Papaverine
drugOn this page
Also known as NSC-136630PapaverinumpapaverinSID11111623SID11111624SID11111625SID50104295SID90341237SID124881091papavarinePAPAVERINE HYDROCHLORIDEMMV002798
Summary
Papaverine (CHEMBL19224) is an approved small-molecule vasodilator agent (ATC G04BE52) targeting PDE3A, PDE3B, and PDE10A; indicated across 7 conditions including erectile dysfunction and gastroenteritis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G04BE52 (+2 more)
- Targets: 3 (PDE3A, PDE3B, PDE10A)
- Indications: 7 conditions
- Clinical trials: 13
- Chemistry: 339.4 Da · C20H21NO4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL19224 |
| Name | Papaverine |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | yes |
| PubChem CID | 4680 |
| ChEBI | CHEBI:28241 |
| ATC | G04BE52, G04BE02, A03AD01 |
| Molecular formula | C20H21NO4 |
| Molecular weight | 339.4 |
| InChIKey | XQYZDYMELSJDRZ-UHFFFAOYSA-N |
SMILES: COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC
IUPAC name: 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline
ChEBI definition: A benzylisoquinoline alkaloid that is isoquinoline substituted by methoxy groups at positions 6 and 7 and a 3,4-dimethoxybenzyl group at position 1. It has been isolated from Papaver somniferum.
Pharmacological roles (ChEBI): vasodilator agent, antispasmodic drug.
Also known as: NSC-136630, Papaverine, Papaverinum, papaverine, papaverin, SID11111623, SID11111624, SID11111625, SID50104295, SID90341237, SID124881091, PAPAVERINE
Parent form; salt/anhydrous children: CHEMBL98123, CHEMBL5278358
Patent coverage: 7,075 distinct patent families (22,172 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 21,767 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PDE3A | phosphodiesterase 3A | Inhibition | 6.04 | 0.1% | Q14432 |
| PDE3B | phosphodiesterase 3B | Inhibition | 5.99 | 0.2% | Q13370 |
| PDE10A | phosphodiesterase 10A | Inhibition | 7.68 | 0.1% | Q9Y233 |
Broader ChEMBL bioactivity targets: 41 (assay-derived). Sample: Ubiquitin carboxyl-terminal hydrolase 2, Nuclear receptor ROR-gamma, Survival motor neuron protein, Prelamin-A/C, Inositol monophosphatase 1, 4’-phosphopantetheinyl transferase ffp, Thrombopoietin, Ras-related protein Rab-9A, ATP-binding cassette sub-family C member 4, cGMP-specific 3’,5’-cyclic phosphodiesterase.
Bioactivity
ChEMBL activities: 81 potent at pChembl ≥ 5 of 108 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P51450 | 8.55 | Potency | 2.8 | nM | CHEMBL_ACT_4972248 |
| PDE10A | 7.77 | IC50 | 17 | nM | CHEMBL_ACT_5127548 |
| PDE10A | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_6337522 |
| PDE10A | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_14650045 |
| PDE10A | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_15151306 |
| Q9QYJ6 | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_16421368 |
| Q9QYJ6 | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_18657963 |
| Q9QYJ6 | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_18984741 |
| PDE10A | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_19032237 |
| PDE10A | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_24985001 |
| Q9QYJ6 | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_6337584 |
| PDE10A | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_8047627 |
| PDE10A | 7.42 | IC50 | 38 | nM | CHEMBL_ACT_22905669 |
| PDE10A | 7.4 | IC50 | 40 | nM | CHEMBL_ACT_12157791 |
| PDE10A | 7.31 | IC50 | 49 | nM | CHEMBL_ACT_29311598 |
| PDE10A | 7.25 | IC50 | 56.9 | nM | CHEMBL_ACT_3310701 |
| P08482 | 7.25 | Potency | 56.2 | nM | CHEMBL_ACT_4811336 |
| PDE10A | 7.12 | IC50 | 76 | nM | CHEMBL_ACT_3310758 |
| PDE10A | 7.04 | IC50 | 92.3 | nM | CHEMBL_ACT_16491770 |
| PDE10A | 7.04 | IC50 | 92.3 | nM | CHEMBL_ACT_26105984 |
| PDE10A | 7.01 | IC50 | 97 | nM | CHEMBL_ACT_18984710 |
| PDE10A | 6.68 | IC50 | 210 | nM | CHEMBL_ACT_13419208 |
| PDE10A | 6.68 | IC50 | 210 | nM | CHEMBL_ACT_6212179 |
| PDE3A | 6.55 | IC50 | 284 | nM | CHEMBL_ACT_12157790 |
| PDE3A | 6.55 | Ki | 279 | nM | CHEMBL_ACT_1803384 |
| PDE3A | 6.54 | IC50 | 287 | nM | CHEMBL_ACT_19052112 |
| PDE3A | 6.43 | AC50 | 370 | nM | CHEMBL_ACT_25190747 |
| PDE3B | 6.38 | Ki | 417 | nM | CHEMBL_ACT_1803385 |
| CREBBP | 6.25 | Potency | 562.3 | nM | CHEMBL_ACT_4773275 |
| CREBBP | 6.15 | Potency | 707.9 | nM | CHEMBL_ACT_4773171 |
Target pathways
Aggregated over 3 target gene(s): PDE3A, PDE3B, PDE10A.
Top Reactome pathways
3 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| G alpha (s) signalling events | 3 | PDE10A, PDE3A, PDE3B |
| PDE3B signalling | 1 | PDE3B |
| cGMP effects | 1 | PDE10A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of cAMP/PKA signal transduction | 3 |
| signal transduction | 3 |
| G protein-coupled receptor signaling pathway | 2 |
| negative regulation of adenylate cyclase-activating G protein-coupled receptor signaling pathway | 2 |
| oocyte maturation | 1 |
| lipid metabolic process | 1 |
| response to xenobiotic stimulus | 1 |
| regulation of meiotic nuclear division | 1 |
| negative regulation of apoptotic process | 1 |
| negative regulation of vascular permeability | 1 |
| positive regulation of vascular permeability | 1 |
| positive regulation of oocyte development | 1 |
| regulation of ribonuclease activity | 1 |
| cellular response to cGMP | 1 |
| cellular response to transforming growth factor beta stimulus | 1 |
Indications & clinical
Indications
7 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| erectile dysfunction | 4 | MONDO:0005362 | EFO:0004234 |
| gastroenteritis | 3 | MONDO:0002269 | EFO:1001463 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| lung neoplasm | 1 | MONDO:0021117 | MONDO:0008903 |
| benign prostatic hyperplasia | 0 | MONDO:0010811 | EFO:0000284 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 13.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 3 |
| PHASE1 | 3 |
| PHASE2 | 2 |
| EARLY_PHASE1 | 2 |
| Not specified | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03894904 | PHASE4 | COMPLETED | Papaverine vs Heparin for Peripheral Arterial Catheter Patency in Pediatric Patients |
| NCT04162834 | PHASE4 | COMPLETED | Effect of Papaverine on Renal Artery Blood Flow Volume |
| NCT06550232 | PHASE4 | COMPLETED | IV PAPAVERINE Prior to Propess for Labor Induction |
| NCT02711241 | PHASE3 | TERMINATED | Optimal Analgesia in Acute Gastroenteritis |
| NCT00080808 | PHASE2 | COMPLETED | Nerve-Sparing Radical Prostatectomy With or Without Nerve Grafting Followed by Standard Therapy for Erectile Dysfunction in Treating Patients With Localized Prostate Cancer |
| NCT05861765 | PHASE2 | UNKNOWN | The Efficacy of Papaverine to Prevent Radial Artery Spasm During Transradial Cerebral Angiography |
| NCT03824327 | PHASE1 | ACTIVE_NOT_RECRUITING | Papaverine and Stereotactic Body Radiotherapy (SBRT) for Non Small Cell Lung Cancer (NSCLC) or Lung Metastases |
| NCT05136846 | PHASE1 | RECRUITING | Papaverine in Combination With Chemoradiation for the Treatment of Stage II-III Non-small Cell Lung Cancer |
| NCT06834126 | PHASE1 | RECRUITING | Papaverine in Combination With Radiation Therapy for the Treatment of Locally Advanced Rectal Cancer, DINOMITE Trial |
| NCT03064282 | EARLY_PHASE1 | UNKNOWN | Prostatic Hyperplasia Treatment and Cancer Prevention |
| NCT04030663 | EARLY_PHASE1 | COMPLETED | The Effect of Periradial Injection of Papaverine Versus Nitroglycerine on Radial Artery Diameter |
| NCT06547437 | Not specified | NOT_YET_RECRUITING | Papaverine and Oxytocin vs Oxytocin Alone in Labor Induction |
| NCT07572461 | Not specified | NOT_YET_RECRUITING | A Single-Arm, Prospective Study of Papaverine for the Treatment of Refractory Peripheral Neuropathy Induced by Taxane-Based Chemotherapy |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 2 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
207 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| SILDENAFIL | ChEMBL + PubChem | Phase 4 (approved) | PDE10A, PDE3A, PDE3B |
| VARDENAFIL | ChEMBL + PubChem | Phase 4 (approved) | PDE10A, PDE3A, PDE3B |
| DIPYRIDAMOLE | ChEMBL | Phase 4 (approved) | PDE10A, PDE3A, PDE3B |
| Tadalafil | PubChem | Approved | PDE10A, PDE3A, PDE3B |
| ANAGRELIDE | ChEMBL + PubChem | Phase 4 (approved) | PDE3A, PDE3B |
| LOSARTAN | ChEMBL + PubChem | Phase 4 (approved) | PDE3A, PDE3B |
| CILOSTAZOL | ChEMBL | Phase 4 (approved) | PDE3A, PDE3B |
| CRISABOROLE | ChEMBL | Phase 4 (approved) | PDE3A, PDE3B |
| ENOXIMONE | ChEMBL | Phase 4 (approved) | PDE3A, PDE3B |
| IBUDILAST | ChEMBL | Phase 4 (approved) | PDE3A, PDE3B |
| INAMRINONE | ChEMBL | Phase 4 (approved) | PDE3A, PDE3B |
| MILRINONE | ChEMBL | Phase 4 (approved) | PDE3A, PDE3B |
| LEVOSIMENDAN | ChEMBL | Phase 3 | PDE3A, PDE3B |
| ADIBENDAN | ChEMBL | Phase 2 | PDE3A, PDE3B |
| BEMARINONE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| BEMORADAN | ChEMBL | Phase 2 | PDE3A, PDE3B |
| CC-115 | ChEMBL | Phase 2 | PDE3A, PDE3B |
| CILOSTAMIDE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| ETAZOLATE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| IMAZODAN | ChEMBL | Phase 2 | PDE3A, PDE3B |
| INDOLIDAN | ChEMBL | Phase 2 | PDE3A, PDE3B |
| ISOMAZOLE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| LIXAZINONE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| MEDORINONE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| MERIBENDAN | ChEMBL | Phase 2 | PDE3A, PDE3B |
| ORISMILAST | ChEMBL | Phase 2 | PDE3A, PDE3B |
| OXAGRELATE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| PIMOBENDAN | ChEMBL | Phase 2 | PDE3A, PDE3B |
| PIROXIMONE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| QUAZINONE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| SIMENDAN | ChEMBL | Phase 2 | PDE3A, PDE3B |
| SULMAZOLE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| VESNARINONE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| ZARDAVERINE | ChEMBL | Phase 2 | PDE3A, PDE3B |
| CLOFARABINE | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| IDELALISIB | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| TAFAMIDIS | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| TAVABOROLE | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| ACARBOSE | ChEMBL | Phase 4 (approved) | PDE3A |
| ADENOSINE | ChEMBL | Phase 4 (approved) | PDE3A |
| ALECTINIB | ChEMBL | Phase 4 (approved) | PDE3A |
| ALENDRONIC ACID | ChEMBL | Phase 4 (approved) | PDE3A |
| AMINOGLUTETHIMIDE | ChEMBL | Phase 4 (approved) | PDE3A |
| AMLEXANOX | ChEMBL | Phase 4 (approved) | PDE3A |
| ANTAZOLINE | ChEMBL | Phase 4 (approved) | PDE3A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | PDE3A |
| BENAZEPRIL | ChEMBL | Phase 4 (approved) | PDE3A |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | PDE3A |
| BITHIONOL | ChEMBL | Phase 4 (approved) | PDE3A |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | PDE3A |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | PDE3A |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | PDE3A |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | PDE3A |
| CEFOPERAZONE | ChEMBL | Phase 4 (approved) | PDE3A |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CHOLIC ACID | ChEMBL | Phase 4 (approved) | PDE3A |
| CINCHOPHEN | ChEMBL | Phase 4 (approved) | PDE10A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CLADRIBINE | ChEMBL | Phase 4 (approved) | PDE3A |
Related Atlas pages
- Genes: PDE3A, PDE3B, PDE10A
- Diseases: erectile dysfunction, gastroenteritis
- Drugs: Sildenafil, Vardenafil, Dipyridamole, Tadalafil, Anagrelide, Losartan, Cilostazol, Crisaborole, Enoximone, Ibudilast, Inamrinone, Milrinone, Levosimendan, Clofarabine, Idelalisib, Tafamidis, Tavaborole, Acarbose, Adenosine, Alectinib, Alendronic Acid, Aminoglutethimide, Amlexanox, Antazoline, Aripiprazole, Benazepril, Benzbromarone, Bithionol, Cabozantinib, Calcitriol, Candesartan Cilexetil, Cannabidiol, Cefoperazone, Chlorhexidine, Chloroquine, Cholic Acid, Cinchophen, Cinnarizine, Cladribine