Nandrolone
drug drugOn this page
Also known as BiobolDecaduraHybolinMenidrabolNandrolone ciiiNSC-3351nandrolonSID29215354SID85148374SID144206718SID144206750SID144208410SID170466348C0164932
Summary
Nandrolone (CHEMBL757) is a phase-3 clinical-stage small molecule targeting AR; indicated across 1 condition including aplastic anemia.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (AR)
- Indications: 1 condition
- Clinical trials: 1
- Chemistry: 274.4 Da · C18H26O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL757 |
| Name | Nandrolone |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 9904 |
| ChEBI | CHEBI:7466 |
| Molecular formula | C18H26O2 |
| Molecular weight | 274.4 |
| InChIKey | NPAGDVCDWIYMMC-IZPLOLCNSA-N |
SMILES: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@H]34
IUPAC name: (8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one
ChEBI definition: A 3-oxo Δ4-steroid that is estr-4-en-3-one substituted by a β-hydroxy group at position 17.
Other ChEBI roles (chemical / environmental): human metabolite.
Also known as: Biobol, Decadura, Hybolin, Menidrabol, Nandrolone, Nandrolone ciii, NSC-3351, nandrolon, nandrolone, SID29215354, SID85148374, SID144206718
Parent form; salt/anhydrous children: CHEMBL3337497
Patent coverage: 2,650 distinct patent families (9,485 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AR | Androgen receptor | Agonist | P10275 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: Thyroid hormone receptor beta, Corticosteroid-binding globulin, Androgen receptor, Sex hormone-binding globulin, Aldehyde dehydrogenase 1A1, Solute carrier family 22 member 1.
Bioactivity
ChEMBL activities: 4 potent at pChembl ≥ 5 of 7 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P15207 | 8.68 | Ki | 2.1 | nM | CHEMBL_ACT_7731043 |
| P15207 | 8.5 | IC50 | 3.15 | nM | CHEMBL_ACT_7731042 |
| SHBG | 6.3 | Kd | 501.2 | nM | CHEMBL_ACT_2155683 |
| SERPINA6 | 6.14 | Ki | 724.4 | nM | CHEMBL_ACT_953950 |
Target pathways
Aggregated over 1 target gene(s): AR.
Top Reactome pathways
23 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | AR |
| Signaling by Rho GTPases | 1 | AR |
| RHO GTPase Effectors | 1 | AR |
| Generic Transcription Pathway | 1 | AR |
| Cellular responses to stress | 1 | AR |
| SUMOylation | 1 | AR |
| SUMO E3 ligases SUMOylate target proteins | 1 | AR |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | AR |
| Nuclear Receptor transcription pathway | 1 | AR |
| Metabolism of proteins | 1 | AR |
| SUMOylation of intracellular receptors | 1 | AR |
| RHO GTPases activate PKNs | 1 | AR |
| Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3 | 1 | AR |
| Deubiquitination | 1 | AR |
| Ub-specific processing proteases | 1 | AR |
| Post-translational protein modification | 1 | AR |
| RNA Polymerase II Transcription | 1 | AR |
| Gene expression (Transcription) | 1 | AR |
| Transcriptional regulation by RUNX2 | 1 | AR |
| RUNX2 regulates osteoblast differentiation | 1 | AR |
| RUNX2 regulates bone development | 1 | AR |
| Cellular responses to stimuli | 1 | AR |
| Signaling by Rho GTPases, Miro GTPases and RHOBTB3 | 1 | AR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 1 |
| MAPK cascade | 1 |
| in utero embryonic development | 1 |
| regulation of systemic arterial blood pressure | 1 |
| epithelial cell morphogenesis | 1 |
| transcription by RNA polymerase II | 1 |
| signal transduction | 1 |
| cell-cell signaling | 1 |
| spermatogenesis | 1 |
| single fertilization | 1 |
| positive regulation of cell population proliferation | 1 |
| negative regulation of cell population proliferation | 1 |
| male gonad development | 1 |
| positive regulation of gene expression | 1 |
| male somatic sex determination | 1 |
Indications & clinical
Indications
1 disease in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| aplastic anemia | 3 | MONDO:0015909 | HP:0001915 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00000597 | PHASE3 | COMPLETED | Multi-Center Trial of Anti-Thymocyte Globulin in Treatment of Aplastic Anemia and Other Hematologic Disorders |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
130 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| MEGESTROL | ChEMBL + PubChem | Phase 4 (approved) | AR |
| ABIRATERONE | ChEMBL | Phase 4 (approved) | AR |
| APALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | AR |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | AR |
| BICALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| BITHIONOL | ChEMBL | Phase 4 (approved) | AR |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | AR |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | AR |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | AR |
| CLARITHROMYCIN | ChEMBL | Phase 4 (approved) | AR |
| CLASCOTERONE | ChEMBL | Phase 4 (approved) | AR |
| CLOCORTOLONE PIVALATE | ChEMBL | Phase 4 (approved) | AR |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | AR |
| CORTISONE | ChEMBL | Phase 4 (approved) | AR |
| CYCLOFENIL | ChEMBL | Phase 4 (approved) | AR |
| DAROLUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | AR |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | AR |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | AR |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | AR |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | AR |
| DORZOLAMIDE | ChEMBL | Phase 4 (approved) | AR |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | AR |
| DYDROGESTERONE | ChEMBL | Phase 4 (approved) | AR |
| ENZALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| EPLERENONE | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL CYPIONATE | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL VALERATE | ChEMBL | Phase 4 (approved) | AR |
| ESTRIOL | ChEMBL | Phase 4 (approved) | AR |
| ESTRONE | ChEMBL | Phase 4 (approved) | AR |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | AR |
| ETHYNODIOL DIACETATE | ChEMBL | Phase 4 (approved) | AR |
| ETONOGESTREL | ChEMBL | Phase 4 (approved) | AR |
| FLUMETHASONE PIVALATE | ChEMBL | Phase 4 (approved) | AR |
| FLUOCINOLONE ACETONIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUOCINONIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUOXYMESTERONE | ChEMBL | Phase 4 (approved) | AR |
| FLURANDRENOLIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | AR |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| HALCINONIDE | ChEMBL | Phase 4 (approved) | AR |
| HALOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | AR |
| HEXESTROL | ChEMBL | Phase 4 (approved) | AR |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | AR |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | AR |
| LEVONORGESTREL | ChEMBL | Phase 4 (approved) | AR |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | AR |
| METHYLPREDNISOLONE | ChEMBL | Phase 4 (approved) | AR |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | AR |
| MOMETASONE FUROATE | ChEMBL | Phase 4 (approved) | AR |
| NILUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| NOMEGESTROL | ChEMBL | Phase 4 (approved) | AR |
| NORETHINDRONE | ChEMBL | Phase 4 (approved) | AR |
| NORETHYNODREL | ChEMBL | Phase 4 (approved) | AR |
| OXANDROLONE | ChEMBL | Phase 4 (approved) | AR |
| OXICONAZOLE | ChEMBL | Phase 4 (approved) | AR |
| PRANLUKAST | ChEMBL | Phase 4 (approved) | AR |
| PRASUGREL | ChEMBL | Phase 4 (approved) | AR |
| PREDNISOLONE | ChEMBL | Phase 4 (approved) | AR |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | AR |
| PYRVINIUM | ChEMBL | Phase 4 (approved) | AR |
| RIFAPENTINE | ChEMBL | Phase 4 (approved) | AR |
| SERTACONAZOLE | ChEMBL | Phase 4 (approved) | AR |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | AR |
| STIRIPENTOL | ChEMBL | Phase 4 (approved) | AR |
| TESTOSTERONE | ChEMBL | Phase 4 (approved) | AR |
| TESTOSTERONE PROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| TRETINOIN | ChEMBL | Phase 4 (approved) | AR |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | AR |
| ULIPRISTAL | ChEMBL | Phase 4 (approved) | AR |
| ASOPRISNIL | ChEMBL | Phase 3 | AR |
| CYPROTERONE | ChEMBL | Phase 3 | AR |
| ENOBOSARM | ChEMBL | Phase 3 | AR |
| ETHISTERONE | ChEMBL | Phase 3 | AR |
| GALETERONE | ChEMBL | Phase 3 | AR |
| GESTODENE | ChEMBL | Phase 3 | AR |
| GOSSYPOL | ChEMBL | Phase 3 | AR |
| TIRATRICOL | ChEMBL | Phase 3 | AR |
| TIRILAZAD | ChEMBL | Phase 3 | AR |
| ALLYLESTRENOL | ChEMBL | Phase 2 | AR |
| BENTAZEPAM | ChEMBL | Phase 2 | AR |
| CIFENLINE | ChEMBL | Phase 2 | AR |
| CLOFOCTOL | ChEMBL | Phase 2 | AR |
| DICHLORISONE | ChEMBL | Phase 2 | AR |
| DIOXYBENZONE | ChEMBL | Phase 2 | AR |
| FLAVONE | ChEMBL | Phase 2 | AR |
| FLUMETHASONE | ChEMBL | Phase 2 | AR |
| FLUOCORTIN BUTYL | ChEMBL | Phase 2 | AR |
| GUMELUTAMIDE | ChEMBL | Phase 2 | AR |
| HALOMETASONE | ChEMBL | Phase 2 | AR |
| HYDROCORTISONE ACEPONATE | ChEMBL | Phase 2 | AR |
| HYDROXYFLUTAMIDE | ChEMBL | Phase 2 | AR |
| LONAPRISAN | ChEMBL | Phase 2 | AR |
| METRIBOLONE | ChEMBL | Phase 2 | AR |
| MK-0773 | ChEMBL | Phase 2 | AR |
Related Atlas pages
- Genes: AR
- In clinical trials for: aplastic anemia
- Drugs: Megestrol, Abiraterone, Apalutamide, Aripiprazole, Beclomethasone Dipropionate, Betamethasone, Bicalutamide, Bithionol, Bromhexine, Budesonide, Chlormadinone, Clarithromycin, Clascoterone, Clocortolone Pivalate, Clomiphene, Cortisone, Cyclofenil, Darolutamide, Desogestrel, Desoximetasone, Dexamethasone, Diethylstilbestrol, Diflorasone Diacetate, Dorzolamide, Drospirenone, Dydrogesterone, Enzalutamide, Eplerenone, Estradiol, Estradiol Cypionate, Estradiol Valerate, Estriol, Estrone, Ethinyl Estradiol, Ethynodiol Diacetate, Etonogestrel, Flumethasone Pivalate, Fluocinolone Acetonide, Fluocinonide, Fluoxymesterone, Flurandrenolide, Flutamide, Fluticasone Furoate, Fluticasone Propionate, Halcinonide, Halobetasol Propionate, Hexachlorophene, Hexestrol, Hydrocortisone, Indomethacin, Levonorgestrel, Medroxyprogesterone, Methylprednisolone, Mifepristone, Mometasone Furoate, Nilutamide, Norethindrone, Norethynodrel, Oxandrolone, Oxiconazole, Pranlukast, Prasugrel, Prednisolone, Progesterone, Pyrvinium, Rifapentine, Sertaconazole, Spironolactone, Stiripentol, Testosterone, Testosterone Propionate, Tretinoin, Troglitazone, Ulipristal, Asoprisnil, Cyproterone, Enobosarm, Ethisterone, Galeterone, Gestodene, Gossypol, Tiratricol, Tirilazad