Morphine
drugOn this page
Also known as Anhydrous morphineHydromorphone hydrochloride impuritymorphine-IDS-NM-009MorphiaMorphine (anhydrous)Morphine anhydrousMorphine extended releaseMorphine polistirexMorphiumN02AA01NepentheOspalivina(-)-etorphine(-)-morphine(+)-MorphineDIMORPHINE PAMOATEMorphine-1
Summary
Morphine (CHEMBL70) is an approved small-molecule opioid analgesic (ATC N02AA51) targeting OPRD1, OPRK1, and OPRM1; indicated across 42 conditions including chronic obstructive pulmonary disease and injury.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N02AA51 (+2 more)
- Targets: 3 (OPRD1, OPRK1, OPRM1)
- Indications: 42 conditions
- Clinical trials: 635
- Chemistry: 285.34 Da · C17H19NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL70 |
| Name | Morphine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5288826 |
| ChEBI | CHEBI:17303 |
| ATC | N02AA51, A07DA52, N02AA01 |
| Molecular formula | C17H19NO3 |
| Molecular weight | 285.34 |
| InChIKey | BQJCRHHNABKAKU-KBQPJGBKSA-N |
SMILES: CN1CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)O)O[C@H]3[C@H](C=C4)O
IUPAC name: (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol
ChEBI definition: A morphinane alkaloid that is a highly potent opiate analgesic psychoactive drug. Morphine acts directly on the central nervous system (CNS) to relieve pain but has a high potential for addiction, with tolerance and both physical and psychological dependence developing rapidly. Morphine is the most abundant opiate found in Papaver somniferum (the opium poppy).
Pharmacological roles (ChEBI): opioid analgesic, μ-opioid receptor agonist, vasodilator agent, anaesthetic, drug allergen, geroprotector.
Other ChEBI roles (chemical / environmental): plant metabolite, environmental contaminant, xenobiotic.
Also known as: Anhydrous morphine, Hydromorphone hydrochloride impurity, morphine-, IDS-NM-009, Morphia, Morphine, Morphine (anhydrous), Morphine anhydrous, Morphine extended release, Morphine polistirex, Morphium, N02AA01
Parent form; salt/anhydrous children: CHEMBL556578, CHEMBL2096625, CHEMBL2103744, CHEMBL4068407
Patent coverage: 39,119 distinct patent families (128,573 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 126,077 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| OPRD1 | δ receptor | Full agonist | 6.9 | 0.2% | P41143 |
| OPRK1 | κ receptor | Partial agonist | 7.3 | 0% | P41145 |
| OPRM1 | μ receptor | Full agonist | 9 | 0% | P35372 |
Broader ChEMBL bioactivity targets: 21 (assay-derived). Sample: Alpha-2A adrenergic receptor, Opioid receptor, Opioid receptors; mu & delta, Opioid receptors; mu/kappa/delta, Opioid receptor, Mu-type opioid receptor, Delta-type opioid receptor, Kappa-type opioid receptor, Delta-type opioid receptor, Mu-type opioid receptor.
Bioactivity
ChEMBL activities: 361 potent at pChembl ≥ 5 of 364 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| OPRM1 | 9.85 | Ki | 0.14 | nM | CHEMBL_ACT_12065925 |
| P33535 | 9.85 | IC50 | 0.14 | nM | CHEMBL_ACT_459603 |
| OPRM1 | 9.49 | Ki | 0.32 | nM | CHEMBL_ACT_17705276 |
| OPRM1 | 9.49 | Ki | 0.32 | nM | CHEMBL_ACT_27578891 |
| P79350 | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_1018190 |
| OPRM1 | 9.28 | Ki | 0.53 | nM | CHEMBL_ACT_16505967 |
| OPRM1 | 9.24 | IC50 | 0.57 | nM | CHEMBL_ACT_628306 |
| P33535 | 9.11 | Ki | 0.78 | nM | CHEMBL_ACT_256082 |
| OPRM1 | 9.06 | Ki | 0.88 | nM | CHEMBL_ACT_10949069 |
| P97266 | 9.06 | Ki | 0.88 | nM | CHEMBL_ACT_162054 |
| OPRM1 | 9.06 | Ki | 0.88 | nM | CHEMBL_ACT_1668614 |
| P97266 | 9.06 | Ki | 0.88 | nM | CHEMBL_ACT_2263757 |
| OPRM1 | 9.06 | Ki | 0.88 | nM | CHEMBL_ACT_373313 |
| P97266 | 9.06 | Ki | 0.88 | nM | CHEMBL_ACT_441131 |
| P79350 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_943222 |
| P33535 | 9 | Ki | 1 | nM | CHEMBL_ACT_557716 |
| OPRM1 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_1759528 |
| OPRM1 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_1928209 |
| P97266 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_6255729 |
| P42866 | 8.9 | IC50 | 1.27 | nM | CHEMBL_ACT_2216742 |
| P42866 | 8.9 | IC50 | 1.27 | nM | CHEMBL_ACT_2584180 |
| P33535 | 8.84 | Ki | 1.45 | nM | CHEMBL_ACT_15112863 |
| P33535 | 8.8 | IC50 | 1.6 | nM | CHEMBL_ACT_952794 |
| OPRM1 | 8.77 | Ki | 1.7 | nM | CHEMBL_ACT_2153552 |
| P42866 | 8.74 | Ki | 1.8 | nM | CHEMBL_ACT_1455296 |
| OPRM1 | 8.74 | Ki | 1.8 | nM | CHEMBL_ACT_317119 |
| P33535 | 8.74 | Ki | 1.8 | nM | CHEMBL_ACT_384030 |
| P41144 | 8.74 | IC50 | 1.82 | nM | CHEMBL_ACT_459605 |
| P33535 | 8.74 | Ki | 1.8 | nM | CHEMBL_ACT_516289 |
| P33533 | 8.74 | Ki | 1.8 | nM | CHEMBL_ACT_6229868 |
Target pathways
Aggregated over 3 target gene(s): OPRD1, OPRK1, OPRM1.
Top Reactome pathways
6 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Peptide ligand-binding receptors | 3 | OPRD1, OPRK1, OPRM1 |
| G alpha (i) signalling events | 3 | OPRD1, OPRK1, OPRM1 |
| Interleukin-4 and Interleukin-13 signaling | 2 | OPRD1, OPRM1 |
| MECP2 regulates neuronal receptors and channels | 2 | OPRK1, OPRM1 |
| Opioid Signalling | 1 | OPRM1 |
| G-protein activation | 1 | OPRM1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 3 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 3 |
| neuropeptide signaling pathway | 3 |
| G protein-coupled opioid receptor signaling pathway | 3 |
| signal transduction | 3 |
| immune response | 2 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| response to nicotine | 2 |
| eating behavior | 2 |
| response to ethanol | 2 |
| sensory perception | 2 |
| sensory perception of pain | 2 |
| adult locomotory behavior | 1 |
| negative regulation of gene expression | 1 |
Indications & clinical
Indications
42 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| neoplasm | 3 | MONDO:0005070 | EFO:0000616 |
| neonatal abstinence syndrome | 3 | MONDO:0005566 | EFO:0005799 |
| obstructive sleep apnea syndrome | 3 | MONDO:0007147 | EFO:0003918 |
| scoliosis | 3 | MONDO:0005392 | EFO:0004273 |
| obesity disorder | 3 | MONDO:0011122 | EFO:0001073 |
| opiate dependence | 3 | MONDO:0005530 | EFO:0005611 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| nephrolithiasis | 3 | MONDO:0008171 | EFO:0004253 |
| acute myocardial infarction | 3 | MONDO:0004781 | EFO:0008583 |
| sickle cell disease | 3 | MONDO:0011382 | MONDO:0011382 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| neuralgia | 2 | MONDO:0021667 | EFO:0005762 |
| rotator cuff syndrome | 2 | MONDO:0007028 | EFO:1001250 |
| mucositis | 2 | MONDO:0020579 | EFO:1001898 |
| blood coagulation disease | 2 | MONDO:0001531 | EFO:0009314 |
| stomatitis | 2 | MONDO:0004842 | EFO:0009688 |
| respiratory failure | 2 | MONDO:0021113 | EFO:0009842 |
| tonsillitis | 2 | MONDO:0001039 | MONDO:0001039 |
| restless legs syndrome | 1 | MONDO:0005391 | EFO:0004270 |
| constipation disorder | 1 | MONDO:0002203 | HP:0002019 |
| heroin dependence | 1 | MONDO:0005367 | EFO:0004240 |
| rheumatic disorder | 1 | MONDO:0005554 | EFO:0005755 |
| cardiac arrest | 1 | MONDO:0000745 | EFO:0009492 |
| bone fracture | 0 | MONDO:0005315 | EFO:0003931 |
16 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 635.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 220 |
| Not specified | 198 |
| PHASE3 | 83 |
| PHASE2 | 66 |
| PHASE1 | 25 |
| PHASE2/PHASE3 | 20 |
| PHASE1/PHASE2 | 13 |
| EARLY_PHASE1 | 10 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04849455 | PHASE4 | RECRUITING | Erector Spinae Plane Block Catheters and Intrathecal Morphine for Hepatic Resection |
| NCT06186141 | PHASE4 | RECRUITING | Nausea and Vomiting in Postoperative Paediatric Patients With Patient-Controlled Analgesia (PCA): Morphine vs Oxycodone |
| NCT06411665 | PHASE4 | RECRUITING | Effect of Oliceridine Analgesia on Postoperative Nause and Vomiting |
| NCT06479655 | PHASE4 | RECRUITING | Compare the Efficacy and Outcome Between Fentanyl and Morphine as Analgo-sedation in Mechanically Ventilated Patients |
| NCT06511232 | PHASE4 | RECRUITING | Intraosseous Morphine Administration During Anterior Cruciate Ligament Reconstruction |
| NCT06570343 | PHASE4 | NOT_YET_RECRUITING | Analgesic Efficacy of Intrathecal Fentanyl-Morphine Combination Versus Morphine Alone for Intraoperative Pain During Elective Cesarean Delivery |
| NCT06704139 | PHASE4 | NOT_YET_RECRUITING | Role of Prophylactic Antiemetics in Women Receiving Intrathecal Morphine and Lipophilic Opioids Added to Bupivacaine for Cesarean Section |
| NCT06715657 | PHASE4 | NOT_YET_RECRUITING | Effect of Propofol Administration Time on the Incidence and Severity of Intrathecal Morphine-induced Pruritus in Parturient Undergoing Elective Cesarean Delivaries |
| NCT06797973 | PHASE4 | RECRUITING | Efficacy and Safety of Intrathecal Morphine for Postoperative Pain Management Following Planned Caesarean Section |
| NCT06800846 | PHASE4 | ENROLLING_BY_INVITATION | Comparative Analgesic Effect After Total Knee Arthroplasty Between Intraosseous and Peri-articular Injection |
| NCT06881563 | PHASE4 | NOT_YET_RECRUITING | Intrathecal Morphine Versus Epidural Analgesia for Laparoscopic Colon Surgery |
| NCT06935708 | PHASE4 | RECRUITING | Intrathecal Morphine Versus Epidural Analgesia for Open Colon Surgery |
| NCT07229495 | PHASE4 | NOT_YET_RECRUITING | Tegileridine for Postoperative Pain After Adolescent Scoliosis Surgery |
| NCT07377630 | PHASE4 | NOT_YET_RECRUITING | Intrathecal MoRphine Versus Transabdominal Plane Block (TAP) Block for AnalGesic Management in Elective Caesarean Section |
| NCT07386353 | PHASE4 | RECRUITING | Intrathecal Versus Epidural Morphine for Post-Cesarean Analgesia |
| NCT07412223 | PHASE4 | NOT_YET_RECRUITING | Effect of Tegileridine on Postoperative Bowel Function Recovery in Abdominal Surgery |
| NCT07525986 | PHASE4 | RECRUITING | Anrikefon-based Patient-controlled Intravenous Analgesia Following Laparoscopic Surgery |
| NCT00155233 | PHASE4 | UNKNOWN | Interaction Between Nalbuphine and Morphine in PCA |
| NCT00155376 | PHASE4 | UNKNOWN | Intravenous-Morphine and Glucagon-Usage Enhanced MR Cholangiography |
| NCT00158873 | PHASE4 | COMPLETED | Pharmaco-Economic Study Of Ultiva In Intensive Care Unit(ICU)Subjects |
| NCT00237731 | PHASE4 | COMPLETED | Pre-hospital Morphine Titration : Comparison of 0,05 Versus 0,1 mg/kg |
| NCT00246532 | PHASE4 | COMPLETED | Opiate-Induced Tolerance & Hyperalgesia in Pain Patients |
| NCT00289419 | PHASE4 | COMPLETED | Intraarticular Analgesia After Total Hip Arthroplasty, a Randomised Study |
| NCT00338481 | PHASE4 | COMPLETED | Red Morphine Drops for Symptomatic Treatment of Dyspnoea in Lung Cancer |
| NCT00346268 | PHASE4 | TERMINATED | Morphine-Sparing Efficacy Of Parecoxib In Pain Treatment After Radical Prostatectomy |
| NCT00353704 | PHASE4 | COMPLETED | Analgetic and Anxiolytic Effect of Preoperative Pregabalin |
| NCT00357942 | PHASE4 | COMPLETED | Topical Morphine for Stomatitis-related Pain Induced by Chemotherapy |
| NCT00477061 | PHASE4 | COMPLETED | Morphine Analgesia in Patients With Acute Appendicitis |
| NCT00513864 | PHASE4 | WITHDRAWN | Assessment of Opioid Analgesia in Sickle Cell |
| NCT00527332 | PHASE4 | COMPLETED | Effects of General Anesthesia and Spinal-Morphine Anesthesia on Recovery and Comfort After Benign Abdominal Hysterectomy |
| NCT00528177 | PHASE4 | COMPLETED | Morphine vs. Oxycodone for Postoperative Pain Management |
| NCT00562627 | PHASE4 | COMPLETED | Efficacy of Multimodal Peri- and Intraarticular Drug Injections in Total Knee Arthroplasty |
| NCT00640042 | PHASE4 | COMPLETED | Evaluation of Risk Minimization, Assessment and Outcomes in Patients With Chronic Pain Taking Avinza |
| NCT00681174 | PHASE4 | TERMINATED | Controlled-Release Oxycodone For Postoperative Analgesia After Video-Assisted Thoracic Surgery |
| NCT00702416 | PHASE4 | COMPLETED | Ultrasound Guidance for Interscalene Brachial Plexus Block |
| NCT00772187 | PHASE4 | COMPLETED | Intraoperative and Postoperative Analgesia for Laparoscopic Surgery. |
| NCT00783016 | PHASE4 | COMPLETED | Effect of Pain Control on the Diagnosis of Acute Appendicitis on the Diagnostic Accuracy of General Surgeon |
| NCT00795223 | PHASE4 | COMPLETED | Comparative Pain Control Between 0.2 or 0.3 Spinal Morphine and 0.25 or 0.5 % Bupivacaine for FNB After TKA |
| NCT00878371 | PHASE4 | COMPLETED | Effects of a Surgery-induced Peripheral Inflammatory Response on the Blood Brain Barrier |
| NCT00880607 | PHASE4 | COMPLETED | Intrathecal Morphine Versus Epidural Extended Release Morphine for Pediatric Patients Undergoing Spinal Fusion |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for alfentanil, buprenorphine, codeine, f | CPIC | COMT;OPRM1 |
PharmGKB also curates 43 clinical and 266 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
612 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| TAFAMIDIS | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ALVIMOPAN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BUPRENORPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BUTORPHANOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CODEINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| FENTANYL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| HYDROCODONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| HYDROMORPHONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LANSOPRAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LEVORPHANOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MEPERIDINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| METHADONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| METHYLNALTREXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NAFTOPIDIL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALBUPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALFURAFINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALMEFENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALOXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALTREXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OLICERIDINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OXYCODONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OXYMORPHONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PAROXETINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PASIREOTIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PENTAZOCINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| RITONAVIR | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| SAMIDORPHAN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| SAQUINAVIR | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| TRAMADOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ASIMADOLINE | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| ATICAPRANT | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| CEBRANOPADOL | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| NAVACAPRANT | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| TRIMEBUTINE | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| BREMAZOCINE | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1 |
| CARFENTANIL | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1 |
Related Atlas pages
- Genes: OPRD1, OPRK1, OPRM1
- Diseases: chronic obstructive pulmonary disease, injury, neoplasm, neonatal abstinence syndrome, obstructive sleep apnea syndrome, scoliosis, obesity disorder, opiate dependence, acute myeloid leukemia, nephrolithiasis, acute myocardial infarction, sickle cell disease, leukemia
- Drugs: Dihydroergotamine, Propoxyphene, Tafamidis, Alvimopan, Amiodarone, Amlodipine, Amoxapine, Astemizole, Benztropine, Buprenorphine, Butorphanol, Candesartan Cilexetil, Cannabidiol, Chlorpromazine, Cinnarizine, Clotrimazole, Codeine, Diethylstilbestrol, Econazole, Fentanyl, Fluphenazine, Fluspirilene, Hydrocodone, Hydromorphone, Lansoprazole, Levorphanol, Loperamide, Loxapine, Meperidine, Methadone, Methylnaltrexone, Miconazole, Naftopidil, Nalbuphine, Nalfurafine, Nalmefene, Naloxone, Naltrexone, Nelfinavir, Oliceridine, Oxycodone, Oxymorphone, Paroxetine, Pasireotide, Pentazocine, Pimozide, Raloxifene, Ritonavir, Samidorphan, Saquinavir, Sunitinib, Tamoxifen, Tramadol, Asimadoline, Aticaprant, Cebranopadol, Navacaprant, Trimebutine