Nafamostat
drugOn this page
Also known as SID26754619SID29216079SID89650190nafomostat
Summary
Nafamostat (CHEMBL273264) is a phase-3 clinical-stage small molecule targeting C1R, PRSS1, and TMPRSS2; indicated across 2 conditions including acute kidney injury and severe acute respiratory syndrome.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 8 (C1R, PRSS1, TMPRSS2…)
- Indications: 2 conditions
- Clinical trials: 2
- Chemistry: 347.4 Da · C19H17N5O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL273264 |
| Name | Nafamostat |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 4413 |
| Molecular formula | C19H17N5O2 |
| Molecular weight | 347.4 |
| InChIKey | MQQNFDZXWVTQEH-UHFFFAOYSA-N |
SMILES: C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N)N=C(N)N
IUPAC name: (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate
Also known as: Nafamostat, SID26754619, SID29216079, SID89650190, nafamostat, nafomostat, NAFAMOSTAT
Parent form; salt/anhydrous children: CHEMBL1091841, CHEMBL3989553
Patent coverage: 2,407 distinct patent families (7,063 SureChEMBL compound mentions), from 6 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| C1R | complement C1r | Inhibition | 4.92 | 0% | P00736 |
| PRSS1 | serine protease 1 | Inhibition | 7.77 | 0.2% | P07477 |
| TMPRSS2 | transmembrane serine protease 2 | Inhibition | 7 | 0.1% | O15393 |
| TPSAB1 | tryptase alpha/beta 1 | Inhibition | 10 | 3.1% | Q15661 |
| TRPM7 | TRPM7 | Inhibition | 3.21 | 62.2% | Q96QT4 |
| ASIC1 | ASIC1 | 4.9 | 2.6% | P78348 | |
| ASIC2 | ASIC2 | 4.2 | 0.1% | Q16515 | |
| ASIC3 | ASIC3 | 5.6 | 0% | Q9UHC3 |
Broader ChEMBL bioactivity targets: 40 (assay-derived). Sample: Microtubule-associated protein tau, Prelamin-A/C, Transmembrane protease serine 2, Plasminogen, 5-hydroxytryptamine receptor 2B, 5-hydroxytryptamine receptor 3A, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, Amine oxidase [flavin-containing] A, Prothrombin.
Bioactivity
ChEMBL activities: 37 potent at pChembl ≥ 5 of 61 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ST14 | 10.7 | Ki | 0.02 | nM | CHEMBL_ACT_15098312 |
| ST14 | 10.7 | Ki | 0.02 | nM | CHEMBL_ACT_15176549 |
| TMPRSS2 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_25848520 |
| HPN | 9.28 | Ki | 0.53 | nM | CHEMBL_ACT_15098342 |
| HPN | 9.28 | Ki | 0.53 | nM | CHEMBL_ACT_15176510 |
| TMPRSS2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_25847345 |
| HPN | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_18289616 |
| LMNA | 8.05 | Potency | 8.9 | nM | CHEMBL_ACT_3648985 |
| P00760 | 7.77 | IC50 | 17 | nM | CHEMBL_ACT_34203 |
| PRSS1 | 7.77 | IC50 | 17 | nM | CHEMBL_ACT_489403 |
| PRSS1 | 7.7 | IC50 | 20 | nM | CHEMBL_ACT_332928 |
| HGFAC | 7.6 | Ki | 25 | nM | CHEMBL_ACT_15098332 |
| HGFAC | 7.6 | Ki | 25 | nM | CHEMBL_ACT_15176531 |
| C1S | 7.54 | IC50 | 29 | nM | CHEMBL_ACT_18652423 |
| F12 | 6.98 | Ki | 105 | nM | CHEMBL_ACT_22793546 |
| C1S | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_332927 |
| HGFAC | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_15176544 |
| PLG | 6.62 | IC50 | 240 | nM | CHEMBL_ACT_332929 |
| P35439 | 6.54 | AC50 | 290 | nM | CHEMBL_ACT_25120223 |
| F2 | 6.54 | IC50 | 290 | nM | CHEMBL_ACT_332930 |
| PLG | 6.39 | Ki | 410 | nM | CHEMBL_ACT_19054756 |
| HGFAC | 6.31 | EC50 | 490 | nM | CHEMBL_ACT_15102839 |
| KLK1 | 6.19 | IC50 | 650 | nM | CHEMBL_ACT_332931 |
| C1R | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_18652424 |
| C1R | 6 | IC50 | 1000 | nM | CHEMBL_ACT_332923 |
| C1R | 5.98 | IC50 | 1040 | nM | CHEMBL_ACT_332926 |
| F2 | 5.72 | IC50 | 1900 | nM | CHEMBL_ACT_667294 |
| SLC6A3 | 5.55 | AC50 | 2800 | nM | CHEMBL_ACT_25123521 |
| PLG | 5.54 | IC50 | 2900 | nM | CHEMBL_ACT_667295 |
| ADRA2C | 5.5 | AC50 | 3200 | nM | CHEMBL_ACT_25147438 |
Target pathways
Aggregated over 8 target gene(s): C1R, PRSS1, TMPRSS2, TPSAB1, TRPM7, ASIC1, ASIC2, ASIC3.
Top Reactome pathways
13 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Stimuli-sensing channels | 3 | ASIC1, ASIC2, ASIC3 |
| Transport of small molecules | 3 | ASIC1, ASIC2, ASIC3 |
| Ion channel transport | 3 | ASIC1, ASIC2, ASIC3 |
| Activation of Matrix Metalloproteinases | 2 | PRSS1, TPSAB1 |
| Initial triggering of complement | 1 | C1R |
| Classical antibody-mediated complement activation | 1 | C1R |
| TRP channels | 1 | TRPM7 |
| Attachment and Entry | 1 | TMPRSS2 |
| Induction of Cell-Cell Fusion | 1 | TMPRSS2 |
| Uptake of dietary cobalamins into enterocytes | 1 | PRSS1 |
| Regulation of Complement cascade | 1 | C1R |
| Developmental Lineage of Pancreatic Acinar Cells | 1 | PRSS1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| proteolysis | 4 |
| monoatomic ion transport | 4 |
| monoatomic ion transmembrane transport | 4 |
| sodium ion transport | 3 |
| response to acidic pH | 3 |
| sodium ion transmembrane transport | 3 |
| sensory perception of sour taste | 3 |
| monoatomic cation transport | 3 |
| establishment of localization in cell | 3 |
| extracellular matrix disassembly | 2 |
| calcium ion transport | 2 |
| calcium ion transmembrane transport | 2 |
| regulation of membrane potential | 2 |
| regulation of postsynapse assembly | 2 |
| detection of mechanical stimulus involved in sensory perception | 2 |
Indications & clinical
Indications
2 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| acute kidney injury | 3 | MONDO:0002492 | HP:0001919 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01001403 | PHASE4 | COMPLETED | Effect of Nafamostat on Postreperfusion Syndrome (PRS) |
| NCT06676085 | Not specified | RECRUITING | A Novel Strategy of ECMO Management Using Nafamostat for Regional Combined With Low Intensity Systematic Anticoagulation |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
27 molecules share ≥1 primary target. Top 27 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Amiloride | ChEMBL + PubChem | Phase 4 (approved) | ASIC1, ASIC3 |
| CAMOSTAT | ChEMBL | Phase 3 | PRSS1, TMPRSS2 |
| OTAMIXABAN | ChEMBL | Phase 3 | PRSS1, TMPRSS2 |
| PENTAMIDINE | ChEMBL + PubChem | Phase 4 (approved) | TMPRSS2 |
| TANNIC ACID | ChEMBL + PubChem | Phase 4 (approved) | TMPRSS2 |
| ARGATROBAN | ChEMBL | Phase 4 (approved) | PRSS1 |
| BEROTRALSTAT | ChEMBL | Phase 4 (approved) | PRSS1 |
| DEBRISOQUIN | ChEMBL | Phase 4 (approved) | TMPRSS2 |
| MELAGATRAN | ChEMBL | Phase 4 (approved) | PRSS1 |
| SULFAGUANIDINE | ChEMBL | Phase 4 (approved) | PRSS1 |
| CAMOSTAT MESILATE | ChEMBL | Phase 3 | PRSS1 |
| DABIGATRAN | ChEMBL | Phase 3 | PRSS1 |
| GABEXATE | ChEMBL | Phase 3 | TMPRSS2 |
| MILVEXIAN | ChEMBL | Phase 3 | PRSS1 |
| PROPAMIDINE | ChEMBL | Phase 3 | TMPRSS2 |
| QUERCETIN | ChEMBL | Phase 3 | PRSS1 |
| RUTIN | ChEMBL | Phase 3 | PRSS1 |
| SILIBININ | ChEMBL | Phase 3 | PRSS1 |
| BAICALEIN | ChEMBL | Phase 2 | PRSS1 |
| DIMINAZENE | ChEMBL | Phase 2 | TMPRSS2 |
| EFEGATRAN | ChEMBL | Phase 2 | PRSS1 |
| SEPIMOSTAT | ChEMBL | Phase 2 | PRSS1 |
| Apixaban | PubChem | Approved | PRSS1 |
| arginine | PubChem | Approved | TPSAB1 |
| Aspirin | PubChem | Approved | ASIC3 |
| Bromhexine | PubChem | Approved | TMPRSS2 |
| Carfilzomib | PubChem | Approved | PRSS1 |
Related Atlas pages
- Genes: C1R, PRSS1, TMPRSS2, TPSAB1, TRPM7, ASIC1, ASIC2, ASIC3
- Diseases: acute kidney injury, severe acute respiratory syndrome
- Drugs: Amiloride, Camostat, Otamixaban, Pentamidine, Tannic Acid, Argatroban, Berotralstat, Debrisoquin, Melagatran, Sulfaguanidine, Dabigatran, Gabexate, Milvexian, Propamidine, Quercetin, Rutin, Silibinin, Apixaban, arginine, Aspirin, Bromhexine, Carfilzomib