Molindone
drugOn this page
Also known as MolindonaSpn-810SID90341242SID26755691SID50111112
Summary
Molindone (CHEMBL460) is an approved small molecule (ATC N05AE02) targeting HRH1 and HTR2A; indicated across 2 conditions including psychotic disorder and attention deficit-hyperactivity disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05AE02
- Targets: 2 (HRH1, HTR2A)
- Indications: 2 conditions
- Clinical trials: 9
- Chemistry: 276.37 Da · C16H24N2O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL460 |
| Name | Molindone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 23897 |
| ATC | N05AE02 |
| Molecular formula | C16H24N2O2 |
| Molecular weight | 276.37 |
| InChIKey | KLPWJLBORRMFGK-UHFFFAOYSA-N |
SMILES: CCC1=C(NC2=C1C(=O)C(CC2)CN3CCOCC3)C
IUPAC name: 3-ethyl-2-methyl-5-(morpholin-4-ylmethyl)-1,5,6,7-tetrahydroindol-4-one
Also known as: Molindona, Molindone, Spn-810, SID90341242, SID26755691, SID50111112, molindone, MOLINDONE
Parent form; salt/anhydrous children: CHEMBL1200419
Patent coverage: 2,022 distinct patent families (7,611 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HRH1 | H1 receptor | Antagonist | 5.7 | 0% | P35367 |
| HTR2A | 5-HT2A receptor | Antagonist | 6.5 | 0% | P28223 |
Broader ChEMBL bioactivity targets: 14 (assay-derived). Sample: 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, D(1A) dopamine receptor, D(2) dopamine receptor, 5-hydroxytryptamine receptor 2A, Alpha-1A adrenergic receptor, D(3) dopamine receptor, Delta-type opioid receptor.
Bioactivity
ChEMBL activities: 16 potent at pChembl ≥ 5 of 21 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P61169 | 7.48 | Ki | 33.11 | nM | CHEMBL_ACT_1300746 |
| P61169 | 7.48 | Ki | 33.11 | nM | CHEMBL_ACT_50508 |
| ADRA2B | 7.03 | AC50 | 93.1 | nM | CHEMBL_ACT_25143552 |
| HTR2B | 6.92 | AC50 | 120 | nM | CHEMBL_ACT_25164063 |
| DRD2 | 6.68 | AC50 | 209.4 | nM | CHEMBL_ACT_25140178 |
| HTR7 | 6.58 | Ki | 265 | nM | CHEMBL_ACT_73720 |
| DRD3 | 6.52 | AC50 | 300.5 | nM | CHEMBL_ACT_25193377 |
| HTR2B | 6.13 | AC50 | 735.7 | nM | CHEMBL_ACT_25227384 |
| DRD1 | 6.11 | AC50 | 770 | nM | CHEMBL_ACT_25180372 |
| P14842 | 5.85 | Ki | 1413 | nM | CHEMBL_ACT_1300747 |
| P14842 | 5.85 | Ki | 1413 | nM | CHEMBL_ACT_50509 |
| P18901 | 5.8 | Ki | 1585 | nM | CHEMBL_ACT_50507 |
| ADRA2A | 5.7 | AC50 | 2020 | nM | CHEMBL_ACT_25219751 |
| ADRA2C | 5.68 | AC50 | 2066 | nM | CHEMBL_ACT_25147722 |
| ADRA2A | 5.02 | AC50 | 9600 | nM | CHEMBL_ACT_25155892 |
| HTR2A | 5.02 | AC50 | 9578 | nM | CHEMBL_ACT_25173559 |
Target pathways
Aggregated over 2 target gene(s): HRH1, HTR2A.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| G alpha (q) signalling events | 2 | HRH1, HTR2A |
| Signal Transduction | 1 | HTR2A |
| Signaling by GPCR | 1 | HTR2A |
| Class A/1 (Rhodopsin-like receptors) | 1 | HTR2A |
| Amine ligand-binding receptors | 1 | HTR2A |
| GPCR downstream signalling | 1 | HTR2A |
| Histamine receptors | 1 | HRH1 |
| Serotonin receptors | 1 | HTR2A |
| GPCR ligand binding | 1 | HTR2A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 2 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| chemical synaptic transmission | 2 |
| memory | 2 |
| positive regulation of vasoconstriction | 2 |
| signal transduction | 2 |
| phospholipase C-activating serotonin receptor signaling pathway | 2 |
| inflammatory response | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| visual learning | 1 |
| regulation of vascular permeability | 1 |
| regulation of synaptic plasticity | 1 |
| cellular response to histamine | 1 |
| temperature homeostasis | 1 |
| positive regulation of cytokine production involved in immune response | 1 |
Indications & clinical
Indications
2 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 4 | MONDO:0005485 | EFO:0005407 |
| attention deficit-hyperactivity disorder | 3 | MONDO:0007743 | EFO:0003888 |
Clinical trials
Total trials: 9.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 4 |
| PHASE2 | 4 |
| PHASE4 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00053703 | PHASE4 | COMPLETED | Treatment of Early Onset Schizophrenia Spectrum Disorders (TEOSS) |
| NCT02618408 | PHASE3 | COMPLETED | Treatment of Impulsive Aggression in Subjects With ADHD in Conjunction With Standard ADHD Treatment (CHIME 1) |
| NCT02618434 | PHASE3 | COMPLETED | Treatment of Impulsive Aggression in Subjects With ADHD in Conjunction With Standard ADHD Treatment (CHIME 2) |
| NCT02691182 | PHASE3 | TERMINATED | Treatment of Impulsive Aggression in Subjects With ADHD in Conjunction With Standard ADHD Treatment (CHIME 4) |
| NCT03597503 | PHASE3 | TERMINATED | Treatment of Impulsive Aggression (IA) in Adolescent With ADHD in Conjunction With Standard ADHD Treatment |
| NCT00626236 | PHASE2 | COMPLETED | Phase 2a Study of Safety and Tolerability of SPN-810 in Children With ADHD and Persistent Serious Conduct Problems |
| NCT01364662 | PHASE2 | COMPLETED | A Study to Evaluate the Efficacy and Safety of SPN-810 as Adjunctive Therapy in Children With Impulsive Aggression Comorbid With Attention-Deficit/Hyperactivity Disorder (ADHD) |
| NCT01416064 | PHASE2 | COMPLETED | Open-Label, Extension Study to 810P202 |
| NCT03638466 | PHASE2 | TERMINATED | Exploratory fMRI Study on the Treatment for Impulsive Aggression in Children With ADHD |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
481 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Almotriptan | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| Crizotinib | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| Erythromycin | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| Olodaterol | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| Tamsulosin | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR2A |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| AMIODARONE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| ASENAPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| AZATADINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| BUTRIPTYLINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CETIRIZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CHLORPHENTERMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CINACALCET | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CYCLIZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DEXBROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DEXCHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DICYCLOMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DIETHYLPROPION | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DIMENHYDRINATE | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
| DIPHEMANIL | ChEMBL | Phase 4 (approved) | HRH1, HTR2A |
Related Atlas pages
- Genes: HRH1, HTR2A
- Diseases: psychotic disorder, attention deficit-hyperactivity disorder
- Drugs: Almotriptan, Crizotinib, Desloratadine, Dihydroergotamine, Erythromycin, Fidaxomicin, Olodaterol, Paliperidone, Pramipexole, Propoxyphene, Tamsulosin, Abemaciclib, Acetophenazine, Amiodarone, Amisulpride, Amitriptyline, Amoxapine, Apomorphine, Aripiprazole, Asenapine, Astemizole, Atomoxetine, Azatadine, Azelastine, Benfluorex, Benperidol, Benzbromarone, Benztropine, Bepridil, Brexpiprazole, Bromperidol, Buspirone, Butriptyline, Cabergoline, Candesartan Cilexetil, Captopril, Cariprazine, Cetirizine, Chlorpheniramine, Chlorphentermine, Chlorpromazine, Cinacalcet, Cinnarizine, Cisapride, Citalopram, Clemastine, Clomipramine, Clotrimazole, Clozapine, Cyclizine, Cyclobenzaprine, Cyproheptadine, Desipramine, Dexbrompheniramine, Dibenzepin, Dicyclomine, Diethylpropion, Dimenhydrinate, Diphemanil