Periciazine
drugOn this page
Also known as NeulactilNSC-758641PericiazinaPericyazinePropericiazineRP 8909RP 8909SKF 20716RP-8909SKF 20716SKF-20716SID26748871SID144204970
Summary
Periciazine (CHEMBL251940) is an approved small-molecule adrenergic antagonist (ATC N05AC01) targeting DRD1; indicated across 1 condition including psychotic disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05AC01
- Targets: 1 (DRD1)
- Indications: 1 condition
- Chemistry: 365.5 Da · C21H23N3OS
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL251940 |
| Name | Periciazine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4747 |
| ChEBI | CHEBI:31981 |
| ATC | N05AC01 |
| Molecular formula | C21H23N3OS |
| Molecular weight | 365.5 |
| InChIKey | LUALIOATIOESLM-UHFFFAOYSA-N |
SMILES: C1CN(CCC1O)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C#N
IUPAC name: 10-[3-(4-hydroxypiperidin-1-yl)propyl]phenothiazine-2-carbonitrile
ChEBI definition: A member of the class of phenothiazines that is 10H-phenothiazine substituted by a 3-(4-hydroxypiperidin-1-yl)propyl group at the nitrogen atom and a carbonitrile group at position 2. Periciazine is a first generation antipsychotic.
Pharmacological roles (ChEBI): sedative, adrenergic antagonist, first generation antipsychotic.
Also known as: Neulactil, NSC-758641, Periciazina, Periciazine, Pericyazine, Propericiazine, RP 8909, RP 8909SKF 20716, RP-8909, SKF 20716, SKF-20716, SID26748871
Patent coverage: 777 distinct patent families (3,047 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 3,009 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| DRD1 | D1 receptor | Antagonist | 8 | 0% | P21728 |
Broader ChEMBL bioactivity targets: 22 (assay-derived). Sample: Prelamin-A/C, Alpha-2A adrenergic receptor, D(1A) dopamine receptor, Thromboxane A2 receptor, Progesterone receptor, Muscarinic acetylcholine receptor M2, 5-hydroxytryptamine receptor 1A, Muscarinic acetylcholine receptor M1, Acetylcholinesterase, Prostaglandin G/H synthase 1.
Bioactivity
ChEMBL activities: 17 potent at pChembl ≥ 5 of 22 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRA1A | 8.49 | AC50 | 3.2 | nM | CHEMBL_ACT_25218589 |
| LMNA | 8.2 | Potency | 6.3 | nM | CHEMBL_ACT_3627594 |
| DRD1 | 8.11 | AC50 | 7.7 | nM | CHEMBL_ACT_25114907 |
| DRD3 | 7.96 | AC50 | 11.1 | nM | CHEMBL_ACT_25194230 |
| P81908 | 6.64 | IC50 | 230 | nM | CHEMBL_ACT_6217881 |
| ADRA2A | 5.68 | AC50 | 2069 | nM | CHEMBL_ACT_25156126 |
| SLC6A3 | 5.53 | AC50 | 2982 | nM | CHEMBL_ACT_25124656 |
| P15207 | 5.52 | Ki | 3000 | nM | CHEMBL_ACT_2149487 |
| SLC6A4 | 5.48 | AC50 | 3282 | nM | CHEMBL_ACT_25151024 |
| OPRM1 | 5.34 | AC50 | 4593 | nM | CHEMBL_ACT_25157872 |
| SLC6A2 | 5.29 | AC50 | 5079 | nM | CHEMBL_ACT_25145697 |
| CHRM1 | 5.25 | AC50 | 5582 | nM | CHEMBL_ACT_25209947 |
| KCNH2 | 5.24 | AC50 | 5820 | nM | CHEMBL_ACT_25117069 |
| CHRM2 | 5.23 | AC50 | 5870 | nM | CHEMBL_ACT_25195433 |
| P23795 | 5.16 | IC50 | 7000 | nM | CHEMBL_ACT_6217831 |
| HTR1A | 5.05 | AC50 | 8802 | nM | CHEMBL_ACT_25164721 |
| MAPK1 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4523972 |
Target pathways
Aggregated over 1 target gene(s): DRD1.
Top Reactome pathways
2 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Dopamine receptors | 1 | DRD1 |
| G alpha (s) signalling events | 1 | DRD1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| temperature homeostasis | 1 |
| conditioned taste aversion | 1 |
| behavioral fear response | 1 |
| response to amphetamine | 1 |
| protein import into nucleus | 1 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 1 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-activating dopamine receptor signaling pathway | 1 |
| G protein-coupled dopamine receptor signaling pathway | 1 |
| synapse assembly | 1 |
| memory | 1 |
| mating behavior | 1 |
| grooming behavior | 1 |
| adult walking behavior | 1 |
| visual learning | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 4 | MONDO:0005485 | EFO:0005407 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
335 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| TAFAMIDIS | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| TAFENOQUINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | DRD1 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | DRD1 |
| ALPROSTADIL | ChEMBL | Phase 4 (approved) | DRD1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | DRD1 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD1 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | DRD1 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | DRD1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD1 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | DRD1 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD1 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | DRD1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | DRD1 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | DRD1 |
| BENZIODARONE | ChEMBL | Phase 4 (approved) | DRD1 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | DRD1 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | DRD1 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | DRD1 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | DRD1 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | DRD1 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD1 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | DRD1 |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | DRD1 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | DRD1 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | DRD1 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | DRD1 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | DRD1 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | DRD1 |
| CETRORELIX | ChEMBL | Phase 4 (approved) | DRD1 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | DRD1 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | DRD1 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | DRD1 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | DRD1 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CLOPIDOGREL | ChEMBL | Phase 4 (approved) | DRD1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | DRD1 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | DRD1 |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | DRD1 |
| CYCLIZINE | ChEMBL | Phase 4 (approved) | DRD1 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | DRD1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | DRD1 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | DRD1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | DRD1 |
| DEXBROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | DRD1 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | DRD1 |
| DICYCLOMINE | ChEMBL | Phase 4 (approved) | DRD1 |
Related Atlas pages
- Genes: DRD1
- Diseases: psychotic disorder
- Drugs: Desloratadine, Dihydroergotamine, Paliperidone, Pimavanserin, Regorafenib, Tafamidis, Tafenoquine, Acetophenazine, Alectinib, Alprostadil, Amiodarone, Amitriptyline, Amlodipine, Amoxapine, Apomorphine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benperidol, Benziodarone, Benztropine, Benzydamine, Bexarotene, Bithionol, Bosutinib, Brexpiprazole, Bromocriptine, Bromodiphenhydramine, Brompheniramine, Cabergoline, Cabozantinib, Cannabidiol, Cariprazine, Carvedilol, Caspofungin, Celecoxib, Cetrorelix, Chlorpromazine, Chlorprothixene, Cinnarizine, Cisapride, Citalopram, Clemastine, Clomiphene, Clomipramine, Clopidogrel, Clotrimazole, Clozapine, Cobimetinib, Cyclizine, Cyproheptadine, Danazol, Dequalinium, Desogestrel, Dexbrompheniramine, Dibenzepin, Dicyclomine