Pentazocine
drugOn this page
Also known as Dl-pentazocineNIH-7958NSC-107430PentazocinaPentazocine civWIN 20,228WIN-20228Pentazocin(+)-Pentazocine(R)-Pentazocine(-)-Pentazocine
Summary
Pentazocine (CHEMBL100116) is an approved small molecule (ATC N02AD01) targeting SIGMAR1, OPRD1, and OPRK1; indicated across 2 conditions including bipolar disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N02AD01
- Targets: 4 (SIGMAR1, OPRD1, OPRK1…)
- Indications: 2 conditions
- Clinical trials: 3
- Chemistry: 285.4 Da · C19H27NO
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL100116 |
| Name | Pentazocine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4736 |
| ATC | N02AD01 |
| Molecular formula | C19H27NO |
| Molecular weight | 285.4 |
| InChIKey | VOKSWYLNZZRQPF-UHFFFAOYSA-N |
SMILES: CC1C2CC3=C(C1(CCN2CC=C(C)C)C)C=C(C=C3)O
IUPAC name: 1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol
Also known as: Dl-pentazocine, NIH-7958, NSC-107430, Pentazocina, Pentazocine, Pentazocine civ, WIN 20,228, WIN-20228, PENTAZOCINE, Pentazocin, (+)-Pentazocine, pentazocine
Parent form; salt/anhydrous children: CHEMBL3989509, CHEMBL3989510, CHEMBL5483020
Patent coverage: 8,479 distinct patent families (33,194 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 33,178 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SIGMAR1 | sigma non-opioid intracellular receptor 1 | Antagonist | 2.6% | Q99720 | |
| OPRD1 | δ receptor | Full agonist | 7.3 | 0.2% | P41143 |
| OPRK1 | κ receptor | Partial agonist | 8.6 | 0% | P41145 |
| OPRM1 | μ receptor | Partial agonist | 8.4 | 0% | P35372 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Mu-type opioid receptor, Delta-type opioid receptor, Kappa-type opioid receptor, Sigma non-opioid intracellular receptor 1, Sigma intracellular receptor 2, Sigma intracellular receptor 2, Sigma non-opioid intracellular receptor 1.
Bioactivity
ChEMBL activities: 38 potent at pChembl ≥ 5 of 38 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| OPRK1 | 8.66 | Ki | 2.2 | nM | CHEMBL_ACT_22850854 |
| OPRM1 | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_27066968 |
| OPRM1 | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_27465314 |
| OPRM1 | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_28072706 |
| OPRM1 | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_28876637 |
| Q60492 | 8.54 | Kd | 2.9 | nM | CHEMBL_ACT_19227129 |
| Q60492 | 8.51 | Ki | 3.1 | nM | CHEMBL_ACT_25067169 |
| OPRM1 | 8.49 | Ki | 3.2 | nM | CHEMBL_ACT_25611550 |
| OPRM1 | 8.41 | Ki | 3.9 | nM | CHEMBL_ACT_22850853 |
| Q60492 | 8.41 | Ki | 3.93 | nM | CHEMBL_ACT_24415831 |
| Q60492 | 8.37 | Ki | 4.3 | nM | CHEMBL_ACT_24796409 |
| Q60492 | 8.33 | Ki | 4.7 | nM | CHEMBL_ACT_20652124 |
| Q60492 | 8.33 | Ki | 4.7 | nM | CHEMBL_ACT_22992800 |
| SIGMAR1 | 8.33 | Ki | 4.7 | nM | CHEMBL_ACT_24735213 |
| Q60492 | 8.27 | Ki | 5.4 | nM | CHEMBL_ACT_18448051 |
| Q60492 | 8.27 | Ki | 5.4 | nM | CHEMBL_ACT_18507214 |
| Q60492 | 8.27 | Ki | 5.4 | nM | CHEMBL_ACT_19120822 |
| Q60492 | 8.27 | Ki | 5.4 | nM | CHEMBL_ACT_22422103 |
| Q60492 | 8.27 | Ki | 5.4 | nM | CHEMBL_ACT_24887256 |
| Q60492 | 8.24 | Ki | 5.7 | nM | CHEMBL_ACT_22910524 |
| Q60492 | 8.24 | Ki | 5.7 | nM | CHEMBL_ACT_23192290 |
| Q60492 | 8.24 | Ki | 5.7 | nM | CHEMBL_ACT_24758484 |
| Q60492 | 8.24 | Ki | 5.7 | nM | CHEMBL_ACT_24888292 |
| OPRK1 | 8.12 | Ki | 7.6 | nM | CHEMBL_ACT_25611537 |
| SIGMAR1 | 7.92 | Ki | 12.1 | nM | CHEMBL_ACT_22850776 |
| Q60492 | 7.82 | Ki | 15 | nM | CHEMBL_ACT_18793097 |
| OPRK1 | 7.4 | EC50 | 40 | nM | CHEMBL_ACT_25611561 |
| OPRD1 | 7.21 | Ki | 62 | nM | CHEMBL_ACT_25611577 |
| OPRM1 | 7.21 | EC50 | 61 | nM | CHEMBL_ACT_27066971 |
| OPRM1 | 7.21 | EC50 | 61 | nM | CHEMBL_ACT_27465317 |
Target pathways
Aggregated over 4 target gene(s): SIGMAR1, OPRD1, OPRK1, OPRM1.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Peptide ligand-binding receptors | 3 | OPRD1, OPRK1, OPRM1 |
| G alpha (i) signalling events | 3 | OPRD1, OPRK1, OPRM1 |
| Interleukin-4 and Interleukin-13 signaling | 2 | OPRD1, OPRM1 |
| MECP2 regulates neuronal receptors and channels | 2 | OPRK1, OPRM1 |
| Opioid Signalling | 1 | OPRM1 |
| Disease | 1 | SIGMAR1 |
| G-protein activation | 1 | OPRM1 |
| Infectious disease | 1 | SIGMAR1 |
| Potential therapeutics for SARS | 1 | SIGMAR1 |
| SARS-CoV Infections | 1 | SIGMAR1 |
| Viral Infection Pathways | 1 | SIGMAR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled opioid receptor signaling pathway | 4 |
| G protein-coupled receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 3 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 3 |
| neuropeptide signaling pathway | 3 |
| signal transduction | 3 |
| immune response | 2 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| response to nicotine | 2 |
| eating behavior | 2 |
| response to ethanol | 2 |
| sensory perception | 2 |
| sensory perception of pain | 2 |
| lipid transport | 1 |
| nervous system development | 1 |
Indications & clinical
Indications
2 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| bipolar disorder | 2 | MONDO:0004985 | MONDO:0004985 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 3.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 1 |
| PHASE2 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02208596 | PHASE4 | UNKNOWN | The Feasibility of Different Doses of Etomidate Admixed With Propofol in Induced Abortion: A Randomized, Double Blind Controlled Trial |
| NCT00431184 | PHASE2 | COMPLETED | Effects of Pentazocine Versus Lorazepam on Manic Symptoms |
| NCT04539249 | Not specified | COMPLETED | Opioid-free Analgesia for the Management of Acute Post-operative Pain Following Caesarean Section |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
687 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| FENTANYL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| PAROXETINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| FLUNARIZINE | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| METAZOCINE | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| NALORPHINE | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| NIGULDIPINE | ChEMBL | Phase 2 | OPRD1, OPRK1, OPRM1, SIGMAR1 |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| TAFAMIDIS | ChEMBL + PubChem | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| ALVIMOPAN | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BUPRENORPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| BUTORPHANOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CINACALCET | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, SIGMAR1 |
| CODEINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| DEXTROMETHORPHAN | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| HYDROCODONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| HYDROMORPHONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LANSOPRAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LEVORPHANOL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MEPERIDINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| METHADONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| METHYLNALTREXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | OPRK1, OPRM1, SIGMAR1 |
| MORPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NAFTOPIDIL | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALBUPHINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALFURAFINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALMEFENE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALOXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NALTREXONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OLICERIDINE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OXYCODONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| OXYMORPHONE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
| PASIREOTIDE | ChEMBL | Phase 4 (approved) | OPRD1, OPRK1, OPRM1 |
Related Atlas pages
- Genes: SIGMAR1, OPRD1, OPRK1, OPRM1
- Drugs: Dihydroergotamine, Amiodarone, Astemizole, Benztropine, Chlorpromazine, Cinnarizine, Econazole, Fentanyl, Fluphenazine, Loperamide, Paroxetine, Raloxifene, Tamoxifen, Propoxyphene, Tafamidis, Alvimopan, Amitriptyline, Amlodipine, Amoxapine, Buprenorphine, Butorphanol, Candesartan Cilexetil, Cannabidiol, Cinacalcet, Clemastine, Clomipramine, Clotrimazole, Clozapine, Codeine, Dextromethorphan, Diethylstilbestrol, Dobutamine, Fluoxetine, Fluspirilene, Hydrocodone, Hydromorphone, Lansoprazole, Levorphanol, Loxapine, Meperidine, Methadone, Methylnaltrexone, Miconazole, Mifepristone, Morphine, Naftopidil, Nalbuphine, Nalfurafine, Nalmefene, Naloxone, Naltrexone, Nelfinavir, Oliceridine, Oxycodone, Oxymorphone, Pasireotide