Palbociclib
drugOn this page
Also known as IbrancePD-0332991PD0332991PFE-PKIS 32PF-0008066573PALBOCICLIB ISETHIONATEPD-03329910054PFE-PKIS_32PD 0332991SID103905660SID103905661SID137275973PalbocicilibPalbociclibPaldociclibPD 0332991 (Palbociclib) HCl
Summary
Palbociclib (CHEMBL189963) is an approved small-molecule EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (ATC L01EF01) targeting CDK4 and CDK6; indicated across 53 conditions including breast carcinoma and breast neoplasm; with CIViC clinical evidence for 83 variant-indication associations (e.g. PIK3CA E453K OR PIK3CA E453Q OR PIK3CA E453A OR PIK3CA E453D OR PIK3CA E453G OR PIK3CA E453V in breast cancer).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EF01
- Targets: 2 (CDK4, CDK6)
- Indications: 53 conditions
- Clinical trials: 322
- Precision-oncology evidence (CIViC): 83 variant–indication associations
- Chemistry: 447.5 Da · C24H29N7O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL189963 |
| Name | Palbociclib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5330286 |
| ChEBI | CHEBI:85993 |
| ATC | L01EF01 |
| Molecular formula | C24H29N7O2 |
| Molecular weight | 447.5 |
| InChIKey | AHJRHEGDXFFMBM-UHFFFAOYSA-N |
SMILES: CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)C(=O)C
IUPAC name: 6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one
ChEBI definition: A member of the class of pyridopyrimidines that is 2-{[5-(piperazin-1-yl)pyridin-2-yl]amino}pyrido[2,3-d]pyrimidin-7-one bearing additional methyl, acetyl and cyclopentyl substituents at positions 5, 6 and 8 respectively. It is used in combination with letrozole for the treatment of metastatic breast cancer.
Pharmacological roles (ChEBI): EC 2.7.11.22 (cyclin-dependent kinase) inhibitor, antineoplastic agent.
Also known as: Ibrance, Palbociclib, PD-0332991, PD0332991, PFE-PKIS 32, PALBOCICLIB, PF-0008066573, PALBOCICLIB ISETHIONATE, PD-03329910054, PFE-PKIS_32, PD 0332991, IBRANCE
Parent form; salt/anhydrous children: CHEMBL2364621, CHEMBL3962672
Patent coverage: 5,635 distinct patent families (13,102 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 12,666 (97%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CDK4 | cyclin dependent kinase 4 | Inhibition | 7.36 | 58% | P11802 |
| CDK6 | cyclin dependent kinase 6 | Inhibition | 7.44 | 52.1% | Q00534 |
Broader ChEMBL bioactivity targets: 88 (assay-derived). Sample: Leucine-rich repeat serine/threonine-protein kinase 2, Serine/threonine-protein kinase TAO2, Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma, Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha, cGMP-specific 3’,5’-cyclic phosphodiesterase, Alpha-2A adrenergic receptor, Neuronal acetylcholine receptor subunit alpha-4, Cyclin-dependent kinase 5/CDK5 activator 1, Cyclin-dependent kinase 4/cyclin D1, Cyclin-dependent kinase 1/cyclin B1.
Bioactivity
ChEMBL activities: 224 potent at pChembl ≥ 5 of 254 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CCND1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_25011955 |
| CDK4 | 9.59 | Ki | 0.26 | nM | CHEMBL_ACT_25789144 |
| CCND1 | 9.59 | Ki | 0.26 | nM | CHEMBL_ACT_25789164 |
| CCND1 | 9.37 | IC50 | 0.43 | nM | CHEMBL_ACT_26333770 |
| CDK4 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_25011932 |
| CDK4 | 9.01 | IC50 | 0.98 | nM | CHEMBL_ACT_25789145 |
| CCNT1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_25789193 |
| CCND1 | 9 | IC50 | 0.99 | nM | CHEMBL_ACT_25993927 |
| CDK4 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_26333767 |
| CDK4 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_14584743 |
| CCND1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_25789168 |
| CDK4 | 8.52 | Ki | 3 | nM | CHEMBL_ACT_18020966 |
| CCND1 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_24964305 |
| CCND1 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_25993906 |
| CDK4 | 8.49 | IC50 | 3.2 | nM | CHEMBL_ACT_22960036 |
| CDK4 | 8.49 | IC50 | 3.2 | nM | CHEMBL_ACT_22960062 |
| CDK4 | 8.46 | IC50 | 3.44 | nM | CHEMBL_ACT_23206362 |
| PARP1 | 8.46 | IC50 | 3.5 | nM | CHEMBL_ACT_29321628 |
| CCND1 | 8.43 | IC50 | 3.76 | nM | CHEMBL_ACT_13917508 |
| CCND3 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_25789165 |
| CDK4 | 8.31 | IC50 | 4.84 | nM | CHEMBL_ACT_25993915 |
| CCND3 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_20606447 |
| CCND3 | 8.29 | IC50 | 5.1 | nM | CHEMBL_ACT_26333774 |
| CDK4 | 8.27 | IC50 | 5.36 | nM | CHEMBL_ACT_13917486 |
| STING1 | 8.22 | Kd | 6.01 | nM | CHEMBL_ACT_26023207 |
| CDK4 | 8.18 | IC50 | 6.6 | nM | CHEMBL_ACT_24964291 |
| CDK4 | 8.16 | IC50 | 6.9 | nM | CHEMBL_ACT_25993903 |
| CDK4 | 8.15 | IC50 | 7 | nM | CHEMBL_ACT_26333772 |
| CDK4 | 8.09 | IC50 | 8.2 | nM | CHEMBL_ACT_22420546 |
| CCND2 | 8.05 | IC50 | 9 | nM | CHEMBL_ACT_15678945 |
Target pathways
Aggregated over 2 target gene(s): CDK4, CDK6.
Top Reactome pathways
52 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cell Cycle | 2 | CDK4, CDK6 |
| Disease | 2 | CDK4, CDK6 |
| Generic Transcription Pathway | 2 | CDK4, CDK6 |
| Cellular responses to stress | 2 | CDK4, CDK6 |
| Oxidative Stress Induced Senescence | 2 | CDK4, CDK6 |
| Senescence-Associated Secretory Phenotype (SASP) | 2 | CDK4, CDK6 |
| Cellular Senescence | 2 | CDK4, CDK6 |
| Oncogene Induced Senescence | 2 | CDK4, CDK6 |
| Mitotic G1 phase and G1/S transition | 2 | CDK4, CDK6 |
| Cyclin D associated events in G1 | 2 | CDK4, CDK6 |
| G1 Phase | 2 | CDK4, CDK6 |
| Cell Cycle, Mitotic | 2 | CDK4, CDK6 |
| RNA Polymerase II Transcription | 2 | CDK4, CDK6 |
| Gene expression (Transcription) | 2 | CDK4, CDK6 |
| Cellular responses to stimuli | 2 | CDK4, CDK6 |
| Diseases of Cellular Senescence | 2 | CDK4, CDK6 |
| Evasion of Oncogene Induced Senescence Due to p16INK4A Defects | 2 | CDK4, CDK6 |
| Evasion of Oncogene Induced Senescence Due to Defective p16INK4A binding to CDK4 and CDK6 | 2 | CDK4, CDK6 |
| Evasion of Oxidative Stress Induced Senescence Due to p16INK4A Defects | 2 | CDK4, CDK6 |
| Evasion of Oxidative Stress Induced Senescence Due to Defective p16INK4A binding to CDK4 and CDK6 | 2 | CDK4, CDK6 |
| Aberrant regulation of mitotic G1/S transition in cancer due to RB1 defects | 2 | CDK4, CDK6 |
| Defective binding of RB1 mutants to E2F1,(E2F2, E2F3) | 2 | CDK4, CDK6 |
| Diseases of mitotic cell cycle | 2 | CDK4, CDK6 |
| Diseases of cellular response to stress | 2 | CDK4, CDK6 |
| Aberrant regulation of mitotic cell cycle due to RB1 defects | 2 | CDK4, CDK6 |
| Drug-mediated inhibition of CDK4/CDK6 activity | 2 | CDK4, CDK6 |
| Developmental Biology | 1 | CDK4 |
| Reproduction | 1 | CDK4 |
| Meiosis | 1 | CDK4 |
| Signal Transduction | 1 | CDK4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G1/S transition of mitotic cell cycle | 2 |
| signal transduction | 2 |
| regulation of G2/M transition of mitotic cell cycle | 2 |
| regulation of gene expression | 2 |
| positive regulation of fibroblast proliferation | 2 |
| cell division | 2 |
| regulation of cell cycle | 2 |
| protein phosphorylation | 2 |
| positive regulation of cell population proliferation | 1 |
| response to xenobiotic stimulus | 1 |
| positive regulation of G2/M transition of mitotic cell cycle | 1 |
| regulation of transcription initiation by RNA polymerase II | 1 |
| regulation of type B pancreatic cell proliferation | 1 |
| cellular response to lipopolysaccharide | 1 |
| cellular response to interleukin-4 | 1 |
Indications & clinical
Indications
53 indications (6 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| breast carcinoma | 4 | MONDO:0004989 | EFO:0000305 |
| breast neoplasm | 4 | MONDO:0021100 | EFO:0003869 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| HER2 positive breast carcinoma | 4 | MONDO:0006244 | EFO:1000294 |
| squamous cell lung carcinoma | 3 | MONDO:0005097 | EFO:0000708 |
| head and neck squamous cell carcinoma | 3 | MONDO:0010150 | EFO:0000181 |
| squamous cell carcinoma | 3 | MONDO:0005096 | EFO:0000707 |
| soft tissue sarcoma | 3 | MONDO:0018078 | EFO:1001968 |
| sarcoma | 3 | MONDO:0005089 | EFO:0000691 |
| mantle cell lymphoma | 2 | MONDO:0018876 | EFO:1001469 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| liposarcoma | 2 | MONDO:0005060 | EFO:0000569 |
| adenocarcinoma | 2 | MONDO:0004970 | EFO:0000228 |
| oligoastrocytoma | 2 | MONDO:0016702 | EFO:0000630 |
| oligodendroglioma | 2 | MONDO:0016695 | EFO:0000632 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| thymus neoplasm | 2 | MONDO:0005197 | EFO:0002626 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| pancreatic neuroendocrine tumor | 2 | MONDO:0019954 | EFO:1000045 |
| Ewing sarcoma | 2 | MONDO:0012817 | EFO:0000174 |
| urothelial carcinoma | 2 | MONDO:0040679 | EFO:0008528 |
| colon carcinoma | 2 | MONDO:0002032 | EFO:1001950 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| endometrium neoplasm | 2 | MONDO:0021251 | MONDO:0011962 |
| lymphoma | 2 | MONDO:0005062 | EFO:0000574 |
| clear cell renal carcinoma | 2 | MONDO:0005005 | EFO:0000349 |
| osteosarcoma | 2 | MONDO:0009807 | EFO:0000637 |
| renal cell carcinoma | 2 | MONDO:0005086 | EFO:0000681 |
| chordoma | 2 | MONDO:0008978 | MONDO:0008978 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| ovarian carcinoma | 2 | MONDO:0005140 | EFO:0001075 |
| dedifferentiated liposarcoma | 2 | MONDO:0020563 | EFO:0003085 |
| esophageal squamous cell carcinoma | 2 | MONDO:0005580 | EFO:0005922 |
| ductal breast carcinoma in situ | 2 | MONDO:0005023 | EFO:0000432 |
| nasopharyngeal carcinoma | 2 | MONDO:0015459 | MONDO:0015459 |
| non-Hodgkin lymphoma | 1 | MONDO:0018908 | EFO:0005952 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| plasma cell myeloma | 1 | MONDO:0009693 | EFO:0001378 |
| acute lymphoblastic leukemia | 1 | MONDO:0004967 | EFO:0000220 |
| acute myeloid leukemia | 1 | MONDO:0018874 | EFO:0000222 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| hereditary breast ovarian cancer syndrome | 1 | MONDO:0003582 | Orphanet:145 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
| breast ductal adenocarcinoma | 1 | MONDO:0005590 | EFO:0006318 |
| lung neoplasm | 1 | MONDO:0021117 | MONDO:0008903 |
| breast disorder | 1 | MONDO:0002657 | EFO:0009483 |
| undifferentiated pleomorphic sarcoma | 1 | MONDO:0002142 | EFO:1001972 |
| pancreatic ductal adenocarcinoma | 1 | MONDO:0005184 | MONDO:0005184 |
5 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 322.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 126 |
| PHASE1 | 77 |
| Not specified | 39 |
| PHASE1/PHASE2 | 34 |
| PHASE3 | 32 |
| PHASE4 | 6 |
| EARLY_PHASE1 | 5 |
| PHASE2/PHASE3 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02679755 | PHASE4 | COMPLETED | Palbociclib In Combination With Letrozole As Treatment Of Post-Menopausal Women With HR+, HER2- Advanced Breast Cancer |
| NCT03220178 | PHASE4 | TERMINATED | Impact of eHealth-support on Quality of Life in Metastatic Breast Cancer Patients Treated With Palbociclib and Endocrine Therapy |
| NCT03355157 | PHASE4 | COMPLETED | A Randomized, Open-label, Multi-center Phase IV Study Evaluating Palbociclib Plus Endocrine Treatment Versus a Chemotherapy-based Treatment Strategy in Patients With Hormone Receptor Positive / HER2 Negative Breast Cancer in a Real World Setting (GBG 93 - PADMA Study). |
| NCT05949424 | PHASE4 | UNKNOWN | OPTI - DOSE: Optimal Dosing of Oral Anticancer Drugs in Older Adults |
| NCT06331715 | PHASE4 | COMPLETED | Bioequivalence Study of Palbociclib 125 mg Capsules of Iclos vs. Ibrance (Palbociclib) Capsules 125 mg |
| NCT07487129 | PHASE4 | COMPLETED | Clinical and Pharmacoeconomic Assessment of CDK4/6 Inhibitors for Treatment of Breast Cancer in Egypt |
| NCT02513394 | PHASE3 | ACTIVE_NOT_RECRUITING | PALbociclib CoLlaborative Adjuvant Study |
| NCT02947685 | PHASE3 | ACTIVE_NOT_RECRUITING | Randomized, Open Label, Clinical Study of the Targeted Therapy, Palbociclib, to Treat Metastatic Breast Cancer |
| NCT03820830 | PHASE3 | ACTIVE_NOT_RECRUITING | Palbociclib for HR Positive / HER2-negative Isolated Locoregional Recurrence of Breast Cancer |
| NCT04191499 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | A Study Evaluating the Efficacy and Safety of Inavolisib + Palbociclib + Fulvestrant vs Placebo + Palbociclib + Fulvestrant in Participants With PIK3CA-Mutant, Hormone Receptor-Positive, HER2-Negative, Locally Advanced or Metastatic Breast Cancer |
| NCT04546009 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study Evaluating the Efficacy and Safety of Giredestrant Combined With Palbociclib Compared With Letrozole Combined With Palbociclib in Participants With Estrogen Receptor-Positive, HER2-Negative Locally Advanced or Metastatic Breast Cancer (persevERA Breast Cancer) |
| NCT04711252 | PHASE3 | ACTIVE_NOT_RECRUITING | A Comparative Study of AZD9833 Plus Palbociclib Versus Anastrozole Plus Palbociclib in Patients With ER-Positive HER2 Negative Breast Cancer Who Have Not Received Any Systemic Treatment for Advanced Disease |
| NCT04862663 | PHASE3 | RECRUITING | Capivasertib + CDK4/6i + Fulvestrant for Advanced/Metastatic HR+/HER2- Breast Cancer (CAPItello-292) |
| NCT04964934 | PHASE3 | ACTIVE_NOT_RECRUITING | Phase III Study to Assess AZD9833+ CDK4/6 Inhibitor in HR+/HER2-MBC With Detectable ESR1m Before Progression (SERENA-6) |
| NCT04966481 | PHASE3 | RECRUITING | Palbociclib and Cetuximab Versus Cetuximab Monotherapy for Patients With CDKN2A-altered, HPV-unrelated Head and Neck Squamous Cell Carcinoma Who Experienced Disease Progression on a PD-1/L1 Inhibitor |
| NCT05207709 | PHASE3 | ACTIVE_NOT_RECRUITING | Ribociclib vs. Palbociclib in Patients With Advanced Breast Cancer Within the HER2-Enriched Intrinsic Subtype |
| NCT05501886 | PHASE3 | ACTIVE_NOT_RECRUITING | Gedatolisib Plus Fulvestrant With or Without Palbociclib vs Standard-of-Care for the Treatment of Patients With Advanced or Metastatic HR+/HER2- Breast Cancer (VIKTORIA-1) |
| NCT05909397 | PHASE3 | ACTIVE_NOT_RECRUITING | Vepdegestrant (ARV-471/PF-07850327) + Palbociclib vs Letrozole + Palbociclib in ER(+)/HER2(-) Advanced Breast Cancer |
| NCT06065748 | PHASE3 | RECRUITING | A Study to Evaluate Efficacy and Safety of Giredestrant Compared With Fulvestrant (Plus a CDK4/6 Inhibitor), in Participants With ER-Positive, HER2-Negative Advanced Breast Cancer Resistant to Adjuvant Endocrine Therapy (pionERA Breast Cancer) |
| NCT06377852 | PHASE3 | RECRUITING | The CDK4/6 Inhibitor Dosing Knowledge (CDK) Study |
| NCT06380751 | PHASE3 | RECRUITING | Saruparib (AZD5305) Plus Camizestrant Compared With CDK4/6 Inhibitor Plus Endocrine Therapy or Plus Camizestrant in HR-Positive, HER2-Negative (IHC 0, 1+, 2+/ ISH Non-amplified), BRCA1, BRCA2, or PALB2m Advanced Breast Cancer |
| NCT06757634 | PHASE3 | RECRUITING | Phase 3 Study of Gedatolisib as First-Line Treatment for Patients With HR-Positive, HER2-Negative Advanced Breast Cancer (VIKTORIA-2) |
| NCT06760637 | PHASE3 | ACTIVE_NOT_RECRUITING | Study of PF-07220060 With Letrozole in Adults With HR-positive HER2-negative Breast Cancer Who Have Not Received Anticancer Treatment for Advanced/Metastatic Disease |
| NCT07174336 | PHASE3 | RECRUITING | A Study of Tersolisib (LY4064809/STX-478) With Other Anti-Cancer Treatments in Participants With Advanced Breast Cancer With a Genetic Change (PIK3CA) |
| NCT07405164 | PHASE3 | RECRUITING | Extension Study for Participants in Studies That Include Belzutifan (MK-6482-043/LITESPARK-043) |
| NCT07492641 | PHASE3 | RECRUITING | BGB-43395 Plus Letrozole Versus CDK4/6i Plus Letrozole for Patients With Advanced or Metastatic HR+/HER2- Breast Cancer Who Have Not Received Prior Treatment for Advanced or Metastatic Disease |
| NCT01740427 | PHASE3 | COMPLETED | A Study of Palbociclib (PD-0332991) + Letrozole vs. Letrozole For 1st Line Treatment Of Postmenopausal Women With ER+/HER2- Advanced Breast Cancer (PALOMA-2) |
| NCT01864746 | PHASE3 | COMPLETED | A Study of Palbociclib in Addition to Standard Endocrine Treatment in Hormone Receptor Positive Her2 Normal Patients With Residual Disease After Neoadjuvant Chemotherapy and Surgery |
| NCT01942135 | PHASE3 | COMPLETED | Palbociclib (PD-0332991) Combined With Fulvestrant In Hormone Receptor+ HER2-Negative Metastatic Breast Cancer After Endocrine Failure (PALOMA-3) |
| NCT02028507 | PHASE3 | COMPLETED | Phase III Palbociclib With Endocrine Therapy vs. Capecitabine in HR+/HER2- MBC With Resistance to Aromatase Inhibitors |
| NCT02297438 | PHASE3 | COMPLETED | A Study Of Palbociclib (PD-0332991) + Letrozole VS. Placebo+ Letrozole For 1st Line Treatment Of Asian Postmenopausal Women With ER+/HER2- Advanced Breast Cancer [PALOMA-4] |
| NCT02600923 | PHASE3 | COMPLETED | Palbociclib Plus Letrozole For Postmenopausal Women With HR(+) HER2(-) Advanced Breast Cancer For Whom Letrozole Is Deemed Appropriate |
| NCT02692755 | PHASE2/PHASE3 | COMPLETED | Palbociclib / Letrozole or Fulvestrant in African American Women With HR+ HER2- Breast Cancer |
| NCT02785939 | PHASE2/PHASE3 | COMPLETED | Lung-MAP: Palbociclib as Second-Line Therapy in Treating Cell Cycle Gene Alteration Positive Patients With Recurrent Stage IV Squamous Cell Lung Cancer |
| NCT03079011 | PHASE3 | COMPLETED | PAlbociclib and Circulating Tumor DNA for ESR1 Mutation Detection |
| NCT03423199 | PHASE3 | UNKNOWN | PAlbociclib Plus Tamoxifen for the Treatment of Hormone Receptor-positive, HER2-negative Advanced Breast Cancer Women - Asian studY |
| NCT03447132 | PHASE3 | COMPLETED | Fulvestrant Versus Fulvestrant Plus Palbociclib in Operable Breast Cancer Responding to Fulvestrant |
| NCT03784014 | PHASE3 | COMPLETED | Molecular Profiling of Advanced Soft-tissue Sarcomas |
| NCT03969121 | PHASE3 | COMPLETED | Neoadjuvant Hormonal Therapy Plus Palbociclib in Operable, Hormone Sensitive and HER2-Negative Primary Breast Cancer |
| NCT04047758 | PHASE3 | UNKNOWN | Palbociclib Combined With an Aromatase Inhibitor in Breast Cancer |
Clinical evidence (CIViC)
Variant × indication × effect (83 predictive associations from 87 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| PIK3CA E453K OR PIK3CA E453Q OR PIK3CA E453A OR PIK3CA E453D OR PIK3CA E453G OR PIK3CA E453V | Breast Cancer | Sensitivity/Response | Fulvestrant + Inavolisib + Palbociclib | CIViC A | EID12540 |
| PIK3CA E542K OR PIK3CA E542Q OR PIK3CA E542A OR PIK3CA E542D OR PIK3CA E542G OR PIK3CA E542R OR PIK3CA E542V | Breast Cancer | Sensitivity/Response | Palbociclib + Inavolisib + Fulvestrant | CIViC A | EID12535 |
| PIK3CA E545K OR PIK3CA E545Q OR PIK3CA E545A OR PIK3CA E545G OR PIK3CA E545V OR PIK3CA E545D OR PIK3CA E545L OR PIK3CA E545R | Breast Cancer | Sensitivity/Response | Palbociclib + Inavolisib + Fulvestrant | CIViC A | EID12534 |
| PIK3CA G1049S OR PIK3CA G1049R OR PIK3CA G106V OR PIK3CA G106R OR PIK3CA G1049A OR PIK3CA G106S OR PIK3CA G106A OR PIK3CA G106D OR PIK3CA G118D OR PIK3CA G1049C OR PIK3CA G1049D | Breast Cancer | Sensitivity/Response | Palbociclib + Inavolisib + Fulvestrant | CIViC A | EID12537 |
| PIK3CA H1047R OR PIK3CA H1047Y OR PIK3CA H1047L OR PIK3CA H1047D OR PIK3CA H1047I OR PIK3CA H1047N OR PIK3CA H1047P OR PIK3CA H1047Q OR PIK3CA H1047T | Breast Cancer | Sensitivity/Response | Palbociclib + Inavolisib + Fulvestrant | CIViC A | EID12533 |
| PIK3CA N345K OR PIK3CA N345D OR PIK3CA N345H OR PIK3CA N345I OR PIK3CA N345S OR PIK3CA N345T OR PIK3CA N345Y | Breast Cancer | Sensitivity/Response | Palbociclib + Inavolisib + Fulvestrant | CIViC A | EID12538 |
| PIK3CA Q546K OR PIK3CA Q546E OR PIK3CA Q546P OR PIK3CA Q546R OR PIK3CA Q546L OR PIK3CA K111E OR PIK3CA K111N OR PIK3CA K111R OR PIK3CA Q546H | Breast Cancer | Sensitivity/Response | Inavolisib + Fulvestrant + Palbociclib | CIViC A | EID12536 |
| PIK3CA R88Q OR PIK3CA C420R OR PIK3CA M1043V OR PIK3CA M1043I OR PIK3CA M1043T | Breast Cancer | Sensitivity/Response | Fulvestrant + Palbociclib + Inavolisib | CIViC A | EID12539 |
| CCND1 Overexpression | Mantle Cell Lymphoma | Sensitivity/Response | Palbociclib | CIViC B | EID1536 +1 |
| CDK4 Amplification | Liposarcoma | Sensitivity/Response | Palbociclib | CIViC B | EID1366 +1 |
| ESR1 Y537N | Breast Cancer | Sensitivity/Response | Palbociclib | CIViC B | EID4817 +1 |
| ESR1 Y537S | Breast Cancer | Sensitivity/Response | Palbociclib | CIViC B | EID4819 +1 |
| CCND1 Amplification | Lung Squamous Cell Carcinoma | Sensitivity/Response | Palbociclib | CIViC B | EID7405 |
| CCND1 Amplification OR CCND2 Amplification OR CCND3 Amplification | Cancer | Sensitivity/Response | Palbociclib | CIViC B | EID11673 |
| CCND2 Amplification | Lung Squamous Cell Carcinoma | Sensitivity/Response | Palbociclib | CIViC B | EID7406 |
| CCND3 Amplification | Lung Squamous Cell Carcinoma | Sensitivity/Response | Palbociclib | CIViC B | EID7407 |
| CCNE1 Underexpression | Breast Cancer | Sensitivity/Response | Fulvestrant + Palbociclib | CIViC B | EID7331 |
| CDK6 Overexpression | Breast Cancer | Sensitivity/Response | Palbociclib | CIViC B | EID11200 |
| CDKN2A Deletion | Gastrointestinal Stromal Tumor | Sensitivity/Response | Palbociclib | CIViC B | EID7311 |
| CDKN2A Loss OR CDKN2A Mutation | Pancreatic Cancer | Sensitivity/Response | Palbociclib | CIViC B | EID11653 |
| CDKN2A Loss OR CDKN2A Mutation | Biliary Tract Cancer | Sensitivity/Response | Palbociclib | CIViC B | EID11654 |
| CDKN2A Mutation | Pancreatic Cancer | Sensitivity/Response | Palbociclib | CIViC B | EID7299 |
| CDKN2A Mutation | Cholangiocarcinoma | Sensitivity/Response | Palbociclib | CIViC B | EID7300 |
| ESR1 Overexpression | Breast Cancer | Sensitivity/Response | Palbociclib + Letrozole | CIViC B | EID1541 |
| RB1 Wildtype AND ( CDKN2A Loss OR CDKN2A Mutation ) | Lung Non-small Cell Carcinoma | Sensitivity/Response | Palbociclib | CIViC B | EID11665 |
| CDKN2A Loss | Lung Non-small Cell Carcinoma | Resistance | Palbociclib | CIViC B | EID7444 |
| PIK3CA Mutation OR RB1 Mutation OR ESR1 Mutation | Breast Cancer | Resistance | Fulvestrant + Palbociclib | CIViC B | EID12045 |
| FGFR1 Amplification | Breast Cancer | Palbociclib + Erdafitinib + Fulvestrant | CIViC B | EID12485 | |
| CDKN2A Loss | Her2-receptor Negative Breast Cancer | Sensitivity/Response | Letrozole + Palbociclib | CIViC C | EID1765 |
| ESR1 D538G | Breast Cancer | Sensitivity/Response | Palbociclib | CIViC C | EID4813 |
+53 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 6 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
63 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| RIBOCICLIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| TRILACICLIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| ALVOCIDIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| DALPICICLIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| DINACICLIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| DOVITINIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| LEROCICLIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| LESTAURTINIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| QUERCETIN | ChEMBL | Phase 3 | CDK4, CDK6 |
| AT-7519 | ChEMBL | Phase 2 | CDK4, CDK6 |
| AT-9283 | ChEMBL | Phase 2 | CDK4, CDK6 |
| ATIRMOCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| CROZBACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| CT-7001 | ChEMBL | Phase 2 | CDK4, CDK6 |
| CULMERCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| EBVACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ECIRUCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| INDIRUBIN | ChEMBL | Phase 2 | CDK4, CDK6 |
| INIXACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ISTISOCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| MILCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| NARAZACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| RG-547 | ChEMBL | Phase 2 | CDK4, CDK6 |
| RIVICICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| SELICICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| TEGTOCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ULECACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| VORUCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ZEMIRCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| Afatinib | PubChem | Approved | CDK4, CDK6 |
| Binimetinib | PubChem | Approved | CDK4, CDK6 |
| Crizotinib | PubChem | Approved | CDK4, CDK6 |
| dacomitinib | PubChem | Approved | CDK4, CDK6 |
| Fostamatinib | PubChem | Approved | CDK4, CDK6 |
| Gefitinib | PubChem | Approved | CDK4, CDK6 |
| Idelalisib | PubChem | Approved | CDK4, CDK6 |
| Pazopanib | PubChem | Approved | CDK4, CDK6 |
| Pomalidomide | PubChem | Approved | CDK4, CDK6 |
| regorafenib | PubChem | Approved | CDK4, CDK6 |
| Selumetinib | PubChem | Approved | CDK4, CDK6 |
| Trametinib | PubChem | Approved | CDK4, CDK6 |
| CERITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| ENCORAFENIB | ChEMBL | Phase 4 (approved) | CDK4 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | CDK6 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | CDK4 |
| OLAPARIB | ChEMBL | Phase 4 (approved) | CDK6 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | CDK6 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| RUBOXISTAURIN | ChEMBL | Phase 3 | CDK4 |
| BI-2536 | ChEMBL | Phase 2 | CDK4 |
| CYC-065 | ChEMBL | Phase 2 | CDK4 |
| ELLAGIC ACID | ChEMBL | Phase 2 | CDK4 |
| FISETIN | ChEMBL | Phase 2 | CDK6 |
| LY-2090314 | ChEMBL | Phase 2 | CDK4 |
| REBASTINIB | ChEMBL | Phase 2 | CDK4 |
| RONICICLIB | ChEMBL | Phase 2 | CDK4 |
Related Atlas pages
- Genes: CDK4, CDK6
- Diseases: breast carcinoma, breast neoplasm, neoplasm, HER2 positive breast carcinoma, squamous cell lung carcinoma, head and neck squamous cell carcinoma, squamous cell carcinoma, soft tissue sarcoma, sarcoma, mantle cell lymphoma, pediatric liposarcoma, cancer, gastrointestinal stromal tumor, malignant pancreatic neoplasm, biliary tract cancer, cholangiocarcinoma, Her2-receptor negative breast cancer
- Drugs: Abemaciclib, Dabrafenib, Ribociclib, Trilaciclib, Alvocidib, Dalpiciclib, Dinaciclib, Dovitinib, Lerociclib, Lestaurtinib, Quercetin, Afatinib, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Pazopanib, Pomalidomide, regorafenib, Selumetinib, Trametinib, Ceritinib, Encorafenib, Fedratinib, Gilteritinib, Momelotinib, Nintedanib, Olaparib, Sorafenib, Sunitinib, Ruboxistaurin
- Biomarker genes: CCND1, CCND2, CCND3, CCNE1, CDKN2A, CDKN2B, ESR1, RB1