Picotamide
drugOn this page
Also known as G-137NSC-304384SID11111675SID50106897SID85231198SID90341089
Summary
Picotamide (CHEMBL1257015) is an approved small molecule (ATC B01AC03) targeting TBXAS1; indicated across 1 condition including thrombotic disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: B01AC03
- Targets: 1 (TBXAS1)
- Indications: 1 condition
- Chemistry: 376.4 Da · C21H20N4O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1257015 |
| Name | Picotamide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4814 |
| ATC | B01AC03 |
| Molecular formula | C21H20N4O3 |
| Molecular weight | 376.4 |
| InChIKey | KYWCWBXGRWWINE-UHFFFAOYSA-N |
SMILES: COC1=C(C=C(C=C1)C(=O)NCC2=CN=CC=C2)C(=O)NCC3=CN=CC=C3
IUPAC name: 4-methoxy-1-N,3-N-bis(pyridin-3-ylmethyl)benzene-1,3-dicarboxamide
Also known as: G-137, NSC-304384, Picotamide, SID11111675, SID50106897, SID85231198, SID90341089, PICOTAMIDE, picotamide
Parent form; salt/anhydrous children: CHEMBL1317747
Patent coverage: 661 distinct patent families (2,679 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 2,666 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| TBXAS1 | CYP5A1 | Inhibition | 3.8 | 0.1% | P24557 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: RecQ-like DNA helicase BLM, Thyrotropin receptor, Cytochrome P450 1A2, Cytochrome P450 3A4.
Bioactivity
ChEMBL activities: 5 potent at pChembl ≥ 5 of 8 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| BLM | 8.55 | Potency | 2.8 | nM | CHEMBL_ACT_4749950 |
| BLM | 8.55 | Potency | 2.8 | nM | CHEMBL_ACT_4937726 |
| CYP3A4 | 5.5 | Potency | 3162 | nM | CHEMBL_ACT_5005859 |
| CYP3A4 | 5.5 | Potency | 3162 | nM | CHEMBL_ACT_5070627 |
| CYP3A4 | 5.5 | AC50 | 3162 | nM | CHEMBL_ACT_6014245 |
Target pathways
Aggregated over 1 target gene(s): TBXAS1.
Top Reactome pathways
13 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 1 | TBXAS1 |
| Disease | 1 | TBXAS1 |
| Biological oxidations | 1 | TBXAS1 |
| Cytochrome P450 - arranged by substrate type | 1 | TBXAS1 |
| Phase I - Functionalization of compounds | 1 | TBXAS1 |
| Eicosanoids | 1 | TBXAS1 |
| Arachidonate metabolism | 1 | TBXAS1 |
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 1 | TBXAS1 |
| Metabolism of lipids | 1 | TBXAS1 |
| Metabolic disorders of biological oxidation enzymes | 1 | TBXAS1 |
| Defective TBXAS1 causes GHDD | 1 | TBXAS1 |
| Diseases of metabolism | 1 | TBXAS1 |
| Fatty acid metabolism | 1 | TBXAS1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| prostaglandin biosynthetic process | 1 |
| icosanoid metabolic process | 1 |
| intracellular chloride ion homeostasis | 1 |
| long-chain fatty acid biosynthetic process | 1 |
| response to ethanol | 1 |
| positive regulation of vasoconstriction | 1 |
| prostanoid biosynthetic process | 1 |
| response to fatty acid | 1 |
| lipid metabolic process | 1 |
| fatty acid metabolic process | 1 |
| fatty acid biosynthetic process | 1 |
| prostaglandin metabolic process | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| thrombotic disease | 4 | MONDO:0000831 | HP:0004419 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
46 molecules share ≥1 primary target. Top 46 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| AMINOGLUTETHIMIDE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| AMPRENAVIR | ChEMBL | Phase 4 (approved) | TBXAS1 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | TBXAS1 |
| CISPLATIN | ChEMBL | Phase 4 (approved) | TBXAS1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | TBXAS1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| GRAMICIDIN | ChEMBL | Phase 4 (approved) | TBXAS1 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| IMATINIB | ChEMBL | Phase 4 (approved) | TBXAS1 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | TBXAS1 |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | TBXAS1 |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | TBXAS1 |
| NIFEDIPINE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| OXICONAZOLE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| OZAGREL | ChEMBL | Phase 4 (approved) | TBXAS1 |
| RITONAVIR | ChEMBL | Phase 4 (approved) | TBXAS1 |
| ROSIGLITAZONE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| SAQUINAVIR | ChEMBL | Phase 4 (approved) | TBXAS1 |
| SULCONAZOLE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| SULFASALAZINE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | TBXAS1 |
| TANNIC ACID | ChEMBL | Phase 4 (approved) | TBXAS1 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| TROVAFLOXACIN | ChEMBL | Phase 4 (approved) | TBXAS1 |
| VINBLASTINE | ChEMBL | Phase 4 (approved) | TBXAS1 |
| ZAFIRLUKAST | ChEMBL | Phase 4 (approved) | TBXAS1 |
| CANDESARTAN | ChEMBL | Phase 3 | TBXAS1 |
| INDINAVIR | ChEMBL | Phase 3 | TBXAS1 |
| LACIDIPINE | ChEMBL | Phase 3 | TBXAS1 |
| ABLUKAST | ChEMBL | Phase 2 | TBXAS1 |
| CLOSANTEL | ChEMBL | Phase 2 | TBXAS1 |
| DAZMEGREL | ChEMBL | Phase 2 | TBXAS1 |
| DAZOXIBEN | ChEMBL | Phase 2 | TBXAS1 |
| GENISTEIN | ChEMBL | Phase 2 | TBXAS1 |
| IMITRODAST | ChEMBL | Phase 2 | TBXAS1 |
| ISBOGREL | ChEMBL | Phase 2 | TBXAS1 |
| PIRMAGREL | ChEMBL | Phase 2 | TBXAS1 |
| RIDOGREL | ChEMBL | Phase 2 | TBXAS1 |
| SAMIXOGREL | ChEMBL | Phase 2 | TBXAS1 |
| SULOTROBAN | ChEMBL | Phase 2 | TBXAS1 |
| TERBOGREL | ChEMBL | Phase 2 | TBXAS1 |
Related Atlas pages
- Genes: TBXAS1
- Diseases: thrombotic disease
- Drugs: 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Aminoglutethimide, Amprenavir, Bithionol, Cisplatin, Clotrimazole, Diethylstilbestrol, Econazole, Ergotamine, Gramicidin, Hexachlorophene, Imatinib, Indomethacin, Ketoconazole, Miconazole, Montelukast, Nelfinavir, Nifedipine, Oxiconazole, Ozagrel, Ritonavir, Rosiglitazone, Saquinavir, Sulconazole, Sulfasalazine, Tamoxifen, Tannic Acid, Troglitazone, Trovafloxacin, Vinblastine, Zafirlukast, Candesartan, Lacidipine