Povorcitinib
drug drugOn this page
Also known as INCB-054707Incb054707
Summary
Povorcitinib (CHEMBL5095079) is a phase-3 clinical-stage small molecule targeting JAK1; indicated across 4 conditions including vitiligo and hidradenitis suppurativa.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (JAK1)
- Indications: 4 conditions
- Clinical trials: 24
- Chemistry: 507.5 Da · C23H22F5N7O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL5095079 |
| Name | Povorcitinib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 86280672 |
| Molecular formula | C23H22F5N7O |
| Molecular weight | 507.5 |
| InChIKey | MSGYSFWCPOBHEV-AWEZNQCLSA-N |
SMILES: CC1=C(C(=NN1)C)C2=CN(N=C2)C3(CN(C3)C4=C(C=C(C(=C4)F)C(=O)N[C@@H](C)C(F)(F)F)F)CC#N
IUPAC name: 4-[3-(cyanomethyl)-3-[4-(3,5-dimethyl-1H-pyrazol-4-yl)pyrazol-1-yl]azetidin-1-yl]-2,5-difluoro-N-[(2S)-1,1,1-trifluoropropan-2-yl]benzamide
Also known as: INCB-054707, Incb054707, INCB054707, Povorcitinib, POVORCITINIB
Parent form; salt/anhydrous children: CHEMBL5314592
Patent coverage: 61 distinct patent families (224 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| JAK1 | Janus kinase 1 | Inhibition | 6.52 | 2.8% | P23458 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: Tyrosine-protein kinase JAK1, Tyrosine-protein kinase JAK2, Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform, Tyrosine-protein kinase receptor UFO, Tyrosine-protein kinase receptor TYRO3, Tyrosine-protein kinase Mer.
Bioactivity
ChEMBL activities: 17 potent at pChembl ≥ 5 of 17 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| JAK1 | 7.12 | IC50 | 75 | nM | CHEMBL_ACT_28013678 |
| PIK3CD | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_26930143 |
| PIK3CD | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_26930149 |
| TYRO3 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_26791223 |
| AXL | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_26791229 |
| TYRO3 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_26791232 |
| JAK2 | 6.19 | IC50 | 650 | nM | CHEMBL_ACT_27555461 |
| JAK2 | 6.19 | IC50 | 650 | nM | CHEMBL_ACT_27555503 |
| JAK2 | 6.19 | IC50 | 650 | nM | CHEMBL_ACT_27749969 |
| JAK2 | 6.19 | IC50 | 650 | nM | CHEMBL_ACT_27750011 |
| JAK2 | 6.19 | IC50 | 650 | nM | CHEMBL_ACT_28957091 |
| MERTK | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_26781194 |
| AXL | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_26781197 |
| MERTK | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_27837155 |
| AXL | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_27837158 |
| MERTK | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_28527671 |
| AXL | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_28527674 |
Target pathways
Aggregated over 1 target gene(s): JAK1.
Top Reactome pathways
52 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Interleukin-6 signaling | 1 | JAK1 |
| MAPK3 (ERK1) activation | 1 | JAK1 |
| RAF-independent MAPK1/3 activation | 1 | JAK1 |
| MAPK1 (ERK2) activation | 1 | JAK1 |
| ISG15 antiviral mechanism | 1 | JAK1 |
| Antimicrobial mechanism of IFN-stimulated genes | 1 | JAK1 |
| Interleukin-7 signaling | 1 | JAK1 |
| Cytokine Signaling in Immune system | 1 | JAK1 |
| Signal Transduction | 1 | JAK1 |
| Disease | 1 | JAK1 |
| Immune System | 1 | JAK1 |
| Interleukin-12 family signaling | 1 | JAK1 |
| Signaling by Interleukins | 1 | JAK1 |
| Other interleukin signaling | 1 | JAK1 |
| Interleukin-2 family signaling | 1 | JAK1 |
| Interleukin-3, Interleukin-5 and GM-CSF signaling | 1 | JAK1 |
| Infectious disease | 1 | JAK1 |
| RAF/MAP kinase cascade | 1 | JAK1 |
| MAPK family signaling cascades | 1 | JAK1 |
| MAPK1/MAPK3 signaling | 1 | JAK1 |
| Interleukin-6 family signaling | 1 | JAK1 |
| Interleukin-10 signaling | 1 | JAK1 |
| Interleukin-4 and Interleukin-13 signaling | 1 | JAK1 |
| IL-6-type cytokine receptor ligand interactions | 1 | JAK1 |
| Interferon gamma signaling | 1 | JAK1 |
| Regulation of IFNG signaling | 1 | JAK1 |
| Interleukin-20 family signaling | 1 | JAK1 |
| Interleukin-15 signaling | 1 | JAK1 |
| Interleukin-35 Signalling | 1 | JAK1 |
| Interleukin-9 signaling | 1 | JAK1 |
| Interleukin-2 signaling | 1 | JAK1 |
| Interleukin-12 signaling | 1 | JAK1 |
| Interleukin-27 signaling | 1 | JAK1 |
| Interleukin-21 signaling | 1 | JAK1 |
| Interferon alpha/beta signaling | 1 | JAK1 |
| Interleukin receptor SHC signaling | 1 | JAK1 |
| Regulation of IFNA/IFNB signaling | 1 | JAK1 |
| Interferon Signaling | 1 | JAK1 |
| Signaling by CSF3 (G-CSF) | 1 | JAK1 |
| Potential therapeutics for SARS | 1 | JAK1 |
| SARS-CoV Infections | 1 | JAK1 |
| SARS-CoV-2 Infection | 1 | JAK1 |
| Inactivation of CSF3 (G-CSF) signaling | 1 | JAK1 |
| SARS-CoV-2 activates/modulates innate and adaptive immune responses | 1 | JAK1 |
| SARS-CoV-2-host interactions | 1 | JAK1 |
| IFNG signaling activates MAPKs | 1 | JAK1 |
| Respiratory Syncytial Virus Infection Pathway | 1 | JAK1 |
| Viral Infection Pathways | 1 | JAK1 |
| Evasion by RSV of host interferon responses | 1 | JAK1 |
| RSV-host interactions | 1 | JAK1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 1 |
| cell surface receptor signaling pathway via JAK-STAT | 1 |
| cytokine-mediated signaling pathway | 1 |
| cell differentiation | 1 |
| positive regulation of homotypic cell-cell adhesion | 1 |
| intracellular signal transduction | 1 |
| interleukin-15-mediated signaling pathway | 1 |
| interleukin-4-mediated signaling pathway | 1 |
| interleukin-2-mediated signaling pathway | 1 |
| interleukin-7-mediated signaling pathway | 1 |
| interleukin-9-mediated signaling pathway | 1 |
| interleukin-11-mediated signaling pathway | 1 |
| type III interferon-mediated signaling pathway | 1 |
| response to antibiotic | 1 |
| type II interferon-mediated signaling pathway | 1 |
Indications & clinical
Indications
4 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| vitiligo | 3 | MONDO:0008661 | EFO:0004208 |
| hidradenitis suppurativa | 3 | MONDO:0006559 | EFO:1000710 |
| asthma | 2 | MONDO:0004979 | MONDO:0004979 |
| prurigo | 1 | MONDO:0021739 | MONDO:0021739 |
Clinical trials
Total trials: 24.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 8 |
| PHASE2 | 8 |
| PHASE1 | 8 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06113445 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study to Evaluate Efficacy and Safety of Povorcitinib in Participants With Nonsegmental Vitiligo (STOP-V1) |
| NCT06113471 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study to Evaluate Efficacy and Safety of Povorcitinib in Participants With Nonsegmental Vitiligo (STOP-V2) |
| NCT06212999 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study to Evaluate the Long-Term Safety and Efficacy of Povorcitinib in Participants With Moderate to Severe Hidradenitis Suppurativa |
| NCT06516952 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study to Evaluate the Efficacy and Safety Study of Povorcitinib in Participants With Prurigo Nodularis (STOP-PN1) |
| NCT06516965 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study to Evaluate the Efficacy and Safety Study of Povorcitinib in Participants With Prurigo Nodularis (STOP-PN2) |
| NCT06855498 | PHASE3 | RECRUITING | Rollover Study for Participants Previously Enrolled in Clinical Trials of Povorcitinib |
| NCT05620823 | PHASE3 | COMPLETED | A Study to Evaluate the Efficacy and Safety of Povorcitinib (INCB054707) in Participants With Moderate to Severe Hidradenitis Suppurativa |
| NCT05620836 | PHASE3 | COMPLETED | A Study to Evaluate the Efficacy and Safety of Povorcitinib (INCB054707) in Participants With Moderate to Severe Hidradenitis Suppurativa (HS) |
| NCT05851443 | PHASE2 | RECRUITING | A Study to Evaluate the Efficacy and Safety Study of Povorcitinib in Participants With Inadequately Controlled Moderate to Severe Asthma |
| NCT07213973 | PHASE2 | RECRUITING | Pharmacokinetics, Safety, and Efficacy of Povorcitinib in Adolescent Participants With Moderate to Severe Hidradenitis Suppurativa |
| NCT03569371 | PHASE2 | COMPLETED | A Study of the Safety of INCB054707 in Participants With Hidradenitis Suppurativa |
| NCT03607487 | PHASE2 | COMPLETED | A Placebo-Controlled Study of the Safety of INCB054707 in Participants With Hidradenitis Suppurativa |
| NCT04476043 | PHASE2 | COMPLETED | To Assess the Efficacy and Safety of INCB054707 in Participants With Hidradenitis Suppurativa |
| NCT04818346 | PHASE2 | COMPLETED | A Study to Evaluate the Efficacy and Safety of INCB054707 in Participants With Vitiligo |
| NCT05061693 | PHASE2 | COMPLETED | A Study to Evaluate the Efficacy and Safety of INCB054707 in Participants With Prurigo Nodularis |
| NCT05936567 | PHASE2 | COMPLETED | Study Evaluating the Efficacy and Safety of Povorcitinib in Adults With Chronic Spontaneous Urticaria |
| NCT07588139 | PHASE1 | RECRUITING | A Study to Evaluate Dermal Open-Flow Microperfusion and Plasma Pharmacokinetic Study of Multiple Doses of Oral Povorcitinib or Topical Ruxolitinib Cream in Healthy Adult Participants |
| NCT05068466 | PHASE1 | COMPLETED | A Study to Evaluate the Safety, Tolerability and Pharmacokinetics of INCB054707 |
| NCT05624710 | PHASE1 | COMPLETED | A Study to Evaluate the Pharmacokinetics and Safety of INCB054707 in Participants With Normal Hepatic Function and Participants With Hepatic Impairment |
| NCT05624723 | PHASE1 | COMPLETED | Study to Evaluate the Pharmacokinetics, Safety, and Pharmacodynamics of INCB054707 in Participants With Normal and Impaired Renal Function and Participants on Hemodialysis |
| NCT06380205 | PHASE1 | COMPLETED | A Study to Evaluate the Drug Interaction Between Povorcitinib and the Oral Contraceptive Levonorgestrel/Ethinyl Estradiol in Healthy Adult Females |
| NCT06416800 | PHASE1 | COMPLETED | A Study to Assess the Effect of Povorcitinib on Digoxin, Rosuvastatin, and Metformin Pharmacokinetics and the Effect of Probenecid on Povorcitinib Pharmacokinetics When Administered Orally to Healthy Adult Participants |
| NCT06441318 | PHASE1 | COMPLETED | A Study to Evaluate the Effect of Povorcitinib on the QT/QTc Interval in Healthy Participants |
| NCT06505265 | PHASE1 | COMPLETED | A Study to Evaluate Skin and Plasma Pharmacokinetic of Multiple Doses of Povorcitinib After Oral Administration in Healthy Participants |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
67 molecules share ≥1 primary target. Top 67 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | JAK1 |
| DEUCRAVACITINIB | ChEMBL + PubChem | Phase 4 (approved) | JAK1 |
| RITLECITINIB | ChEMBL + PubChem | Phase 4 (approved) | JAK1 |
| ABROCITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| BARICITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| CERITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| FILGOTINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | JAK1 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | JAK1 |
| PACRITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| PEFICITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| PONATINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| TOFACITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| UPADACITINIB | ChEMBL | Phase 4 (approved) | JAK1 |
| ABIVERTINIB | ChEMBL | Phase 3 | JAK1 |
| BREPOCITINIB | ChEMBL | Phase 3 | JAK1 |
| DELGOCITINIB | ChEMBL | Phase 3 | JAK1 |
| DOVITINIB | ChEMBL | Phase 3 | JAK1 |
| ITACITINIB | ChEMBL | Phase 3 | JAK1 |
| IVARMACITINIB | ChEMBL | Phase 3 | JAK1 |
| LESTAURTINIB | ChEMBL | Phase 3 | JAK1 |
| MOTESANIB | ChEMBL | Phase 3 | JAK1 |
| ZASOCITINIB | ChEMBL | Phase 3 | JAK1 |
| APITOLISIB | ChEMBL | Phase 2 | JAK1 |
| AT-9283 | ChEMBL | Phase 2 | JAK1 |
| ATINVICITINIB | ChEMBL | Phase 2 | JAK1 |
| AZD-1480 | ChEMBL | Phase 2 | JAK1 |
| BMS-911543 | ChEMBL | Phase 2 | JAK1 |
| CC-401 | ChEMBL | Phase 2 | JAK1 |
| CERDULATINIB | ChEMBL | Phase 2 | JAK1 |
| DECERNOTINIB | ChEMBL | Phase 2 | JAK1 |
| GANDOTINIB | ChEMBL | Phase 2 | JAK1 |
| GOLIDOCITINIB | ChEMBL | Phase 2 | JAK1 |
| GUSACITINIB | ChEMBL | Phase 2 | JAK1 |
| IFIDANCITINIB | ChEMBL | Phase 2 | JAK1 |
| IZENCITINIB | ChEMBL | Phase 2 | JAK1 |
| LEPZACITINIB | ChEMBL | Phase 2 | JAK1 |
| LONDAMOCITINIB | ChEMBL | Phase 2 | JAK1 |
| NEZULCITINIB | ChEMBL | Phase 2 | JAK1 |
| NS-018 | ChEMBL | Phase 2 | JAK1 |
| OCLACITINIB | ChEMBL | Phase 2 | JAK1 |
| PICTILISIB | ChEMBL | Phase 2 | JAK1 |
| R-406 | ChEMBL | Phase 2 | JAK1 |
| REBASTINIB | ChEMBL | Phase 2 | JAK1 |
| ROPSACITINIB | ChEMBL | Phase 2 | JAK1 |
| SOLCITINIB | ChEMBL | Phase 2 | JAK1 |
| SOTRASTAURIN | ChEMBL | Phase 2 | JAK1 |
| SU-014813 | ChEMBL | Phase 2 | JAK1 |
| TG100-115 | ChEMBL | Phase 2 | JAK1 |
| TOZASERTIB | ChEMBL | Phase 2 | JAK1 |
| ZOTIRACICLIB | ChEMBL | Phase 2 | JAK1 |
| Afatinib | PubChem | Approved | JAK1 |
| Binimetinib | PubChem | Approved | JAK1 |
| dacomitinib | PubChem | Approved | JAK1 |
| Fostamatinib | PubChem | Approved | JAK1 |
| Gefitinib | PubChem | Approved | JAK1 |
| Idelalisib | PubChem | Approved | JAK1 |
| Imatinib | PubChem | Approved | JAK1 |
| Pazopanib | PubChem | Approved | JAK1 |
| regorafenib | PubChem | Approved | JAK1 |
| Selumetinib | PubChem | Approved | JAK1 |
| Trametinib | PubChem | Approved | JAK1 |
Related Atlas pages
- Genes: JAK1
- In clinical trials for: vitiligo, hidradenitis suppurativa, asthma
- Drugs: Crizotinib, Deucravacitinib, Ritlecitinib, Abrocitinib, Baricitinib, Ceritinib, Entrectinib, Fedratinib, Filgotinib, Midostaurin, Momelotinib, Nintedanib, Pacritinib, Peficitinib, Ponatinib, Ruxolitinib, Sunitinib, Tofacitinib, Upadacitinib, Abivertinib, Brepocitinib, Delgocitinib, Dovitinib, Itacitinib, Ivarmacitinib, Lestaurtinib, Motesanib, Zasocitinib, Afatinib, Binimetinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Imatinib, Pazopanib, regorafenib, Selumetinib, Trametinib