Oxaprozin
drugOn this page
Also known as CoxantoDayproNSC-310839OxaprozinaOxaprozineWY-21,743WY-21743SID11110656SID11110657SID26719634SID26747622SID4254158SID50106813SID50106814SID85230870SID90340983OxaprocinSID455291SID170464987
Summary
Oxaprozin (CHEMBL1071) is an approved small-molecule non-steroidal anti-inflammatory drug (ATC M01AE12) targeting PTGS1, PTGS2, and EPHX2; indicated across 4 conditions including rheumatic disorder and rheumatoid arthritis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M01AE12
- Targets: 3 (PTGS1, PTGS2, EPHX2)
- Indications: 4 conditions
- Clinical trials: 1
- Chemistry: 293.3 Da · C18H15NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1071 |
| Name | Oxaprozin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4614 |
| ChEBI | CHEBI:7822 |
| ATC | M01AE12 |
| Molecular formula | C18H15NO3 |
| Molecular weight | 293.3 |
| InChIKey | OFPXSFXSNFPTHF-UHFFFAOYSA-N |
SMILES: C1=CC=C(C=C1)C2=C(OC(=N2)CCC(=O)O)C3=CC=CC=C3
IUPAC name: 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid
ChEBI definition: A monocarboxylic acid that is a propionic acid derivative having a 4,5-diphenyl-1,3-oxazol-2-yl substituent at position 3. It is non-steroidal anti-inflammatory drug commonly used to relieve the pain and inflammatory responses associated with osteoarthritis and rheumatoid arthritis.
Pharmacological roles (ChEBI): non-steroidal anti-inflammatory drug, analgesic.
Also known as: Coxanto, Daypro, NSC-310839, Oxaprozin, Oxaprozina, Oxaprozine, WY-21,743, WY-21743, SID11110656, SID11110657, SID26719634, SID26747622
Parent form; salt/anhydrous children: CHEMBL1200463
Patent coverage: 13,465 distinct patent families (51,044 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PTGS1 | COX-1 | Inhibition | 5.66 | 0% | P23219 |
| PTGS2 | COX-2 | Inhibition | 4.44 | 0% | P35354 |
| EPHX2 | epoxide hydrolase 2 | Inhibition | 5.3 | 0% | P34913 |
Broader ChEMBL bioactivity targets: 33 (assay-derived). Sample: Lysine-specific demethylase 4E, Nuclear receptor subfamily 4immunitygroup A member 1, Prelamin-A/C, 4’-phosphopantetheinyl transferase ffp, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Peripheral myelin protein 22, ATP-binding cassette sub-family C member 4, Retinoic acid receptor RXR-beta, Nuclear receptor subfamily 4 group A member 3, Thyrotropin receptor.
Bioactivity
ChEMBL activities: 18 potent at pChembl ≥ 5 of 50 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR2A | 7.08 | AC50 | 83.7 | nM | CHEMBL_ACT_25173534 |
| ADRA1A | 7.03 | AC50 | 92.6 | nM | CHEMBL_ACT_25137799 |
| PTGS2 | 6.96 | IC50 | 110 | nM | CHEMBL_ACT_19307253 |
| HRH1 | 6.51 | AC50 | 310 | nM | CHEMBL_ACT_25212278 |
| LMNA | 6.45 | Potency | 354.8 | nM | CHEMBL_ACT_3665048 |
| C5 | 6.19 | Kd | 640 | nM | CHEMBL_ACT_19243010 |
| PTGS1 | 6.13 | IC50 | 740 | nM | CHEMBL_ACT_19307255 |
| DRD3 | 6.09 | AC50 | 810 | nM | CHEMBL_ACT_25193300 |
| PTGS1 | 6.07 | IC50 | 856 | nM | CHEMBL_ACT_7725365 |
| DRD2 | 5.93 | AC50 | 1180 | nM | CHEMBL_ACT_25140102 |
| SHMT2 | 5.71 | IC50 | 1950 | nM | CHEMBL_ACT_19333075 |
| PTGS1 | 5.66 | IC50 | 2200 | nM | CHEMBL_ACT_25650362 |
| CYP2C19 | 5.6 | Potency | 2512 | nM | CHEMBL_ACT_4006373 |
| CHRM1 | 5.48 | AC50 | 3300 | nM | CHEMBL_ACT_25135219 |
| MAPK1 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_4541651 |
| P15917 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_4675116 |
| HTR2C | 5.08 | AC50 | 8300 | nM | CHEMBL_ACT_25131582 |
| Q9F4F7 | 5.05 | Potency | 8912 | nM | CHEMBL_ACT_4376581 |
Target pathways
Aggregated over 3 target gene(s): PTGS1, PTGS2, EPHX2.
Top Reactome pathways
12 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 2 | PTGS1, PTGS2 |
| COX reactions | 1 | PTGS1 |
| Synthesis of epoxy (EET) and dihydroxyeicosatrienoic acids (DHET) | 1 | EPHX2 |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of maresins | 1 | EPHX2 |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
| Peroxisomal protein import | 1 | EPHX2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| lipid metabolic process | 3 |
| prostaglandin biosynthetic process | 2 |
| response to oxidative stress | 2 |
| regulation of blood pressure | 2 |
| cyclooxygenase pathway | 2 |
| regulation of cell population proliferation | 2 |
| long-chain fatty acid biosynthetic process | 2 |
| fatty acid metabolic process | 2 |
| fatty acid biosynthetic process | 2 |
| prostaglandin metabolic process | 2 |
| prostanoid biosynthetic process | 2 |
| cellular oxidant detoxification | 2 |
| embryo implantation | 1 |
| response to nematode | 1 |
| response to selenium ion | 1 |
Indications & clinical
Indications
4 indications (4 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03350386 | PHASE1 | COMPLETED | Drug-drug Interaction Study of FYU-981 and Oxaprozin |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
418 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Fulvestrant | ChEMBL + PubChem | Phase 4 (approved) | EPHX2, PTGS2 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | EPHX2, PTGS1 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MOFEZOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MONOBENZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NAPROXEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OMADACYCLINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PIROXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| RANITIDINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ROFECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SELINEXOR | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | EPHX2, PTGS2 |
| SUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ZILEUTON | ChEMBL | Phase 4 (approved) | EPHX2, PTGS2 |
| CURCUMIN | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| QUERCETIN | ChEMBL | Phase 3 | EPHX2, PTGS2 |
| RESVERATROL | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| CIMICOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| DERACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| ENOFELAST | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FIROCOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| LICOFELONE | ChEMBL | Phase 2 | PTGS1, PTGS2 |
Related Atlas pages
- Genes: PTGS1, PTGS2, EPHX2
- Diseases: rheumatic disorder, rheumatoid arthritis, juvenile idiopathic arthritis, osteoarthritis
- Drugs: Fulvestrant, Regorafenib, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acemetacin, Aspirin, Bromfenac, Capsaicin, Captopril, Carprofen, Celecoxib, Cianidanol, Dexibuprofen, Dexketoprofen, Diclofenac, Diethylstilbestrol, Doxorubicin, Esflurbiprofen, Etodolac, Etoricoxib, Flurbiprofen, Glafenine, Hexachlorophene, Ibuprofen, Indomethacin, Ketorolac, Levodopa, Loxoprofen, Lumiracoxib, Meclofenamic Acid, Mefenamic Acid, Meloxicam, Mofezolac, Monobenzone, Naproxen, Nimesulide, Omadacycline, Piroxicam, Primaquine, Ranitidine, Rofecoxib, Selinexor, Sorafenib, Suprofen, Tegaserod, Telotristat, Tolmetin, Troglitazone, Valdecoxib, Vortioxetine, Zileuton, Curcumin, Quercetin, Resveratrol