Naltrexone
drugOn this page
Also known as CelupanEN-1639A FREE BASEEN-1639A [AS HYDROCHLORIDE]NaltrexonaNSC-758439TrexalVivitrolSID170465207SID144205560NA(+)-Naltrexone
Summary
Naltrexone (CHEMBL19019) is an approved small-molecule μ-opioid receptor antagonist (ATC N07BB04) targeting OPRD1, OPRK1, and OPRM1; indicated across 53 conditions including alcohol abuse and pathological gambling.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N07BB04
- Targets: 3 (OPRD1, OPRK1, OPRM1)
- Indications: 53 conditions
- Clinical trials: 280
- Chemistry: 341.4 Da · C20H23NO4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL19019 |
| Name | Naltrexone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5360515 |
| ChEBI | CHEBI:7465 |
| ATC | N07BB04 |
| Molecular formula | C20H23NO4 |
| Molecular weight | 341.4 |
| InChIKey | DQCKKXVULJGBQN-XFWGSAIBSA-N |
SMILES: C1CC1CN2CC[C@]34[C@@H]5C(=O)CC[C@]3([C@H]2CC6=C4C(=C(C=C6)O)O5)O
IUPAC name: (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one
ChEBI definition: An organic heteropentacyclic compound that is naloxone substituted in which the allyl group attached to the nitrogen is replaced by a cyclopropylmethyl group. A μ-opioid receptor antagonist, it is used to treat alcohol dependence.
Pharmacological roles (ChEBI): μ-opioid receptor antagonist, central nervous system depressant, antidote to opioid poisoning.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: Celupan, EN-1639A FREE BASE, EN-1639A [AS HYDROCHLORIDE], Naltrexona, Naltrexone, NSC-758439, Trexal, Vivitrol, naltrexone, NALTREXONE, SID170465207, SID144205560
Parent form; salt/anhydrous children: CHEMBL1201149, CHEMBL4303313
Patent coverage: 8,926 distinct patent families (34,647 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 34,257 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| OPRD1 | δ receptor | Antagonist | 8 | 0.2% | P41143 |
| OPRK1 | κ receptor | Antagonist | 9.4 | 0% | P41145 |
| OPRM1 | μ receptor | Antagonist | 9.7 | 0% | P35372 |
Broader ChEMBL bioactivity targets: 20 (assay-derived). Sample: Opioid receptor, Opioid receptors; mu & delta, Opioid receptors; delta & kappa, Opioid receptors; mu & kappa, Opioid receptors; mu/kappa/delta, Opioid receptors; mu and delta, Mu-type opioid receptor, Delta-type opioid receptor, Kappa-type opioid receptor, Neuronal acetylcholine receptor subunit alpha-7.
Bioactivity
ChEMBL activities: 304 potent at pChembl ≥ 5 of 307 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| OPRM1 | 10.7 | Ki | 0.02 | nM | CHEMBL_ACT_642017 |
| OPRD1 | 10.4 | Ki | 0.04 | nM | CHEMBL_ACT_642016 |
| OPRK1 | 10.38 | Ki | 0.04 | nM | CHEMBL_ACT_3070137 |
| OPRM1 | 10.3 | Kd | 0.05 | nM | CHEMBL_ACT_2115991 |
| OPRM1 | 10.15 | Ki | 0.07 | nM | CHEMBL_ACT_6262900 |
| OPRM1 | 9.96 | Ki | 0.11 | nM | CHEMBL_ACT_1519220 |
| OPRM1 | 9.96 | Ki | 0.11 | nM | CHEMBL_ACT_2263763 |
| OPRM1 | 9.96 | Ki | 0.11 | nM | CHEMBL_ACT_2407516 |
| P42866 | 9.8 | EC50 | 0.16 | nM | CHEMBL_ACT_13417668 |
| P42866 | 9.8 | EC50 | 0.16 | nM | CHEMBL_ACT_15172128 |
| OPRM1 | 9.8 | Ki | 0.16 | nM | CHEMBL_ACT_19291436 |
| OPRM1 | 9.8 | EC50 | 0.16 | nM | CHEMBL_ACT_25943333 |
| P97266 | 9.77 | Ki | 0.17 | nM | CHEMBL_ACT_152201 |
| P97266 | 9.77 | Ki | 0.17 | nM | CHEMBL_ACT_399760 |
| OPRK1 | 9.72 | Ki | 0.19 | nM | CHEMBL_ACT_1519222 |
| OPRK1 | 9.72 | Ki | 0.19 | nM | CHEMBL_ACT_2263765 |
| OPRK1 | 9.72 | Ki | 0.19 | nM | CHEMBL_ACT_2407479 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_1470060 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_14997950 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_16427814 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_1759534 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_1774660 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_1928210 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_2606064 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_501822 |
| OPRM1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_642015 |
| P97266 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_769193 |
| OPRM1 | 9.64 | Ki | 0.23 | nM | CHEMBL_ACT_1859779 |
| P97266 | 9.64 | IC50 | 0.23 | nM | CHEMBL_ACT_354430 |
| OPRK1 | 9.6 | Ki | 0.25 | nM | CHEMBL_ACT_1859787 |
Target pathways
Aggregated over 3 target gene(s): OPRD1, OPRK1, OPRM1.
Top Reactome pathways
6 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Peptide ligand-binding receptors | 3 | OPRD1, OPRK1, OPRM1 |
| G alpha (i) signalling events | 3 | OPRD1, OPRK1, OPRM1 |
| Interleukin-4 and Interleukin-13 signaling | 2 | OPRD1, OPRM1 |
| MECP2 regulates neuronal receptors and channels | 2 | OPRK1, OPRM1 |
| Opioid Signalling | 1 | OPRM1 |
| G-protein activation | 1 | OPRM1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 3 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 3 |
| neuropeptide signaling pathway | 3 |
| G protein-coupled opioid receptor signaling pathway | 3 |
| signal transduction | 3 |
| immune response | 2 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| response to nicotine | 2 |
| eating behavior | 2 |
| response to ethanol | 2 |
| sensory perception | 2 |
| sensory perception of pain | 2 |
| adult locomotory behavior | 1 |
| negative regulation of gene expression | 1 |
Indications & clinical
Indications
53 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| alcohol abuse | 4 | MONDO:0002046 | MONDO:0002046 |
| pathological gambling | 3 | MONDO:0011662 | EFO:0004699 |
| opiate dependence | 3 | MONDO:0005530 | EFO:0005611 |
| HIV infectious disease | 3 | MONDO:0005109 | EFO:0000764 |
| obesity disorder | 3 | MONDO:0011122 | EFO:0001073 |
| methamphetamine dependence | 3 | MONDO:0005419 | EFO:0004701 |
| heroin dependence | 3 | MONDO:0005367 | EFO:0004240 |
| nicotine dependence | 3 | MONDO:0008575 | EFO:0003768 |
| cocaine dependence | 3 | MONDO:0005186 | EFO:0002610 |
| drug dependence | 3 | MONDO:0005303 | EFO:0003890 |
| post-traumatic stress disorder | 3 | MONDO:0005146 | EFO:0001358 |
| borderline personality disorder | 3 | MONDO:0001156 | HP:0012076 |
| endometriosis | 3 | MONDO:0005133 | EFO:0001065 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| multiple sclerosis | 3 | MONDO:0005301 | MONDO:0005301 |
| Crohn disease | 2 | MONDO:0005011 | EFO:0000384 |
| obsessive-compulsive disorder | 2 | MONDO:0008114 | EFO:0004242 |
| ulcerative colitis | 2 | MONDO:0005101 | EFO:0000729 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| dry eye syndrome | 2 | MONDO:0006733 | EFO:1000906 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | EFO:0000694 |
| fibromyalgia | 2 | MONDO:0005546 | EFO:0005687 |
| acute respiratory distress syndrome | 2 | MONDO:0006502 | EFO:1000637 |
| major depressive disorder | 2 | MONDO:0002009 | MONDO:0002009 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| alcohol-related disorders | 2 | MONDO:0021698 | MONDO:0021698 |
| interstitial cystitis | 2 | MONDO:0018301 | EFO:0008507 |
| diabetic neuropathy | 2 | MONDO:0006626 | EFO:1000783 |
| migraine disorder | 2 | MONDO:0005277 | MONDO:0005277 |
| trichotillomania | 2 | MONDO:0013189 | MONDO:0013189 |
| long COVID-19 | 2 | MONDO:0100233 | MONDO:0100233 |
| atopic eczema | 1 | MONDO:0004980 | EFO:0000274 |
| psoriasis | 1 | MONDO:0005083 | EFO:0000676 |
| pervasive developmental disorder | 1 | MONDO:0000594 | MONDO:0000594 |
| mental disorder | 1 | MONDO:0005084 | EFO:0000677 |
| melanoma | 1 | MONDO:0005105 | EFO:0000756 |
| binge eating disorder | 0 | MONDO:0005582 | EFO:0005924 |
| bulimia nervosa | 0 | MONDO:0005452 | EFO:0005204 |
| anorexia nervosa | 0 | MONDO:0005351 | MONDO:0005351 |
14 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 280.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 90 |
| PHASE4 | 65 |
| PHASE3 | 32 |
| PHASE1 | 30 |
| Not specified | 27 |
| PHASE2/PHASE3 | 19 |
| PHASE1/PHASE2 | 9 |
| EARLY_PHASE1 | 8 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06426303 | PHASE4 | RECRUITING | Sex Differences in Trauma, Inflammation and Brain Function and the Implications for Treatment Efficacy in Alcohol Use Disorder |
| NCT06620562 | PHASE4 | RECRUITING | Improving Efficacity of Sleeve Gastrectomy With Naltrexone/Bupropion Extended-release Tablet |
| NCT07213466 | PHASE4 | RECRUITING | Individualized Pharmacological Approach to Obesity in Patients With Bipolar Disorder |
| NCT00000438 | PHASE4 | COMPLETED | Naltrexone Treatment for Alcoholism |
| NCT00000442 | PHASE4 | COMPLETED | Naltrexone for Relapse Prevention |
| NCT00000445 | PHASE4 | COMPLETED | Use of Naltrexone in a Clinical Setting |
| NCT00000447 | PHASE4 | COMPLETED | Behavioral/Drug Therapy for Alcohol-Nicotine Dependence (Naltrexone/Nicotine Patch) |
| NCT00000448 | PHASE4 | COMPLETED | Naltrexone Treatment for Alcoholic Women |
| NCT00000449 | PHASE4 | COMPLETED | Behavior and Naltrexone Treatment for Alcoholics |
| NCT00000450 | PHASE4 | COMPLETED | Naltrexone Maintenance Treatment of Alcoholism |
| NCT00000452 | PHASE4 | COMPLETED | Naltrexone Treatment of Alcohol Dependence |
| NCT00000455 | PHASE4 | COMPLETED | Naltrexone for Early Problem Drinkers |
| NCT00000456 | PHASE4 | COMPLETED | Behavioral Therapy Plus Naltrexone for Alcoholism |
| NCT00004554 | PHASE4 | COMPLETED | Sertraline for Alcohol Dependence and Depression |
| NCT00006203 | PHASE4 | COMPLETED | Naltrexone, Craving, and Drinking |
| NCT00006204 | PHASE4 | COMPLETED | Drug Treatment for Depressed Alcoholics (Naltrexone/Fluoxetine) |
| NCT00006449 | PHASE4 | COMPLETED | Post-Treatment Effects of Naltrexone |
| NCT00006489 | PHASE4 | COMPLETED | Treatment for Alcoholism and Post-Traumatic Stress Disorder (Naltrexone) |
| NCT00018824 | PHASE4 | COMPLETED | Treating Alcohol Use In Older Adults With Depression |
| NCT00115037 | PHASE4 | COMPLETED | Managing Alcoholism in People Who Do Not Respond to Naltrexone |
| NCT00120601 | PHASE4 | UNKNOWN | Trial for the Treatment of Alcohol Dependence |
| NCT00223275 | PHASE4 | COMPLETED | Naltrexone for Bipolar Disorder and Alcohol Dependence |
| NCT00256451 | PHASE4 | COMPLETED | Endophenotype for Alcohol Misuse in Healthy Minority Populations |
| NCT00366626 | PHASE4 | COMPLETED | Effectiveness of Naltrexone Versus Placebo to Reduce Craving for Alcohol With Evaluation of Genetic Variability. |
| NCT00369408 | PHASE4 | COMPLETED | Targeted Naltrexone for Problem Drinkers |
| NCT00453804 | PHASE4 | COMPLETED | Injectable Versus Oral Naltrexone Treatment of Alcohol Dependence In Serious Mental Illness (SMI) |
| NCT00461890 | PHASE4 | TERMINATED | Long-Acting Injectable Naltrexone Treatment of Alcohol Dependence in Primary Care vs. in Specialized Chemical Dependence Treatment: A Pilot Trial |
| NCT00511836 | PHASE4 | COMPLETED | ALK21-018: Effects of Medisorb® Naltrexone (VIVITROL®) on Alcohol Craving in Treatment-seeking, Alcohol-dependent Adults |
| NCT00568958 | PHASE4 | COMPLETED | Naltrexone for Heavy Drinking in Young Adults |
| NCT00817089 | PHASE4 | COMPLETED | Understanding Treatment Response With Naltrexone Among White Alcoholics |
| NCT00831272 | PHASE4 | COMPLETED | Pharmacogenetic Response to Naltrexone For Alcohol Dependence |
| NCT00854230 | PHASE4 | WITHDRAWN | Pharmacotherapy for HIV Infected Patients With Alcohol Problems |
| NCT00920829 | PHASE4 | COMPLETED | Genetic and Brain Mechanisms of Naltrexone’s Treatment Efficacy for Alcoholism |
| NCT01015066 | PHASE4 | WITHDRAWN | Comparison of Buprenorphine/Naloxone With Naltrexone in Opioid Dependent Adolescents |
| NCT01052831 | PHASE4 | COMPLETED | Naltrexone for Impulse Control Disorders in Parkinson’s Disease |
| NCT01155869 | PHASE4 | TERMINATED | Pilot Study of Depot NTX in Homeless Veterans |
| NCT01377168 | PHASE4 | COMPLETED | Naltrexone for Medication Compliance Among HIV-infected Men With Alcohol Use Disorder |
| NCT01453374 | PHASE4 | COMPLETED | A Study of VIVITROL in the Prevention of Re-arrest and Re-incarceration |
| NCT01471145 | PHASE4 | COMPLETED | Depot Naltrexone Mechanism of Action in Heroin Dependent Patients Using fMRI and SPECT |
| NCT01528007 | PHASE4 | COMPLETED | Treatment of Pathological Gambling With Naltrexone Pharmacotherapy and Brief Intervention |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for alfentanil, buprenorphine, codeine, f | CPIC | COMT;OPRM1 |
PharmGKB also curates 10 clinical and 52 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
612 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| TAFAMIDIS | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ALVIMOPAN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BUPRENORPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BUTORPHANOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CODEINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| FENTANYL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| HYDROCODONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| HYDROMORPHONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LANSOPRAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LEVORPHANOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MEPERIDINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| METHADONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| METHYLNALTREXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MORPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NAFTOPIDIL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALBUPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALFURAFINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALMEFENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALOXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OLICERIDINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OXYCODONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OXYMORPHONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PAROXETINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PASIREOTIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PENTAZOCINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| RITONAVIR | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| SAMIDORPHAN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| SAQUINAVIR | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| TRAMADOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ASIMADOLINE | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| ATICAPRANT | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| CEBRANOPADOL | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| NAVACAPRANT | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| TRIMEBUTINE | ChEMBL | Phase 3 | OPRD1, OPRK1, OPRM1 |
| BREMAZOCINE | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1 |
| CARFENTANIL | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1 |
Related Atlas pages
- Genes: OPRD1, OPRK1, OPRM1
- Diseases: alcohol abuse, pathological gambling, opiate dependence, HIV infectious disease, obesity disorder, methamphetamine dependence, heroin dependence, nicotine dependence, cocaine dependence, drug dependence, post-traumatic stress disorder, borderline personality disorder, endometriosis, depressive disorder, multiple sclerosis
- Drugs: Dihydroergotamine, Propoxyphene, Tafamidis, Alvimopan, Amiodarone, Amlodipine, Amoxapine, Astemizole, Benztropine, Buprenorphine, Butorphanol, Candesartan Cilexetil, Cannabidiol, Chlorpromazine, Cinnarizine, Clotrimazole, Codeine, Diethylstilbestrol, Econazole, Fentanyl, Fluphenazine, Fluspirilene, Hydrocodone, Hydromorphone, Lansoprazole, Levorphanol, Loperamide, Loxapine, Meperidine, Methadone, Methylnaltrexone, Miconazole, Morphine, Naftopidil, Nalbuphine, Nalfurafine, Nalmefene, Naloxone, Nelfinavir, Oliceridine, Oxycodone, Oxymorphone, Paroxetine, Pasireotide, Pentazocine, Pimozide, Raloxifene, Ritonavir, Samidorphan, Saquinavir, Sunitinib, Tamoxifen, Tramadol, Asimadoline, Aticaprant, Cebranopadol, Navacaprant, Trimebutine