Oxyphenonium
drugOn this page
Also known as Oxyphenonium cationOxyphenonium ionOXYPHENONIUM BROMIDE
Summary
Oxyphenonium (CHEMBL1201286) is an approved small molecule (ATC A03AB53) targeting CHRM4; indicated across 1 condition.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A03AB53 (+1 more)
- Targets: 1 (CHRM4)
- Indications: 1 condition
- Chemistry: 348.5 Da · C21H34NO3+
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1201286 |
| Name | Oxyphenonium |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 5749 |
| ATC | A03AB53, A03AB03 |
| Molecular formula | C21H34NO3+ |
| Molecular weight | 348.5 |
| InChIKey | GFRUPHOKLBPHTQ-UHFFFAOYSA-N |
SMILES: CC[N+](C)(CC)CCOC(=O)C(C1CCCCC1)(C2=CC=CC=C2)O
IUPAC name: 2-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxyethyl-diethyl-methylazanium
Also known as: Oxyphenonium, Oxyphenonium cation, Oxyphenonium ion, OXYPHENONIUM, oxyphenonium, OXYPHENONIUM BROMIDE
Parent form; salt/anhydrous children: CHEMBL1200906
Patent coverage: 365 distinct patent families (1,139 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CHRM4 | M4 receptor | Antagonist | 9.84 | 1.6% | P08173 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: Muscarinic acetylcholine receptor M2, Muscarinic acetylcholine receptor M1, Sodium-dependent dopamine transporter, Voltage-gated inwardly rectifying potassium channel KCNH2.
Bioactivity
ChEMBL activities: 2 potent at pChembl ≥ 5 of 4 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CHRM2 | 8.52 | AC50 | 3 | nM | CHEMBL_ACT_25196338 |
| CHRM1 | 8.52 | AC50 | 3 | nM | CHEMBL_ACT_25210737 |
Target pathways
Aggregated over 1 target gene(s): CHRM4.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | CHRM4 |
| Signaling by GPCR | 1 | CHRM4 |
| Class A/1 (Rhodopsin-like receptors) | 1 | CHRM4 |
| Amine ligand-binding receptors | 1 | CHRM4 |
| GPCR downstream signalling | 1 | CHRM4 |
| Muscarinic acetylcholine receptors | 1 | CHRM4 |
| G alpha (i) signalling events | 1 | CHRM4 |
| GPCR ligand binding | 1 | CHRM4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| signal transduction | 1 |
| cell surface receptor signaling pathway | 1 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 1 |
| adenylate cyclase-inhibiting G protein-coupled acetylcholine receptor signaling pathway | 1 |
| G protein-coupled acetylcholine receptor signaling pathway | 1 |
| chemical synaptic transmission | 1 |
| regulation of locomotion | 1 |
| G protein-coupled receptor signaling pathway | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4).
The 1 indication record carries no mapped disease name (EFO/MeSH-only); none shown.
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
107 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | CHRM4 |
| ACETYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | CHRM4 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | CHRM4 |
| ATROPINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | CHRM4 |
| BETHANECHOL | ChEMBL | Phase 4 (approved) | CHRM4 |
| BIPERIDEN | ChEMBL | Phase 4 (approved) | CHRM4 |
| CARBACHOL | ChEMBL | Phase 4 (approved) | CHRM4 |
| CARBAMOYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CEVIMELINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CLIDINIUM | ChEMBL | Phase 4 (approved) | CHRM4 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CYCLIZINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | CHRM4 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| DEXCHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| DICYCLOMINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| DIMENHYDRINATE | ChEMBL | Phase 4 (approved) | CHRM4 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| DIPHENIDOL | ChEMBL | Phase 4 (approved) | CHRM4 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | CHRM4 |
| DROPERIDOL | ChEMBL | Phase 4 (approved) | CHRM4 |
| DYCLONINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| EBASTINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | CHRM4 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| GENTIAN VIOLET | ChEMBL | Phase 4 (approved) | CHRM4 |
| GLYCOPYRRONIUM BROMIDE | ChEMBL | Phase 4 (approved) | CHRM4 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | CHRM4 |
| HOMATROPINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| HYDROXYCHLOROQUINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| IPRATROPIUM | ChEMBL | Phase 4 (approved) | CHRM4 |
| IRINOTECAN | ChEMBL | Phase 4 (approved) | CHRM4 |
| KETOTIFEN | ChEMBL | Phase 4 (approved) | CHRM4 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| MAPROTILINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| MEPAZINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| METHACHOLINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| METHSCOPOLAMINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| METHSCOPOLAMINE BROMIDE | ChEMBL | Phase 4 (approved) | CHRM4 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | CHRM4 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | CHRM4 |
| MITOXANTRONE | ChEMBL | Phase 4 (approved) | CHRM4 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| ORPHENADRINE | ChEMBL | Phase 4 (approved) | CHRM4 |
| OXYBUTYNIN | ChEMBL | Phase 4 (approved) | CHRM4 |
Related Atlas pages
- Genes: CHRM4
- Drugs: Aclidinium Bromide, Acetylcholine, Amiodarone, Amitriptyline, Amoxapine, Astemizole, Atropine, Benztropine, Betamethasone Phosphoric Acid, Bethanechol, Biperiden, Carbachol, Cariprazine, Cevimeline, Chloroquine, Chlorpromazine, Cinnarizine, Clemastine, Clidinium, Clomipramine, Clotrimazole, Clozapine, Cyclizine, Cyproheptadine, Darifenacin, Desloratadine, Dexchlorpheniramine, Dicyclomine, Dimenhydrinate, Diphenhydramine, Diphenidol, Doxepin, Droperidol, Dyclonine, Ebastine, Econazole, Fluphenazine, Glycopyrronium Bromide, Haloperidol, Homatropine, Hydroxychloroquine, Imipramine, Ipratropium, Irinotecan, Ketotifen, Loxapine, Maprotiline, Mepazine, Methacholine, Methscopolamine, Mianserin, Miconazole, Mitoxantrone, Nortriptyline, Olanzapine, Orphenadrine, Oxybutynin