Otamixaban
drugOn this page
Also known as FXV-673Fxv673RPR-130673RPR130673XRP-0673XRP0673
Summary
Otamixaban (CHEMBL46618) is a phase-3 clinical-stage small molecule targeting F10 and TMPRSS2; indicated across 4 conditions including acute coronary syndrome and coronary artery disorder.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (F10, TMPRSS2)
- Indications: 4 conditions
- Clinical trials: 5
- Chemistry: 446.5 Da · C25H26N4O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL46618 |
| Name | Otamixaban |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 5496659 |
| Molecular formula | C25H26N4O4 |
| Molecular weight | 446.5 |
| InChIKey | PFGVNLZDWRZPJW-OPAMFIHVSA-N |
SMILES: C[C@H]([C@@H](CC1=CC(=CC=C1)C(=N)N)C(=O)OC)NC(=O)C2=CC=C(C=C2)C3=CC=[N+](C=C3)[O-]
IUPAC name: methyl (2R,3R)-2-[(3-carbamimidoylphenyl)methyl]-3-[[4-(1-oxidopyridin-1-ium-4-yl)benzoyl]amino]butanoate
Also known as: FXV-673, Fxv673, Otamixaban, RPR-130673, RPR130673, XRP-0673, XRP0673, OTAMIXABAN
Patent coverage: 222 distinct patent families (526 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 522 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| F10 | coagulation factor X | Inhibition | 9.4 | 0% | P00742 |
| TMPRSS2 | transmembrane serine protease 2 | Inhibition | 6.21 | 0.1% | O15393 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: Transmembrane protease serine 2, Serine protease 1, Coagulation factor X, Coagulation factor X.
Bioactivity
ChEMBL activities: 19 potent at pChembl ≥ 5 of 19 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| F10 | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_1117740 |
| F10 | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_3519166 |
| F10 | 9.23 | IC50 | 0.59 | nM | CHEMBL_ACT_16913730 |
| F10 | 9.21 | IC50 | 0.62 | nM | CHEMBL_ACT_16913480 |
| F10 | 9.17 | IC50 | 0.68 | nM | CHEMBL_ACT_16913790 |
| F10 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_16913563 |
| F10 | 9.13 | IC50 | 0.73 | nM | CHEMBL_ACT_16913590 |
| F10 | 9.13 | IC50 | 0.75 | nM | CHEMBL_ACT_16913959 |
| F10 | 9.11 | IC50 | 0.78 | nM | CHEMBL_ACT_16913814 |
| F10 | 9.09 | IC50 | 0.82 | nM | CHEMBL_ACT_16914052 |
| F10 | 9.07 | IC50 | 0.85 | nM | CHEMBL_ACT_16914023 |
| F10 | 9.06 | IC50 | 0.86 | nM | CHEMBL_ACT_16913862 |
| F10 | 9.03 | IC50 | 0.93 | nM | CHEMBL_ACT_16913656 |
| F10 | 9.03 | IC50 | 0.93 | nM | CHEMBL_ACT_16914099 |
| F10 | 7.77 | Kd | 16.84 | nM | CHEMBL_ACT_16914728 |
| F10 | 7.05 | Kd | 89.31 | nM | CHEMBL_ACT_16914988 |
| O19045 | 6.98 | Kd | 104.9 | nM | CHEMBL_ACT_16914541 |
| PRSS1 | 6.52 | Ki | 301 | nM | CHEMBL_ACT_1117742 |
| TMPRSS2 | 6.21 | IC50 | 620 | nM | CHEMBL_ACT_25848524 |
Target pathways
Aggregated over 2 target gene(s): F10, TMPRSS2.
Top Reactome pathways
15 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| R-HSA-140834 | 1 | F10 |
| R-HSA-140837 | 1 | F10 |
| R-HSA-140875 | 1 | F10 |
| Gamma-carboxylation of protein precursors | 1 | F10 |
| Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus | 1 | F10 |
| Removal of aminoterminal propeptides from gamma-carboxylated proteins | 1 | F10 |
| Defective factor IX causes thrombophilia | 1 | F10 |
| Defective cofactor function of FVIIIa variant | 1 | F10 |
| Defective F9 variant does not activate FX | 1 | F10 |
| Attachment and Entry | 1 | TMPRSS2 |
| Induction of Cell-Cell Fusion | 1 | TMPRSS2 |
| Initiation of coagulation cascade | 1 | F10 |
| Regulation of clotting cascade | 1 | F10 |
| Amplification and propagation of coagulation cascade | 1 | F10 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| proteolysis | 2 |
| blood coagulation | 1 |
| positive regulation of cell migration | 1 |
| positive regulation of TOR signaling | 1 |
| hemostasis | 1 |
| protein autoprocessing | 1 |
| positive regulation of viral entry into host cell | 1 |
| entry receptor-mediated virion attachment to host cell | 1 |
| viral translation | 1 |
| symbiont-mediated induction of syncytium formation | 1 |
Indications & clinical
Indications
4 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| acute coronary syndrome | 3 | MONDO:0005542 | EFO:0005672 |
| coronary artery disorder | 2 | MONDO:0005010 | EFO:0001645 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
Clinical trials
Total trials: 5.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 2 |
| PHASE1 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01076764 | PHASE3 | COMPLETED | Effect of Otamixaban Versus Unfractionated Heparin + Eptifibatide in Patients With Unstable Angina/Non ST Elevation Myocardial Infarction Undergoing Early Invasive Strategy |
| NCT00133731 | PHASE2 | COMPLETED | The SEPIA-PCI Trial: Otamixaban in Comparison to Heparin in Subjects Undergoing Non-Urgent Percutaneous Coronary Intervention |
| NCT00317395 | PHASE2 | COMPLETED | Study of Otamixaban Versus Unfractionated Heparin (UFH) and Eptifibatide in Non-ST Elevation Acute Coronary Syndrome |
| NCT01120314 | PHASE1 | COMPLETED | Pharmacokinetic, Pharmacodynamic and Tolerability Study of Otamixaban in Patients With Mild, Moderate and Severe Renal Impairment |
| NCT01126086 | PHASE1 | COMPLETED | Pharmacokinetic, Pharmacodynamic and Tolerability Study of Otamixaban in Patients With Mild and Moderate Hepatic Impairment |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
27 molecules share ≥1 primary target. Top 27 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| PENTAMIDINE | ChEMBL + PubChem | Phase 4 (approved) | F10, TMPRSS2 |
| GABEXATE | ChEMBL | Phase 3 | F10, TMPRSS2 |
| NAFAMOSTAT | ChEMBL | Phase 3 | F10, TMPRSS2 |
| APIXABAN | ChEMBL + PubChem | Phase 4 (approved) | F10 |
| EDOXABAN | ChEMBL + PubChem | Phase 4 (approved) | F10 |
| TANNIC ACID | ChEMBL + PubChem | Phase 4 (approved) | TMPRSS2 |
| ARGATROBAN | ChEMBL | Phase 4 (approved) | F10 |
| BETRIXABAN | ChEMBL | Phase 4 (approved) | F10 |
| DEBRISOQUIN | ChEMBL | Phase 4 (approved) | TMPRSS2 |
| FONDAPARINUX | ChEMBL | Phase 4 (approved) | F10 |
| MELAGATRAN | ChEMBL | Phase 4 (approved) | F10 |
| RIVAROXABAN | ChEMBL | Phase 4 (approved) | F10 |
| CAMOSTAT | ChEMBL | Phase 3 | TMPRSS2 |
| DABIGATRAN | ChEMBL | Phase 3 | F10 |
| DAREXABAN | ChEMBL | Phase 3 | F10 |
| PROPAMIDINE | ChEMBL | Phase 3 | TMPRSS2 |
| DIMINAZENE | ChEMBL | Phase 2 | TMPRSS2 |
| EFEGATRAN | ChEMBL | Phase 2 | F10 |
| ERIBAXABAN | ChEMBL | Phase 2 | F10 |
| FIDEXABAN | ChEMBL | Phase 2 | F10 |
| GW813893 | ChEMBL | Phase 2 | F10 |
| LETAXABAN | ChEMBL | Phase 2 | F10 |
| LY-517717 | ChEMBL | Phase 2 | F10 |
| RAZAXABAN | ChEMBL | Phase 2 | F10 |
| SEGATROXABAN | ChEMBL | Phase 2 | F10 |
| TANOGITRAN | ChEMBL | Phase 2 | F10 |
| Bromhexine | PubChem | Approved | TMPRSS2 |
Related Atlas pages
- Genes: F10, TMPRSS2
- Diseases: acute coronary syndrome
- Drugs: Pentamidine, Gabexate, Nafamostat, Apixaban, Edoxaban, Tannic Acid, Argatroban, Betrixaban, Debrisoquin, Fondaparinux, Melagatran, Rivaroxaban, Camostat, Dabigatran, Darexaban, Propamidine, Bromhexine