Obatoclax
drugOn this page
Summary
Obatoclax (CHEMBL408194) is a phase-3 clinical-stage small molecule targeting BCL2, BCL2L1, and MCL1; indicated across 2 conditions including acute myeloid leukemia and small cell lung carcinoma.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 3 (BCL2, BCL2L1, MCL1)
- Indications: 2 conditions
- Clinical trials: 2
- Chemistry: 317.4 Da · C20H19N3O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL408194 |
| Name | Obatoclax |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 11404337 |
| Molecular formula | C20H19N3O |
| Molecular weight | 317.4 |
| InChIKey | CVCLJVVBHYOXDC-IAZSKANUSA-N |
SMILES: CC1=CC(=C(N1)/C=C\2/C(=C/C(=C/3\C=C4C=CC=CC4=N3)/N2)OC)C
IUPAC name: (2Z)-2-[(5Z)-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole
Also known as: Obatoclax, obatoclax, OBATOCLAX
Parent form; salt/anhydrous children: CHEMBL2107358
Patent coverage: 1,130 distinct patent families (2,914 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 2,847 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| BCL2 | BCL2 apoptosis regulator | Antagonist | 5.96 | 3.3% | P10415 |
| BCL2L1 | Bcl-2-like 1 | Antagonist | 5.33 | 86.5% | Q07817 |
| MCL1 | MCL1 apoptosis regulator, BCL2 family member | Antagonist | 5.54 | 63.7% | Q07820 |
Broader ChEMBL bioactivity targets: 8 (assay-derived). Sample: Adenosine receptor A1, Bcl2-associated agonist of cell death, Induced myeloid leukemia cell differentiation protein Mcl-1, Bcl-2-like protein 1, Bcl-2-like protein 2, Apoptosis regulator Bcl-2, Bcl-2-like protein 10, Bcl-2-related protein A1.
Bioactivity
ChEMBL activities: 21 potent at pChembl ≥ 5 of 21 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| BCL2 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_29155650 |
| BCL2 | 6.52 | EC50 | 300 | nM | CHEMBL_ACT_12100874 |
| MCL1 | 6.3 | EC50 | 500 | nM | CHEMBL_ACT_12100873 |
| BCL2A1 | 6.22 | EC50 | 600 | nM | CHEMBL_ACT_12100872 |
| BCL2L1 | 6.05 | EC50 | 900 | nM | CHEMBL_ACT_12100871 |
| BAD | 6 | Ki | 1000 | nM | CHEMBL_ACT_2150678 |
| MCL1 | 6 | Ki | 1000 | nM | CHEMBL_ACT_2150679 |
| BCL2L2-PABPN1 | 6 | Ki | 1000 | nM | CHEMBL_ACT_2150680 |
| BCL2A1 | 6 | Ki | 1000 | nM | CHEMBL_ACT_2150681 |
| BCL2L10 | 6 | Ki | 1000 | nM | CHEMBL_ACT_2150682 |
| BCL2 | 5.96 | IC50 | 1110 | nM | CHEMBL_ACT_16623378 |
| BCL2 | 5.96 | IC50 | 1110 | nM | CHEMBL_ACT_18390898 |
| BCL2 | 5.96 | Ki | 1110 | nM | CHEMBL_ACT_19235572 |
| MCL1 | 5.7 | Ki | 2000 | nM | CHEMBL_ACT_19235575 |
| MCL1 | 5.54 | IC50 | 2900 | nM | CHEMBL_ACT_16623377 |
| MCL1 | 5.54 | IC50 | 2900 | nM | CHEMBL_ACT_18390904 |
| BCL2L1 | 5.33 | IC50 | 4690 | nM | CHEMBL_ACT_16623379 |
| BCL2L1 | 5.33 | IC50 | 4690 | nM | CHEMBL_ACT_18390901 |
| BCL2L1 | 5.33 | Ki | 4690 | nM | CHEMBL_ACT_19235573 |
| ADORA1 | 5.3 | Ki | 5000 | nM | CHEMBL_ACT_19235576 |
| BCL2L2-PABPN1 | 5.15 | Ki | 7010 | nM | CHEMBL_ACT_19235574 |
Target pathways
Aggregated over 3 target gene(s): BCL2, BCL2L1, MCL1.
Top Reactome pathways
47 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cytokine Signaling in Immune system | 3 | BCL2, BCL2L1, MCL1 |
| Immune System | 3 | BCL2, BCL2L1, MCL1 |
| Signaling by Interleukins | 3 | BCL2, BCL2L1, MCL1 |
| Interleukin-4 and Interleukin-13 signaling | 3 | BCL2, BCL2L1, MCL1 |
| Apoptosis | 2 | BCL2, BCL2L1 |
| Intrinsic Pathway for Apoptosis | 2 | BCL2, BCL2L1 |
| BH3-only proteins associate with and inactivate anti-apoptotic BCL-2 members | 2 | BCL2, BCL2L1 |
| Signal Transduction | 2 | BCL2, BCL2L1 |
| Disease | 2 | BCL2L1, MCL1 |
| Innate Immune System | 2 | BCL2, BCL2L1 |
| Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways | 2 | BCL2, BCL2L1 |
| Cellular responses to stress | 2 | BCL2, BCL2L1 |
| Programmed Cell Death | 2 | BCL2, BCL2L1 |
| Diseases of signal transduction by growth factor receptors and second messengers | 2 | BCL2L1, MCL1 |
| Inflammasomes | 2 | BCL2, BCL2L1 |
| The NLRP1 inflammasome | 2 | BCL2, BCL2L1 |
| Cellular responses to stimuli | 2 | BCL2, BCL2L1 |
| Cellular response to chemical stress | 2 | BCL2, BCL2L1 |
| KEAP1-NFE2L2 pathway | 2 | BCL2, BCL2L1 |
| Nuclear events mediated by NFE2L2 | 2 | BCL2, BCL2L1 |
| NFE2L2 regulating tumorigenic genes | 2 | BCL2, BCL2L1 |
| Activation of BAD and translocation to mitochondria | 1 | BCL2 |
| Activation of BH3-only proteins | 1 | BCL2 |
| Developmental Biology | 1 | BCL2 |
| Infectious disease | 1 | BCL2L1 |
| RAF/MAP kinase cascade | 1 | BCL2L1 |
| MAPK family signaling cascades | 1 | BCL2L1 |
| MAPK1/MAPK3 signaling | 1 | BCL2L1 |
| ESR-mediated signaling | 1 | BCL2 |
| Signaling by Nuclear Receptors | 1 | BCL2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| release of cytochrome c from mitochondria | 3 |
| apoptotic process | 3 |
| intrinsic apoptotic signaling pathway in response to DNA damage | 3 |
| negative regulation of autophagy | 3 |
| response to cytokine | 3 |
| positive regulation of apoptotic process | 3 |
| negative regulation of apoptotic process | 3 |
| extrinsic apoptotic signaling pathway in absence of ligand | 3 |
| negative regulation of anoikis | 3 |
| negative regulation of extrinsic apoptotic signaling pathway in absence of ligand | 3 |
| regulation of apoptotic process | 3 |
| regulation of intracellular signal transduction | 3 |
| regulation of apoptotic signaling pathway | 3 |
| ovarian follicle development | 2 |
| DNA damage response | 2 |
Indications & clinical
Indications
2 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| small cell lung carcinoma | 1 | MONDO:0008433 | EFO:0000702 |
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1/PHASE2 | 1 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00682981 | PHASE1/PHASE2 | COMPLETED | A Phase I/II Study of Carboplatin and Etoposide With or Without Obatoclax in Extensive-stage Small Cell Lung Cancer (ES-SCLC) |
| NCT00684918 | PHASE2 | COMPLETED | Study of Obatoclax in Previously Untreated Acute Myeloid Leukemia (AML) |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
19 molecules share ≥1 primary target. Top 19 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| VENETOCLAX | ChEMBL | Phase 4 (approved) | BCL2, BCL2L1, MCL1 |
| EPIGALOCATECHIN GALLATE | ChEMBL | Phase 3 | BCL2, BCL2L1, MCL1 |
| GOSSYPOL | ChEMBL | Phase 3 | BCL2, BCL2L1, MCL1 |
| NAVITOCLAX | ChEMBL | Phase 3 | BCL2, BCL2L1, MCL1 |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | BCL2L1, MCL1 |
| SONROTOCLAX | ChEMBL | Phase 3 | BCL2, BCL2L1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | MCL1 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | MCL1 |
| COUMARIN | ChEMBL | Phase 4 (approved) | MCL1 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | MCL1 |
| IXABEPILONE | ChEMBL | Phase 4 (approved) | BCL2 |
| LIOTHYRONINE | ChEMBL | Phase 4 (approved) | MCL1 |
| OMEPRAZOLE | ChEMBL | Phase 4 (approved) | MCL1 |
| PROCHLORPERAZINE | ChEMBL | Phase 4 (approved) | MCL1 |
| ASARETOCLAX | ChEMBL | Phase 2 | BCL2L1 |
| CHLORCYCLIZINE | ChEMBL | Phase 2 | BCL2 |
| FORMONONETIN | ChEMBL | Phase 2 | BCL2 |
| HYMECROMONE | ChEMBL | Phase 2 | MCL1 |
| LACUTOCLAX | ChEMBL | Phase 2 | BCL2 |