Prednisone
drugOn this page
Also known as 3en3hg4wswCortanCortancylDecortinDecortisylDehydrocortisoneDelta-domeDeltasoneFernisoneLiquid predLodotraMetacortandracinMeticortenNSC-10023OrasoneParacortPrednicen-mPrednisonaPrednisone anhydrous
Summary
Prednisone (CHEMBL635) is an approved small-molecule prodrug (ATC A07EA03) targeting NR3C1; indicated across 225 conditions including rheumatoid arthritis and pneumonia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A07EA03 (+1 more)
- Targets: 1 (NR3C1)
- Indications: 225 conditions
- Clinical trials: 1,357
- Chemistry: 358.4 Da · C21H26O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL635 |
| Name | Prednisone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5865 |
| ChEBI | CHEBI:8382 |
| ATC | A07EA03, H02AB07 |
| Molecular formula | C21H26O5 |
| Molecular weight | 358.4 |
| InChIKey | XOFYZVNMUHMLCC-ZPOLXVRWSA-N |
SMILES: C[C@]12CC(=O)[C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)CO)O)CCC4=CC(=O)C=C[C@]34C
IUPAC name: (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione
ChEBI definition: A synthetic glucocorticoid drug that is particularly effective as an immunosuppressant, and affects virtually all of the immune system. Prednisone is a prodrug that is converted by the liver into prednisolone (a β-hydroxy group instead of the oxo group at position 11), which is the active drug and also a steroid.
Pharmacological roles (ChEBI): prodrug, anti-inflammatory drug, antineoplastic agent, immunosuppressive agent, adrenergic agent.
Also known as: 3en3hg4wsw, Cortan, Cortancyl, Decortin, Decortisyl, Dehydrocortisone, Delta-dome, Deltasone, Fernisone, Liquid pred, Lodotra, Metacortandracin
Patent coverage: 50,972 distinct patent families (190,796 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR3C1 | Glucocorticoid receptor | Full agonist | 6.28 | 0.9% | P04150 |
Broader ChEMBL bioactivity targets: 9 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Nuclear receptor ROR-gamma, Equilibrative nucleoside transporter 1, Glucocorticoid receptor, Progesterone receptor, Menin/Histone-lysine N-methyltransferase MLL, Aldehyde dehydrogenase 1A1, 3-hydroxyacyl-CoA dehydrogenase type-2, Hypoxia-inducible factor 1-alpha.
Bioactivity
ChEMBL activities: 6 potent at pChembl ≥ 5 of 12 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C1 | 7.54 | Kd | 29 | nM | CHEMBL_ACT_22449309 |
| NR3C1 | 6.57 | AC50 | 268 | nM | CHEMBL_ACT_25175426 |
| NR3C1 | 6.28 | Ki | 521 | nM | CHEMBL_ACT_7734869 |
| NR3C1 | 5.94 | IC50 | 1146 | nM | CHEMBL_ACT_7734868 |
| P51450 | 5.45 | Potency | 3548 | nM | CHEMBL_ACT_4770100 |
| ALDH1A1 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4119660 |
Target pathways
Aggregated over 1 target gene(s): NR3C1.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | NR3C1 |
| Nuclear Receptor transcription pathway | 1 | NR3C1 |
| SUMOylation of intracellular receptors | 1 | NR3C1 |
| PTK6 Expression | 1 | NR3C1 |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 1 |
| regulation of gluconeogenesis | 1 |
| chromatin organization | 1 |
| regulation of DNA-templated transcription | 1 |
| regulation of transcription by RNA polymerase II | 1 |
| apoptotic process | 1 |
| chromosome segregation | 1 |
| signal transduction | 1 |
| glucocorticoid metabolic process | 1 |
| response to wounding | 1 |
| gene expression | 1 |
| microglia differentiation | 1 |
| adrenal gland development | 1 |
| nuclear receptor-mediated steroid hormone signaling pathway | 1 |
| regulation of glucocorticoid biosynthetic process | 1 |
Indications & clinical
Indications
225 indications (72 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| pneumonia | 4 | MONDO:0005249 | EFO:0003106 |
| allergic rhinitis | 4 | MONDO:0011786 | EFO:0005854 |
| Crohn disease | 4 | MONDO:0005011 | EFO:0000384 |
| ulcerative colitis | 4 | MONDO:0005101 | EFO:0000729 |
| polymyositis | 4 | MONDO:0019127 | EFO:0003063 |
| seasonal allergic rhinitis | 4 | MONDO:0005324 | EFO:0003956 |
| gout | 4 | MONDO:0005393 | EFO:0004274 |
| non-autoimmune hemolytic anemia | 4 | MONDO:0021559 | EFO:0005558 |
| atopic eczema | 4 | MONDO:0004980 | EFO:0000274 |
| ankylosing spondylitis | 4 | MONDO:0005306 | EFO:0003898 |
| contact dermatitis | 4 | MONDO:0005480 | EFO:0005319 |
| tenosynovitis | 4 | MONDO:0004855 | EFO:1001435 |
| psoriasis | 4 | MONDO:0005083 | EFO:0000676 |
| meningeal tuberculosis | 4 | MONDO:0006042 | EFO:1000039 |
| frozen shoulder | 4 | MONDO:0006763 | EFO:1000941 |
| dermatomyositis | 4 | MONDO:0016367 | EFO:0000398 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| autoimmune thrombocytopenic purpura | 4 | MONDO:0008558 | EFO:0007160 |
| mycosis fungoides | 4 | MONDO:0009691 | EFO:1001051 |
| subacute thyroiditis | 4 | MONDO:0006982 | EFO:1001194 |
| lymphoma | 4 | MONDO:0005062 | EFO:0000574 |
| optic neuritis | 4 | MONDO:0005885 | EFO:0007405 |
| pulmonary tuberculosis | 4 | MONDO:0006052 | EFO:1000049 |
| dermatitis herpetiformis | 4 | MONDO:0015614 | EFO:1000684 |
| seborrheic dermatitis | 4 | MONDO:0006608 | EFO:1000764 |
| posterior uveitis | 4 | MONDO:0006918 | EFO:1001119 |
| leukemia | 4 | MONDO:0005059 | EFO:0000565 |
| psoriatic arthritis | 4 | MONDO:0011849 | EFO:0003778 |
| Stevens-Johnson syndrome | 4 | MONDO:0018229 | EFO:0004276 |
| pemphigus vulgaris | 4 | MONDO:0008219 | EFO:0004719 |
| arthritic joint disease | 4 | MONDO:0005578 | EFO:0005856 |
| chronic beryllium disease | 4 | MONDO:0015274 | EFO:0007168 |
| eosinophilic pneumonia | 4 | MONDO:0005749 | EFO:0007257 |
| trichinellosis | 4 | MONDO:0019444 | EFO:0007520 |
| thrombocytopenia | 4 | MONDO:0002049 | HP:0001873 |
| nephrotic syndrome | 4 | MONDO:0005377 | EFO:0004255 |
| atopic conjunctivitis | 4 | MONDO:0005642 | EFO:0007141 |
| ophthalmic herpes zoster | 4 | MONDO:0005883 | EFO:0007403 |
| erythema multiforme | 4 | MONDO:0006545 | EFO:1000694 |
| iritis | 4 | MONDO:0006814 | EFO:1000997 |
| sympathetic ophthalmia | 4 | MONDO:0019198 | EFO:1001205 |
| aplastic anemia | 4 | MONDO:0015909 | HP:0001915 |
| hypercalcemia disease | 4 | MONDO:0001566 | HP:0003072 |
| juvenile dermatomyositis | 4 | MONDO:0008054 | EFO:0000557 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| myocarditis | 4 | MONDO:0004496 | EFO:0009609 |
| synovitis | 4 | MONDO:0002400 | EFO:0008997 |
| keratitis | 4 | MONDO:0003085 | EFO:0009449 |
| exfoliative dermatitis | 4 | MONDO:0043233 | EFO:0009456 |
| epicondylitis | 4 | MONDO:0001875 | EFO:1001896 |
| iridocyclitis | 4 | MONDO:0004773 | HP:0001094 |
| chorioretinitis | 4 | MONDO:0004674 | HP:0012424 |
| choroiditis | 4 | MONDO:0001280 | MONDO:0001280 |
| chronic primary adrenal insufficiency | 4 | MONDO:0015129 | MONDO:0015128 |
| pemphigus | 4 | MONDO:0006594 | EFO:1000749 |
| type III hypersensitivity disease | 4 | MONDO:0007004 | EFO:1001222 |
| asthma | 4 | MONDO:0004979 | MONDO:0004979 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| multiple sclerosis | 4 | MONDO:0005301 | MONDO:0005301 |
| congenital adrenal hyperplasia | 4 | MONDO:0018479 | MONDO:0008728 |
| sarcoidosis | 4 | MONDO:0019338 | MONDO:0019338 |
| endocrine system disorder | 4 | MONDO:0005151 | EFO:0001379 |
| brain neoplasm | 4 | MONDO:0021211 | EFO:0003833 |
| adrenal gland disorder | 4 | MONDO:0005495 | EFO:0005539 |
| peptic ulcer disease | 4 | MONDO:0004247 | HP:0004398 |
| anemia | 4 | MONDO:0002280 | MONDO:0002280 |
| bursitis | 4 | MONDO:0002471 | MONDO:0002471 |
| spondylitis | 4 | MONDO:0003937 | MONDO:0003937 |
| systemic lupus erythematosus | 4 | MONDO:0007915 | MONDO:0007915 |
| nasal cavity polyp | 3 | MONDO:0006314 | EFO:1000391 |
| pulmonary sarcoidosis | 3 | MONDO:0001708 | DOID:13406 |
| sciatica | 3 | MONDO:0024333 | HP:0011868 |
| granulomatosis with polyangiitis | 3 | MONDO:0012105 | EFO:0005297 |
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| heart failure | 3 | MONDO:0005252 | EFO:0003144 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| prostate carcinoma | 3 | MONDO:0005159 | EFO:0001663 |
| myasthenia gravis | 3 | MONDO:0009688 | EFO:0004991 |
| sinusitis | 3 | MONDO:0005961 | EFO:0007486 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| prostate adenocarcinoma | 3 | MONDO:0005082 | EFO:0000673 |
| urticaria | 3 | MONDO:0005492 | EFO:0005531 |
| IgA glomerulonephritis | 3 | MONDO:0005342 | EFO:0004194 |
| graft versus host disease | 3 | MONDO:0013730 | EFO:0004599 |
| uveitis | 3 | MONDO:0020283 | EFO:1001231 |
| perennial allergic rhinitis | 3 | MONDO:0024332 | EFO:1001417 |
| mantle cell lymphoma | 3 | MONDO:0018876 | EFO:1001469 |
| B-cell chronic lymphocytic leukemia | 3 | MONDO:0004948 | EFO:0000095 |
| neoplasm of mature B-cells | 3 | MONDO:0004949 | EFO:0000096 |
| Hodgkins lymphoma | 3 | MONDO:0004952 | EFO:0000183 |
| metastatic prostate carcinoma | 3 | MONDO:0004956 | EFO:0000196 |
| T-cell acute lymphoblastic leukemia | 3 | MONDO:0004963 | EFO:0000209 |
| peripheral T-cell lymphoma, not otherwise specified | 3 | MONDO:0004964 | EFO:0000211 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| cardiomyopathy | 3 | MONDO:0004994 | EFO:0000318 |
| congestive heart failure | 3 | MONDO:0005009 | EFO:0000373 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| neuroblastoma | 3 | MONDO:0005072 | EFO:0000621 |
| sarcoma | 3 | MONDO:0005089 | EFO:0000691 |
| idiopathic pulmonary fibrosis | 3 | MONDO:0800504 | EFO:0000768 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| membranous glomerulonephritis | 3 | MONDO:0005376 | EFO:0004254 |
| lymphoid leukemia | 3 | MONDO:0005402 | EFO:0004289 |
| anti-neutrophil antibody associated vasculitis | 3 | MONDO:0005435 | EFO:0004826 |
| lupus nephritis | 3 | MONDO:0005556 | EFO:0005761 |
| non-Hodgkin lymphoma | 3 | MONDO:0018908 | EFO:0005952 |
| Langerhans cell histiocytosis | 3 | MONDO:0018310 | EFO:1000318 |
| microscopic polyangiitis | 3 | MONDO:0019124 | EFO:1000784 |
| temporal arteritis | 3 | MONDO:0008538 | EFO:1001209 |
| hypereosinophilic syndrome | 3 | MONDO:0015691 | EFO:1001467 |
| vasculitis | 3 | MONDO:0018882 | EFO:0006803 |
| polymyalgia rheumatica | 3 | MONDO:0019735 | EFO:0008518 |
| intermediate uveitis | 3 | MONDO:0006806 | EFO:1000986 |
| central nervous system neoplasm | 3 | MONDO:0006130 | EFO:1000158 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| thrombotic thrombocytopenic purpura | 3 | MONDO:0018896 | MONDO:0018896 |
| follicular lymphoma | 3 | MONDO:0018906 | MONDO:0018906 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
| B-cell acute lymphoblastic leukemia | 3 | MONDO:0004947 | EFO:0000094 |
| Waldenstrom macroglobulinemia | 3 | MONDO:0100280 | MONDO:0000432 |
| IgG4-related retroperitoneal fibrosis | 3 | MONDO:0018848 | MONDO:0018848 |
| bullous pemphigoid | 3 | MONDO:0019082 | EFO:0007187 |
| soft tissue sarcoma | 3 | MONDO:0018078 | EFO:1001968 |
| mature T-cell and NK-cell non-Hodgkin lymphoma | 3 | MONDO:0000430 | MONDO:0000430 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| cystic fibrosis | 3 | MONDO:0009061 | MONDO:0009061 |
| Duchenne muscular dystrophy | 3 | MONDO:0010679 | MONDO:0010679 |
| tuberculosis | 3 | MONDO:0018076 | MONDO:0018076 |
| pericarditis | 3 | MONDO:0005904 | EFO:0007427 |
| plasma cell neoplasm | 3 | MONDO:0004959 | EFO:0000200 |
| marginal zone lymphoma | 3 | MONDO:0017604 | EFO:1000630 |
| prostate cancer | 3 | MONDO:0008315 | MONDO:0021259 |
| myelodysplastic syndrome | 2 | MONDO:0018881 | EFO:0000198 |
| hepatitis C virus infection | 2 | MONDO:0005231 | EFO:0003047 |
| autoimmune disease | 2 | MONDO:0007179 | EFO:0005140 |
| primary myelofibrosis | 2 | MONDO:0009692 | EFO:0002430 |
| lung disorder | 2 | MONDO:0005275 | EFO:0003818 |
| hemangioma | 2 | MONDO:0006500 | EFO:1000635 |
| alcoholic hepatitis | 2 | MONDO:0001505 | EFO:1001345 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| angioimmunoblastic T-cell lymphoma | 2 | MONDO:0004977 | EFO:0000255 |
| Burkitt lymphoma | 2 | MONDO:0007243 | EFO:0000309 |
| essential thrombocythemia | 2 | MONDO:0005029 | EFO:0000479 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| acquired polycythemia vera | 2 | MONDO:0009891 | EFO:0002429 |
| thymus neoplasm | 2 | MONDO:0005197 | EFO:0002626 |
| anaplastic large cell lymphoma | 2 | MONDO:0020325 | EFO:0003032 |
| relapsing-remitting multiple sclerosis | 2 | MONDO:0005314 | EFO:0003929 |
| focal segmental glomerulosclerosis | 2 | MONDO:0100313 | EFO:0004236 |
| hearing loss disorder | 2 | MONDO:0005365 | EFO:0004238 |
| autoimmune hepatitis | 2 | MONDO:0016264 | EFO:0005676 |
| cholesterol embolism | 2 | MONDO:0005568 | EFO:0005801 |
| eosinophilic granulomatosis with polyangiitis | 2 | MONDO:0015943 | EFO:0007208 |
| vestibular neuronitis | 2 | MONDO:0006008 | EFO:0007537 |
| immunoglobulin A vasculitis | 2 | MONDO:0019167 | EFO:1000965 |
| sensorineural hearing loss disorder | 2 | MONDO:0020678 | EFO:1001176 |
| autoimmune hemolytic anemia | 2 | MONDO:0020108 | EFO:1001264 |
| AIDS | 2 | MONDO:0012268 | EFO:0000765 |
| Bell’s palsy | 2 | MONDO:0005665 | EFO:0007167 |
| HIV-associated nephropathy | 2 | MONDO:0005798 | EFO:0007313 |
| stiff-person syndrome | 2 | MONDO:0008491 | EFO:0007498 |
| lichen planus, oral | 2 | MONDO:0043923 | EFO:0008517 |
| pulmonary fibrosis | 2 | MONDO:0002771 | EFO:0009448 |
| Takayasu arteritis | 2 | MONDO:0017991 | EFO:1001857 |
| myeloproliferative neoplasm | 2 | MONDO:0020076 | EFO:0002428 |
| neuromyelitis optica | 2 | MONDO:0019100 | EFO:0004256 |
| viral pneumonia | 2 | MONDO:0006012 | EFO:0007541 |
| Guillain-Barre syndrome, familial | 2 | MONDO:0007691 | EFO:0009538 |
| blast phase chronic myelogenous leukemia, BCR-ABL1 positive | 2 | MONDO:0006115 | EFO:1000131 |
| opsoclonus-myoclonus syndrome | 2 | MONDO:0015247 | EFO:1001383 |
| interstitial nephritis | 2 | MONDO:0001085 | MONDO:0001085 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| Castleman disease | 2 | MONDO:0015564 | MONDO:0015564 |
| T-cell non-Hodgkin lymphoma | 2 | MONDO:0015760 | MONDO:0015760 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| adrenocortical insufficiency | 2 | MONDO:0000004 | EFO:0009491 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| allergic disease | 2 | MONDO:0005271 | MONDO:0005271 |
| hemophilia A | 2 | MONDO:0010602 | MONDO:0010602 |
| gastrointestinal stromal tumor | 2 | MONDO:0011719 | MONDO:0011719 |
| lymphoproliferative syndrome | 2 | MONDO:0016537 | MONDO:0016537 |
| hematopoietic and lymphoid system neoplasm | 2 | MONDO:0002334 | MONDO:0044881 |
| drug-induced liver injury | 2 | MONDO:0005359 | EFO:0004228 |
| lymphoid neoplasm | 2 | MONDO:0005157 | EFO:0001642 |
| CD4+/CD56+ hematodermic neoplasm | 2 | MONDO:0019467 | EFO:0010580 |
| B-cell non-Hodgkin lymphoma | 2 | MONDO:0015759 | EFO:1001938 |
| respiratory syncytial virus infectious disease | 1 | MONDO:0001577 | EFO:1001413 |
| hematologic disorder | 1 | MONDO:0005570 | HP:0001871 |
| glucose intolerance | 1 | MONDO:0001076 | HP:0001952 |
| Gaucher disease | 1 | MONDO:0018150 | Orphanet:77260 |
| Canavan disease | 1 | MONDO:0010079 | MONDO:0010079 |
| frontotemporal dementia | 1 | MONDO:0017276 | MONDO:0017276 |
| Fanconi anemia | 1 | MONDO:0019391 | MONDO:0019391 |
| status asthmaticus | 1 | MONDO:0004766 | EFO:0008590 |
| primary effusion lymphoma | 1 | MONDO:0018842 | EFO:1000491 |
| Diamond-Blackfan anemia | 1 | MONDO:0015253 | MONDO:0015253 |
| type 2 diabetes mellitus | 0 | MONDO:0005148 | MONDO:0005148 |
23 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 1,357.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 516 |
| PHASE3 | 313 |
| PHASE4 | 135 |
| PHASE1 | 127 |
| PHASE1/PHASE2 | 111 |
| Not specified | 90 |
| PHASE2/PHASE3 | 51 |
| EARLY_PHASE1 | 14 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03016741 | PHASE4 | ACTIVE_NOT_RECRUITING | Cognitive Effects of Androgen Receptor Directed Therapies for Advanced Prostate Cancer |
| NCT03153527 | PHASE4 | RECRUITING | Taper Or Abrupt Steroid Stop: TOASSTtrial |
| NCT03760835 | PHASE4 | RECRUITING | Congenital Adrenal Hyperplasia Once Daily Hydrocortisone Treatment |
| NCT03829371 | PHASE4 | ACTIVE_NOT_RECRUITING | STUDY COMPARING TWO STANDARD TREATMENTS IN AUTOLOGOUS STEM CELL TRANSPLANTATION INELIGIBLE POPULATION AFFECTED BY MULTIPLE MYELOMA |
| NCT04314193 | PHASE4 | ACTIVE_NOT_RECRUITING | Effectiveness of Methotrexate Versus Prednisone as First-line Therapy for Pulmonary Sarcoidosis |
| NCT04376216 | PHASE4 | RECRUITING | Prednisolone Treatment in Acute Interstitial Nephritis |
| NCT04568837 | PHASE4 | NOT_YET_RECRUITING | Steroids After Spine Fusion Surgery |
| NCT04654988 | PHASE4 | RECRUITING | Study to Evaluate the Efficacy of Immunosuppression in Myocarditis or Inflammatory Cardiomyopathy. |
| NCT04788823 | PHASE4 | ACTIVE_NOT_RECRUITING | The Impact of Prednisone on Semen Parameters and Pregnancy Rates Post Vasectomy Reversal |
| NCT04875702 | PHASE4 | RECRUITING | Treat-to-Target Serum Urate Versus Treat-to-Avoid Symptoms in Gout |
| NCT05428826 | PHASE4 | RECRUITING | Early Discontinuation of Steroid Treatment in Negative FDG-PET/CT Patients With Idiopathic Retroperitoneal Fibrosis |
| NCT05457257 | PHASE4 | ACTIVE_NOT_RECRUITING | Clinical Study to Assess the Efficacy and Safety of Olaparib in Chinese Patients With Metastatic Castration-Resistant Prostate Cancer Who Have Failed Prior Treatment With a New Hormonal Agent and Have BRCA1/2 Mutations |
| NCT05522465 | PHASE4 | RECRUITING | Short-course High-dose Prednisone and Dexamethasone in Children With ITP |
| NCT05578456 | PHASE4 | NOT_YET_RECRUITING | Effect of Prednisone and Aspirin on IVF-ET Outcome Among Patients With Thyroid Autoimmunity |
| NCT05772871 | PHASE4 | RECRUITING | The Efficacy and Safety of Prednisone Combined With Huaiqihuang Granule for Primary Nephrotic Syndrome in Children |
| NCT05867329 | PHASE4 | RECRUITING | Feasibility Pilot Sequential Multiple Assignment Randomized Trial (SMART) for Acute Severe Ulcerative Colitis |
| NCT06040255 | PHASE4 | ENROLLING_BY_INVITATION | Focal Cerebral Arteriopathy Steroid Trial |
| NCT06090890 | PHASE4 | RECRUITING | Anti-inflammatory Therapy for Recurrent In-stent Restenosis |
| NCT06364319 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of Anti-CD25 rhMAb in the Treatment of Steroid-Refractory cGVHD |
| NCT06498089 | PHASE4 | RECRUITING | A Randomized, Controlled, Open-label, Multicenter Clinical Trial Comparing the Efficacy and Safety of a Precision Treatment Regimen Based on Clinical-molecular Phenotypes with a Conventional Treatment Regimen in the Treatment of Patients with Active Takayasu’s Arteritis |
| NCT06603662 | PHASE4 | RECRUITING | Systemic Oral Glucocorticoids for the Treatment of Acute Osteoarthritis Pain in the Emergency Department |
| NCT06635863 | PHASE4 | ENROLLING_BY_INVITATION | Comparing Immune System Suppression to Medication for Unexplained Heart Function and Irregular Heartbeat |
| NCT06833814 | PHASE4 | NOT_YET_RECRUITING | DOSE Trial: Optimal Dose of Oral Corticosteroids to Treat Asthma Exacerbations |
| NCT07221838 | PHASE4 | RECRUITING | A Study to Investigate OCS Tapering in Adult Participants With Generalized Myasthenia Gravis Treated With Ravulizumab |
| NCT07426484 | PHASE4 | NOT_YET_RECRUITING | Cosibelimab for CSCC in Patients With Kidney Transplant or Hematologic Malignancy |
| NCT07451665 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of Vunakizumab and Ivarmacitinib in the Treatment of Active Takayasu’s Arteritis |
| NCT00133172 | PHASE4 | TERMINATED | Effect of Rapid Steroid Withdrawal on Subclinical Markers of Rejection |
| NCT00149994 | PHASE4 | COMPLETED | Cyclosporine A C-2h Monitoring Versus Tacrolimus C-0h Monitoring in de Novo Liver Transplant Recipients |
| NCT00195429 | PHASE4 | COMPLETED | A Study Comparing the Withdrawal of Steroids or Tacrolimus in Kidney Transplant Recipients |
| NCT00203047 | PHASE4 | TERMINATED | Assessment Study of Steroid Effect in Relapsing Multiple Sclerosis Subjects Treated With Glatiramer Acetate |
| NCT00204737 | PHASE4 | COMPLETED | Short Course Glucocorticoid Treatment for PTSD |
| NCT00275535 | PHASE4 | COMPLETED | The Comparison of Tacrolimus and Sirolimus Immunosuppression Based Drug Regimens in Kidney Transplant Recipients |
| NCT00307671 | PHASE4 | COMPLETED | Treatment of Necrotizing Vasculitides for Patients Older Than 65 Years |
| NCT00371826 | PHASE4 | COMPLETED | SOCRATES: Steroid or Cyclosporine Removal After Transplantation Using Everolimus |
| NCT00374231 | PHASE4 | COMPLETED | Single Center Pilot Study of Corticosteroid Discontinuation in Liver Transplant Recipients |
| NCT00393367 | PHASE4 | COMPLETED | Budesonide Inhalation Suspension for Acute Asthma in Children |
| NCT00419926 | PHASE4 | COMPLETED | Evaluation of the Therapeutic Benefit of an Initial Intensified Dosing Regimen of Mycophenolate Sodium Versus a Standard Regimen in Renal Transplant Patients |
| NCT00472030 | PHASE4 | COMPLETED | Efficacy and Safety of Omalizumab in Bullous Pemphigoid |
| NCT00494897 | PHASE4 | COMPLETED | PETHEMA LAL-RI/96: Treatment for Patients With Standard Risk Acute Lymphoblastic Leukemia |
| NCT00526175 | PHASE4 | COMPLETED | LAL-BR/2001: Study Treatment to Low Risk ALL |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 13 clinical and 66 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
173 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ALCLOMETASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| APREPITANT | ChEMBL | Phase 4 (approved) | NR3C1 |
| AURANOFIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE VALERATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEFLAZACORT | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIENESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR3C1 |
| ENZALUTAMIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EPLERENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| EXEMESTANE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FELODIPINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUNISOLIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOCINOLONE ACETONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOROMETHOLONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOXYMESTERONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLURANDRENOLIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| GLUCAGON | ChEMBL | Phase 4 (approved) | NR3C1 |
| HALCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
Related Atlas pages
- Genes: NR3C1
- Diseases: rheumatoid arthritis, pneumonia, allergic rhinitis, Crohn disease, ulcerative colitis, polymyositis, seasonal allergic rhinitis, gout, non-autoimmune hemolytic anemia, atopic eczema, ankylosing spondylitis, contact dermatitis, tenosynovitis, psoriasis, meningeal tuberculosis, frozen shoulder, dermatomyositis, juvenile idiopathic arthritis, autoimmune thrombocytopenic purpura, mycosis fungoides, subacute thyroiditis, lymphoma, optic neuritis, pulmonary tuberculosis, dermatitis herpetiformis, seborrheic dermatitis, posterior uveitis, leukemia, psoriatic arthritis, Stevens-Johnson syndrome, pemphigus vulgaris, arthritic joint disease, chronic beryllium disease, eosinophilic pneumonia, trichinellosis, thrombocytopenia, nephrotic syndrome, atopic conjunctivitis, ophthalmic herpes zoster, erythema multiforme, iritis, sympathetic ophthalmia, aplastic anemia, hypercalcemia disease, juvenile dermatomyositis, neoplasm, myocarditis, synovitis, keratitis, exfoliative dermatitis, epicondylitis, iridocyclitis, chorioretinitis, choroiditis, chronic primary adrenal insufficiency, pemphigus, type III hypersensitivity disease, asthma, osteoarthritis, multiple sclerosis, congenital adrenal hyperplasia, sarcoidosis, endocrine system disorder, brain neoplasm, adrenal gland disorder, peptic ulcer disease, anemia, bursitis, spondylitis, systemic lupus erythematosus, nasal cavity polyp, pulmonary sarcoidosis, sciatica, granulomatosis with polyangiitis, chronic obstructive pulmonary disease, heart failure, plasma cell myeloma, prostate carcinoma, myasthenia gravis, sinusitis, acute lymphoblastic leukemia, prostate adenocarcinoma, urticaria, IgA glomerulonephritis, graft versus host disease, uveitis, perennial allergic rhinitis, mantle cell lymphoma, B-cell chronic lymphocytic leukemia, neoplasm of mature B-cells, Hodgkins lymphoma, metastatic prostate carcinoma, T-cell acute lymphoblastic leukemia, peripheral T-cell lymphoma, not otherwise specified, acute myeloid leukemia, cardiomyopathy, congestive heart failure, diffuse large B-cell lymphoma, neuroblastoma, sarcoma, idiopathic pulmonary fibrosis, kidney disorder, heart disorder, chronic kidney disease, membranous glomerulonephritis, lymphoid leukemia, anti-neutrophil antibody associated vasculitis, lupus nephritis, non-Hodgkin lymphoma, Langerhans cell histiocytosis, microscopic polyangiitis, temporal arteritis, hypereosinophilic syndrome, vasculitis, polymyalgia rheumatica, intermediate uveitis, central nervous system neoplasm, breast neoplasm, thrombotic thrombocytopenic purpura, follicular lymphoma, severe acute respiratory syndrome, B-cell acute lymphoblastic leukemia, Waldenstrom macroglobulinemia, IgG4-related retroperitoneal fibrosis, bullous pemphigoid, soft tissue sarcoma, mature T-cell and NK-cell non-Hodgkin lymphoma, Alzheimer disease, cystic fibrosis, Duchenne muscular dystrophy, tuberculosis, pericarditis, plasma cell neoplasm, marginal zone lymphoma, prostate cancer
- Drugs: Fulvestrant, Podofilox, Regorafenib, Acenocoumarol, Alclometasone Dipropionate, Amcinonide, Amiodarone, Aprepitant, Auranofin, Bazedoxifene, Beclomethasone Dipropionate, Benzbromarone, Betamethasone, Betamethasone Dipropionate, Betamethasone Phosphoric Acid, Betamethasone Valerate, Budesonide, Butoconazole, Candesartan Cilexetil, Canrenone, Chlormadinone, Ciclesonide, Clobetasol Propionate, Clofazimine, Clotrimazole, Cortisone, Danazol, Daunorubicin, Deflazacort, Desogestrel, Desonide, Desoximetasone, Desoxycorticosterone Pivalate, Dexamethasone, Dextrothyroxine, Dienestrol, Diethylstilbestrol, Diflorasone Diacetate, Doxorubicin, Drospirenone, Econazole, Efavirenz, Enzalutamide, Eplerenone, Estradiol, Estriol, Ethinyl Estradiol, Exemestane, Felodipine, Fludrocortisone, Flunisolide, Fluocinolone Acetonide, Fluocinonide, Fluorometholone, Fluoxymesterone, Flurandrenolide, Fluticasone Furoate, Fluticasone Propionate, Glucagon, Halcinonide
- Biomarker genes: NOTCH1