Pentagastrin
drugOn this page
Also known as AY-6608ICI 50,123ICI-50123NSC-367746PentagastrinaPentagastrinePeptavlonSID170465396SID144207028SID124894389
Summary
Pentagastrin (CHEMBL1328) is an approved small molecule (ATC V04CG04) targeting CCKAR and CCKBR.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: V04CG04
- Targets: 2 (CCKAR, CCKBR)
- Clinical trials: 1
- Chemistry: 767.9 Da · C37H49N7O9S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1328 |
| Name | Pentagastrin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 9853654 |
| ATC | V04CG04 |
| Molecular formula | C37H49N7O9S |
| Molecular weight | 767.9 |
| InChIKey | NEYNJQRKHLUJRU-DZUOILHNSA-N |
SMILES: CC(C)(C)OC(=O)NCCC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N
IUPAC name: (3S)-4-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-[[(2S)-2-[[(2S)-3-(1H-indol-3-yl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-oxobutanoic acid
Also known as: AY-6608, ICI 50,123, ICI-50123, NSC-367746, Pentagastrin, Pentagastrina, Pentagastrine, Peptavlon, PENTAGASTRIN, SID170465396, SID144207028, SID124894389
Patent coverage: 1,720 distinct patent families (5,374 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 5,371 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CCKAR | CCK1 receptor | Full agonist | 6.2 | 0% | P32238 |
| CCKBR | CCK2 receptor | Full agonist | 9.1 | 0.3% | P32239 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: Gastrin/cholecystokinin type B receptor, Cholecystokinin receptor type A, Gastrin/cholecystokinin type B receptor, Gastrin/cholecystokinin type B receptor.
Bioactivity
ChEMBL activities: 15 potent at pChembl ≥ 5 of 15 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P30553 | 9.37 | EC50 | 0.43 | nM | CHEMBL_ACT_22438525 |
| P56481 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_267223 |
| P56481 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_289877 |
| P56481 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_632380 |
| CCKBR | 9 | IC50 | 1 | nM | CHEMBL_ACT_22438518 |
| CCKBR | 8.55 | EC50 | 2.8 | nM | CHEMBL_ACT_22438521 |
| P30553 | 8.17 | IC50 | 6.8 | nM | CHEMBL_ACT_777418 |
| CCKBR | 7.84 | Ki | 14.5 | nM | CHEMBL_ACT_1075036 |
| CCKBR | 7.66 | Ki | 22 | nM | CHEMBL_ACT_522608 |
| CCKBR | 7.28 | Ki | 52 | nM | CHEMBL_ACT_1075037 |
| P30551 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_267224 |
| P30551 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_289876 |
| P30551 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_632381 |
| P30551 | 5.76 | IC50 | 1750 | nM | CHEMBL_ACT_777417 |
| CCKBR | 5.22 | IC50 | 6000 | nM | CHEMBL_ACT_777419 |
Target pathways
Aggregated over 2 target gene(s): CCKAR, CCKBR.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Peptide ligand-binding receptors | 2 | CCKAR, CCKBR |
| G alpha (q) signalling events | 2 | CCKAR, CCKBR |
| Signal Transduction | 1 | CCKAR |
| Signaling by GPCR | 1 | CCKAR |
| Class A/1 (Rhodopsin-like receptors) | 1 | CCKAR |
| GPCR downstream signalling | 1 | CCKAR |
| GPCR ligand binding | 1 | CCKAR |
| Gastrin-CREB signalling pathway via PKC and MAPK | 1 | CCKBR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 2 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 2 |
| cholecystokinin signaling pathway | 2 |
| signal transduction | 2 |
| neuron migration | 1 |
| axonogenesis | 1 |
| forebrain development | 1 |
| cellular response to hormone stimulus | 1 |
| regulation of hormone secretion | 1 |
| gastric acid secretion | 1 |
| cell surface receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| neuropeptide signaling pathway | 1 |
| positive regulation of cell population proliferation | 1 |
| pH reduction | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00702533 | Not specified | COMPLETED | A New Method for Determining Gastric Acid Output Using a Wireless Capsule |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
122 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | CCKAR, CCKBR |
| Docetaxel | ChEMBL + PubChem | Phase 4 (approved) | CCKAR, CCKBR |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | CCKAR, CCKBR |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | CCKAR, CCKBR |
| CHLORDIAZEPOXIDE | ChEMBL | Phase 4 (approved) | CCKAR, CCKBR |
| INDOCYANINE GREEN ACID FORM | ChEMBL | Phase 4 (approved) | CCKAR, CCKBR |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | CCKAR, CCKBR |
| RIFAXIMIN | ChEMBL | Phase 4 (approved) | CCKAR, CCKBR |
| RIMONABANT | ChEMBL | Phase 4 (approved) | CCKAR, CCKBR |
| SINCALIDE | ChEMBL | Phase 4 (approved) | CCKAR, CCKBR |
| CE-326597 | ChEMBL | Phase 2 | CCKAR, CCKBR |
| DEVAZEPIDE | ChEMBL | Phase 2 | CCKAR, CCKBR |
| NETAZEPIDE | ChEMBL | Phase 2 | CCKAR, CCKBR |
| Abiraterone | PubChem | Approved | CCKAR, CCKBR |
| acetylcysteine | PubChem | Approved | CCKAR, CCKBR |
| Aclidinium Bromide | PubChem | Approved | CCKAR, CCKBR |
| Acyclovir | PubChem | Approved | CCKAR, CCKBR |
| Allopurinol | PubChem | Approved | CCKAR, CCKBR |
| Almotriptan | PubChem | Approved | CCKAR, CCKBR |
| Alogliptin | PubChem | Approved | CCKAR, CCKBR |
| aminolevulinic acid | PubChem | Approved | CCKAR, CCKBR |
| Anagrelide | PubChem | Approved | CCKAR, CCKBR |
| Apixaban | PubChem | Approved | CCKAR, CCKBR |
| Bosentan | PubChem | Approved | CCKAR, CCKBR |
| Clofarabine | PubChem | Approved | CCKAR, CCKBR |
| Clozapine | PubChem | Approved | CCKAR, CCKBR |
| Crizotinib | PubChem | Approved | CCKAR, CCKBR |
| Desloratadine | PubChem | Approved | CCKAR, CCKBR |
| Dihydroergotamine | PubChem | Approved | CCKAR, CCKBR |
| Erythromycin | PubChem | Approved | CCKAR, CCKBR |
| Ethambutol | PubChem | Approved | CCKAR, CCKBR |
| Fulvestrant | PubChem | Approved | CCKAR, CCKBR |
| Ganciclovir | PubChem | Approved | CCKAR, CCKBR |
| Gefitinib | PubChem | Approved | CCKAR, CCKBR |
| Glycopyrrolate | PubChem | Approved | CCKAR, CCKBR |
| Leucovorin | PubChem | Approved | CCKAR, CCKBR |
| Linagliptin | PubChem | Approved | CCKAR, CCKBR |
| Methotrexate | PubChem | Approved | CCKAR, CCKBR |
| Olanzapine | PubChem | Approved | CCKAR, CCKBR |
| Olmesartan Medoxomil | PubChem | Approved | CCKAR, CCKBR |
| Pramipexole | PubChem | Approved | CCKAR, CCKBR |
| Propoxyphene | PubChem | Approved | CCKAR, CCKBR |
| Pyrazinamide | PubChem | Approved | CCKAR, CCKBR |
| Rufinamide | PubChem | Approved | CCKAR, CCKBR |
| saxagliptin | PubChem | Approved | CCKAR, CCKBR |
| Sildenafil | PubChem | Approved | CCKAR, CCKBR |
| Tadalafil | PubChem | Approved | CCKAR, CCKBR |
| Tafamidis | PubChem | Approved | CCKAR, CCKBR |
| Tamsulosin | PubChem | Approved | CCKAR, CCKBR |
| Tegaserod | PubChem | Approved | CCKAR, CCKBR |
| Tiotropium Bromide Monohydrate | PubChem | Approved | CCKAR, CCKBR |
| Valacyclovir | PubChem | Approved | CCKAR, CCKBR |
| Valganciclovir | PubChem | Approved | CCKAR, CCKBR |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | CCKAR |
| FIDAXOMICIN | ChEMBL + PubChem | Phase 4 (approved) | CCKBR |
| AMSACRINE | ChEMBL | Phase 4 (approved) | CCKAR |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | CCKBR |
| AZLOCILLIN | ChEMBL | Phase 4 (approved) | CCKBR |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | CCKAR |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | CCKAR |
Related Atlas pages
- Genes: CCKAR, CCKBR
- Drugs: Afatinib, Docetaxel, Rifampin, Candesartan Cilexetil, Chlordiazepoxide, Indocyanine Green Acid Form, Nitazoxanide, Rifaximin, Rimonabant, Sincalide, Abiraterone, acetylcysteine, Aclidinium Bromide, Acyclovir, Allopurinol, Almotriptan, Alogliptin, aminolevulinic acid, Anagrelide, Apixaban, Bosentan, Clofarabine, Clozapine, Crizotinib, Desloratadine, Dihydroergotamine, Erythromycin, Ethambutol, Fulvestrant, Ganciclovir, Gefitinib, Glycopyrrolate, Linagliptin, Methotrexate, Olanzapine, Olmesartan Medoxomil, Pramipexole, Propoxyphene, Pyrazinamide, Rufinamide, saxagliptin, Sildenafil, Tadalafil, Tafamidis, Tamsulosin, Tegaserod, Valacyclovir, Valganciclovir, Atazanavir, Fidaxomicin, Amsacrine, Apomorphine, Azlocillin, Bepridil, Cannabidiol