Netarsudil
drugOn this page
Also known as AR-11324 FREE BASEAR-13324(S)-Netarsudil
Summary
Netarsudil (CHEMBL4594250) is an approved small molecule (ATC S01EX05) targeting ROCK1 and ROCK2; indicated across 5 conditions including fuchs’ endothelial dystrophy and glaucoma.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: S01EX05
- Targets: 2 (ROCK1, ROCK2)
- Indications: 5 conditions
- Clinical trials: 22
- Chemistry: 453.5 Da · C28H27N3O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4594250 |
| Name | Netarsudil |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 66599893 |
| ATC | S01EX05 |
| Molecular formula | C28H27N3O3 |
| Molecular weight | 453.5 |
| InChIKey | OURRXQUGYQRVML-AREMUKBSSA-N |
SMILES: CC1=CC(=C(C=C1)C(=O)OCC2=CC=C(C=C2)[C@@H](CN)C(=O)NC3=CC4=C(C=C3)C=NC=C4)C
IUPAC name: [4-[(2S)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate
Also known as: AR-11324 FREE BASE, AR-13324, Netarsudil, NETARSUDIL, (S)-Netarsudil
Parent form; salt/anhydrous children: CHEMBL4594251, CHEMBL4796289
Patent coverage: 425 distinct patent families (1,025 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 893 (87%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ROCK1 | Rho associated coiled-coil containing protein kinase 1 | Inhibition | 7.49 | 1.4% | Q13464 |
| ROCK2 | Rho associated coiled-coil containing protein kinase 2 | Inhibition | 7.95 | 1.1% | O75116 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: Rho-associated protein kinase 2, Rho-associated protein kinase 1.
Bioactivity
ChEMBL activities: 34 potent at pChembl ≥ 5 of 34 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ROCK1 | 9 | Ki | 1 | nM | CHEMBL_ACT_24861806 |
| ROCK2 | 9 | Ki | 1 | nM | CHEMBL_ACT_24861814 |
| ROCK1 | 9 | Ki | 1 | nM | CHEMBL_ACT_25033852 |
| ROCK2 | 9 | Ki | 1 | nM | CHEMBL_ACT_25033854 |
| ROCK1 | 9 | Ki | 1 | nM | CHEMBL_ACT_26023208 |
| ROCK2 | 9 | Ki | 1 | nM | CHEMBL_ACT_26023209 |
| ROCK2 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_25033860 |
| ROCK2 | 8.38 | Ki | 4.2 | nM | CHEMBL_ACT_22396435 |
| ROCK1 | 8.26 | IC50 | 5.5 | nM | CHEMBL_ACT_28967915 |
| ROCK2 | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_28840892 |
| ROCK2 | 7.99 | IC50 | 10.18 | nM | CHEMBL_ACT_26124623 |
| ROCK2 | 7.95 | IC50 | 11.2 | nM | CHEMBL_ACT_19072294 |
| ROCK1 | 7.88 | IC50 | 13.18 | nM | CHEMBL_ACT_26124613 |
| ROCK1 | 7.85 | IC50 | 14 | nM | CHEMBL_ACT_28840895 |
| ROCK2 | 7.82 | IC50 | 15 | nM | CHEMBL_ACT_28840880 |
| ROCK1 | 7.82 | IC50 | 15 | nM | CHEMBL_ACT_28840919 |
| ROCK2 | 7.75 | IC50 | 18 | nM | CHEMBL_ACT_28840886 |
| ROCK1 | 7.75 | IC50 | 18 | nM | CHEMBL_ACT_28840952 |
| ROCK1 | 7.72 | IC50 | 19 | nM | CHEMBL_ACT_28840925 |
| ROCK1 | 7.72 | IC50 | 19 | nM | CHEMBL_ACT_28840931 |
| ROCK1 | 7.72 | IC50 | 19 | nM | CHEMBL_ACT_28840940 |
| ROCK1 | 7.7 | IC50 | 20 | nM | CHEMBL_ACT_28840943 |
| ROCK1 | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_28840916 |
| ROCK1 | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_28840934 |
| ROCK1 | 7.64 | IC50 | 23 | nM | CHEMBL_ACT_28840907 |
| ROCK1 | 7.58 | IC50 | 26 | nM | CHEMBL_ACT_28840889 |
| ROCK1 | 7.58 | IC50 | 26 | nM | CHEMBL_ACT_28840937 |
| ROCK1 | 7.57 | IC50 | 27 | nM | CHEMBL_ACT_28840928 |
| ROCK1 | 7.49 | IC50 | 32.6 | nM | CHEMBL_ACT_19072296 |
| ROCK1 | 7.48 | IC50 | 33 | nM | CHEMBL_ACT_28840946 |
Target pathways
Aggregated over 2 target gene(s): ROCK1, ROCK2.
Top Reactome pathways
40 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Developmental Biology | 2 | ROCK1, ROCK2 |
| Signal Transduction | 2 | ROCK1, ROCK2 |
| Disease | 2 | ROCK1, ROCK2 |
| Signaling by VEGF | 2 | ROCK1, ROCK2 |
| Signaling by Rho GTPases | 2 | ROCK1, ROCK2 |
| RHO GTPase Effectors | 2 | ROCK1, ROCK2 |
| EPH-Ephrin signaling | 2 | ROCK1, ROCK2 |
| Signaling by GPCR | 2 | ROCK1, ROCK2 |
| Semaphorin interactions | 2 | ROCK1, ROCK2 |
| GPCR downstream signalling | 2 | ROCK1, ROCK2 |
| EPHB-mediated forward signaling | 2 | ROCK1, ROCK2 |
| EPHA-mediated growth cone collapse | 2 | ROCK1, ROCK2 |
| Sema4D in semaphorin signaling | 2 | ROCK1, ROCK2 |
| G alpha (12/13) signalling events | 2 | ROCK1, ROCK2 |
| Sema4D induced cell migration and growth-cone collapse | 2 | ROCK1, ROCK2 |
| Axon guidance | 2 | ROCK1, ROCK2 |
| VEGFA-VEGFR2 Pathway | 2 | ROCK1, ROCK2 |
| RHO GTPases Activate ROCKs | 2 | ROCK1, ROCK2 |
| Infectious disease | 2 | ROCK1, ROCK2 |
| RHOA GTPase cycle | 2 | ROCK1, ROCK2 |
| Signaling by Receptor Tyrosine Kinases | 2 | ROCK1, ROCK2 |
| RHO GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOB GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOC GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOH GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOBTB1 GTPase cycle | 2 | ROCK1, ROCK2 |
| Nervous system development | 2 | ROCK1, ROCK2 |
| Potential therapeutics for SARS | 2 | ROCK1, ROCK2 |
| SARS-CoV Infections | 2 | ROCK1, ROCK2 |
| RHOBTB GTPase Cycle | 2 | ROCK1, ROCK2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| mitotic cytokinesis | 2 |
| epithelial to mesenchymal transition | 2 |
| aortic valve morphogenesis | 2 |
| smooth muscle contraction | 2 |
| signal transduction | 2 |
| Rho protein signal transduction | 2 |
| positive regulation of cardiac muscle hypertrophy | 2 |
| positive regulation of gene expression | 2 |
| negative regulation of angiogenesis | 2 |
| actin cytoskeleton organization | 2 |
| regulation of cell adhesion | 2 |
| cortical actin cytoskeleton organization | 2 |
| actomyosin structure organization | 2 |
| regulation of actin cytoskeleton organization | 2 |
| positive regulation of MAPK cascade | 2 |
Indications & clinical
Indications
5 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| Fuchs’ endothelial dystrophy | 3 | MONDO:0005321 | Orphanet:98974 |
| glaucoma | 3 | MONDO:0005041 | MONDO:0005041 |
| corneal edema | 2 | MONDO:0006712 | EFO:1000879 |
| open-angle glaucoma | 0 | MONDO:0005338 | EFO:0004190 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 22.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 5 |
| PHASE4 | 4 |
| PHASE2 | 3 |
| EARLY_PHASE1 | 3 |
| Not specified | 3 |
| PHASE2/PHASE3 | 2 |
| PHASE1/PHASE2 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07325240 | PHASE4 | RECRUITING | 24-hour Effect of Rocklatan Compared With Latanoprost in Open Angle Glaucoma and Ocular Hypertension Patients |
| NCT04981886 | PHASE4 | UNKNOWN | Intraocular Pressure Reduction Efficacy of Rhopressa and Lumigan in Normal Tension Glaucoma |
| NCT05283395 | PHASE4 | COMPLETED | Rocklatan® Evaluation |
| NCT06449352 | PHASE4 | COMPLETED | Effect of Netarsudil vs Brimonidine in NTG Patients on Latanoprost |
| NCT05660447 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | A Multi-Center Study on the Use of Rho-Kinase Inhibitor to Reduce or Prevent PVR in RRD Eyes at High Risk for PVR |
| NCT02558400 | PHASE3 | COMPLETED | Double-masked Study of PG324 Ophthalmic Solution in Patients With Glaucoma or Ocular Hypertension |
| NCT02674854 | PHASE3 | COMPLETED | Double-masked Study of PG324 Ophthalmic Solution in Patients With Open-angle Glaucoma or Ocular Hypertension |
| NCT03248037 | PHASE3 | COMPLETED | Trial of Netarsudil for Prevention of Corticosteroid-induced Intraocular Pressure Elevation |
| NCT03284853 | PHASE3 | COMPLETED | Safety and Efficacy Study of PG324 (Netarsudil/Latanoprost 0.02% / 0.005%) Ophthalmic Solution Compared to GANFORT® Ophthalmic Solution in Open Angle Glaucoma or Ocular Hypertension |
| NCT03971357 | PHASE2/PHASE3 | TERMINATED | Trial of Netarsudil for Acceleration of Corneal Endothelial Restoration |
| NCT07082816 | PHASE3 | COMPLETED | Reformulated PG324 Ophthalmic Solution for Intraocular Pressure Reduction |
| NCT06033703 | PHASE1/PHASE2 | RECRUITING | Topical Netarsudil for the Prevention of Proliferative Vitreoretinopathy in Patients With Retinal Detachment |
| NCT02057575 | PHASE2 | COMPLETED | Study Assessing Safety and Efficacy of PG324 Ophthalmic Solution in Patients With Elevated Intraocular Pressure |
| NCT04498169 | PHASE2 | COMPLETED | A Phase 2 Study Evaluating the Safety and Efficacy of Netarsudil Ophthalmic Solution in Patients With Corneal Edema Due to Fuchs Corneal Dystrophy |
| NCT06441643 | PHASE2 | COMPLETED | Next Generation Rocklatan |
| NCT02406287 | PHASE1 | COMPLETED | A Controlled Study of the Aqueous Humor Dynamics of AR-13324 Ophthalmic Solution in Healthy Adult Volunteers |
| NCT04057053 | EARLY_PHASE1 | COMPLETED | Netarsudil Use After Descemetorhexis Without Endothelial Keratoplasty |
| NCT04234932 | EARLY_PHASE1 | UNKNOWN | Short-term Effect of Rho-kinase Inhibitor on Retinal Circulation |
| NCT04752020 | EARLY_PHASE1 | COMPLETED | Netarsudil Use After Descemtorhexis Without Endothelial Keratoplasty |
| NCT06960629 | Not specified | ENROLLING_BY_INVITATION | The Effect of ROCK Inhibitors on Corneas of Patients With Glaucoma and Pseudophakic Bullous Keratopathy (PBK) |
| NCT06969586 | Not specified | ENROLLING_BY_INVITATION | The Effect of Topical Rho-kinase Inhibitors on Corneas of Patients With Fuchs Endothelial Corneal Dystrophy |
| NCT04064918 | Not specified | WITHDRAWN | Effects of Netarsudil and Timolol on Retinal Blood Vessel Density and Visual Acuity |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
51 molecules share ≥1 primary target. Top 51 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BELUMOSUDIL | ChEMBL + PubChem | Phase 4 (approved) | ROCK1, ROCK2 |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ROCK1, ROCK2 |
| BARICITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| CAPIVASERTIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| TOFACITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| UPADACITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| AFURESERTIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| ALVOCIDIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| DOVITINIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| FASUDIL | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| LESTAURTINIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| LINIFANIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| RIPASUDIL | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| CENISERTIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| DECERNOTINIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| ILORASERTIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| LAUROGUADINE | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| R-406 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| RG-547 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| RIPASUDIL HYDROCHLORIDE DIHYDRATE | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| SAR-407899 FREE BASE | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| SU-014813 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| UCN-01 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| UPROSERTIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| VEROSUDIL | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| ZOTIRACICLIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| Afatinib | PubChem | Approved | ROCK1, ROCK2 |
| Binimetinib | PubChem | Approved | ROCK1, ROCK2 |
| dacomitinib | PubChem | Approved | ROCK1, ROCK2 |
| Fostamatinib | PubChem | Approved | ROCK1, ROCK2 |
| Gefitinib | PubChem | Approved | ROCK1, ROCK2 |
| Idelalisib | PubChem | Approved | ROCK1, ROCK2 |
| Pazopanib | PubChem | Approved | ROCK1, ROCK2 |
| regorafenib | PubChem | Approved | ROCK1, ROCK2 |
| Selumetinib | PubChem | Approved | ROCK1, ROCK2 |
| Trametinib | PubChem | Approved | ROCK1, ROCK2 |
| CERITINIB | ChEMBL | Phase 4 (approved) | ROCK2 |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | ROCK2 |
| VANDETANIB | ChEMBL | Phase 4 (approved) | ROCK2 |
| BMS-690514 | ChEMBL | Phase 2 | ROCK1 |
| FORETINIB | ChEMBL | Phase 2 | ROCK2 |
| PH-797804 | ChEMBL | Phase 2 | ROCK2 |
| SIMUROSERTIB | ChEMBL | Phase 2 | ROCK1 |
| VX-702 | ChEMBL | Phase 2 | ROCK1 |
| Belzutifan | PubChem | Approved | ROCK2 |
Related Atlas pages
- Genes: ROCK1, ROCK2
- Diseases: Fuchs’ endothelial dystrophy, glaucoma
- Drugs: Belumosudil, Crizotinib, Baricitinib, Bosutinib, Capivasertib, Fedratinib, Midostaurin, Momelotinib, Ruxolitinib, Sunitinib, Tofacitinib, Upadacitinib, Afuresertib, Alvocidib, Dovitinib, Fasudil, Lestaurtinib, Linifanib, Ripasudil, Afatinib, Binimetinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Pazopanib, regorafenib, Selumetinib, Trametinib, Ceritinib, Palbociclib, Vandetanib, Belzutifan