Mycophenolate Mofetil
drugOn this page
Also known as ArzipCellceptMyclausenMycophenolate mofetil tevaMycophenylate mofetilMyfenaxMyhibbinNSC-724229NSC-758905RS-61443SID29215409SID144205239Morpholinoethyl esterMYCOPHENOLATE_MOFETILSID170464859MycophenolateMycophenolate mofetilÊMycophenolate mofetilÂMYCOPHENOLATE-MOFETIL
Summary
Mycophenolate Mofetil (CHEMBL1456) is an approved small-molecule immunosuppressive agent targeting IMPDH1 and IMPDH2; indicated across 127 conditions including iga glomerulonephritis and nephrotic syndrome.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 2 (IMPDH1, IMPDH2)
- Indications: 127 conditions
- Clinical trials: 608
- Chemistry: 433.5 Da · C23H31NO7
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1456 |
| Name | Mycophenolate Mofetil |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5281078 |
| ChEBI | CHEBI:8764 |
| Molecular formula | C23H31NO7 |
| Molecular weight | 433.5 |
| InChIKey | RTGDFNSFWBGLEC-SYZQJQIISA-N |
SMILES: CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)OCCN3CCOCC3)O
IUPAC name: 2-morpholin-4-ylethyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate
ChEBI definition: A carboxylic ester resulting from the formal condensation between the carboxylic acid group of mycophenolic acid and the hydroxy group of 2-(morpholin-4-yl)ethanol. In the liver, it is metabolised to mycophenolic acid, an immunosuppressant for which it is a prodrug. It is widely used to prevent tissue rejection following organ transplants as well as for the treatment of certain autoimmune diseases.
Pharmacological roles (ChEBI): immunosuppressive agent, prodrug, EC 1.1.1.205 (IMP dehydrogenase) inhibitor, anticoronaviral agent.
Also known as: Arzip, Cellcept, Myclausen, Mycophenolate mofetil, Mycophenolate mofetil teva, Mycophenylate mofetil, Myfenax, Myhibbin, NSC-724229, NSC-758905, RS-61443, mycophenolate Mofetil
Parent form; salt/anhydrous children: CHEMBL1200955
Patent coverage: 13,242 distinct patent families (50,719 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 50,445 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| IMPDH1 | inosine monophosphate dehydrogenase 1 | Inhibition | 8.8% | P20839 | |
| IMPDH2 | inosine monophosphate dehydrogenase 2 | Inhibition | 48.5% | P12268 |
Broader ChEMBL bioactivity targets: 9 (assay-derived). Sample: Prelamin-A/C, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], ATP-binding cassette sub-family C member 4, Sodium-dependent serotonin transporter, Voltage-gated inwardly rectifying potassium channel KCNH2, cGMP-inhibited 3’,5’-cyclic phosphodiesterase 3A, Nuclear receptor subfamily 1 group I member 2, Aldehyde dehydrogenase 1A1, Bile salt export pump.
Bioactivity
ChEMBL activities: 2 potent at pChembl ≥ 5 of 9 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| LMNA | 6.25 | Potency | 562.3 | nM | CHEMBL_ACT_3655871 |
| NR1I2 | 5.17 | AC50 | 6800 | nM | CHEMBL_ACT_25188204 |
Target pathways
Aggregated over 2 target gene(s): IMPDH1, IMPDH2.
Top Reactome pathways
14 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 2 | IMPDH1, IMPDH2 |
| Metabolism of nucleotides | 2 | IMPDH1, IMPDH2 |
| Disease | 2 | IMPDH1, IMPDH2 |
| Innate Immune System | 2 | IMPDH1, IMPDH2 |
| Immune System | 2 | IMPDH1, IMPDH2 |
| Infectious disease | 2 | IMPDH1, IMPDH2 |
| Neutrophil degranulation | 2 | IMPDH1, IMPDH2 |
| Purine ribonucleoside monophosphate biosynthesis | 2 | IMPDH1, IMPDH2 |
| Nucleotide biosynthesis | 2 | IMPDH1, IMPDH2 |
| Potential therapeutics for SARS | 2 | IMPDH1, IMPDH2 |
| SARS-CoV Infections | 2 | IMPDH1, IMPDH2 |
| Drug ADME | 2 | IMPDH1, IMPDH2 |
| Azathioprine ADME | 2 | IMPDH1, IMPDH2 |
| Viral Infection Pathways | 2 | IMPDH1, IMPDH2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| GMP biosynthetic process | 2 |
| GTP biosynthetic process | 2 |
| lymphocyte proliferation | 2 |
| ‘de novo’ XMP biosynthetic process | 2 |
| purine nucleotide biosynthetic process | 2 |
| circadian rhythm | 1 |
| cellular response to interleukin-4 | 1 |
Indications & clinical
Indications
127 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| IgA glomerulonephritis | 3 | MONDO:0005342 | EFO:0004194 |
| nephrotic syndrome | 3 | MONDO:0005377 | EFO:0004255 |
| pemphigus vulgaris | 3 | MONDO:0008219 | EFO:0004719 |
| hepatitis C virus infection | 3 | MONDO:0005231 | EFO:0003047 |
| myasthenia gravis | 3 | MONDO:0009688 | EFO:0004991 |
| graft versus host disease | 3 | MONDO:0013730 | EFO:0004599 |
| cardiovascular disorder | 3 | MONDO:0004995 | EFO:0000319 |
| uveitis | 3 | MONDO:0020283 | EFO:1001231 |
| hepatocellular carcinoma | 3 | MONDO:0007256 | EFO:0000182 |
| Hodgkins lymphoma | 3 | MONDO:0004952 | EFO:0000183 |
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| chronic myeloid leukemia | 3 | MONDO:0011996 | EFO:0000339 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| neoplasm | 3 | MONDO:0005070 | EFO:0000616 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| focal segmental glomerulosclerosis | 3 | MONDO:0100313 | EFO:0004236 |
| interstitial lung disease | 3 | MONDO:0015925 | EFO:0004244 |
| membranous glomerulonephritis | 3 | MONDO:0005376 | EFO:0004254 |
| anti-neutrophil antibody associated vasculitis | 3 | MONDO:0005435 | EFO:0004826 |
| granulomatosis with polyangiitis | 3 | MONDO:0012105 | EFO:0005297 |
| lupus nephritis | 3 | MONDO:0005556 | EFO:0005761 |
| non-Hodgkin lymphoma | 3 | MONDO:0018908 | EFO:0005952 |
| autoimmune thrombocytopenic purpura | 3 | MONDO:0008558 | EFO:0007160 |
| cauda equina syndrome | 3 | MONDO:0005693 | EFO:0007196 |
| microscopic polyangiitis | 3 | MONDO:0019124 | EFO:1000784 |
| Takayasu arteritis | 3 | MONDO:0017991 | EFO:1001857 |
| Waldenstrom macroglobulinemia | 3 | MONDO:0100280 | EFO:0009441 |
| mantle cell lymphoma | 3 | MONDO:0018876 | EFO:1001469 |
| kidney failure | 3 | MONDO:0001106 | EFO:1002048 |
| pure red-cell aplasia | 3 | MONDO:0001705 | MONDO:0001705 |
| diabetic kidney disease | 3 | MONDO:0005016 | EFO:0000401 |
| neuromyelitis optica | 3 | MONDO:0019100 | EFO:0004256 |
| interstitial cystitis | 3 | MONDO:0018301 | EFO:0008507 |
| type 1 diabetes mellitus | 3 | MONDO:0005147 | MONDO:0005147 |
| systemic lupus erythematosus | 3 | MONDO:0007915 | MONDO:0007915 |
| chronic kidney disease | 3 | MONDO:0005300 | MONDO:0024327 |
| diffuse scleroderma | 2 | MONDO:0005019 | EFO:0000404 |
| vasculitis | 2 | MONDO:0018882 | EFO:0006803 |
| liver disorder | 2 | MONDO:0005154 | EFO:0001421 |
| Sjogren syndrome | 2 | MONDO:0010030 | EFO:0000699 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| Crohn disease | 2 | MONDO:0005011 | EFO:0000384 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| lymphoma | 2 | MONDO:0005062 | EFO:0000574 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| psoriasis | 2 | MONDO:0005083 | EFO:0000676 |
| systemic sclerosis | 2 | MONDO:0005100 | EFO:0000717 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| age-related macular degeneration | 2 | MONDO:0005150 | EFO:0001365 |
| lymphoid neoplasm | 2 | MONDO:0005157 | EFO:0001642 |
| primary myelofibrosis | 2 | MONDO:0009692 | EFO:0002430 |
| gout | 2 | MONDO:0005393 | EFO:0004274 |
| autoimmune disease | 2 | MONDO:0007179 | EFO:0005140 |
| aplastic anemia | 2 | MONDO:0015909 | EFO:0006927 |
| B-cell prolymphocytic leukemia | 2 | MONDO:0019461 | EFO:1000102 |
| juvenile myelomonocytic leukemia | 2 | MONDO:0011908 | EFO:1000309 |
| T-cell prolymphocytic leukemia | 2 | MONDO:0019468 | EFO:1000560 |
| epidermolysis bullosa | 2 | MONDO:0006541 | EFO:1000690 |
| Sezary syndrome | 2 | MONDO:0017844 | EFO:1000785 |
| immunoglobulin A vasculitis | 2 | MONDO:0019167 | EFO:1000965 |
| mycosis fungoides | 2 | MONDO:0009691 | EFO:1001051 |
| alcoholic hepatitis | 2 | MONDO:0001505 | EFO:1001345 |
| hematologic disorder | 2 | MONDO:0005570 | HP:0001871 |
| peripheral T-cell lymphoma, not otherwise specified | 2 | MONDO:0004964 | EFO:0000211 |
| angioimmunoblastic T-cell lymphoma | 2 | MONDO:0004977 | EFO:0000255 |
| Burkitt lymphoma | 2 | MONDO:0007243 | EFO:0000309 |
| acquired polycythemia vera | 2 | MONDO:0009891 | EFO:0002429 |
| anaplastic large cell lymphoma | 2 | MONDO:0020325 | EFO:0003032 |
| bullous pemphigoid | 2 | MONDO:0019082 | EFO:0007187 |
| mast cell leukemia | 2 | MONDO:0020334 | EFO:0007359 |
| Langerhans cell histiocytosis | 2 | MONDO:0018310 | EFO:1000318 |
| chronic myelomonocytic leukemia | 2 | MONDO:0020311 | EFO:1001779 |
| myeloproliferative neoplasm | 2 | MONDO:0020076 | EFO:0002428 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| follicular lymphoma | 2 | MONDO:0018906 | MONDO:0018906 |
| nasal cavity and paranasal sinus lethal midline granuloma | 2 | MONDO:0006828 | MONDO:0019472 |
| hematopoietic and lymphoid system neoplasm | 2 | MONDO:0002334 | MONDO:0044881 |
| drug-induced liver injury | 2 | MONDO:0005359 | EFO:0004228 |
| mucous membrane pemphigoid | 2 | MONDO:0018746 | EFO:1000680 |
| MALT lymphoma | 2 | MONDO:0007650 | EFO:0000191 |
| inborn error of immunity | 2 | MONDO:0003778 | HP:0002721 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| familial lipoprotein lipase deficiency | 2 | MONDO:0009387 | MONDO:0009387 |
| Wiskott-Aldrich syndrome | 2 | MONDO:0010518 | MONDO:0010518 |
| sickle cell disease | 2 | MONDO:0011382 | MONDO:0011382 |
| Diamond-Blackfan anemia | 2 | MONDO:0015253 | MONDO:0015253 |
| severe combined immunodeficiency | 2 | MONDO:0015974 | MONDO:0015974 |
| Fanconi anemia | 2 | MONDO:0019391 | MONDO:0019391 |
| cardiomyopathy | 2 | MONDO:0004994 | EFO:0000318 |
| hemoglobinuria | 2 | MONDO:0003656 | MONDO:0100244 |
| plasma cell neoplasm | 2 | MONDO:0004959 | EFO:0000200 |
| Graves disease | 2 | MONDO:0005364 | EFO:0004237 |
| limited cutaneous systemic sclerosis | 2 | MONDO:0016358 | MONDO:0016358 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| hypertensive disorder | 1 | MONDO:0005044 | EFO:0000537 |
| renal cell carcinoma | 1 | MONDO:0005086 | EFO:0000681 |
| beta thalassemia | 1 | MONDO:0019402 | Orphanet:848 |
| rheumatoid arthritis | 1 | MONDO:0008383 | EFO:0000685 |
| gliosarcoma | 1 | MONDO:0016681 | EFO:1001465 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| small cell lung carcinoma | 1 | MONDO:0008433 | EFO:0000702 |
| DiGeorge syndrome | 1 | MONDO:0008564 | MONDO:0018923 |
| lymphoid leukemia | 1 | MONDO:0005402 | EFO:0004289 |
| myeloid leukemia | 1 | MONDO:0004643 | MONDO:0004643 |
| neuroepithelial neoplasm | 0 | MONDO:0021193 | MONDO:0021193 |
16 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 608.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 242 |
| PHASE4 | 98 |
| PHASE3 | 78 |
| PHASE1 | 66 |
| Not specified | 60 |
| PHASE1/PHASE2 | 45 |
| PHASE2/PHASE3 | 13 |
| EARLY_PHASE1 | 6 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02081755 | PHASE4 | ENROLLING_BY_INVITATION | Safety and Efficacy of Everolimus Treatment in Liver Transplantation for Liver Cancer |
| NCT05193565 | PHASE4 | ACTIVE_NOT_RECRUITING | Study to Compare the Efficacy and Safety After Conversion to RaparoBell® or My-Rept® in Kidney Transplant Patients |
| NCT05207358 | PHASE4 | RECRUITING | Minimizing Glucocorticoid Administration in Patients With Proliferative Lupus Nephritis |
| NCT05916781 | PHASE4 | RECRUITING | Effectiveness of Mycophenolate Mofetil Combined With Tacrolimus for Steroid Tapering in Systemic Lupus Erythematosus |
| NCT07352566 | PHASE4 | NOT_YET_RECRUITING | Utilization of a Microdevice for Psoriasis and Atopic Dermatitis |
| NCT00048165 | PHASE4 | COMPLETED | A Study to Evaluate the Efficacy and Safety of Zenapax in Combination With CellCept, Cyclosporine, and Corticosteroids in Patients Undergoing Cardiac Transplantation |
| NCT00087581 | PHASE4 | COMPLETED | Study of Therapeutic Monitoring of Mycophenolate Mofetil (MMF/CellCept) After Kidney Transplantation |
| NCT00113269 | PHASE4 | COMPLETED | Safety/Efficacy of Induction Agents With Tacrolimus, MMF, and Rapid Steroid Withdrawal in Renal Transplant Recipients |
| NCT00133172 | PHASE4 | TERMINATED | Effect of Rapid Steroid Withdrawal on Subclinical Markers of Rejection |
| NCT00160966 | PHASE4 | COMPLETED | Impact of Immunosuppressive Regimens on Polyomavirus-related Transplant Nephropathy |
| NCT00166244 | PHASE4 | COMPLETED | Fixed Dose MMF vs Concentration Controlled MMF After Renal Transplantation |
| NCT00166829 | PHASE4 | UNKNOWN | The Effect of Sirolimus on the Pharmacokinetics of Tacrolimus |
| NCT00189150 | PHASE4 | COMPLETED | Pharmacokinetics of Mmf and Valganciclovir |
| NCT00195988 | PHASE4 | COMPLETED | Comparison of Immunosuppression Protocols After LTx in Children |
| NCT00199667 | PHASE4 | UNKNOWN | Concentration Controlled Versus Fixed Dose of MMF in Kidney Transplant Recipients |
| NCT00200551 | PHASE4 | COMPLETED | A Study of Mycophenolate Mofetil and Cyclosporin, Without Concomitant Corticosteroids, After a First Renal Transplant |
| NCT00206076 | PHASE4 | COMPLETED | Mycophenolate Mofetil Immunosuppression Without/With Reduced Dose Calcineurin Inhibitor Long After Liver Transplantation |
| NCT00217152 | PHASE4 | TERMINATED | A Kidney Transplant Study to Look at the Effects of Taking Fixed Doses of CellCept Versus Taking Doses of CellCept Based on the Concentration of CellCept in the Blood When Taking Full or Reduced Dose Calcineurin Inhibitors |
| NCT00261820 | PHASE4 | COMPLETED | Study Comparing Two Immunosuppressive Regimens in De Novo Renal Allograft Recipients |
| NCT00275535 | PHASE4 | COMPLETED | The Comparison of Tacrolimus and Sirolimus Immunosuppression Based Drug Regimens in Kidney Transplant Recipients |
| NCT00307671 | PHASE4 | COMPLETED | Treatment of Necrotizing Vasculitides for Patients Older Than 65 Years |
| NCT00352092 | PHASE4 | COMPLETED | Pilot Study for HLA Identical Living Donor Renal Transplant Recipients |
| NCT00371319 | PHASE4 | COMPLETED | Comparing the Efficacy of Tacrolimus and Mycophenolate Mofetil for the Initial Therapy of Active Lupus Nephritis |
| NCT00371826 | PHASE4 | COMPLETED | SOCRATES: Steroid or Cyclosporine Removal After Transplantation Using Everolimus |
| NCT00374231 | PHASE4 | COMPLETED | Single Center Pilot Study of Corticosteroid Discontinuation in Liver Transplant Recipients |
| NCT00374647 | PHASE4 | COMPLETED | Study to Evaluate Safety and Efficacy of Early Calcineurin Inhibitor Withdrawal in Primary Renal Allografts |
| NCT00400400 | PHASE4 | COMPLETED | Enteric-coated Mycophenolate Sodium (EC-MPS) and Mycophenolate Mofetil (MMF) in Renal Transplant Patients With Gastrointestinal (GI) Intolerance |
| NCT00400647 | PHASE4 | COMPLETED | Gastrointestinal and Health-related Quality of Life in Kidney Transplant Patients Treated With Mycophenolate Mofetil |
| NCT00411515 | PHASE4 | COMPLETED | A Prospective Randomized Trial on Mycophenolate Mofetil in Risk Penetrating Keratoplasty |
| NCT00420537 | PHASE4 | TERMINATED | Shift to Everolimus (RAD) Kidney Sparing Study |
| NCT00494741 | PHASE4 | COMPLETED | MMF vs. AZA for Kidney Transplantation |
| NCT00522548 | PHASE4 | TERMINATED | Myfortic or CellCept Gastrointestinal Effects in African American Kidney Recipients |
| NCT00545402 | PHASE4 | COMPLETED | A Study of CellCept (Mycophenolate Mofetil) in Combination Therapy in Liver Transplant Patients. |
| NCT00556933 | PHASE4 | COMPLETED | Improved Induction and Maintenance Immunosuppression in Kidney Transplantation |
| NCT00596947 | PHASE4 | TERMINATED | Prednisone Withdrawal Versus Prednisone Maintenance After Kidney Transplant |
| NCT00650468 | PHASE4 | COMPLETED | A Study to Compare Early Steroid Withdrawal and Long-Term Steroid Maintenance Therapy in Kidney Transplant Patients |
| NCT00656266 | PHASE4 | TERMINATED | Trial of Calcineurin Inhibitor-Sparing Immunosuppression Regimen in Pediatric Liver Transplantation |
| NCT00717314 | PHASE4 | COMPLETED | A Study of CellCept (Mycophenolate Mofetil) Combined With Calcineurin Inhibitors in Liver Transplant Patients. |
| NCT00717379 | PHASE4 | COMPLETED | Study of Tacrolimus Immunosuppressive Therapy After Kidney Transplantation |
| NCT00717470 | PHASE4 | COMPLETED | A Study in Kidney Transplant Subjects to Investigate the Optimal Suppression of Immunity to Help Prevent Kidney Rejection |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 20 clinical and 99 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
24 molecules share ≥1 primary target. Top 24 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| MYCOPHENOLIC ACID | ChEMBL + PubChem | Phase 4 (approved) | IMPDH1, IMPDH2 |
| MERIMEPODIB | ChEMBL | Phase 2 | IMPDH1, IMPDH2 |
| Adenosine | PubChem | Approved | IMPDH1 |
| Afatinib | PubChem | Approved | IMPDH2 |
| Binimetinib | PubChem | Approved | IMPDH2 |
| Cobimetinib | PubChem | Approved | IMPDH2 |
| Crizotinib | PubChem | Approved | IMPDH2 |
| dacomitinib | PubChem | Approved | IMPDH2 |
| Erlotinib | PubChem | Approved | IMPDH2 |
| Fedratinib | PubChem | Approved | IMPDH2 |
| Fostamatinib | PubChem | Approved | IMPDH2 |
| Gefitinib | PubChem | Approved | IMPDH2 |
| Idelalisib | PubChem | Approved | IMPDH2 |
| Lapatinib | PubChem | Approved | IMPDH2 |
| Nadide | PubChem | Approved | IMPDH1 |
| Pazopanib | PubChem | Approved | IMPDH2 |
| regorafenib | PubChem | Approved | IMPDH2 |
| Ribavirin | PubChem | Approved | IMPDH1 |
| Selumetinib | PubChem | Approved | IMPDH2 |
| Sorafenib | PubChem | Approved | IMPDH2 |
| Thioguanine | PubChem | Approved | IMPDH1 |
| Tirbanibulin | PubChem | Approved | IMPDH2 |
| Trametinib | PubChem | Approved | IMPDH2 |
| Vorinostat | PubChem | Approved | IMPDH1 |
Related Atlas pages
- Genes: IMPDH1, IMPDH2
- Diseases: IgA glomerulonephritis, nephrotic syndrome, pemphigus vulgaris, hepatitis C virus infection, myasthenia gravis, graft versus host disease, cardiovascular disorder, uveitis, hepatocellular carcinoma, Hodgkins lymphoma, myelodysplastic syndrome, acute lymphoblastic leukemia, acute myeloid leukemia, chronic myeloid leukemia, diffuse large B-cell lymphoma, leukemia, neoplasm, plasma cell myeloma, kidney disorder, heart disorder, focal segmental glomerulosclerosis, interstitial lung disease, membranous glomerulonephritis, anti-neutrophil antibody associated vasculitis, granulomatosis with polyangiitis, lupus nephritis, non-Hodgkin lymphoma, autoimmune thrombocytopenic purpura, cauda equina syndrome, microscopic polyangiitis, Takayasu arteritis, Waldenstrom macroglobulinemia, mantle cell lymphoma, kidney failure, pure red-cell aplasia, diabetic kidney disease, neuromyelitis optica, interstitial cystitis, type 1 diabetes mellitus, systemic lupus erythematosus, chronic kidney disease
- Drugs: Mycophenolic Acid, Adenosine, Afatinib, Binimetinib, Cobimetinib, Crizotinib, dacomitinib, Erlotinib, Fedratinib, Fostamatinib, Gefitinib, Idelalisib, Lapatinib, Pazopanib, regorafenib, Ribavirin, Selumetinib, Sorafenib, Thioguanine, Tirbanibulin, Trametinib, Vorinostat