Nadolol
drugOn this page
Also known as CorgardNadolol component of corzideNSC-758430SolgolSQ 11725SQ-11725SID56463045SID855594SID56422422SID144204197SID170464945C0165015
Summary
Nadolol (CHEMBL521606) is an approved small molecule (ATC C07AA12) targeting ADRB1, ADRB2, and ADRB3; indicated across 8 conditions including cardiovascular disorder and hypertensive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C07AA12
- Targets: 3 (ADRB1, ADRB2, ADRB3)
- Indications: 8 conditions
- Clinical trials: 13
- Chemistry: 309.4 Da · C17H27NO4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL521606 |
| Name | Nadolol |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4411 |
| ATC | C07AA12 |
| Molecular formula | C17H27NO4 |
| Molecular weight | 309.4 |
| InChIKey | VWPOSFSPZNDTMJ-UHFFFAOYSA-N |
SMILES: CC(C)(C)NCC(COC1=CC=CC2=C1CC(C(C2)O)O)O
IUPAC name: 5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol
Also known as: Corgard, Nadolol, Nadolol component of corzide, NSC-758430, Solgol, SQ 11725, SQ-11725, nadolol, SID56463045, SID855594, NADOLOL, SID56422422
Patent coverage: 38 distinct patent families (74 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRB1 | β1-adrenoceptor | Antagonist | 6.9 | 0% | P08588 |
| ADRB2 | β2-adrenoceptor | Antagonist | 8.6 | 0.4% | P07550 |
| ADRB3 | β3-adrenoceptor | Antagonist | 6.3 | 0.1% | P13945 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: ATP-dependent DNA helicase Q1, Beta-2 adrenergic receptor, Beta-1 adrenergic receptor, Alpha-1A adrenergic receptor.
Bioactivity
ChEMBL activities: 6 potent at pChembl ≥ 5 of 6 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRB2 | 8.89 | Kd | 1.3 | nM | CHEMBL_ACT_19403979 |
| ADRB2 | 7.75 | AC50 | 18 | nM | CHEMBL_ACT_25123283 |
| ADRB2 | 7.16 | Kd | 70 | nM | CHEMBL_ACT_19403968 |
| ADRB1 | 6.99 | AC50 | 102 | nM | CHEMBL_ACT_25122274 |
| RECQL | 6.9 | Potency | 125.9 | nM | CHEMBL_ACT_3674560 |
| ADRA1A | 5.11 | AC50 | 7700 | nM | CHEMBL_ACT_25218439 |
Target pathways
Aggregated over 3 target gene(s): ADRB1, ADRB2, ADRB3.
Top Reactome pathways
16 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 3 | ADRB1, ADRB2, ADRB3 |
| Signaling by GPCR | 3 | ADRB1, ADRB2, ADRB3 |
| Class A/1 (Rhodopsin-like receptors) | 3 | ADRB1, ADRB2, ADRB3 |
| Amine ligand-binding receptors | 3 | ADRB1, ADRB2, ADRB3 |
| GPCR downstream signalling | 3 | ADRB1, ADRB2, ADRB3 |
| Adrenoceptors | 3 | ADRB1, ADRB2, ADRB3 |
| G alpha (s) signalling events | 3 | ADRB1, ADRB2, ADRB3 |
| GPCR ligand binding | 3 | ADRB1, ADRB2, ADRB3 |
| Membrane Trafficking | 1 | ADRB2 |
| Metabolism of proteins | 1 | ADRB2 |
| Vesicle-mediated transport | 1 | ADRB2 |
| Deubiquitination | 1 | ADRB2 |
| Ub-specific processing proteases | 1 | ADRB2 |
| Post-translational protein modification | 1 | ADRB2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | ADRB2 |
| Clathrin-mediated endocytosis | 1 | ADRB2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| diet induced thermogenesis | 3 |
| norepinephrine-epinephrine-mediated vasodilation involved in regulation of systemic arterial blood pressure | 3 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 3 |
| response to cold | 3 |
| heat generation | 3 |
| negative regulation of multicellular organism growth | 3 |
| positive regulation of MAPK cascade | 3 |
| brown fat cell differentiation | 3 |
| adenylate cyclase-activating adrenergic receptor signaling pathway | 3 |
| positive regulation of cold-induced thermogenesis | 3 |
| signal transduction | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| positive regulation of cardiac muscle cell apoptotic process | 2 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 2 |
| negative regulation of smooth muscle contraction | 2 |
Indications & clinical
Indications
8 indications (5 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| hypertensive disorder | 4 | MONDO:0005044 | EFO:0000537 |
| myocardial infarction | 4 | MONDO:0005068 | EFO:0000612 |
| stroke disorder | 4 | MONDO:0005098 | EFO:0000712 |
| hemangioma | 3 | MONDO:0006500 | EFO:1000635 |
| asthma | 2 | MONDO:0004979 | MONDO:0004979 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 13.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 4 |
| PHASE2 | 3 |
| PHASE1 | 3 |
| PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00450164 | PHASE4 | COMPLETED | Secondary Prophylaxis After Variceal Bleeding in Non-Responders |
| NCT00567216 | PHASE4 | UNKNOWN | Endoscopic Cyanoacrylate Obliteration vs. Nadolol Treatment in the Prevention of Gastric Variceal Rebleeding |
| NCT00921349 | PHASE4 | COMPLETED | A Trial of Ligation Plus Nadolol Versus Nadolol Alone in the Prophylaxis of First Variceal Bleeding in Cirrhosis |
| NCT01103154 | PHASE4 | COMPLETED | A Trial of Nadolol Plus Isosorbide Mononitrate Versus Carvedilol for the Prevention of Variceal Rebleeding |
| NCT02505971 | PHASE3 | COMPLETED | Nadolol Versus Propranolol in Children With Infantile Hemangiomas |
| NCT00670267 | PHASE1/PHASE2 | COMPLETED | Oral Nadolol for the Treatment of Adults With Mild Asthma |
| NCT01010308 | PHASE2 | COMPLETED | Nadolol for Proliferating Infantile Hemangiomas |
| NCT01804218 | PHASE2 | UNKNOWN | Efficacy and Safety of Beta-adrenoceptor Inverse Agonist, Nadolol, in Mild Asthma |
| NCT01825122 | PHASE2 | COMPLETED | Efficacy and Safety of Βeta-adrenoceptor Inverse Agonist and Biased Ligand, Nadolol, In Smoking Cessation of Patients With Chronic Cough With or Without Airflow Obstruction |
| NCT00647660 | PHASE1 | COMPLETED | Fasting Study of Nadolol/Bendroflumethiazide Tablets 80 mg/5 mg and Corzide® Tablets 80 mg/5 mg |
| NCT00648297 | PHASE1 | COMPLETED | Fed Study of Nadolol/Bendroflumethiazide Tablets 80 mg/5 mg and Corzide® Tablets 80 mg/5 mg |
| NCT00960245 | PHASE1 | COMPLETED | Relative Bioavailability Study of Nadolol (1 x 80 mg) Tablets Under Fasting Conditions |
| NCT06643221 | EARLY_PHASE1 | RECRUITING | Exercise as an Immune Adjuvant for Allogeneic Cell Therapies |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
280 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Crizotinib | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| Desloratadine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| Pramipexole | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| BISOPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| EPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| FENOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| FORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| LABETALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| LEVOBUNOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| NOREPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PHENYLEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PINDOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PRACTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PROPAFENONE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| SOTALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| TIMOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| ALPRENOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| BOPINDOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| CIMATEROL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| FLESTOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| LEVISOPRENALINE | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| LEVOPROPRANOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| MILVETEROL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| RAFABEGRON | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| SOLABEGRON | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| TRETOQUINOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| XAMOTEROL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| ZENIDOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| Alogliptin | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Bosentan | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Fidaxomicin | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Glycopyrrolate | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Linagliptin | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Methotrexate | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Propoxyphene | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Pyrazinamide | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Tiotropium Bromide Monohydrate | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| ACEBUTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ALBUTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB3 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
Related Atlas pages
- Genes: ADRB1, ADRB2, ADRB3
- Diseases: cardiovascular disorder, hypertensive disorder, myocardial infarction, stroke disorder, hemangioma
- Drugs: Crizotinib, Desloratadine, Dihydroergotamine, Pramipexole, Rifampin, Tegaserod, Aripiprazole, Bisoprolol, Bromocriptine, Carvedilol, Clotrimazole, Epinephrine, Fenoterol, Formoterol, Isoproterenol, Labetalol, Levobunolol, Montelukast, Norepinephrine, Phenylephrine, Pimozide, Pindolol, Practolol, Propafenone, Propranolol, Salmeterol, Sotalol, Tamoxifen, Thioridazine, Timolol, Alogliptin, Bosentan, Fidaxomicin, Glycopyrrolate, Linagliptin, Methotrexate, Propoxyphene, Pyrazinamide, Clozapine, Olanzapine, Olodaterol, Tamsulosin, Acebutolol, Albuterol, Amiodarone, Amitriptyline, Amlodipine