Pranlukast
drugOn this page
Also known as AzlaireCCN 00401CCN-00401ONO 1078ONO-1078OnonRS 411RS-411SB 205312SB-205312SID50126316SID144206505Pranlukast hydrateÊPranlukast hydrateÂ
Summary
Pranlukast (CHEMBL21333) is an approved small molecule (ATC R03DC02) targeting CYSLTR1 and CYSLTR2; indicated across 3 conditions including obstructive lung disease and sinusitis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: R03DC02
- Targets: 2 (CYSLTR1, CYSLTR2)
- Indications: 3 conditions
- Clinical trials: 3
- Chemistry: 481.5 Da · C27H23N5O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL21333 |
| Name | Pranlukast |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4887 |
| ATC | R03DC02 |
| Molecular formula | C27H23N5O4 |
| Molecular weight | 481.5 |
| InChIKey | NBQKINXMPLXUET-UHFFFAOYSA-N |
SMILES: C1=CC=C(C=C1)CCCCOC2=CC=C(C=C2)C(=O)NC3=CC=CC4=C3OC(=CC4=O)C5=NNN=N5
IUPAC name: N-[4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-4-(4-phenylbutoxy)benzamide
Also known as: Azlaire, CCN 00401, CCN-00401, ONO 1078, ONO-1078, Onon, Pranlukast, RS 411, RS-411, SB 205312, SB-205312, pranlukast
Parent form; salt/anhydrous children: CHEMBL3810125
Patent coverage: 3,465 distinct patent families (12,755 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 11,877 (93%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CYSLTR1 | CysLT1 receptor | Antagonist | 10 | 0.2% | Q9Y271 |
| CYSLTR2 | CysLT2 receptor | Antagonist | 5.44 | 0.1% | Q9NS75 |
Broader ChEMBL bioactivity targets: 23 (assay-derived). Sample: Uracil nucleotide/cysteinyl leukotriene receptor, ATP-binding cassette sub-family C member 4, Cysteinyl leukotriene receptor 1, Androgen receptor, Bile acid receptor, D(1A) dopamine receptor, ATP-binding cassette sub-family C member 2, Progesterone receptor, Cysteinyl leukotriene receptor, 5-hydroxytryptamine receptor 1A.
Bioactivity
ChEMBL activities: 25 potent at pChembl ≥ 5 of 34 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| Q2NNR5 | 10.36 | IC50 | 0.04 | nM | CHEMBL_ACT_18067141 |
| CYSLTR2 | 10.36 | IC50 | 0.04 | nM | CHEMBL_ACT_289539 |
| CYSLTR2 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_117952 |
| CYSLTR1 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_3408501 |
| Q2NNR5 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_418734 |
| Q2NNR5 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_788888 |
| Q2NNR5 | 9 | IC50 | 1 | nM | CHEMBL_ACT_157932 |
| CYSLTR2 | 9 | Kd | 1 | nM | CHEMBL_ACT_348087 |
| CYSLTR1 | 8.37 | IC50 | 4.3 | nM | CHEMBL_ACT_15657847 |
| CYSLTR1 | 8.37 | IC50 | 4.3 | nM | CHEMBL_ACT_24792886 |
| CYSLTR1 | 8.36 | IC50 | 4.4 | nM | CHEMBL_ACT_18067149 |
| ABCC4 | 5.57 | IC50 | 2700 | nM | CHEMBL_ACT_18130822 |
| DRD1 | 5.54 | AC50 | 2880 | nM | CHEMBL_ACT_25234741 |
| ABCB11 | 5.53 | IC50 | 2970 | nM | CHEMBL_ACT_18129052 |
| CYSLTR2 | 5.44 | IC50 | 3620 | nM | CHEMBL_ACT_15657844 |
| GPR17 | 5.39 | Ki | 4060 | nM | CHEMBL_ACT_14654733 |
| HTR1A | 5.39 | AC50 | 4100 | nM | CHEMBL_ACT_25164901 |
| DRD3 | 5.35 | AC50 | 4450 | nM | CHEMBL_ACT_25194402 |
| OPRM1 | 5.33 | AC50 | 4640 | nM | CHEMBL_ACT_25158052 |
| PGR | 5.21 | AC50 | 6230 | nM | CHEMBL_ACT_25204168 |
| P25779 | 5.16 | IC50 | 7000 | nM | CHEMBL_ACT_3307715 |
| SLC6A2 | 5.15 | AC50 | 7060 | nM | CHEMBL_ACT_25145877 |
| PDE4A | 5.09 | AC50 | 8210 | nM | CHEMBL_ACT_25206964 |
| SLC6A3 | 5.08 | AC50 | 8240 | nM | CHEMBL_ACT_25124836 |
| DRD1 | 5 | AC50 | 10060 | nM | CHEMBL_ACT_25115087 |
Target pathways
Aggregated over 2 target gene(s): CYSLTR1, CYSLTR2.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Leukotriene receptors | 2 | CYSLTR1, CYSLTR2 |
| G alpha (q) signalling events | 2 | CYSLTR1, CYSLTR2 |
| LTC4-CYSLTR mediated IL4 production | 2 | CYSLTR1, CYSLTR2 |
| G alpha (s) signalling events | 1 | CYSLTR2 |
| Potential therapeutics for SARS | 1 | CYSLTR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| neuropeptide signaling pathway | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| leukotriene signaling pathway | 2 |
| inflammatory response to antigenic stimulus | 1 |
| endothelium development | 1 |
| calcium ion transport | 1 |
| chemotaxis | 1 |
| defense response | 1 |
| cell surface receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| respiratory gaseous exchange by respiratory system | 1 |
| establishment of localization in cell | 1 |
| reactive oxygen species biosynthetic process | 1 |
| immune response | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| obstructive lung disease | 4 | MONDO:0002267 | HP:0006536 |
| sinusitis | 3 | MONDO:0005961 | EFO:0007486 |
| seasonal allergic rhinitis | 3 | MONDO:0005324 | EFO:0003956 |
Clinical trials
Total trials: 3.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00127647 | PHASE3 | COMPLETED | An Approved Drug to Study a New Indication for Allergic Rhinitis (0476-327) |
| NCT00410735 | PHASE3 | COMPLETED | Study of ONO-1078 in Patients With Chronic Sinusitis |
| NCT03826485 | PHASE1 | UNKNOWN | Safety, Pharmacokinetic Study of PRIC in Healthy Adult Subjects |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
11 molecules share ≥1 primary target. Top 11 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| MONTELUKAST | ChEMBL | Phase 4 (approved) | CYSLTR1, CYSLTR2 |
| ZAFIRLUKAST | ChEMBL | Phase 4 (approved) | CYSLTR1, CYSLTR2 |
| GEMILUKAST | ChEMBL | Phase 2 | CYSLTR1, CYSLTR2 |
| POBILUKAST | ChEMBL | Phase 2 | CYSLTR1, CYSLTR2 |
| RITOLUKAST | ChEMBL | Phase 2 | CYSLTR1, CYSLTR2 |
| TOMELUKAST | ChEMBL | Phase 2 | CYSLTR1, CYSLTR2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | CYSLTR1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | CYSLTR1 |
| ABLUKAST | ChEMBL | Phase 2 | CYSLTR1 |
| VERLUKAST | ChEMBL | Phase 2 | CYSLTR1 |
| Belzutifan | PubChem | Approved | CYSLTR1 |
Related Atlas pages
- Genes: CYSLTR1, CYSLTR2
- Diseases: obstructive lung disease, sinusitis, seasonal allergic rhinitis
- Drugs: Montelukast, Zafirlukast, Clotrimazole, Diethylstilbestrol, Belzutifan