Motesanib
drugOn this page
Also known as AMG 706AMG-706SID137276049
Summary
Motesanib (CHEMBL572881) is a phase-3 clinical-stage small molecule targeting FLT1, KDR, and FLT4; indicated across 2 conditions including non-small cell lung carcinoma and breast neoplasm.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 3 (FLT1, KDR, FLT4)
- Indications: 2 conditions
- Clinical trials: 2
- Chemistry: 373.5 Da · C22H23N5O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL572881 |
| Name | Motesanib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 11667893 |
| ChEBI | CHEBI:51098 |
| Molecular formula | C22H23N5O |
| Molecular weight | 373.5 |
| InChIKey | RAHBGWKEPAQNFF-UHFFFAOYSA-N |
SMILES: CC1(CNC2=C1C=CC(=C2)NC(=O)C3=C(N=CC=C3)NCC4=CC=NC=C4)C
IUPAC name: N-(3,3-dimethyl-1,2-dihydroindol-6-yl)-2-(pyridin-4-ylmethylamino)pyridine-3-carboxamide
Also known as: AMG 706, AMG-706, Motesanib, MOTESANIB, SID137276049, motesanib
Parent form; salt/anhydrous children: CHEMBL2107357
Patent coverage: 1,687 distinct patent families (4,642 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 3,447 (74%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| FLT1 | fms related receptor tyrosine kinase 1 | Inhibition | 8.7 | 0.1% | P17948 |
| KDR | kinase insert domain receptor | Inhibition | 8.52 | 1.1% | P35968 |
| FLT4 | fms related receptor tyrosine kinase 4 | Inhibition | 8.22 | 0.2% | P35916 |
Broader ChEMBL bioactivity targets: 46 (assay-derived). Sample: Receptor-interacting serine/threonine-protein kinase 3, Tyrosine-protein kinase Fyn, Macrophage colony-stimulating factor 1 receptor, Tyrosine-protein kinase ABL1, Vascular endothelial growth factor receptor 1, RAF proto-oncogene serine/threonine-protein kinase, Platelet-derived growth factor receptor beta, Mast/stem cell growth factor receptor Kit, Vascular endothelial growth factor receptor 3, Receptor-type tyrosine-protein kinase FLT3.
Bioactivity
ChEMBL activities: 144 potent at pChembl ≥ 5 of 144 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MAP4K1 | 9 | Kd | 1 | nM | CHEMBL_ACT_17913444 |
| KIT | 8.89 | Kd | 1.3 | nM | CHEMBL_ACT_7589592 |
| FLT1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_12138543 |
| FLT1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_16610764 |
| FLT1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_23289738 |
| FLT1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_26212346 |
| KDR | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_12138542 |
| KDR | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_16610765 |
| GSPT2 | 8.52 | Kd | 3 | nM | CHEMBL_ACT_17905539 |
| KDR | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_23289713 |
| KDR | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_26212347 |
| KDR | 8.52 | Ki | 3 | nM | CHEMBL_ACT_27790673 |
| KDR | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_3595758 |
| KIT | 8.49 | Kd | 3.2 | nM | CHEMBL_ACT_2897022 |
| KIT | 8.49 | Kd | 3.2 | nM | CHEMBL_ACT_7589593 |
| KIT | 8.43 | Kd | 3.7 | nM | CHEMBL_ACT_2895922 |
| KIT | 8.43 | Kd | 3.7 | nM | CHEMBL_ACT_6220449 |
| KIT | 8.43 | Kd | 3.7 | nM | CHEMBL_ACT_7589588 |
| CSF1R | 8.25 | Kd | 5.6 | nM | CHEMBL_ACT_2902371 |
| CSF1R | 8.25 | Kd | 5.6 | nM | CHEMBL_ACT_7591332 |
| FLT4 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_12138541 |
| FLT4 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_23289721 |
| P35918 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_26212348 |
| FLT4 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_26212349 |
| KIT | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_26212351 |
| MAP3K20 | 8.1 | Kd | 8 | nM | CHEMBL_ACT_2891586 |
| MAP3K20 | 8.1 | Kd | 8 | nM | CHEMBL_ACT_7591498 |
| PDGFRB | 8.04 | Kd | 9.1 | nM | CHEMBL_ACT_2899064 |
| PDGFRB | 8.04 | Kd | 9.1 | nM | CHEMBL_ACT_7589678 |
| FLT4 | 8.01 | Kd | 9.7 | nM | CHEMBL_ACT_2890882 |
Target pathways
Aggregated over 3 target gene(s): FLT1, KDR, FLT4.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| VEGF binds to VEGFR leading to receptor dimerization | 3 | FLT1, FLT4, KDR |
| Neuropilin interactions with VEGF and VEGFR | 2 | FLT1, KDR |
| High laminar flow shear stress activates signaling by PIEZO1 and PECAM1:CDH5:KDR in endothelial cells | 2 | FLT4, KDR |
| Integrin cell surface interactions | 1 | KDR |
| VEGFA-VEGFR2 Pathway | 1 | KDR |
| VEGFR2 mediated cell proliferation | 1 | KDR |
| NOTCH4 Intracellular Domain Regulates Transcription | 1 | FLT4 |
| Signaling by membrane-tethered fusions of PDGFRA or PDGFRB | 1 | KDR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| cell surface receptor protein tyrosine kinase signaling pathway | 3 |
| positive regulation of cell population proliferation | 3 |
| cell migration | 3 |
| peptidyl-tyrosine phosphorylation | 3 |
| positive regulation of cell migration | 3 |
| cellular response to vascular endothelial growth factor stimulus | 3 |
| positive regulation of MAPK cascade | 3 |
| protein autophosphorylation | 3 |
| vascular endothelial growth factor receptor signaling pathway | 3 |
| angiogenesis | 3 |
| protein phosphorylation | 3 |
| vascular endothelial growth factor signaling pathway | 3 |
| sprouting angiogenesis | 2 |
| cell differentiation | 2 |
| positive regulation of angiogenesis | 2 |
Indications & clinical
Indications
2 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| breast neoplasm | 1 | MONDO:0021100 | MONDO:0007254 |
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02629848 | PHASE3 | TERMINATED | Study of Motesanib (AMG 706) in Combination With Paclitaxel and Carboplatin for Advanced Non-Squamous Non-Small Cell Lung Cancer |
| NCT01349088 | PHASE1/PHASE2 | WITHDRAWN | Investigational Drug in Combination With Two Chemotherapy Drugs in Women With Locally Recurrent or Metastatic Breast Cancer |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
174 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | FLT1, FLT4, KDR |
| Gefitinib | ChEMBL + PubChem | Phase 4 (approved) | FLT1, FLT4, KDR |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | FLT1, FLT4, KDR |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | FLT1, FLT4, KDR |
| AXITINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| FRUQUINTINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| LENVATINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| NINTEDANIB ESYLATE | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| QUIZARTINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| SORAFENIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| SUNITINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| VANDETANIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4, KDR |
| BRIVANIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| CEDIRANIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| CEP-1347 | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| DOVITINIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| LESTAURTINIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| LINIFANIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| SEMAXANIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| SURUFATINIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| VATALANIB | ChEMBL | Phase 3 | FLT1, FLT4, KDR |
| AT-9283 | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| BFH-772 | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| CENISERTIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| DORAMAPIMOD | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| FORETINIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| ILORASERTIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| LUCITANIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| MK-2461 | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| OSI-632 | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| R-406 | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| RAF-265 | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| REBASTINIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| SU-014813 | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| TANDUTINIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| TOZASERTIB | ChEMBL | Phase 2 | FLT1, FLT4, KDR |
| Afatinib | PubChem | Approved | FLT1, FLT4, KDR |
| Selumetinib | PubChem | Approved | FLT1, FLT4, KDR |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | FLT4, KDR |
| DASATINIB | ChEMBL | Phase 4 (approved) | FLT1, KDR |
| FILGOTINIB | ChEMBL | Phase 4 (approved) | FLT1, FLT4 |
| PEXIDARTINIB | ChEMBL | Phase 4 (approved) | FLT1, KDR |
| PONATINIB | ChEMBL | Phase 4 (approved) | FLT1, KDR |
| ALISERTIB | ChEMBL | Phase 3 | FLT1, KDR |
| CANERTINIB | ChEMBL | Phase 3 | FLT1, KDR |
| DEFACTINIB | ChEMBL | Phase 3 | FLT1, KDR |
| ORANTINIB | ChEMBL | Phase 3 | FLT1, KDR |
| AEE-788 | ChEMBL | Phase 2 | FLT1, KDR |
| CEP-11981 | ChEMBL | Phase 2 | FLT1, KDR |
| CEP-32496 | ChEMBL | Phase 2 | FLT1, KDR |
| DANUSERTIB | ChEMBL | Phase 2 | FLT4, KDR |
Related Atlas pages
- Genes: FLT1, KDR, FLT4
- Diseases: non-small cell lung carcinoma
- Drugs: Crizotinib, Gefitinib, Pazopanib, Regorafenib, Axitinib, Cabozantinib, Entrectinib, Erlotinib, Fedratinib, Fruquintinib, Infigratinib, Lenvatinib, Midostaurin, Nintedanib, Quizartinib, Sorafenib, Sunitinib, Tivozanib, Vandetanib, Brivanib, Cediranib, CEP-1347, Dovitinib, Lestaurtinib, Linifanib, Semaxanib, Surufatinib, Vatalanib, Afatinib, Selumetinib, Brigatinib, Dasatinib, Filgotinib, Pexidartinib, Ponatinib, Alisertib, Canertinib, Defactinib, Orantinib
- Biomarker genes: RET