Oxytocin
drugOn this page
Also known as Alpha-hypophamineEndopituitrinaIntertocine sOxitocinaOxytocineOxytocinumOrasthinPitocinSyntocinonSyntometrineTNX-1900TNX1900TTA-121Cys-Tyr-Ile-Gln-Asn-Cys-Pro-Leu-Gly-NH2SID50112429
Summary
Oxytocin (CHEMBL395429) is an approved protein vasodilator agent (ATC H01BB02) targeting AVPR1A, AVPR1B, and AVPR2; indicated across 53 conditions including autism spectrum disorder and dystocia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Protein
- ATC class: H01BB02
- Targets: 4 (AVPR1A, AVPR1B, AVPR2…)
- Indications: 53 conditions
- Clinical trials: 504
- Chemistry: 1007.2 Da · C43H66N12O12S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL395429 |
| Name | Oxytocin |
| Type | Protein |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 439302 |
| ChEBI | CHEBI:7872 |
| ATC | H01BB02 |
| Molecular formula | C43H66N12O12S2 |
| Molecular weight | 1007.2 |
| InChIKey | XNOPRXBHLZRZKH-DSZYJQQASA-N |
SMILES: CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N1)CC2=CC=C(C=C2)O)N)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N
IUPAC name: (2S)-1-[(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-butan-2-yl]-16-[(4-hydroxyphenyl)methyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carbonyl]-N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide
ChEBI definition: A cyclic nonapeptide hormone with amino acid sequence CYIQNCPLG that also acts as a neurotransmitter in the brain; the principal uterine-contracting and milk-ejecting hormone of the posterior pituitary. Together with the neuropeptide vasopressin, it is believed to influence social cognition and behaviour.
Pharmacological roles (ChEBI): oxytocic, vasodilator agent.
Also known as: Alpha-hypophamine, Endopituitrina, Intertocine s, Oxitocina, Oxytocin, Oxytocine, Oxytocinum, Orasthin, Pitocin, Syntocinon, Syntometrine, TNX-1900
Parent form; salt/anhydrous children: CHEMBL3185709
Patent coverage: 13,471 distinct patent families (41,727 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 41,716 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AVPR1A | V1A receptor | Full agonist | 8.3 | 4.6% | P37288 |
| AVPR1B | V1B receptor | Full agonist | 7 | 0.4% | P47901 |
| AVPR2 | V2 receptor | Full agonist | 6.8 | 0% | P30518 |
| OXTR | OT receptor | Full agonist | 9.6 | 0.1% | P30559 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Vasopressin V2 receptor, Vasopressin V1a receptor, Vasopressin V1b receptor, Oxytocin receptor, Oxytocin receptor, Vasopressin V2 receptor, Oxytocin receptor.
Bioactivity
ChEMBL activities: 63 potent at pChembl ≥ 5 of 63 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| OXTR | 11 | EC50 | 0.01 | nM | CHEMBL_ACT_19206189 |
| OXTR | 10.4 | EC50 | 0.04 | nM | CHEMBL_ACT_16614744 |
| OXTR | 10.4 | EC50 | 0.04 | nM | CHEMBL_ACT_18480017 |
| AVPR1A | 9.74 | EC50 | 0.18 | nM | CHEMBL_ACT_19193949 |
| AVPR1A | 9.72 | EC50 | 0.19 | nM | CHEMBL_ACT_19206198 |
| AVPR1B | 9.7 | EC50 | 0.2 | nM | CHEMBL_ACT_19193956 |
| OXTR | 9.52 | EC50 | 0.3 | nM | CHEMBL_ACT_18285583 |
| OXTR | 9.36 | Ki | 0.44 | nM | CHEMBL_ACT_16614788 |
| OXTR | 9.24 | Ki | 0.58 | nM | CHEMBL_ACT_19206180 |
| OXTR | 9.15 | EC50 | 0.7 | nM | CHEMBL_ACT_18561472 |
| OXTR | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_1075628 |
| OXTR | 9.1 | Ki | 0.79 | nM | CHEMBL_ACT_15213897 |
| OXTR | 9.1 | Ki | 0.79 | nM | CHEMBL_ACT_15213916 |
| OXTR | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_16472260 |
| OXTR | 9.1 | Ki | 0.79 | nM | CHEMBL_ACT_5119966 |
| P70536 | 9.05 | Ki | 0.89 | nM | CHEMBL_ACT_318378 |
| OXTR | 8.92 | Ki | 1.2 | nM | CHEMBL_ACT_18285565 |
| OXTR | 8.89 | EC50 | 1.28 | nM | CHEMBL_ACT_18929257 |
| AVPR1A | 8.82 | EC50 | 1.5 | nM | CHEMBL_ACT_18084981 |
| P70536 | 8.77 | Ki | 1.7 | nM | CHEMBL_ACT_739235 |
| P97926 | 8.7 | EC50 | 2 | nM | CHEMBL_ACT_18561474 |
| OXTR | 8.68 | EC50 | 2.1 | nM | CHEMBL_ACT_19474030 |
| OXTR | 8.64 | EC50 | 2.3 | nM | CHEMBL_ACT_15001074 |
| OXTR | 8.64 | EC50 | 2.29 | nM | CHEMBL_ACT_18929236 |
| OXTR | 8.64 | EC50 | 2.3 | nM | CHEMBL_ACT_24981425 |
| OXTR | 8.61 | EC50 | 2.46 | nM | CHEMBL_ACT_25663336 |
| OXTR | 8.57 | IC50 | 2.7 | nM | CHEMBL_ACT_1945723 |
| OXTR | 8.52 | EC50 | 3 | nM | CHEMBL_ACT_16472262 |
| OXTR | 8.3 | EC50 | 5 | nM | CHEMBL_ACT_15213910 |
| AVPR1A | 8.24 | EC50 | 5.8 | nM | CHEMBL_ACT_18085049 |
Target pathways
Aggregated over 4 target gene(s): AVPR1A, AVPR1B, AVPR2, OXTR.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Vasopressin-like receptors | 4 | AVPR1A, AVPR1B, AVPR2, OXTR |
| G alpha (q) signalling events | 3 | AVPR1A, AVPR1B, OXTR |
| Defective AVP does not bind AVPR1A,B and causes neurohypophyseal diabetes insipidus (NDI) | 2 | AVPR1A, AVPR1B |
| G alpha (s) signalling events | 1 | AVPR2 |
| Vasopressin regulates renal water homeostasis via Aquaporins | 1 | AVPR2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | AVPR2 |
| Clathrin-mediated endocytosis | 1 | AVPR2 |
| Defective AVP does not bind AVPR2 and causes neurohypophyseal diabetes insipidus (NDI) | 1 | AVPR2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of systemic arterial blood pressure by vasopressin | 4 |
| G protein-coupled receptor signaling pathway | 4 |
| cellular response to hormone stimulus | 4 |
| positive regulation of vasoconstriction | 4 |
| signal transduction | 4 |
| positive regulation of blood pressure | 3 |
| positive regulation of systemic arterial blood pressure | 2 |
| positive regulation of cytosolic calcium ion concentration | 2 |
| positive regulation of cell population proliferation | 2 |
| telencephalon development | 2 |
| transport across blood-brain barrier | 2 |
| regulation of blood pressure | 2 |
| maternal aggressive behavior | 1 |
| generation of precursor metabolites and energy | 1 |
| negative regulation of female receptivity | 1 |
Indications & clinical
Indications
53 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| autism spectrum disorder | 3 | MONDO:0005258 | EFO:0003756 |
| dystocia | 3 | MONDO:0006737 | EFO:1000911 |
| alcohol abuse | 3 | MONDO:0002046 | MONDO:0007079 |
| benign muscle neoplasm | 3 | MONDO:0003061 | MONDO:0003061 |
| alcohol withdrawal | 2 | MONDO:0005433 | EFO:0004777 |
| autism | 2 | MONDO:0005260 | EFO:0003758 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| neuralgia | 2 | MONDO:0021667 | EFO:0005762 |
| post-traumatic stress disorder | 2 | MONDO:0005146 | EFO:0001358 |
| obesity disorder | 2 | MONDO:0011122 | EFO:0001073 |
| physiological sexual disorder | 2 | MONDO:0002134 | EFO:0004714 |
| obsessive-compulsive disorder | 2 | MONDO:0008114 | EFO:0004242 |
| mood disorder | 2 | MONDO:0005371 | EFO:0004247 |
| ductal breast carcinoma in situ | 2 | MONDO:0005023 | EFO:0000432 |
| myocardial infarction | 2 | MONDO:0005068 | EFO:0000612 |
| obstructive sleep apnea syndrome | 2 | MONDO:0007147 | EFO:0003918 |
| postmenopausal atrophic vaginitis | 2 | MONDO:0001410 | EFO:1001271 |
| social phobia | 2 | MONDO:0001247 | EFO:1001917 |
| depressive disorder | 2 | MONDO:0002050 | MONDO:0002050 |
| substance-related disorder | 2 | MONDO:0002494 | MONDO:0002491 |
| osteoarthritis, knee | 2 | MONDO:0005416 | EFO:0004616 |
| psychiatric disorder | 2 | MONDO:0002025 | MONDO:0002025 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| Prader-Willi syndrome | 2 | MONDO:0008300 | MONDO:0008300 |
| fragile X syndrome | 2 | MONDO:0010383 | MONDO:0010383 |
| frontotemporal dementia | 2 | MONDO:0017276 | MONDO:0017276 |
| drug dependence | 2 | MONDO:0005303 | EFO:0003890 |
| eating disorder | 2 | MONDO:0005451 | EFO:0005203 |
| osteoarthritis | 2 | MONDO:0005178 | MONDO:0005178 |
| opiate dependence | 1 | MONDO:0005530 | EFO:0005611 |
| sleep apnea syndrome | 1 | MONDO:0005296 | EFO:0003877 |
| schizoaffective disorder | 1 | MONDO:0005487 | EFO:0005411 |
| neurodevelopmental disorder | 1 | MONDO:0700092 | EFO:0010642 |
| major depressive disorder | 1 | MONDO:0002009 | MONDO:0002009 |
| diabetes insipidus | 1 | MONDO:0004782 | MONDO:0004782 |
| preeclampsia | 0 | MONDO:0005081 | EFO:0000668 |
| gastroparesis | 0 | MONDO:0006769 | EFO:1000948 |
| attention deficit-hyperactivity disorder | 0 | MONDO:0007743 | EFO:0003888 |
| anorexia nervosa | 0 | MONDO:0005351 | MONDO:0005351 |
14 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 504.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 209 |
| PHASE2 | 95 |
| PHASE4 | 68 |
| PHASE1 | 43 |
| PHASE3 | 34 |
| EARLY_PHASE1 | 33 |
| PHASE2/PHASE3 | 11 |
| PHASE1/PHASE2 | 11 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07119398 | PHASE4 | RECRUITING | Oxytocin/Foley vs. Oxytocin for Induction in Patients With PPROM |
| NCT07401524 | PHASE4 | RECRUITING | Carbetocin Uterotonic Treatment in Twin Pregnancies for Prevention of Postpartum Hemorrhage |
| NCT00200252 | PHASE4 | COMPLETED | Oxytocin Administration in the Third Stage of Labour - A Study of Appropriate Route and Dose |
| NCT00695331 | PHASE4 | UNKNOWN | Efficacy and Safety Study of Titrated Oral Misoprostol Solution for Labor Augmentation |
| NCT00777166 | PHASE4 | COMPLETED | Cardiac Effects of Oxytocin Administrated During Cesarean Section, Signs of Myocardial Ischemia |
| NCT00784797 | PHASE4 | COMPLETED | Misopristol Versus Pitocin for Second Trimester Abortion |
| NCT00785395 | PHASE4 | COMPLETED | Up-Down Oxytocin Infusion |
| NCT00790062 | PHASE4 | COMPLETED | Oxytocin Regimen to Prevent Atony and Postpartum Hemorrhage During Vaginal Delivery: 3-arm RCT |
| NCT00906347 | PHASE4 | COMPLETED | A Trial of Oral Misoprostol for Labor Augmentation |
| NCT00919802 | PHASE4 | COMPLETED | Intranasal Oxytocin for the Treatment of Pain Associated With Interstitial Cystitis |
| NCT00975416 | PHASE4 | TERMINATED | Oxytocin and Cognitive Behavioral Therapy in Drug Dependence |
| NCT00977769 | PHASE4 | COMPLETED | Carbetocin Versus Oxytocin and Hemodynamic Effects |
| NCT01190163 | PHASE4 | TERMINATED | Open Label Comparative Trial of Dinoprostone Plus or Minus Oxytocin Versus Oxytocin Alone in Cervical Ripening for Labor Induction |
| NCT01216605 | PHASE4 | COMPLETED | Oxytocin and Emotion Recognition |
| NCT01252342 | PHASE4 | WITHDRAWN | Does Intramyometrial Oxytocin Improve Outcome in Elective Cesarean Delivery? |
| NCT01549223 | PHASE4 | COMPLETED | Oxytocin And Uterotonic Agent Use For Cesarean Delivery |
| NCT01614093 | PHASE4 | COMPLETED | Effects of Intranasal Oxytocin on Satiety Signaling in People With Schizophrenia |
| NCT01631682 | PHASE4 | COMPLETED | Pilot Study of Pharmaceutical and Behavioral Interventions to Treat Anxiety Disorders |
| NCT01827124 | PHASE4 | UNKNOWN | Randomized Clinical Trial for Comparison Of Intravenous Carbeitocin Versus Oxytocin In Management Of Placental Delivery In Second Trimester Interruption |
| NCT01829516 | PHASE4 | COMPLETED | Intranasal Oxytocin and Social Cognition, Implicit Preferences and Craving in Alcohol Drinkers |
| NCT02044549 | PHASE4 | COMPLETED | Carbetocin Versus Syntometrine for Prevention of Postpartum Hemorrhage After Cesarean Section |
| NCT02150954 | PHASE4 | COMPLETED | Foley Bulb With Low Dose Pitocin Versus Foley Bulb With a Standard Incremental Infusion Protocol for the Induction of Labor |
| NCT02273115 | PHASE4 | COMPLETED | Foley With Oxytocin Versus Foley no Oxytocin for Induction of Labor |
| NCT02391636 | PHASE4 | COMPLETED | Carbetocin and Oxytocin in Elective Caesarean Section With High Risk of Postpartum Hemorrhage |
| NCT02410655 | PHASE4 | WITHDRAWN | An Evidence Based Protocol for Oxytocin Administration in Vaginal Delivery |
| NCT02485444 | PHASE4 | COMPLETED | Oxytocin Infusion vs. Spontaneous Follow-up for Third-stage of Labor After Second-trimester Abortion |
| NCT02487797 | PHASE4 | COMPLETED | Comparison of Low-dose and High-dose Oxytocin Regimens for Labor Augmentation |
| NCT02488642 | PHASE4 | COMPLETED | Medical Management of Late Intrauterine Death. |
| NCT02528136 | PHASE4 | COMPLETED | The Clinical Carbetocin Myocardium Trial |
| NCT02553226 | PHASE4 | COMPLETED | Continued Versus Discontinued Oxytocin Stimulation of Labour |
| NCT02595749 | PHASE4 | COMPLETED | Effects of Intranasal Oxytocin on Cigarette Smoking |
| NCT02602301 | PHASE4 | UNKNOWN | The Effect of Intravenous Oxytocin Infusion Using Different Diluents on Neonatal Bilirubin & Sodium Levels |
| NCT02723461 | PHASE4 | UNKNOWN | Continuous Oxytocin Infusion Versus Pulsatile Intravenous Oxytocin for Augmentation of First Stage of Labor |
| NCT02737254 | PHASE4 | COMPLETED | Oxytocin and Attachment-related Interpretation Bias |
| NCT02801227 | PHASE4 | UNKNOWN | Oxytocin vs. Prostaglandin for Induction of Labor in Primiparas With Prelabor Rupture of Membrane and Low Bishop |
| NCT02940574 | PHASE4 | COMPLETED | Neural and Behavioral Effects of Oxytocin in Autism Spectrum Disorders |
| NCT03010670 | PHASE4 | COMPLETED | Oxytocin and Interpersonal Motor Resonance |
| NCT03140488 | PHASE4 | COMPLETED | Oxytocin Dosage to Decrease Induction Duration |
| NCT03246919 | PHASE4 | TERMINATED | Ideal Time of Oxytocin Infusion During Cesarean Section |
| NCT03308643 | PHASE4 | COMPLETED | Effect of Oxytocin Infusion on Blood Loss During Abdominal Myomectomy |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
143 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DESMOPRESSIN | ChEMBL + PubChem | Phase 4 (approved) | AVPR1A, AVPR1B, AVPR2, OXTR |
| ATOSIBAN | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR1B, AVPR2, OXTR |
| CARBETOCIN | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR1B, AVPR2, OXTR |
| MOZAVAPTAN | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR1B, AVPR2, OXTR |
| VASOPRESSIN | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR1B, AVPR2, OXTR |
| NELIVAPTAN | ChEMBL | Phase 2 | AVPR1A, AVPR1B, AVPR2, OXTR |
| ORNIPRESSIN | ChEMBL | Phase 2 | AVPR1A, AVPR1B, AVPR2, OXTR |
| PECAVAPTAN | ChEMBL | Phase 2 | AVPR1A, AVPR1B, AVPR2, OXTR |
| SELEPRESSIN | ChEMBL | Phase 2 | AVPR1A, AVPR1B, AVPR2, OXTR |
| LIXIVAPTAN | ChEMBL | Phase 3 | AVPR1A, AVPR2, OXTR |
| Belzutifan | PubChem | Approved | AVPR1A, AVPR2, OXTR |
| PIMOZIDE | ChEMBL + PubChem | Phase 4 (approved) | AVPR1A, AVPR2 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | AVPR1A, AVPR2 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | AVPR1A, AVPR2 |
| BALSALAZIDE | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| CONIVAPTAN | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| PYRVINIUM | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| RIFAXIMIN | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| TOLVAPTAN | ChEMBL | Phase 4 (approved) | AVPR1A, AVPR2 |
| BALOVAPTAN | ChEMBL | Phase 3 | AVPR1A, AVPR2 |
| NOLASIBAN | ChEMBL | Phase 3 | AVPR1A, OXTR |
| OTILONIUM BROMIDE | ChEMBL | Phase 3 | AVPR1A, AVPR2 |
| RETOSIBAN | ChEMBL | Phase 3 | AVPR2, OXTR |
| SEMAXANIB | ChEMBL | Phase 3 | AVPR1A, OXTR |
| BENZETHONIUM | ChEMBL | Phase 2 | AVPR1A, AVPR2 |
| DOMIPHEN | ChEMBL | Phase 2 | AVPR1A, AVPR2 |
| EPELSIBAN | ChEMBL | Phase 2 | AVPR2, OXTR |
| RELCOVAPTAN | ChEMBL | Phase 2 | AVPR1A, AVPR2 |
| Abiraterone | PubChem | Approved | AVPR1A, AVPR2 |
| acetylcysteine | PubChem | Approved | AVPR1A, AVPR2 |
| Aclidinium Bromide | PubChem | Approved | AVPR1A, AVPR2 |
| Acyclovir | PubChem | Approved | AVPR1A, AVPR2 |
| Afatinib | PubChem | Approved | AVPR1A, AVPR2 |
| Allopurinol | PubChem | Approved | AVPR1A, AVPR2 |
| Almotriptan | PubChem | Approved | AVPR1A, AVPR2 |
| Alogliptin | PubChem | Approved | AVPR1A, AVPR2 |
| aminolevulinic acid | PubChem | Approved | AVPR1A, AVPR2 |
| Anagrelide | PubChem | Approved | AVPR1A, AVPR2 |
| Apixaban | PubChem | Approved | AVPR1A, AVPR2 |
| Aprepitant | PubChem | Approved | AVPR1A, AVPR2 |
| Bosentan | PubChem | Approved | AVPR1A, AVPR2 |
| Clofarabine | PubChem | Approved | AVPR1A, AVPR2 |
| Clozapine | PubChem | Approved | AVPR1A, AVPR2 |
| Crizotinib | PubChem | Approved | AVPR1A, AVPR2 |
| Dacarbazine | PubChem | Approved | AVPR1A, AVPR2 |
| Desloratadine | PubChem | Approved | AVPR1A, AVPR2 |
| Desoxycorticosterone Pivalate | PubChem | Approved | AVPR1A, AVPR2 |
| Didanosine | PubChem | Approved | AVPR1A, AVPR2 |
| Dihydroergotamine | PubChem | Approved | AVPR1A, AVPR2 |
| Erythromycin | PubChem | Approved | AVPR1A, AVPR2 |
| Ethambutol | PubChem | Approved | AVPR1A, AVPR2 |
| Fidaxomicin | PubChem | Approved | AVPR1A, AVPR2 |
| Fulvestrant | PubChem | Approved | AVPR1A, AVPR2 |
| Ganciclovir | PubChem | Approved | AVPR1A, AVPR2 |
| Gefitinib | PubChem | Approved | AVPR1A, AVPR2 |
| Glycopyrrolate | PubChem | Approved | AVPR1A, AVPR2 |
Related Atlas pages
- Genes: AVPR1A, AVPR1B, AVPR2, OXTR
- Diseases: autism spectrum disorder, dystocia, alcohol abuse, benign muscle neoplasm
- Drugs: Desmopressin, Atosiban, Carbetocin, Mozavaptan, Vasopressin, Lixivaptan, Belzutifan, Pimozide, Rifampin, Tegaserod, Balsalazide, Bosutinib, Chlorhexidine, Conivaptan, Fluspirilene, Nitazoxanide, Pyrvinium, Rifaximin, Tolvaptan, Balovaptan, Nolasiban, Otilonium Bromide, Retosiban, Semaxanib, Abiraterone, acetylcysteine, Aclidinium Bromide, Acyclovir, Afatinib, Allopurinol, Almotriptan, Alogliptin, aminolevulinic acid, Anagrelide, Apixaban, Aprepitant, Bosentan, Clofarabine, Clozapine, Crizotinib, Dacarbazine, Desloratadine, Desoxycorticosterone Pivalate, Didanosine, Dihydroergotamine, Erythromycin, Ethambutol, Fidaxomicin, Fulvestrant, Ganciclovir, Gefitinib, Glycopyrrolate