Nalfurafine
drugOn this page
Also known as MT-9938NalfurafinaNANalfurafine (hydrochloride)
Summary
Nalfurafine (CHEMBL267495) is an approved small molecule (ATC V03AX02) targeting OPRK1.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: V03AX02
- Targets: 1 (OPRK1)
- Clinical trials: 6
- Chemistry: 476.6 Da · C28H32N2O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL267495 |
| Name | Nalfurafine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 6445230 |
| ATC | V03AX02 |
| Molecular formula | C28H32N2O5 |
| Molecular weight | 476.6 |
| InChIKey | XGZZHZMWIXFATA-UEZBDDGYSA-N |
SMILES: CN([C@@H]1CC[C@]2([C@H]3CC4=C5[C@]2([C@H]1OC5=C(C=C4)O)CCN3CC6CC6)O)C(=O)/C=C/C7=COC=C7
IUPAC name: (E)-N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)-N-methylprop-2-enamide
Also known as: MT-9938, Nalfurafina, Nalfurafine, nalfurafine, NALFURAFINE, NA, Nalfurafine (hydrochloride)
Parent form; salt/anhydrous children: CHEMBL490665
Patent coverage: 157 distinct patent families (310 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 225 (73%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| OPRK1 | κ receptor | Full agonist | 10.1 | 0% | P41145 |
Broader ChEMBL bioactivity targets: 14 (assay-derived). Sample: MAP kinase p38, Mu-type opioid receptor, Delta-type opioid receptor, Kappa-type opioid receptor, Delta-type opioid receptor, Mu-type opioid receptor, Delta-type opioid receptor, Mitogen-activated protein kinase 3, Kappa-type opioid receptor, Kappa-type opioid receptor.
Bioactivity
ChEMBL activities: 31 potent at pChembl ≥ 5 of 31 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| OPRK1 | 10.72 | Ki | 0.02 | nM | CHEMBL_ACT_24795898 |
| OPRK1 | 10.6 | EC50 | 0.03 | nM | CHEMBL_ACT_2085890 |
| OPRK1 | 10.47 | EC50 | 0.03 | nM | CHEMBL_ACT_15763080 |
| P33534 | 10.44 | IC50 | 0.04 | nM | CHEMBL_ACT_25611603 |
| OPRK1 | 10.3 | EC50 | 0.05 | nM | CHEMBL_ACT_15139366 |
| P41144 | 9.77 | Ki | 0.17 | nM | CHEMBL_ACT_15763036 |
| P41144 | 9.74 | Ki | 0.18 | nM | CHEMBL_ACT_15139342 |
| P41144 | 9.65 | Ki | 0.23 | nM | CHEMBL_ACT_3412720 |
| P41144 | 9.65 | Ki | 0.23 | nM | CHEMBL_ACT_5234097 |
| OPRK1 | 9.64 | Ki | 0.23 | nM | CHEMBL_ACT_10857905 |
| OPRK1 | 9.64 | Ki | 0.23 | nM | CHEMBL_ACT_13318933 |
| P33533 | 9.43 | Ki | 0.37 | nM | CHEMBL_ACT_15763059 |
| P97266 | 9.41 | Ki | 0.39 | nM | CHEMBL_ACT_15763047 |
| P42866 | 9.37 | Ki | 0.43 | nM | CHEMBL_ACT_15139327 |
| P34975 | 9.3 | EC50 | 0.5 | nM | CHEMBL_ACT_19114954 |
| MAPK1 | 9.26 | EC50 | 0.55 | nM | CHEMBL_ACT_19281589 |
| MAPK3 | 9.26 | EC50 | 0.55 | nM | CHEMBL_ACT_19281590 |
| P97266 | 9.23 | Ki | 0.58 | nM | CHEMBL_ACT_3412730 |
| P97266 | 9.23 | Ki | 0.58 | nM | CHEMBL_ACT_5234126 |
| OPRM1 | 9.15 | Ki | 0.7 | nM | CHEMBL_ACT_24795892 |
| OPRM1 | 9.14 | EC50 | 0.72 | nM | CHEMBL_ACT_15139360 |
| OPRK1 | 8.85 | EC50 | 1.4 | nM | CHEMBL_ACT_19114956 |
| P34975 | 8.28 | EC50 | 5.2 | nM | CHEMBL_ACT_19114950 |
| MAPK13 | 8.28 | EC50 | 5.2 | nM | CHEMBL_ACT_19281588 |
| OPRD1 | 7.44 | Ki | 36.5 | nM | CHEMBL_ACT_24795904 |
| P32300 | 7.29 | Ki | 51.3 | nM | CHEMBL_ACT_15139316 |
| OPRD1 | 7.13 | EC50 | 74.1 | nM | CHEMBL_ACT_15139363 |
| HCRTR1 | 7.08 | IC50 | 82.8 | nM | CHEMBL_ACT_27725333 |
| OPRK1 | 6.96 | EC50 | 110 | nM | CHEMBL_ACT_19114952 |
| OPRK1 | 6.77 | Ki | 170 | nM | CHEMBL_ACT_15763024 |
Target pathways
Aggregated over 1 target gene(s): OPRK1.
Top Reactome pathways
3 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Peptide ligand-binding receptors | 1 | OPRK1 |
| G alpha (i) signalling events | 1 | OPRK1 |
| MECP2 regulates neuronal receptors and channels | 1 | OPRK1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| immune response | 1 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| neuropeptide signaling pathway | 1 |
| chemical synaptic transmission | 1 |
| sensory perception | 1 |
| locomotory behavior | 1 |
| sensory perception of pain | 1 |
| adenylate cyclase-inhibiting opioid receptor signaling pathway | 1 |
| response to insulin | 1 |
| positive regulation of dopamine secretion | 1 |
| negative regulation of luteinizing hormone secretion | 1 |
| response to nicotine | 1 |
| G protein-coupled opioid receptor signaling pathway | 1 |
| maternal behavior | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 6.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE2 | 2 |
| PHASE4 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07380113 | PHASE4 | NOT_YET_RECRUITING | Anrikefon vs Nalfurafine for Sleep Quality in Hemodialysis Patients With CKD-aP |
| NCT00793156 | PHASE3 | UNKNOWN | A Randomized-Withdrawal Phase 3 Study Evaluating the Safety and Efficacy of Oral Nalfurafine HCl (AC-820)in Subjects on Hemodialysis With Uremic Pruritus (Renal Itch) |
| NCT01513161 | PHASE3 | COMPLETED | Efficacy and Safety Study of TRK-820 to Treat Conventional-treatment-resistant Pruritus in Patients Receiving Hemodialysis |
| NCT00638495 | PHASE2 | COMPLETED | Phase II Study of TRK-820 Soft Capsules - Intractable Pruritus in Patients With Chronic Liver Disease - |
| NCT01660243 | PHASE2 | TERMINATED | Efficacy and Safety of MT-9938 for Treatment of Uremic Pruritus in Subjects With End-stage Renal Disease Receiving Hemodialysis |
| NCT07478133 | Not specified | COMPLETED | Bioequivalence Study of Nalfurafine Hydrochloride Orally Disintegrating Tablets on Fasting and Fed in Humans |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
347 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | OPRK1 |
| ALOGLIPTIN | ChEMBL + PubChem | Phase 4 (approved) | OPRK1 |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | OPRK1 |
| ACRIVASTINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| ALMITRINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| ALPIDEM | ChEMBL | Phase 4 (approved) | OPRK1 |
| ALPRAZOLAM | ChEMBL | Phase 4 (approved) | OPRK1 |
| ALVIMOPAN | ChEMBL | Phase 4 (approved) | OPRK1 |
| AMBENONIUM | ChEMBL | Phase 4 (approved) | OPRK1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | OPRK1 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| AMSACRINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | OPRK1 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | OPRK1 |
| ATAZANAVIR | ChEMBL | Phase 4 (approved) | OPRK1 |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| ATRACURIUM | ChEMBL | Phase 4 (approved) | OPRK1 |
| AZATADINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BACAMPICILLIN | ChEMBL | Phase 4 (approved) | OPRK1 |
| BECLOBRATE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| BENZNIDAZOLE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | OPRK1 |
| BIFONAZOLE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BISACODYL | ChEMBL | Phase 4 (approved) | OPRK1 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | OPRK1 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| BUCLIZINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BUFLOMEDIL | ChEMBL | Phase 4 (approved) | OPRK1 |
| BUPRENORPHINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BUPROPION | ChEMBL | Phase 4 (approved) | OPRK1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | OPRK1 |
| BUTORPHANOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CANRENONE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CARTEOLOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CHLOPHEDIANOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CHLORDIAZEPOXIDE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CHLOROXINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CILOSTAZOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CINACALCET | ChEMBL | Phase 4 (approved) | OPRK1 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CLIOQUINOL | ChEMBL | Phase 4 (approved) | OPRK1 |
| CLOBAZAM | ChEMBL | Phase 4 (approved) | OPRK1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | OPRK1 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | OPRK1 |
Related Atlas pages
- Genes: OPRK1
- Drugs: Aclidinium Bromide, Alogliptin, Propoxyphene, Acrivastine, Almitrine, Alpidem, Alprazolam, Alvimopan, Ambenonium, Amiodarone, Amitriptyline, Amlodipine, Amoxapine, Amsacrine, Apomorphine, Aripiprazole, Astemizole, Atazanavir, Atomoxetine, Atracurium, Azatadine, Bacampicillin, Beclobrate, Benperidol, Benznidazole, Benzphetamine, Benztropine, Bepridil, Bifonazole, Bisacodyl, Bosutinib, Bromocriptine, Bromperidol, Buclizine, Buflomedil, Buprenorphine, Bupropion, Butoconazole, Butorphanol, Calcitriol, Candesartan Cilexetil, Cannabidiol, Canrenone, Carteolol, Carvedilol, Chlophedianol, Chlordiazepoxide, Chlorhexidine, Chloroxine, Chlorpromazine, Ciclesonide, Cilostazol, Cinacalcet, Cinnarizine, Cisapride, Clemastine, Clioquinol, Clobazam, Clofazimine, Clomipramine