Pancuronium
drugOn this page
Also known as SID90341747SID50104094PANCURONIUM BROMIDE_PANCURONIUMPancuronium dibromide
Summary
Pancuronium (CHEMBL185073) is an approved small-molecule cholinergic antagonist (ATC M03AC01) targeting CHRNA1.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M03AC01
- Targets: 1 (CHRNA1)
- Chemistry: 572.9 Da · C35H60N2O4+2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL185073 |
| Name | Pancuronium |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 441289 |
| ChEBI | CHEBI:7907 |
| ATC | M03AC01 |
| Molecular formula | C35H60N2O4+2 |
| Molecular weight | 572.9 |
| InChIKey | GVEAYVLWDAFXET-XGHATYIMSA-N |
SMILES: CC(=O)O[C@H]1C[C@@H]2CC[C@@H]3[C@@H]([C@]2(C[C@@H]1[N+]4(CCCCC4)C)C)CC[C@]5([C@H]3C[C@@H]([C@@H]5OC(=O)C)[N+]6(CCCCC6)C)C
IUPAC name: [(2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-17-acetyloxy-10,13-dimethyl-2,16-bis(1-methylpiperidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
ChEBI definition: A steroid ester in which a 5α-androstane skeleton is C-3α- and C-17β-disubstituted with acetoxy groups and 2β- and 16β-disubstituted with 1-methylpiperidinium-1-yl groups. It is a non-depolarizing curare-mimetic muscle relaxant.
Pharmacological roles (ChEBI): muscle relaxant, cholinergic antagonist, nicotinic antagonist.
Also known as: Pancuronium, pancuronium, SID90341747, SID50104094, PANCURONIUM, PANCURONIUM BROMIDE_PANCURONIUM, Pancuronium dibromide
Parent form; salt/anhydrous children: CHEMBL1200757
Patent coverage: 8 distinct patent families (11 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CHRNA1 | nicotinic acetylcholine receptor α1 subunit | Antagonist | 0% | P02708 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: Voltage-gated inwardly rectifying potassium channel KCNH2, Serine/threonine-protein kinase mTOR.
Bioactivity
ChEMBL activities: 2 potent at pChembl ≥ 5 of 2 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MTOR | 6.68 | Potency | 207.5 | nM | CHEMBL_ACT_4787618 |
| KCNH2 | 5.9 | AC50 | 1260 | nM | CHEMBL_ACT_25117873 |
Target pathways
Aggregated over 1 target gene(s): CHRNA1.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neurotransmitter receptors and postsynaptic signal transmission | 1 | CHRNA1 |
| Transmission across Chemical Synapses | 1 | CHRNA1 |
| Neuronal System | 1 | CHRNA1 |
| Acetylcholine binding and downstream events | 1 | CHRNA1 |
| Presynaptic nicotinic acetylcholine receptors | 1 | CHRNA1 |
| Postsynaptic nicotinic acetylcholine receptors | 1 | CHRNA1 |
| Highly calcium permeable postsynaptic nicotinic acetylcholine receptors | 1 | CHRNA1 |
| Highly calcium permeable nicotinic acetylcholine receptors | 1 | CHRNA1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| skeletal muscle contraction | 1 |
| synaptic transmission, cholinergic | 1 |
| neuromuscular synaptic transmission | 1 |
| neuromuscular junction development | 1 |
| neuronal action potential | 1 |
| monoatomic ion transmembrane transport | 1 |
| response to nicotine | 1 |
| regulation of membrane potential | 1 |
| muscle cell cellular homeostasis | 1 |
| skeletal muscle tissue growth | 1 |
| musculoskeletal movement | 1 |
| neuromuscular process | 1 |
| membrane depolarization | 1 |
| neuron cellular homeostasis | 1 |
| acetylcholine receptor signaling pathway | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
14 molecules share ≥1 primary target. Top 14 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BUPROPION | ChEMBL + PubChem | Phase 4 (approved) | CHRNA1 |
| MECAMYLAMINE | ChEMBL + PubChem | Phase 4 (approved) | CHRNA1 |
| NICOTINE | ChEMBL + PubChem | Phase 4 (approved) | CHRNA1 |
| VARENICLINE | ChEMBL + PubChem | Phase 4 (approved) | CHRNA1 |
| TROPISETRON | ChEMBL | Phase 4 (approved) | CHRNA1 |
| CYTISINICLINE | ChEMBL + PubChem | Phase 3 (approved) | CHRNA1 |
| DEXMECAMYLAMINE | ChEMBL | Phase 3 | CHRNA1 |
| ALTINICLINE | ChEMBL | Phase 2 | CHRNA1 |
| GTS-21 | ChEMBL | Phase 2 | CHRNA1 |
| MOLIBRESIB | ChEMBL | Phase 2 | CHRNA1 |
| RADAFAXINE | ChEMBL | Phase 2 | CHRNA1 |
| Atracurium | PubChem | Approved | CHRNA1 |
| Imidacloprid | PubChem | Approved | CHRNA1 |
| Ondansetron | PubChem | Approved | CHRNA1 |
Related Atlas pages
- Genes: CHRNA1
- Drugs: Bupropion, Mecamylamine, Nicotine, Varenicline, Tropisetron, Cytisinicline, Dexmecamylamine, Atracurium, Ondansetron