Prednisolone
drugOn this page
Also known as CortaloneDekotilDelta-cortefDeltacortrilDeltaloneDilacortEquisolonFernisolone-pHydeltraMeti-dermNSC-9120NSC-9900Neo-delta-cortefPevantiPrecortisylPrecortisyl ftePrednisolonaPrelonePoly-pred
Summary
Prednisolone (CHEMBL131) is an approved small-molecule adrenergic agent (ATC S02BA03) targeting NR3C1 and NR3C2; indicated across 160 conditions including eye disorder and nephrotic syndrome; with CIViC clinical evidence for 3 variant-indication associations (e.g. NT5C2 R238W in childhood acute lymphocytic leukemia).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: S02BA03 (+12 more)
- Targets: 2 (NR3C1, NR3C2)
- Indications: 160 conditions
- Clinical trials: 506
- Precision-oncology evidence (CIViC): 3 variant–indication associations
- Chemistry: 360.4 Da · C21H28O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL131 |
| Name | Prednisolone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5755 |
| ChEBI | CHEBI:8378 |
| ATC | S02BA03, D07XA02, R01AD02, A01AC04, D07AA03, R01AD52, C05AA04, S03BA02, A07EA01, H02AB06, A01AC54, S01BA04, S01CB02 |
| Molecular formula | C21H28O5 |
| Molecular weight | 360.4 |
| InChIKey | OIGNJSKKLXVSLS-VWUMJDOOSA-N |
SMILES: C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)CO)O)CCC4=CC(=O)C=C[C@]34C)O
IUPAC name: (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
ChEBI definition: A glucocorticoid that is prednisone in which the oxo group at position 11 has been reduced to the corresponding β-hydroxy group. It is a drug metabolite of prednisone.
Pharmacological roles (ChEBI): adrenergic agent, anti-inflammatory drug, antineoplastic agent, immunosuppressive agent.
Other ChEBI roles (chemical / environmental): drug metabolite, environmental contaminant, xenobiotic.
Also known as: Cortalone, Dekotil, Delta-cortef, Deltacortril, Deltalone, Dilacort, Equisolon, Fernisolone-p, Hydeltra, Meti-derm, NSC-9120, NSC-9900
Patent coverage: 36,298 distinct patent families (140,604 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR3C1 | Glucocorticoid receptor | Full agonist | 8.15 | 0.9% | P04150 |
| NR3C2 | Mineralocorticoid receptor | Agonist | 7.43 | 0% | P08235 |
Broader ChEMBL bioactivity targets: 14 (assay-derived). Sample: Interleukin-6, Tumor necrosis factor, Androgen receptor, Mineralocorticoid receptor, Glucocorticoid receptor, Progesterone receptor, Corticosteroid-binding globulin, Glucocorticoid receptor, Glucocorticoid receptor, Disintegrin and metalloproteinase domain-containing protein 17.
Bioactivity
ChEMBL activities: 122 potent at pChembl ≥ 5 of 125 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C2 | 9.54 | Ki | 0.29 | nM | CHEMBL_ACT_13934673 |
| NR3C1 | 9.28 | IC50 | 0.53 | nM | CHEMBL_ACT_16353808 |
| NR3C1 | 8.94 | Ki | 1.14 | nM | CHEMBL_ACT_13934697 |
| NR3C1 | 8.82 | Ki | 1.5 | nM | CHEMBL_ACT_2517717 |
| NR3C1 | 8.82 | Ki | 1.5 | nM | CHEMBL_ACT_6275755 |
| NR3C1 | 8.82 | Ki | 1.5 | nM | CHEMBL_ACT_7848728 |
| NR3C2 | 8.7 | EC50 | 2 | nM | CHEMBL_ACT_6276530 |
| NR3C1 | 8.68 | IC50 | 2.1 | nM | CHEMBL_ACT_1044970 |
| NR3C1 | 8.68 | EC50 | 2.1 | nM | CHEMBL_ACT_208923 |
| NR3C1 | 8.68 | IC50 | 2.1 | nM | CHEMBL_ACT_801758 |
| NR3C1 | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_1044965 |
| NR3C1 | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_208920 |
| NR3C1 | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_3252323 |
| NR3C1 | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_419084 |
| NR3C1 | 8.59 | EC50 | 2.6 | nM | CHEMBL_ACT_419088 |
| NR3C1 | 8.52 | EC50 | 3 | nM | CHEMBL_ACT_3298658 |
| NR3C1 | 8.48 | EC50 | 3.3 | nM | CHEMBL_ACT_419086 |
| P06537 | 8.47 | EC50 | 3.4 | nM | CHEMBL_ACT_1521471 |
| NR3C1 | 8.47 | EC50 | 3.4 | nM | CHEMBL_ACT_1961489 |
| NR3C1 | 8.42 | IC50 | 3.8 | nM | CHEMBL_ACT_1044972 |
| NR3C1 | 8.4 | ED50 | 4 | nM | CHEMBL_ACT_2150546 |
| NR3C1 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_1970219 |
| NR3C1 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_2174109 |
| NR3C1 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_5122334 |
| NR3C1 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_5246651 |
| NR3C1 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_5251404 |
| NR3C1 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_6150089 |
| IL6 | 8.38 | IC50 | 4.2 | nM | CHEMBL_ACT_16339615 |
| NR3C1 | 8.35 | EC50 | 4.5 | nM | CHEMBL_ACT_1521468 |
| NR3C1 | 8.35 | EC50 | 4.5 | nM | CHEMBL_ACT_1961363 |
Target pathways
Aggregated over 2 target gene(s): NR3C1, NR3C2.
Top Reactome pathways
14 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 2 | NR3C1, NR3C2 |
| Nuclear Receptor transcription pathway | 2 | NR3C1, NR3C2 |
| SUMOylation of intracellular receptors | 2 | NR3C1, NR3C2 |
| Cellular responses to stress | 1 | NR3C2 |
| SUMOylation | 1 | NR3C2 |
| SUMO E3 ligases SUMOylate target proteins | 1 | NR3C2 |
| Metabolism of proteins | 1 | NR3C2 |
| Post-translational protein modification | 1 | NR3C2 |
| PTK6 Expression | 1 | NR3C1 |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| Cellular responses to stimuli | 1 | NR3C2 |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of DNA-templated transcription | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| signal transduction | 2 |
| nuclear receptor-mediated steroid hormone signaling pathway | 2 |
| negative regulation of transcription by RNA polymerase II | 1 |
| regulation of gluconeogenesis | 1 |
| chromatin organization | 1 |
| apoptotic process | 1 |
| chromosome segregation | 1 |
| glucocorticoid metabolic process | 1 |
| response to wounding | 1 |
| gene expression | 1 |
| microglia differentiation | 1 |
| adrenal gland development | 1 |
| regulation of glucocorticoid biosynthetic process | 1 |
Indications & clinical
Indications
160 indications (58 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| eye disorder | 4 | MONDO:0005328 | EFO:0005752 |
| nephrotic syndrome | 4 | MONDO:0005377 | EFO:0004255 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| ulcerative colitis | 4 | MONDO:0005101 | EFO:0000729 |
| atopic eczema | 4 | MONDO:0004980 | EFO:0000274 |
| contact dermatitis | 4 | MONDO:0005480 | EFO:0005319 |
| ophthalmic herpes zoster | 4 | MONDO:0005883 | EFO:0007403 |
| frozen shoulder | 4 | MONDO:0006763 | EFO:1000941 |
| iritis | 4 | MONDO:0006814 | EFO:1000997 |
| Crohn disease | 4 | MONDO:0005011 | EFO:0000384 |
| dermatomyositis | 4 | MONDO:0016367 | EFO:0000398 |
| lymphoma | 4 | MONDO:0005062 | EFO:0000574 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| dermatitis herpetiformis | 4 | MONDO:0015614 | EFO:1000684 |
| aplastic anemia | 4 | MONDO:0015909 | HP:0001915 |
| ankylosing spondylitis | 4 | MONDO:0005306 | EFO:0003898 |
| allergic rhinitis | 4 | MONDO:0011786 | EFO:0005854 |
| optic neuritis | 4 | MONDO:0005885 | EFO:0007405 |
| trichinellosis | 4 | MONDO:0019444 | EFO:0007520 |
| psoriasis | 4 | MONDO:0005083 | EFO:0000676 |
| psoriatic arthritis | 4 | MONDO:0011849 | EFO:0003778 |
| non-autoimmune hemolytic anemia | 4 | MONDO:0021559 | EFO:0005558 |
| leukemia | 4 | MONDO:0005059 | EFO:0000565 |
| pneumonia | 4 | MONDO:0005249 | EFO:0003106 |
| meningeal tuberculosis | 4 | MONDO:0006042 | EFO:1000039 |
| subacute thyroiditis | 4 | MONDO:0006982 | EFO:1001194 |
| thrombocytopenia | 4 | MONDO:0002049 | HP:0001873 |
| gout | 4 | MONDO:0005393 | EFO:0004274 |
| atopic conjunctivitis | 4 | MONDO:0005642 | EFO:0007141 |
| pulmonary tuberculosis | 4 | MONDO:0006052 | EFO:1000049 |
| sympathetic ophthalmia | 4 | MONDO:0019198 | EFO:1001205 |
| peptic ulcer disease | 4 | MONDO:0004247 | HP:0004398 |
| erythema multiforme | 4 | MONDO:0006545 | EFO:1000694 |
| seborrheic dermatitis | 4 | MONDO:0006608 | EFO:1000764 |
| mycosis fungoides | 4 | MONDO:0009691 | EFO:1001051 |
| posterior uveitis | 4 | MONDO:0006918 | EFO:1001119 |
| tenosynovitis | 4 | MONDO:0004855 | EFO:1001435 |
| hypercalcemia disease | 4 | MONDO:0001566 | HP:0003072 |
| eosinophilic pneumonia | 4 | MONDO:0005749 | EFO:0007257 |
| synovitis | 4 | MONDO:0002400 | EFO:0008997 |
| keratitis | 4 | MONDO:0003085 | EFO:0009449 |
| exfoliative dermatitis | 4 | MONDO:0043233 | EFO:0009456 |
| hemorrhoid | 4 | MONDO:0004872 | EFO:0009552 |
| myocarditis | 4 | MONDO:0004496 | EFO:0009609 |
| epicondylitis | 4 | MONDO:0001875 | EFO:1001887 |
| iridocyclitis | 4 | MONDO:0004773 | HP:0001094 |
| chorioretinitis | 4 | MONDO:0004674 | HP:0012424 |
| choroiditis | 4 | MONDO:0001280 | MONDO:0001280 |
| chronic primary adrenal insufficiency | 4 | MONDO:0015129 | MONDO:0015128 |
| type III hypersensitivity disease | 4 | MONDO:0007004 | EFO:1001222 |
| asthma | 4 | MONDO:0004979 | MONDO:0004979 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| multiple sclerosis | 4 | MONDO:0005301 | MONDO:0005301 |
| congenital adrenal hyperplasia | 4 | MONDO:0018479 | MONDO:0008728 |
| sarcoidosis | 4 | MONDO:0019338 | MONDO:0019338 |
| systemic lupus erythematosus | 4 | MONDO:0007915 | MONDO:0007915 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| IgA glomerulonephritis | 3 | MONDO:0005342 | EFO:0004194 |
| pulpitis | 3 | MONDO:0006937 | EFO:1001139 |
| idiopathic pulmonary fibrosis | 3 | MONDO:0800504 | EFO:0000768 |
| alcoholic hepatitis | 3 | MONDO:0001505 | EFO:1001345 |
| pericarditis | 3 | MONDO:0005904 | EFO:0007427 |
| neoplasm of mature B-cells | 3 | MONDO:0004949 | EFO:0000096 |
| hepatocellular carcinoma | 3 | MONDO:0007256 | EFO:0000182 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| prostate adenocarcinoma | 3 | MONDO:0005082 | EFO:0000673 |
| prostate carcinoma | 3 | MONDO:0005159 | EFO:0001663 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| Kawasaki disease | 3 | MONDO:0012727 | EFO:0004246 |
| lupus nephritis | 3 | MONDO:0005556 | EFO:0005761 |
| non-Hodgkin lymphoma | 3 | MONDO:0018908 | EFO:0005952 |
| allergic bronchopulmonary aspergillosis | 3 | MONDO:0015243 | EFO:0007140 |
| autoimmune thrombocytopenic purpura | 3 | MONDO:0008558 | EFO:0007160 |
| eosinophilic granulomatosis with polyangiitis | 3 | MONDO:0015943 | EFO:0007208 |
| croup | 3 | MONDO:0005722 | EFO:0007227 |
| autoimmune hemolytic anemia | 3 | MONDO:0020108 | EFO:1001264 |
| hypereosinophilic syndrome | 3 | MONDO:0015691 | EFO:1001467 |
| membranous glomerulonephritis | 3 | MONDO:0005376 | EFO:0004254 |
| anti-neutrophil antibody associated vasculitis | 3 | MONDO:0005435 | EFO:0004826 |
| polymyalgia rheumatica | 3 | MONDO:0019735 | EFO:0008518 |
| habitual spontaneous abortion | 3 | MONDO:0006774 | EFO:1000954 |
| orbital pseudotumor | 3 | MONDO:0004769 | EFO:1001077 |
| T-cell acute lymphoblastic leukemia | 3 | MONDO:0004963 | EFO:0000209 |
| open-angle glaucoma | 3 | MONDO:0005338 | EFO:0004190 |
| Graves disease | 3 | MONDO:0005364 | EFO:0004237 |
| ocular hypertension | 3 | MONDO:0006875 | EFO:1001069 |
| pure red-cell aplasia | 3 | MONDO:0001705 | MONDO:0001705 |
| glomerulonephritis | 3 | MONDO:0002462 | MONDO:0002462 |
| follicular lymphoma | 3 | MONDO:0018906 | MONDO:0018906 |
| colitis | 3 | MONDO:0005292 | EFO:0003872 |
| focal segmental glomerulosclerosis | 3 | MONDO:0100313 | EFO:0004236 |
| adrenocortical insufficiency | 3 | MONDO:0000004 | EFO:0009491 |
| pemphigus | 3 | MONDO:0006594 | EFO:1000749 |
| eye infectious disorder | 3 | MONDO:0043885 | EFO:1001888 |
| soft tissue sarcoma | 3 | MONDO:0018078 | EFO:1001968 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
| metastatic prostate carcinoma | 3 | MONDO:0004956 | EFO:0000196 |
| cataract | 3 | MONDO:0005129 | MONDO:0005129 |
| allergic disease | 3 | MONDO:0005271 | MONDO:0005271 |
| biliary atresia | 3 | MONDO:0008867 | MONDO:0008867 |
| thrombotic thrombocytopenic purpura | 3 | MONDO:0018896 | MONDO:0018896 |
| stroke disorder | 3 | MONDO:0005098 | EFO:0000712 |
| Takayasu arteritis | 3 | MONDO:0017991 | EFO:1001857 |
| glaucoma | 3 | MONDO:0005041 | MONDO:0005041 |
| graft versus host disease | 3 | MONDO:0013730 | MONDO:0013730 |
| plasma cell neoplasm | 3 | MONDO:0004959 | EFO:0000200 |
| chronic progressive multiple sclerosis | 3 | MONDO:0005284 | EFO:0003840 |
| alcoholic liver disease | 3 | MONDO:0043693 | EFO:0008573 |
| hyperthyroidism | 3 | MONDO:0004425 | EFO:0009189 |
| leprosy | 2 | MONDO:0005124 | EFO:0001054 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| canker sore | 2 | MONDO:0005318 | EFO:0003938 |
| hemangioma | 2 | MONDO:0006500 | EFO:1000635 |
| Hodgkins lymphoma | 2 | MONDO:0004952 | EFO:0000183 |
| peripheral T-cell lymphoma, not otherwise specified | 2 | MONDO:0004964 | EFO:0000211 |
| angioimmunoblastic T-cell lymphoma | 2 | MONDO:0004977 | EFO:0000255 |
| infertility disorder | 2 | MONDO:0005047 | EFO:0000545 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| celiac disease | 2 | MONDO:0005130 | EFO:0001060 |
| anaplastic large cell lymphoma | 2 | MONDO:0020325 | EFO:0003032 |
| chronic kidney disease | 2 | MONDO:0005300 | EFO:0003884 |
| granulomatosis with polyangiitis | 2 | MONDO:0012105 | EFO:0005297 |
| microscopic polyangiitis | 2 | MONDO:0019124 | EFO:1000784 |
| ACTH-dependent Cushing syndrome | 2 | MONDO:0020528 | EFO:1001110 |
| hypersensitivity pneumonitis | 2 | MONDO:0017853 | EFO:1001321 |
| systemic sclerosis | 2 | MONDO:0005100 | EFO:0000717 |
| temporal arteritis | 2 | MONDO:0008538 | EFO:1001209 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| mucous membrane pemphigoid | 2 | MONDO:0018746 | EFO:1000680 |
| lichen planus | 2 | MONDO:0006572 | EFO:1000726 |
| uveitis | 2 | MONDO:0020283 | EFO:1001231 |
| sinusitis | 2 | MONDO:0005961 | EFO:0007486 |
| type 2 diabetes mellitus | 2 | MONDO:0005148 | MONDO:0005148 |
| familial lipoprotein lipase deficiency | 2 | MONDO:0009387 | MONDO:0009387 |
| Duchenne muscular dystrophy | 2 | MONDO:0010679 | MONDO:0010679 |
| cardiomyopathy | 2 | MONDO:0004994 | EFO:0000318 |
| Sjogren syndrome | 2 | MONDO:0010030 | EFO:0000699 |
| osteoarthritis, knee | 2 | MONDO:0005416 | EFO:0004616 |
| sensorineural hearing loss disorder | 2 | MONDO:0020678 | EFO:1001176 |
| lymphoid leukemia | 2 | MONDO:0005402 | EFO:0004289 |
| lipoma | 1 | MONDO:0005106 | EFO:0000759 |
| age-related macular degeneration | 1 | MONDO:0005150 | EFO:0001365 |
| Bell’s palsy | 1 | MONDO:0005665 | EFO:0007167 |
| neoplasm | 1 | MONDO:0005070 | MONDO:0004992 |
14 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 506.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 133 |
| PHASE4 | 123 |
| PHASE2 | 107 |
| Not specified | 63 |
| PHASE1 | 29 |
| PHASE2/PHASE3 | 24 |
| PHASE1/PHASE2 | 24 |
| EARLY_PHASE1 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03760835 | PHASE4 | RECRUITING | Congenital Adrenal Hyperplasia Once Daily Hydrocortisone Treatment |
| NCT03781700 | PHASE4 | RECRUITING | Evaluation of Cortisone Treatment in Children With Acute Facial Nerve Palsy |
| NCT04371445 | PHASE4 | RECRUITING | Dextenza in the Post-op Management of Vitreoretinal Surgeries |
| NCT04549935 | PHASE4 | RECRUITING | The PRIME Study: A Randomized, Controlled, Prospective Study |
| NCT05191706 | PHASE4 | RECRUITING | Evaluate the Safety of DEXYCU for the Treatment of Inflammation Following Ocular Surgery for Childhood Cataract |
| NCT05331664 | PHASE4 | RECRUITING | Dropless Pars Plana Vitrectomy Study |
| NCT05412394 | PHASE4 | RECRUITING | Once Weekly Infant Corticosteroid Trial for DMD |
| NCT05725512 | PHASE4 | RECRUITING | Prednisolone Administration in Patients With Unexplained REcurrent MIscarriages |
| NCT06040255 | PHASE4 | ENROLLING_BY_INVITATION | Focal Cerebral Arteriopathy Steroid Trial |
| NCT06611696 | PHASE4 | RECRUITING | Avacopan vs Reduced-dose Glucocorticoids in ANCA-associated Vasculitis |
| NCT06654934 | PHASE4 | NOT_YET_RECRUITING | Prednisolone for 12 Versus 6 Months to Treat Pulmonary Sarcoidosis |
| NCT06676384 | PHASE4 | RECRUITING | Which of the Commonly Available and Approved Drugs in Addition to Standard of Care Can Significantly Improve the Slope of Estimated Glomerular Filtration Rate at Two Years When Compared to Standard of Care Alone in South-Asian Kidney Biopsy-proven Adult (≥18 Years) Primary IgA Nephropathy? |
| NCT06943482 | PHASE4 | NOT_YET_RECRUITING | Comparing Effectiveness of Steroids and Methotrexate in Treatment of Chronic Inflammatory Breast Disease |
| NCT07221838 | PHASE4 | RECRUITING | A Study to Investigate OCS Tapering in Adult Participants With Generalized Myasthenia Gravis Treated With Ravulizumab |
| NCT07227428 | PHASE4 | NOT_YET_RECRUITING | Comparison of Glucocorticoid Tapering Schedules in Rheumatoid Arthritis |
| NCT07252271 | PHASE4 | NOT_YET_RECRUITING | Very Low Dose Prednisolone on Newly Diagnosed Rheumatoid Arthritis |
| NCT07258771 | PHASE4 | RECRUITING | Upadacitinib Combined With Corticosteroids vs Corticosteroid Monotherapy Induction for Inpatients and Outpatients With Acute Severe Ulcerative Colitis |
| NCT00138970 | PHASE4 | COMPLETED | Calcineurin Inhibitor-Free Immunosuppression in Renal Transplant Recipients at Low Immunogenic Risk |
| NCT00198978 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Elderly Patients With Newly Diagnosed Acute Lymphoblastic Leukemia |
| NCT00198991 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (07/2003) |
| NCT00199004 | PHASE4 | COMPLETED | Trial for Treatment of Adult Patients With Standard Risk Acute Lymphoblastic Leukemia With Chemotherapy and Rituximab |
| NCT00199017 | PHASE4 | COMPLETED | German Multicenter Trial for the Treatment of Newly Diagnosed T-lymphoblastic Lymphoma in Adults |
| NCT00199056 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (06/99) |
| NCT00199069 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (05/93) |
| NCT00199082 | PHASE4 | COMPLETED | Newly Diagnosed Mature B-ALL, Burkitt’s Lymphoma and Other High-grade Lymphoma in Adults |
| NCT00261820 | PHASE4 | COMPLETED | Study Comparing Two Immunosuppressive Regimens in De Novo Renal Allograft Recipients |
| NCT00311961 | PHASE4 | COMPLETED | Intravenous Versus Oral Administration of Prednisolone in Exacerbations of Chronic Obstructive Pulmonary Disease (COPD) |
| NCT00312325 | PHASE4 | COMPLETED | Effect of High-Dose Prednisolone (Solu Dacortin®) Treatment on Choroidal and Optic Nerve Head Blood Flow in Humans |
| NCT00393367 | PHASE4 | COMPLETED | Budesonide Inhalation Suspension for Acute Asthma in Children |
| NCT00445081 | PHASE4 | COMPLETED | Prednisolone vs. Ciclosporine in Severe Atopic Eczema |
| NCT00494624 | PHASE4 | UNKNOWN | Efficacy of Systemic Glucocorticoid in the Treatment of Wheezing in Children |
| NCT00510263 | PHASE4 | COMPLETED | Scandinavian Bell’s Palsy Study |
| NCT00526409 | PHASE4 | COMPLETED | LAL-AR-N-2005:Study Treatment for Children High Risk Acute Lymphoblastic Leukemia |
| NCT00609752 | PHASE4 | UNKNOWN | Adverse Effects of Glucocorticoid Therapy on Bone in Childhood Crohn’s Disease |
| NCT00627731 | PHASE4 | COMPLETED | Oral Glucocorticosteroid in the Treatment of Severe Asthma Exacerbation in Hospitalized Patients |
| NCT00632554 | PHASE4 | COMPLETED | The Efficacy of Three Months-prednisolone Therapy for Chronic Eosinophilic Pneumonia |
| NCT00662298 | PHASE4 | COMPLETED | Prednisolone Pharmacokinetics in Severe Asthma |
| NCT00689078 | PHASE4 | COMPLETED | Evaluation of the Efficacy of Topical Ophthalmic Steroids in a Modified Conjunctival Allergen Challenge (CAC) Model |
| NCT00744666 | PHASE4 | UNKNOWN | IntraVitreal Triamcinolone Acetonide: Preventing Raised Eye-pressure by Tracking Elevations After Topical Steroids |
| NCT00778596 | PHASE4 | UNKNOWN | Prednisolone Priming Study in Patients With Chronic Hepatitis B |
Clinical evidence (CIViC)
Variant × indication × effect (3 predictive associations from 3 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| NT5C2 R238W | Childhood Acute Lymphocytic Leukemia | Resistance | Cytarabine + Gemcitabine + Doxorubicin + Prednisolone | CIViC D | EID7816 |
| NT5C2 R367Q | Childhood Acute Lymphocytic Leukemia | Resistance | Cytarabine + Gemcitabine + Prednisolone + Doxorubicin | CIViC D | EID7815 |
| NT5C2 S445F | Childhood Acute Lymphocytic Leukemia | Resistance | Cytarabine + Doxorubicin + Gemcitabine + Prednisolone | CIViC D | EID7817 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 4 clinical and 21 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
179 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ENZALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| EPLERENONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUDROCORTISONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROCORTISONE BUTYRATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| ASOPRISNIL | ChEMBL | Phase 3 | NR3C1, NR3C2 |
| BALCINRENONE | ChEMBL | Phase 3 | NR3C1, NR3C2 |
| METRIBOLONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| ONAPRISTONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| STANOLONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| TUROFEXORATE ISOPROPYL | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ALCLOMETASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| APREPITANT | ChEMBL | Phase 4 (approved) | NR3C1 |
| AURANOFIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE VALERATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEFLAZACORT | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIENESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
Related Atlas pages
- Genes: NR3C1, NR3C2
- Diseases: eye disorder, nephrotic syndrome, rheumatoid arthritis, ulcerative colitis, atopic eczema, contact dermatitis, ophthalmic herpes zoster, frozen shoulder, iritis, Crohn disease, dermatomyositis, lymphoma, juvenile idiopathic arthritis, dermatitis herpetiformis, aplastic anemia, ankylosing spondylitis, allergic rhinitis, optic neuritis, trichinellosis, psoriasis, psoriatic arthritis, non-autoimmune hemolytic anemia, leukemia, pneumonia, meningeal tuberculosis, subacute thyroiditis, thrombocytopenia, gout, atopic conjunctivitis, pulmonary tuberculosis, sympathetic ophthalmia, peptic ulcer disease, erythema multiforme, seborrheic dermatitis, mycosis fungoides, posterior uveitis, tenosynovitis, hypercalcemia disease, eosinophilic pneumonia, synovitis, keratitis, exfoliative dermatitis, hemorrhoid, myocarditis, epicondylitis, iridocyclitis, chorioretinitis, choroiditis, chronic primary adrenal insufficiency, type III hypersensitivity disease, asthma, osteoarthritis, multiple sclerosis, congenital adrenal hyperplasia, sarcoidosis, systemic lupus erythematosus, plasma cell myeloma, chronic obstructive pulmonary disease, IgA glomerulonephritis, pulpitis, idiopathic pulmonary fibrosis, alcoholic hepatitis, pericarditis, neoplasm of mature B-cells, hepatocellular carcinoma, acute lymphoblastic leukemia, diffuse large B-cell lymphoma, prostate adenocarcinoma, prostate carcinoma, kidney disorder, Kawasaki disease, lupus nephritis, non-Hodgkin lymphoma, allergic bronchopulmonary aspergillosis, autoimmune thrombocytopenic purpura, eosinophilic granulomatosis with polyangiitis, croup, autoimmune hemolytic anemia, hypereosinophilic syndrome, membranous glomerulonephritis, anti-neutrophil antibody associated vasculitis, polymyalgia rheumatica, habitual spontaneous abortion, orbital pseudotumor, T-cell acute lymphoblastic leukemia, open-angle glaucoma, Graves disease, ocular hypertension, pure red-cell aplasia, glomerulonephritis, follicular lymphoma, colitis, focal segmental glomerulosclerosis, adrenocortical insufficiency, pemphigus, eye infectious disorder, soft tissue sarcoma, severe acute respiratory syndrome, metastatic prostate carcinoma, cataract, allergic disease, biliary atresia, thrombotic thrombocytopenic purpura, stroke disorder, Takayasu arteritis, glaucoma, graft versus host disease, plasma cell neoplasm, chronic progressive multiple sclerosis, alcoholic liver disease, hyperthyroidism, childhood acute lymphoblastic leukemia
- Drugs: Enzalutamide, Eplerenone, Fludrocortisone, Budesonide, Dexamethasone, Fluticasone Furoate, Fluticasone Propionate, Hydrocortisone, Hydrocortisone Butyrate, Medroxyprogesterone, Mifepristone, Progesterone, Spironolactone, Asoprisnil, Balcinrenone, Fulvestrant, Podofilox, Regorafenib, Acenocoumarol, Alclometasone Dipropionate, Amcinonide, Amiodarone, Aprepitant, Auranofin, Bazedoxifene, Beclomethasone Dipropionate, Benzbromarone, Betamethasone, Betamethasone Dipropionate, Betamethasone Phosphoric Acid, Betamethasone Valerate, Butoconazole, Candesartan Cilexetil, Canrenone, Chlormadinone, Ciclesonide, Clobetasol Propionate, Clofazimine, Clotrimazole, Cortisone, Danazol, Daunorubicin, Deflazacort, Desogestrel, Desonide, Desoximetasone, Desoxycorticosterone Pivalate, Dextrothyroxine, Dienestrol, Diethylstilbestrol, Diflorasone Diacetate, Doxorubicin, Drospirenone, Econazole, Efavirenz, Estradiol