Prinomastat
drug drugOn this page
Also known as AG-3340AG3340KB-R-9896
Summary
Prinomastat (CHEMBL75094) is a phase-3 clinical-stage small-molecule antineoplastic agent targeting MMP13; indicated across 3 conditions including lung neoplasm and central nervous system neoplasm.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (MMP13)
- Indications: 3 conditions
- Clinical trials: 3
- Chemistry: 423.5 Da · C18H21N3O5S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL75094 |
| Name | Prinomastat |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 466151 |
| ChEBI | CHEBI:138885 |
| Molecular formula | C18H21N3O5S2 |
| Molecular weight | 423.5 |
| InChIKey | YKPYIPVDTNNYCN-INIZCTEOSA-N |
SMILES: CC1([C@@H](N(CCS1)S(=O)(=O)C2=CC=C(C=C2)OC3=CC=NC=C3)C(=O)NO)C
IUPAC name: (3S)-N-hydroxy-2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxamide
ChEBI definition: A hydroxamic acid that is (3S)-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide in which the hydrogen attached to the thiomorpholine nitrogen has been replaced by a [4-(pyridin-4-yloxy)phenyl]sulfonyl group. It is a selective inhibitor with of matrix metalloproteinases (MMPs) 2, 3, 9, 13, and 14.
Pharmacological roles (ChEBI): antineoplastic agent, matrix metalloproteinase inhibitor, EC 3.4.24.35 (gelatinase B) inhibitor.
Also known as: AG-3340, AG3340, KB-R-9896, Prinomastat, prinomastat, PRINOMASTAT
Patent coverage: 2,172 distinct patent families (8,839 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MMP13 | MMP13 | Inhibition | 10.4 | 0% | P45452 |
Broader ChEMBL bioactivity targets: 9 (assay-derived). Sample: Collagenase 3, Stromelysin-1, Matrix metalloproteinase-9, Interstitial collagenase, 72 kDa type IV collagenase, Disintegrin and metalloproteinase domain-containing protein 17, Matrix metalloproteinase-14, Matrilysin, Neutrophil collagenase.
Bioactivity
ChEMBL activities: 53 potent at pChembl ≥ 5 of 54 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MMP2 | 10.52 | Ki | 0.03 | nM | CHEMBL_ACT_24998193 |
| MMP3 | 10.52 | Ki | 0.03 | nM | CHEMBL_ACT_24998198 |
| MMP9 | 10.52 | Ki | 0.03 | nM | CHEMBL_ACT_24998202 |
| MMP13 | 10.52 | Ki | 0.03 | nM | CHEMBL_ACT_24998213 |
| MMP13 | 10.42 | Ki | 0.04 | nM | CHEMBL_ACT_650068 |
| MMP13 | 10.42 | Ki | 0.04 | nM | CHEMBL_ACT_951078 |
| MMP2 | 10.32 | IC50 | 0.05 | nM | CHEMBL_ACT_1149203 |
| MMP9 | 10.32 | IC50 | 0.05 | nM | CHEMBL_ACT_1149207 |
| MMP2 | 10.3 | Ki | 0.05 | nM | CHEMBL_ACT_25004626 |
| MMP2 | 10.3 | Ki | 0.05 | nM | CHEMBL_ACT_845295 |
| MMP2 | 10.1 | Ki | 0.08 | nM | CHEMBL_ACT_596662 |
| MMP2 | 10.08 | Ki | 0.08 | nM | CHEMBL_ACT_650066 |
| MMP2 | 10.08 | Ki | 0.08 | nM | CHEMBL_ACT_951070 |
| MMP2 | 10.05 | IC50 | 0.09 | nM | CHEMBL_ACT_1424616 |
| MMP13 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_1149208 |
| MMP9 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_195393 |
| MMP9 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_92719 |
| MMP3 | 9.64 | IC50 | 0.23 | nM | CHEMBL_ACT_1424617 |
| MMP9 | 9.59 | IC50 | 0.26 | nM | CHEMBL_ACT_1424621 |
| MMP9 | 9.59 | Ki | 0.26 | nM | CHEMBL_ACT_25004625 |
| MMP3 | 9.57 | Ki | 0.27 | nM | CHEMBL_ACT_650067 |
| MMP3 | 9.57 | Ki | 0.27 | nM | CHEMBL_ACT_951072 |
| MMP14 | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_1424613 |
| MMP2 | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_269160 |
| MMP2 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_195391 |
| MMP13 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_269161 |
| MMP2 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_92717 |
| MMP8 | 9.27 | IC50 | 0.54 | nM | CHEMBL_ACT_1149206 |
| MMP3 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_195392 |
| MMP3 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_92718 |
| MMP13 | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_195394 |
| MMP13 | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_92720 |
| MMP2 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_19277542 |
| MMP9 | 8.48 | IC50 | 3.3 | nM | CHEMBL_ACT_19277576 |
| MMP3 | 8.46 | IC50 | 3.5 | nM | CHEMBL_ACT_1149204 |
| MMP1 | 8.31 | IC50 | 4.9 | nM | CHEMBL_ACT_951067 |
| MMP3 | 8.31 | IC50 | 4.9 | nM | CHEMBL_ACT_951071 |
| ADAM17 | 8.26 | IC50 | 5.5 | nM | CHEMBL_ACT_1150319 |
| MMP1 | 8.24 | IC50 | 5.7 | nM | CHEMBL_ACT_1149202 |
| MMP1 | 8.09 | Ki | 8.2 | nM | CHEMBL_ACT_1096983 |
| MMP1 | 8.09 | IC50 | 8.2 | nM | CHEMBL_ACT_1150320 |
| MMP1 | 8.09 | IC50 | 8.2 | nM | CHEMBL_ACT_1424612 |
| MMP1 | 8.09 | Ki | 8.2 | nM | CHEMBL_ACT_650065 |
| MMP1 | 8.09 | Ki | 8.2 | nM | CHEMBL_ACT_951068 |
| MMP1 | 8.08 | Ki | 8.3 | nM | CHEMBL_ACT_24998188 |
| ADAM17 | 7.66 | IC50 | 22 | nM | CHEMBL_ACT_2391972 |
| MMP1 | 7.63 | IC50 | 23.5 | nM | CHEMBL_ACT_269162 |
| MMP1 | 7.32 | IC50 | 48 | nM | CHEMBL_ACT_195390 |
| MMP1 | 7.32 | IC50 | 48 | nM | CHEMBL_ACT_92716 |
| MMP7 | 7.27 | IC50 | 54 | nM | CHEMBL_ACT_1424619 |
| MMP7 | 7.27 | Ki | 54 | nM | CHEMBL_ACT_951074 |
| MMP7 | 7.14 | IC50 | 72 | nM | CHEMBL_ACT_1149205 |
| MMP7 | 7.04 | IC50 | 91 | nM | CHEMBL_ACT_951073 |
Target pathways
Aggregated over 1 target gene(s): MMP13.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Collagen degradation | 1 | MMP13 |
| Degradation of the extracellular matrix | 1 | MMP13 |
| Extracellular matrix organization | 1 | MMP13 |
| Collagen formation | 1 | MMP13 |
| Activation of Matrix Metalloproteinases | 1 | MMP13 |
| Assembly of collagen fibrils and other multimeric structures | 1 | MMP13 |
| Generic Transcription Pathway | 1 | MMP13 |
| RNA Polymerase II Transcription | 1 | MMP13 |
| Gene expression (Transcription) | 1 | MMP13 |
| Transcriptional regulation by RUNX2 | 1 | MMP13 |
| RUNX2 regulates genes involved in cell migration | 1 | MMP13 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| endochondral ossification | 1 |
| growth plate cartilage development | 1 |
| proteolysis | 1 |
| extracellular matrix disassembly | 1 |
| extracellular matrix organization | 1 |
| bone mineralization | 1 |
| collagen catabolic process | 1 |
| bone morphogenesis | 1 |
| response to amyloid-beta | 1 |
Indications & clinical
Indications
2 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| lung neoplasm | 3 | MONDO:0021117 | MONDO:0008903 |
| central nervous system neoplasm | 2 | MONDO:0006130 | EFO:1000158 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 3.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00003343 | PHASE3 | COMPLETED | Chemotherapy in Treating Patients Who Have Metastatic Prostate Cancer |
| NCT00004199 | PHASE3 | COMPLETED | Prinomastat and Combination Chemotherapy in Treating Patients With Metastatic or Recurrent Non-small Cell Lung Cancer |
| NCT00004200 | PHASE2 | COMPLETED | Prinomastat Plus Temozolomide Following Radiation Therapy in Treating Patients With Newly Diagnosed Glioblastoma Multiforme |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
12 molecules share ≥1 primary target. Top 12 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CHLOROXINE | ChEMBL | Phase 4 (approved) | MMP13 |
| DOXYCYCLINE | ChEMBL | Phase 4 (approved) | MMP13 |
| CURCUMIN | ChEMBL | Phase 3 | MMP13 |
| MARIMASTAT | ChEMBL | Phase 3 | MMP13 |
| QUERCETIN | ChEMBL | Phase 3 | MMP13 |
| APRATASTAT | ChEMBL | Phase 2 | MMP13 |
| BATIMASTAT | ChEMBL | Phase 2 | MMP13 |
| CIPEMASTAT | ChEMBL | Phase 2 | MMP13 |
| CTS-1027 | ChEMBL | Phase 2 | MMP13 |
| ILOMASTAT | ChEMBL | Phase 2 | MMP13 |
| LUTEOLIN | ChEMBL | Phase 2 | MMP13 |
| TANOMASTAT | ChEMBL | Phase 2 | MMP13 |
Related Atlas pages
- Genes: MMP13
- In clinical trials for: lung neoplasm, central nervous system neoplasm
- Drugs: Chloroxine, Doxycycline, Curcumin, Marimastat, Quercetin