Moxonidine
drugOn this page
Also known as BDF-5896BDF5896BE-5895BE5895CyntFisiotensLY-326869LY326869MoxonidinaNormatensPhysiotensSID11111430SID11111431SID90341434SID85148350SID144203741SID170466534
Summary
Moxonidine (CHEMBL19236) is an approved small molecule (ATC C02AC05) targeting ADRA2A, ADRA2B, and ADRA2C; indicated across 3 conditions including hypertensive disorder and heart disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C02AC05
- Targets: 3 (ADRA2A, ADRA2B, ADRA2C)
- Indications: 3 conditions
- Clinical trials: 18
- Chemistry: 241.68 Da · C9H12ClN5O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL19236 |
| Name | Moxonidine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4810 |
| ATC | C02AC05 |
| Molecular formula | C9H12ClN5O |
| Molecular weight | 241.68 |
| InChIKey | WPNJAUFVNXKLIM-UHFFFAOYSA-N |
SMILES: CC1=NC(=C(C(=N1)Cl)NC2=NCCN2)OC
IUPAC name: 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-6-methoxy-2-methylpyrimidin-5-amine
Also known as: BDF-5896, BDF5896, BE-5895, BE5895, Cynt, Fisiotens, LY-326869, LY326869, Moxonidina, Moxonidine, Normatens, Physiotens
Parent form; salt/anhydrous children: CHEMBL1256287
Patent coverage: 1,259 distinct patent families (4,405 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 4,145 (94%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA2A | α2A-adrenoceptor | Agonist | 5 | 0.1% | P08913 |
| ADRA2B | α2B-adrenoceptor | Agonist | 4.6 | 0.2% | P18089 |
| ADRA2C | α2C-adrenoceptor | Agonist | 4.8 | 0% | P18825 |
Broader ChEMBL bioactivity targets: 14 (assay-derived). Sample: Prelamin-A/C, Alpha-2A adrenergic receptor, Alpha-2C adrenergic receptor, Histamine H2 receptor, Alpha-2B adrenergic receptor, Adrenergic receptor alpha-2, 5-hydroxytryptamine receptor 1A, Alpha-1A adrenergic receptor, Alpha-2B adrenergic receptor, 5-hydroxytryptamine receptor 1A.
Bioactivity
ChEMBL activities: 14 potent at pChembl ≥ 5 of 19 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NISCH | 8.45 | IC50 | 3.55 | nM | CHEMBL_ACT_19062262 |
| NISCH | 8.38 | Ki | 4.2 | nM | CHEMBL_ACT_2564082 |
| NISCH | 7.25 | Ki | 56 | nM | CHEMBL_ACT_758354 |
| ADRA2A | 7.12 | Ki | 75 | nM | CHEMBL_ACT_15197908 |
| Q4G017 | 7.11 | Ki | 77.8 | nM | CHEMBL_ACT_15197881 |
| ADRA2A | 7.06 | AC50 | 88 | nM | CHEMBL_ACT_25220855 |
| ADRA1A | 7.05 | AC50 | 90 | nM | CHEMBL_ACT_25229620 |
| ADRA2A | 6.82 | Ki | 150 | nM | CHEMBL_ACT_758351 |
| LMNA | 6.4 | Potency | 398.1 | nM | CHEMBL_ACT_3655025 |
| P19327 | 6.4 | Ki | 401.2 | nM | CHEMBL_ACT_7773483 |
| P19327 | 6.15 | IC50 | 702.1 | nM | CHEMBL_ACT_7773482 |
| P19328 | 6 | Ki | 1000 | nM | CHEMBL_ACT_758352 |
| ADRA2C | 5.7 | Ki | 2000 | nM | CHEMBL_ACT_758353 |
| HTR1A | 5.19 | AC50 | 6500 | nM | CHEMBL_ACT_25216789 |
Target pathways
Aggregated over 3 target gene(s): ADRA2A, ADRA2B, ADRA2C.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signal Transduction | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signaling by GPCR | 3 | ADRA2A, ADRA2B, ADRA2C |
| Class A/1 (Rhodopsin-like receptors) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Amine ligand-binding receptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR downstream signalling | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenoceptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenaline signalling through Alpha-2 adrenergic receptor | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (i) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (z) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR ligand binding | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet activation, signaling and aggregation | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet Aggregation (Plug Formation) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Metabolism | 2 | ADRA2A, ADRA2C |
| Integration of energy metabolism | 2 | ADRA2A, ADRA2C |
| Metabolism of proteins | 2 | ADRA2A, ADRA2C |
| Adrenaline,noradrenaline inhibits insulin secretion | 2 | ADRA2A, ADRA2C |
| Regulation of insulin secretion | 2 | ADRA2A, ADRA2C |
| Surfactant metabolism | 2 | ADRA2A, ADRA2C |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| epidermal growth factor receptor signaling pathway | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| negative regulation of norepinephrine secretion | 3 |
| regulation of vasoconstriction | 3 |
| platelet activation | 3 |
| negative regulation of epinephrine secretion | 3 |
| positive regulation of MAPK cascade | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| adrenergic receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting adrenergic receptor signaling pathway | 3 |
| regulation of smooth muscle contraction | 3 |
| signal transduction | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| female pregnancy | 2 |
| negative regulation of insulin secretion | 2 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| hypertensive disorder | 4 | MONDO:0005044 | EFO:0000537 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| orthostatic hypotension | 0 | MONDO:0005469 | EFO:0005252 |
Clinical trials
Total trials: 18.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 11 |
| PHASE3 | 2 |
| EARLY_PHASE1 | 2 |
| PHASE1/PHASE2 | 1 |
| PHASE1 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01094769 | PHASE4 | COMPLETED | Sympathetic Nervous System Inhibition for the Treatment of Diabetic Kidney Disease |
| NCT01138423 | PHASE4 | COMPLETED | Treatment of Adiposity Related hypErTension (TARGET) |
| NCT01180231 | PHASE4 | UNKNOWN | Study of the Effect of Moxonidine and Diet on Sympathetic Functions in Young Adults With Obesity |
| NCT01360710 | PHASE4 | UNKNOWN | The Effect of Moxonidine on Blood Pressure and Regression of Early Target Organ Damage in Young Subjects With Abdominal Obesity and Hypertension |
| NCT01504321 | PHASE4 | COMPLETED | Polycystic Ovary Syndrome - Improving Outcomes |
| NCT01567124 | PHASE4 | WITHDRAWN | Alleviating the Metabolic Side Effects of Antipsychotic Medications |
| NCT01791699 | PHASE4 | COMPLETED | Moxonidine for Prevention of Post-ablation AFib Recurrences |
| NCT04023565 | PHASE4 | UNKNOWN | Moxonidine + Perindopril in Hypertensive Patients With Metabolic Syndrome |
| NCT04474899 | PHASE4 | UNKNOWN | Sympathoinhibition as a Preferred Second Line Treatment of Obesity Related Hypertension |
| NCT04479813 | PHASE4 | COMPLETED | Role of Sympathetic Activation in Ischemia Reperfusion Injury |
| NCT05147753 | PHASE4 | COMPLETED | Moxonidine Effects on Neuropeptide Y |
| NCT00160277 | PHASE3 | COMPLETED | Efficacy and Safety of Moxonidine in Indian Patients |
| NCT00244504 | PHASE3 | TERMINATED | Moxonidine in Patients Undergoing Vascular Surgery |
| NCT05312892 | PHASE1/PHASE2 | RECRUITING | Sympathetic Mechanisms in Obesity-Crossover Design |
| NCT04329806 | PHASE1 | TERMINATED | Sympathetic Mechanisms in the Cardiovascular and Metabolic Alterations of Obesity |
| NCT04050410 | EARLY_PHASE1 | ACTIVE_NOT_RECRUITING | Autonomic Determinants of POTS - Pilot1 |
| NCT04140721 | EARLY_PHASE1 | ACTIVE_NOT_RECRUITING | Autonomic Determinants of POTS - Pilot 2 |
| NCT02355821 | Not specified | COMPLETED | Comparative Effects of Moxonidine on Bone Metabolism, Vascular and Cellular Aging in Hypertensive Postmenopausal Women |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
607 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Almotriptan | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| NAPHAZOLINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ALFUZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APRACLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTHIAZIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BRIMONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DANAZOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DEXMEDETOMIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
Related Atlas pages
- Genes: ADRA2A, ADRA2B, ADRA2C
- Diseases: hypertensive disorder, heart disorder
- Drugs: Aclidinium Bromide, Afatinib, Almotriptan, Chenodiol, Clozapine, Crizotinib, Desloratadine, Dihydroergotamine, Naphazoline, Olanzapine, Olodaterol, Paliperidone, Pramipexole, Tamsulosin, Tegaserod, Acetophenazine, Alfuzosin, Amisulpride, Amitriptyline, Amoxapine, Apomorphine, Apraclonidine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benfluorex, Benperidol, Benzbromarone, Benzquinamide, Benzthiazide, Benztropine, Bithionol, Brexpiprazole, Brimonidine, Bromocriptine, Bromperidol, Cabergoline, Candesartan Cilexetil, Cariprazine, Carvedilol, Chlorhexidine, Chloroquine, Chlorpromazine, Cinnarizine, Cisapride, Clemastine, Clomipramine, Clonidine, Clotrimazole, Cyproheptadine, Danazol, Darifenacin, Dexmedetomidine, Diethylstilbestrol, Dobutamine, Domperidone, Dothiepin