Pipamperone
drugOn this page
Also known as FloropipamideNSC-759178PipamperonaPipamperone hydrochloridePipaneperoneR 3345R-3345SID29217622SID50111712
Summary
Pipamperone (CHEMBL440294) is a phase-3 clinical-stage small-molecule first generation antipsychotic (ATC N05AD05) targeting HTR1A, HRH1, and HTR1B; indicated across 7 conditions including psychotic disorder and anxiety.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- ATC class: N05AD05
- Targets: 5 (HTR1A, HRH1, HTR1B…)
- Indications: 7 conditions
- Clinical trials: 4
- Chemistry: 375.5 Da · C21H30FN3O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL440294 |
| Name | Pipamperone |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 4830 |
| ChEBI | CHEBI:78549 |
| ATC | N05AD05 |
| Molecular formula | C21H30FN3O2 |
| Molecular weight | 375.5 |
| InChIKey | AXKPFOAXAHJUAG-UHFFFAOYSA-N |
SMILES: C1CCN(CC1)C2(CCN(CC2)CCCC(=O)C3=CC=C(C=C3)F)C(=O)N
IUPAC name: 1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidin-1-ylpiperidine-4-carboxamide
ChEBI definition: A member of the class of bipiperidines that is 1,4’-bipiperidine which is substituted at the 1’ and 4’ positions by 4-(p-fluorophenyl)-4-oxobutyl and carboxamide groups, respectively. A first generation antipsychotic, its properties are generally similar to those of haloperidol.
Pharmacological roles (ChEBI): first generation antipsychotic, serotonergic antagonist, dopaminergic antagonist.
Also known as: Floropipamide, NSC-759178, Pipamperona, Pipamperone, Pipamperone hydrochloride, Pipaneperone, R 3345, R-3345, SID29217622, SID50111712, PIPAMPERONE, pipamperone
Parent form; salt/anhydrous children: CHEMBL2361301
Patent coverage: 4,570 distinct patent families (15,661 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR1A | 5-HT1A receptor | Antagonist | 5.6 | 0% | P08908 |
| HRH1 | H1 receptor | Antagonist | 5.6 | 0% | P35367 |
| HTR1B | 5-HT1B receptor | Antagonist | 6.2 | 0.2% | P28222 |
| HTR1D | 5-HT1D receptor | Antagonist | 6.8 | 0% | P28221 |
| HTR2A | 5-HT2A receptor | Antagonist | 8.3 | 0% | P28223 |
Broader ChEMBL bioactivity targets: 10 (assay-derived). Sample: Alpha-2A adrenergic receptor, D(1A) dopamine receptor, 5-hydroxytryptamine receptor 1A, Sodium-dependent serotonin transporter, Alpha-1A adrenergic receptor, Mu-type opioid receptor, D(3) dopamine receptor, Sodium-dependent dopamine transporter, Voltage-gated inwardly rectifying potassium channel KCNH2, Histamine H3 receptor.
Bioactivity
ChEMBL activities: 7 potent at pChembl ≥ 5 of 10 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DRD1 | 6.59 | AC50 | 257.6 | nM | CHEMBL_ACT_25115078 |
| ADRA1A | 6.4 | AC50 | 397.5 | nM | CHEMBL_ACT_25218739 |
| DRD3 | 5.75 | AC50 | 1768 | nM | CHEMBL_ACT_25194393 |
| KCNH2 | 5.72 | AC50 | 1900 | nM | CHEMBL_ACT_25117396 |
| SLC6A3 | 5.53 | AC50 | 2921 | nM | CHEMBL_ACT_25124827 |
| ADRA2A | 5.26 | AC50 | 5470 | nM | CHEMBL_ACT_25156297 |
| OPRM1 | 5.15 | AC50 | 7021 | nM | CHEMBL_ACT_25158043 |
Target pathways
Aggregated over 5 target gene(s): HTR1A, HRH1, HTR1B, HTR1D, HTR2A.
Top Reactome pathways
10 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 4 | HTR1A, HTR1B, HTR1D, HTR2A |
| Signaling by GPCR | 4 | HTR1A, HTR1B, HTR1D, HTR2A |
| Class A/1 (Rhodopsin-like receptors) | 4 | HTR1A, HTR1B, HTR1D, HTR2A |
| Amine ligand-binding receptors | 4 | HTR1A, HTR1B, HTR1D, HTR2A |
| Serotonin receptors | 4 | HTR1A, HTR1B, HTR1D, HTR2A |
| GPCR ligand binding | 4 | HTR1A, HTR1B, HTR1D, HTR2A |
| GPCR downstream signalling | 3 | HTR1B, HTR1D, HTR2A |
| G alpha (q) signalling events | 2 | HRH1, HTR2A |
| G alpha (i) signalling events | 2 | HTR1B, HTR1D |
| Histamine receptors | 1 | HRH1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 5 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 5 |
| chemical synaptic transmission | 5 |
| signal transduction | 5 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 3 |
| regulation of behavior | 3 |
| phospholipase C-activating serotonin receptor signaling pathway | 3 |
| serotonin receptor signaling pathway | 2 |
| positive regulation of cell population proliferation | 2 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 2 |
| G protein-coupled serotonin receptor signaling pathway | 2 |
| memory | 2 |
| positive regulation of vasoconstriction | 2 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| vasoconstriction | 2 |
Indications & clinical
Indications
7 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 3 | MONDO:0005485 | EFO:0005407 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| schizoaffective disorder | 3 | MONDO:0005487 | EFO:0005411 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| major depressive disorder | 3 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 4.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE2 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01312922 | PHASE3 | COMPLETED | Pipamperone/Citalopram (PNB01) Versus Citalopram (CIT) and Versus Pipamperone (PIP) in Major Depressive Disorder (MDD) |
| NCT02374567 | PHASE3 | TERMINATED | Pharmacovigilance in Gerontopsychiatric Patients |
| NCT00672659 | PHASE2 | COMPLETED | Pipamperone/Citalopram (PipCit)Versus Citalopram in the Treatment of Major Depressive Disorder(MDD) |
| NCT01450514 | PHASE2 | COMPLETED | POC Study of Pipamperone Added to Stable Treatment With RIS or PAL in Chronic Schizophrenia |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
674 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| RIZATRIPTAN | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR2A |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1B, HTR1D, HTR2A |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR2A |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1B, HTR1D, HTR2A |
| CINACALCET | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1D, HTR2A |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR2A |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR2A |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1D, HTR2A |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR2A |
| OXYMETAZOLINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR2A |
| SALMETEROL | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR2A |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR2A |
| SILODOSIN | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D |
| SUMATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR2A |
| VILAZODONE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D |
| XYLOMETAZOLINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR2A |
| ZOLMITRIPTAN | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR2A |
| SEROTONIN | ChEMBL | Phase 3 | HTR1A, HTR1B, HTR1D, HTR2A |
| YOHIMBINE | ChEMBL | Phase 3 | HTR1A, HTR1B, HTR1D, HTR2A |
| GSK163090 | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1D, HTR2A |
| LYSERGIDE | ChEMBL | Phase 2 | HRH1, HTR1A, HTR1D, HTR2A |
| MEBUFOTENIN | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1D, HTR2A |
| PENFLURIDOL | ChEMBL | Phase 2 | HRH1, HTR1A, HTR1D, HTR2A |
| PSILOCIN | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1D, HTR2A |
| RITANSERIN | ChEMBL | Phase 2 | HRH1, HTR1A, HTR1B, HTR2A |
| SPIRAMIDE | ChEMBL | Phase 2 | HRH1, HTR1A, HTR1D, HTR2A |
| ALMOTRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| ASENAPINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| AZATADINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | HRH1, HTR1A, HTR2A |
Related Atlas pages
- Genes: HTR1A, HRH1, HTR1B, HTR1D, HTR2A
- Diseases: psychotic disorder, anxiety, schizoaffective disorder, dementia, major depressive disorder, depressive disorder
- Drugs: Dihydroergotamine, Aripiprazole, Brexpiprazole, Cariprazine, Imipramine, Ketanserin, Nefazodone, Risperidone, Rizatriptan, Paliperidone, Pramipexole, Azelastine, Cinacalcet, Clozapine, Ergotamine, Mianserin, Olanzapine, Oxymetazoline, Salmeterol, Sertindole, Silodosin, Sumatriptan, Vilazodone, Xylometazoline, Zolmitriptan, Serotonin, Yohimbine, Almotriptan, Desloratadine, Fidaxomicin, Olodaterol, Propoxyphene, Regorafenib, Tamsulosin, Acetophenazine, Amitriptyline, Amoxapine, Apomorphine, Asenapine, Astemizole, Azatadine, Benfluorex, Benperidol, Bromperidol, Buspirone, Cabergoline, Candesartan Cilexetil, Chlorpromazine, Cinnarizine, Cisapride, Citalopram, Clemastine, Clomipramine