3 |
| Dopamine clearance from the synaptic cleft | 1 | SLC6A3 |
| Transport of small molecules | 1 | SLC6A3 |
| R-HSA-425366 | 1 | SLC6A3 |
| SLC-mediated transmembrane transport | 1 | SLC6A3 |
| SLC-mediated transport of neurotransmitters | 1 | SLC6A3 |
| Defective neurotransmitter clearance by SLC6A3 causes Parkinsonism-dystonia infantile (PKDYS) | 1 | SLC6A3 |
| SLC transporter disorders | 1 | SLC6A3 |
| Disorders of transmembrane transporters | 1 | SLC6A3 |
| Defective transport of neurotransmitters by SLC6A3 causes Parkinsonism-dystonia infantile (PKDYS) | 1 | SLC6A3 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| neurotransmitter transport | 1 |
| amino acid transport | 1 |
| lactation | 1 |
| sensory perception of smell | 1 |
| locomotory behavior | 1 |
| response to xenobiotic stimulus | 1 |
| response to iron ion | 1 |
| obsolete monoamine transport | 1 |
| obsolete dopamine transport | 1 |
| adenohypophysis development | 1 |
| response to nicotine | 1 |
| sodium ion transmembrane transport | 1 |
| positive regulation of multicellular organism growth | 1 |
| regulation of dopamine metabolic process | 1 |
| response to cocaine | 1 |
Indications & clinical
Indications
36 indications (4 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| attention deficit-hyperactivity disorder | 4 | MONDO:0007743 | EFO:0003888 |
| obstructive sleep apnea syndrome | 4 | MONDO:0007147 | EFO:0003918 |
| narcolepsy | 4 | MONDO:0021107 | MONDO:0021107 |
| cocaine dependence | 3 | MONDO:0005186 | EFO:0002610 |
| brain neoplasm | 3 | MONDO:0021211 | EFO:0003833 |
| Ewing sarcoma | 3 | MONDO:0012817 | EFO:0000174 |
| stroke disorder | 3 | MONDO:0005098 | EFO:0000712 |
| postpoliomyelitis syndrome | 3 | MONDO:0017416 | EFO:0007454 |
| sleep disorder | 3 | MONDO:0100081 | EFO:0008568 |
| major depressive disorder | 3 | MONDO:0002009 | MONDO:0002009 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| multiple sclerosis | 3 | MONDO:0005301 | MONDO:0005301 |
| methamphetamine dependence | 2 | MONDO:0005419 | EFO:0004701 |
| post-traumatic stress disorder | 2 | MONDO:0005146 | EFO:0001358 |
| drug dependence | 2 | MONDO:0005303 | EFO:0003890 |
| opiate dependence | 2 | MONDO:0005530 | EFO:0005611 |
| depressive disorder | 2 | MONDO:0002050 | MONDO:0002050 |
| Parkinson disease | 2 | MONDO:0005180 | MONDO:0005180 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0007079 |
| ovarian carcinoma | 2 | MONDO:0005140 | EFO:0001075 |
| orthostatic hypotension | 1 | MONDO:0005469 | EFO:0005252 |
| sleep apnea syndrome | 1 | MONDO:0005296 | EFO:0003877 |
| melanoma | 1 | MONDO:0005105 | EFO:0000756 |
| nicotine dependence | 1 | MONDO:0008575 | EFO:0003768 |
| insomnia | 1 | MONDO:0013600 | EFO:0004698 |
| schizoaffective disorder | 1 | MONDO:0005487 | EFO:0005411 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
9 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 143.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 40 |
| PHASE3 | 27 |
| PHASE1 | 22 |
| Not specified | 22 |
| PHASE4 | 20 |
| PHASE1/PHASE2 | 5 |
| EARLY_PHASE1 | 4 |
| PHASE2/PHASE3 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06041048 | PHASE4 | RECRUITING | Investigation of Locus Coeruleus Function in Sustained Attention |
| NCT00102284 | PHASE4 | TERMINATED | Neuromodulation and Language Acquisition (Project Stage Ia) |
| NCT00118378 | PHASE4 | COMPLETED | Effectiveness of Modafinil for Treating Fatigue in Adults With HIV/AIDS |
| NCT00124384 | PHASE4 | COMPLETED | The Effects of Modafinil on Waking Function and on Sleep in Individuals With Primary Insomnia |
| NCT00208715 | PHASE4 | COMPLETED | Provigil in Conjunction With SSRIs for the Treatment of Mild or Moderate Depression With Attendant Symptoms of Sleepiness and Fatigue. |
| NCT00423943 | PHASE4 | COMPLETED | Modafinil for Treatment of Cognitive Dysfunction in Schizophrenia |
| NCT00573417 | PHASE4 | COMPLETED | A Placebo-Controlled Trial of Modafinil (Provigil) Added to Clozapine in Patients With Schizophrenia |
| NCT00614926 | PHASE4 | COMPLETED | Modafinil for Treatment of Fatigue in ALS Patients |
| NCT00626210 | PHASE4 | TERMINATED | Modafinil Treatment for Sleep/Wake Disturbances in Older Adults |
| NCT00711464 | PHASE4 | COMPLETED | Modafinil Effects on Cognition in Schizophrenia Patients |
| NCT00751023 | PHASE4 | COMPLETED | Effects of Modafinil in Methamphetamine Dependence |
| NCT00829322 | PHASE4 | COMPLETED | Modafinil for the Treatment of Fatigue in Lung Cancer V9.0 |
| NCT01365897 | PHASE4 | COMPLETED | Effectiveness of Modafinil in Improving Cognitive Performance of University Students |
| NCT01913327 | PHASE4 | TERMINATED | Antipsychotic Effects on Brain Function in Schizophrenia |
| NCT01965925 | PHASE4 | COMPLETED | Targeting Circadian and Cognitive Dysfunction in Bipolar Disorder With Modafinil |
| NCT02155257 | PHASE4 | COMPLETED | Pain Expectations in Subjects With Osteoarthritis |
| NCT02385656 | PHASE4 | UNKNOWN | The Efficacy and Tolerability of Modafinil for Fatigue and Daytime Sleepiness in Cancer Patients: Preliminary Study |
| NCT02494102 | PHASE4 | TERMINATED | Evaluation of Modafinil vs Placebo for Treatment of Anesthesia Delayed Emergence in Obstructive Sleep Apnea |
| NCT03616717 | PHASE4 | COMPLETED | Modafinil Effects on EEG Biomarkers of Reward and Motivation |
| NCT03621761 | PHASE4 | COMPLETED | Cognitive Behavioral Therapy, Modafinil, or Both for Multiple Sclerosis Fatigue |
| NCT06354985 | PHASE3 | NOT_YET_RECRUITING | Modafinil and Exercise for Post Stroke Fatigue |
| NCT07231497 | PHASE3 | RECRUITING | Cognitive Strategies in Early Psychosis 1 |
| NCT07263022 | PHASE3 | NOT_YET_RECRUITING | Cognitive Strategies in Early Psychosis 2 |
| NCT07582458 | PHASE2/PHASE3 | NOT_YET_RECRUITING | Modafinil for Debilitating Fatigue in Quiescent Inflammatory Bowel Disease MODIFI-IBD Trial) |
| NCT00042848 | PHASE3 | COMPLETED | Modafinil in Treating Fatigue in Patients Receiving Chemotherapy for Cancer |
| NCT00066170 | PHASE3 | COMPLETED | Trial Comparing Effects of Xyrem Taken Orally and Modafinil With Placebo in Treating Daytime Sleepiness in Narcolepsy |
| NCT00067496 | PHASE3 | TERMINATED | Modafinil to Treat Fatigue in Post-Polio Syndrome |
| NCT00107796 | PHASE3 | COMPLETED | Study of PROVIGIL ® (Modafinil) Treatment in Children and Adolescents With Excessive Sleepiness Associated With Narcolepsy |
| NCT00107809 | PHASE3 | COMPLETED | Study of PROVIGIL ® (Modafinil) Treatment in Children and Adolescents With Excessive Sleepiness Associated With Obstructive Sleep Apnea/Hypopnea Syndrome |
| NCT00107848 | PHASE3 | COMPLETED | PROVIGIL® (Modafinil) Treatment in Children and Adolescents With Excessive Sleepiness Associated With Narcolepsy or Obstructive Sleep Apnea/Hypopnea Syndrome |
| NCT00214968 | PHASE3 | COMPLETED | Assess the Safety and Effectiveness of PROVIGIL Treatment in Children and Adolescents With Excessive Sleepiness |
| NCT00214981 | PHASE3 | COMPLETED | Evaluate the Safety and Efficacy of Modafinil in Children and Adolescents With ADHD |
| NCT00215176 | PHASE2/PHASE3 | COMPLETED | Modafinil for Atypical Depression |
| NCT00228540 | PHASE3 | COMPLETED | Study to Assess Satisfaction With Modafinil Treatment in Children and Adolescents With ADHD |
| NCT00236080 | PHASE3 | COMPLETED | Study of the Efficacy and Multiple-Dose Plasma Concentration-Time Profiles of Armodafinil and PROVIGIL |
| NCT00267332 | PHASE3 | TERMINATED | Modafinil in Opioid Induced Sedation |
| NCT00343811 | PHASE3 | COMPLETED | Study to Evaluate the Efficacy of Modafinil Treatment in Patients With Attention Deficit Hyperactivity Disorder (ADHD) Who Are Responders to Modafinil Treatment |
| NCT00418691 | PHASE3 | TERMINATED | Effects of Methylphenidate Versus Sustained Release Methylphenidate on Cognitive Functioning |
| NCT00701532 | PHASE3 | COMPLETED | Brain Imaging Study of the Effects of Modafinil in Cocaine Addiction |
| NCT00917748 | PHASE3 | COMPLETED | Study With Modafinil in Patients Treated With Docetaxel-Based Chemotherapy for Metastatic Breast or Prostate Cancer (MOTIF) |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 4 clinical and 7 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
482 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| DACOMITINIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| IDELALISIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| TAFENOQUINE | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| UMECLIDINIUM | ChEMBL + PubChem | Phase 4 (approved) | SLC6A3 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMINEPTINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMINOCAPROIC ACID | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMODIAQUINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AMPHOTERICIN B | ChEMBL | Phase 4 (approved) | SLC6A3 |
| ANTAZOLINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| ARMODAFINIL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AXITINIB | ChEMBL | Phase 4 (approved) | SLC6A3 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BEDAQUILINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENDROFLUMETHIAZIDE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENOXINATE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENZIODARONE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BENZYL BENZOATE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BISACODYL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BUPROPION | ChEMBL | Phase 4 (approved) | SLC6A3 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CANAGLIFLOZIN | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CARBINOXAMINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | SLC6A3 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | SLC6A3 |
Related Atlas pages
- Genes: SLC6A3
- Diseases: attention deficit-hyperactivity disorder, obstructive sleep apnea syndrome, narcolepsy, cocaine dependence, brain neoplasm, Ewing sarcoma, stroke disorder, postpoliomyelitis syndrome, sleep disorder, major depressive disorder, Alzheimer disease, multiple sclerosis
- Drugs: Afatinib, Crizotinib, Dacomitinib, Idelalisib, Olodaterol, Pimavanserin, Regorafenib, Tafenoquine, Umeclidinium, Acetophenazine, Amineptine, Aminocaproic Acid, Amiodarone, Amitriptyline, Amlodipine, Amodiaquine, Amoxapine, Amphotericin B, Antazoline, Arformoterol, Aripiprazole, Armodafinil, Asenapine, Astemizole, Atomoxetine, Axitinib, Azelastine, Bazedoxifene, Bedaquiline, Bendroflumethiazide, Benfluorex, Benoxinate, Benperidol, Benzbromarone, Benziodarone, Benzphetamine, Benztropine, Benzydamine, Benzyl Benzoate, Bepridil, Bexarotene, Bisacodyl, Bithionol, Bosutinib, Brexpiprazole, Bromhexine, Bromodiphenhydramine, Bromperidol, Brompheniramine, Bupropion, Butoconazole, Cabergoline, Calcitriol, Canagliflozin, Candesartan Cilexetil, Cannabidiol, Carbinoxamine, Cariprazine, Carvedilol