Progesterone
drugOn this page
Also known as CrinoneCyclogestEndometrinLutigestMilprosaNSC-64377NSC-9704ProchieveProgesta-careProgestasertProgesteronaProgesterone component of bijuvamicronizedProgesteronumPrometriumProgestinRegumateSerenity for womenSyngestrone
Summary
Progesterone (CHEMBL103) is an approved small-molecule contraceptive drug (ATC G03DA04) targeting CATSPER1, CATSPER2, and CATSPER3; indicated across 47 conditions including amenorrhea and atypical endometrial hyperplasia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G03DA04
- Targets: 7 (CATSPER1, CATSPER2, CATSPER3…)
- Indications: 47 conditions
- Clinical trials: 315
- Chemistry: 314.5 Da · C21H30O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL103 |
| Name | Progesterone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5994 |
| ChEBI | CHEBI:17026 |
| ATC | G03DA04 |
| Molecular formula | C21H30O2 |
| Molecular weight | 314.5 |
| InChIKey | RJKFOVLPORLFTN-LEKSSAKUSA-N |
SMILES: CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C
IUPAC name: (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one
ChEBI definition: A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species.
Pharmacological roles (ChEBI): contraceptive drug, progestin, progesterone receptor agonist.
Other ChEBI roles (chemical / environmental): human metabolite, mouse metabolite.
Also known as: Crinone, Cyclogest, Endometrin, Lutigest, Milprosa, NSC-64377, NSC-9704, Prochieve, Progesta-care, Progestasert, Progesterona, Progesterone
Patent coverage: 52,333 distinct patent families (162,141 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CATSPER1 | CatSper1 | Full agonist | 8.11 | 1.8% | Q8NEC5 |
| CATSPER2 | CatSper2 | Full agonist | 8.11 | 0.2% | Q96P56 |
| CATSPER3 | CatSper3 | Full agonist | 8.11 | 0.6% | Q86XQ3 |
| CATSPER4 | CatSper4 | Full agonist | 8.11 | 0.2% | Q7RTX7 |
| Glycine Receptor (All subtypes) | Inhibition | ||||
| TRPC5 | TRPC5 | Inhibition | 5.3 | 0% | Q9UL62 |
| NR3C2 | Mineralocorticoid receptor | Antagonist | 11 | 0% | P08235 |
| PGR | Progesterone receptor | Agonist | 8.46 | 0.1% | P06401 |
Broader ChEMBL bioactivity targets: 53 (assay-derived). Sample: Microtubule-associated protein tau, Lysine-specific demethylase 4E, Nuclear receptor ROR-gamma, Survival motor neuron protein, Prelamin-A/C, Ferritin light chain, Thrombopoietin, Ras-related protein Rab-9A, Peripheral myelin protein 22, Solute carrier family 22 member 2.
Bioactivity
ChEMBL activities: 115 potent at pChembl ≥ 5 of 158 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| PGR | 10 | EC50 | 0.1 | nM | CHEMBL_ACT_3224266 |
| PGR | 9.74 | EC50 | 0.18 | nM | CHEMBL_ACT_24514867 |
| PGR | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_5221854 |
| NR3C2 | 9.41 | Kd | 0.39 | nM | CHEMBL_ACT_1082433 |
| PGR | 9.3 | EC50 | 0.5 | nM | CHEMBL_ACT_2448979 |
| PGR | 9.05 | EC50 | 0.9 | nM | CHEMBL_ACT_2369822 |
| PGR | 9.05 | EC50 | 0.9 | nM | CHEMBL_ACT_269054 |
| PGR | 9.04 | EC50 | 0.92 | nM | CHEMBL_ACT_269056 |
| PGR | 9.04 | EC50 | 0.92 | nM | CHEMBL_ACT_416554 |
| PGR | 8.92 | AC50 | 1.2 | nM | CHEMBL_ACT_25223579 |
| PGR | 8.82 | EC50 | 1.5 | nM | CHEMBL_ACT_860293 |
| PGR | 8.74 | EC50 | 1.8 | nM | CHEMBL_ACT_263045 |
| PGR | 8.74 | EC50 | 1.8 | nM | CHEMBL_ACT_296090 |
| PGR | 8.74 | EC50 | 1.8 | nM | CHEMBL_ACT_57303 |
| PGR | 8.7 | EC50 | 2 | nM | CHEMBL_ACT_15068947 |
| PGR | 8.66 | EC50 | 2.2 | nM | CHEMBL_ACT_2448994 |
| PGR | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_1203354 |
| PGR | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_263040 |
| PGR | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_296085 |
| PGR | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_315394 |
| PGR | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_57301 |
| PGR | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_595052 |
| PGR | 8.54 | EC50 | 2.89 | nM | CHEMBL_ACT_696861 |
| PGR | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_860310 |
| PGR | 8.48 | AC50 | 3.3 | nM | CHEMBL_ACT_25204915 |
| PGR | 8.47 | Ki | 3.4 | nM | CHEMBL_ACT_2449035 |
| PGR | 8.46 | Ki | 3.5 | nM | CHEMBL_ACT_1203357 |
| PGR | 8.46 | Ki | 3.47 | nM | CHEMBL_ACT_1734227 |
| PGR | 8.46 | Ki | 3.5 | nM | CHEMBL_ACT_263041 |
| PGR | 8.46 | Ki | 3.5 | nM | CHEMBL_ACT_296088 |
Target pathways
Aggregated over 7 target gene(s): CATSPER1, CATSPER2, CATSPER3, CATSPER4, TRPC5, NR3C2, PGR.
Top Reactome pathways
16 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Sperm Motility And Taxes | 4 | CATSPER1, CATSPER2, CATSPER3, CATSPER4 |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 2 | NR3C2, PGR |
| Nuclear Receptor transcription pathway | 2 | NR3C2, PGR |
| SUMOylation of intracellular receptors | 2 | NR3C2, PGR |
| Nuclear signaling by ERBB4 | 1 | PGR |
| Cellular responses to stress | 1 | NR3C2 |
| SUMOylation | 1 | NR3C2 |
| SUMO E3 ligases SUMOylate target proteins | 1 | NR3C2 |
| TRP channels | 1 | TRPC5 |
| Metabolism of proteins | 1 | NR3C2 |
| Role of second messengers in netrin-1 signaling | 1 | TRPC5 |
| Post-translational protein modification | 1 | NR3C2 |
| Cellular responses to stimuli | 1 | NR3C2 |
| Estrogen-dependent gene expression | 1 | PGR |
| Developmental Lineage of Mammary Gland Luminal Epithelial Cells | 1 | PGR |
| Developmental Lineage of Mammary Gland Alveolar Cells | 1 | PGR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| calcium ion transport | 5 |
| monoatomic ion transport | 5 |
| monoatomic ion transmembrane transport | 5 |
| transmembrane transport | 5 |
| calcium ion transmembrane transport | 5 |
| spermatogenesis | 4 |
| cell differentiation | 4 |
| flagellated sperm motility | 4 |
| sperm capacitation | 3 |
| monoatomic cation transmembrane transport | 2 |
| sodium ion transport | 2 |
| establishment of localization in cell | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| signal transduction | 2 |
| nuclear receptor-mediated steroid hormone signaling pathway | 2 |
Indications & clinical
Indications
47 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| amenorrhea | 4 | MONDO:0001836 | EFO:0010269 |
| atypical endometrial hyperplasia | 4 | MONDO:0006096 | EFO:1000098 |
| infertility disorder | 3 | MONDO:0005047 | EFO:0000545 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| epilepsy | 3 | MONDO:0005027 | EFO:0000474 |
| uterine corpus leiomyoma | 3 | MONDO:0007886 | EFO:0000731 |
| female infertility | 3 | MONDO:0021124 | EFO:0008560 |
| diabetes mellitus | 3 | MONDO:0005015 | EFO:0000400 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| osteoporosis | 3 | MONDO:0005298 | EFO:0003882 |
| intermediate coronary syndrome | 3 | MONDO:0006805 | EFO:1000985 |
| myocardial ischemia | 3 | MONDO:0024644 | EFO:1001375 |
| thrombotic disease | 3 | MONDO:0000831 | MONDO:0000831 |
| brain injury | 3 | MONDO:0043510 | MONDO:0043510 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
| ovarian neoplasm | 3 | MONDO:0021068 | EFO:0003893 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| ovarian hyperstimulation syndrome | 3 | MONDO:0011972 | MONDO:0011972 |
| breast carcinoma | 3 | MONDO:0004989 | EFO:0000305 |
| cardiovascular disorder | 3 | MONDO:0004995 | EFO:0000319 |
| bone disorder | 3 | MONDO:0005381 | EFO:0004260 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| nicotine dependence | 2 | MONDO:0008575 | EFO:0003768 |
| preeclampsia | 2 | MONDO:0005081 | EFO:0000668 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000180 |
| polycystic ovary syndrome | 2 | MONDO:0008487 | EFO:0000660 |
| vulvar lichen sclerosus | 2 | MONDO:0006491 | EFO:1000623 |
| postural orthostatic tachycardia syndrome | 2 | MONDO:0011479 | EFO:1000645 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| placenta praevia | 2 | MONDO:0005918 | EFO:0007442 |
| postpartum depression | 2 | MONDO:0005929 | EFO:0007453 |
| bulimia nervosa | 2 | MONDO:0005452 | EFO:0005204 |
| endometrium neoplasm | 2 | MONDO:0021251 | MONDO:0011962 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| anorexia nervosa | 2 | MONDO:0005351 | MONDO:0005351 |
| dysplasia of cervix | 2 | MONDO:0006736 | MONDO:0022394 |
| depressive disorder | 2 | MONDO:0002050 | MONDO:0002050 |
| methamphetamine dependence | 0 | MONDO:0005419 | EFO:0004701 |
| gliosarcoma | 0 | MONDO:0016681 | EFO:1001465 |
8 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 315.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 97 |
| PHASE4 | 80 |
| PHASE3 | 53 |
| PHASE2 | 44 |
| PHASE1 | 16 |
| PHASE2/PHASE3 | 11 |
| EARLY_PHASE1 | 9 |
| PHASE1/PHASE2 | 5 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05282277 | PHASE4 | RECRUITING | Examining the Effects of Estradiol on Neural and Molecular Response to Reward |
| NCT05704036 | PHASE4 | RECRUITING | Estrogen Supplementation and Bone Health in Women With CF |
| NCT06396390 | PHASE4 | NOT_YET_RECRUITING | Comparison of Progestin Primed Ovarian Stimulation (PPOS) vs.GnRH Antagonist Methods on IVF Outcomes |
| NCT06610305 | PHASE4 | RECRUITING | Ovarian Hormone Withdrawal, Anhedonia, and Reward Sensitivity in Women With Premenstrual Exacerbations of Depression |
| NCT06856174 | PHASE4 | RECRUITING | Menopausal HT for Women Living With HIV (HoT) |
| NCT06875752 | PHASE4 | RECRUITING | Is There a Need for Luteal Support in Modified Natural Cycle Frozen Embryo Transfer Cycles |
| NCT06896617 | PHASE4 | RECRUITING | Impact of the Presence of the Corpus Luteum on Pregnancies Obtained Through Frozen Embryo Transfer(FET) |
| NCT07448597 | PHASE4 | NOT_YET_RECRUITING | Progesterone Preeclampsia |
| NCT07508657 | PHASE4 | NOT_YET_RECRUITING | Progesterone Supplementation After Letrozole-stimulated Insemination |
| NCT00154180 | PHASE4 | UNKNOWN | Kronos Early Estrogen Prevention Study (KEEPS) |
| NCT00530582 | PHASE4 | COMPLETED | Progesterone Reduces Wakefulness in Sleep EEG and Has no Effect on Cognition in Healthy Postmenopausal Women |
| NCT00646802 | PHASE4 | COMPLETED | Vaginal PROgesterone as Maintenance Treatment After an epISode of prEterm Labor (PROMISE Study) |
| NCT00656201 | PHASE4 | COMPLETED | Comparison of Crinone 8% Intravaginal Gel and IM Progesterone Supplementation for In Vitro Fertilization (IVF) |
| NCT00708539 | PHASE4 | UNKNOWN | A Prospective Randomized Multicentre Study to Compare Crinone 8% Once Daily Versus Other Vaginal Progesterone. |
| NCT00732693 | PHASE4 | COMPLETED | Evaluation of Physiologic and Standard Sex Steroid Replacement Regimens in Women With Premature Ovarian Failure |
| NCT00755963 | PHASE4 | COMPLETED | Effects of Hormone Replacement Therapy on the Serotonergic System and Mood in Postmenopausal Women |
| NCT00954811 | PHASE4 | UNKNOWN | Luteal Supplementation With Rec-LH After GnRH-agonist Triggering in In Vitro (IVF) |
| NCT01031017 | PHASE4 | COMPLETED | Prophylactic Administration of Natural Progesterone in the Prevention of Preterm Delivery in Twin Pregnancies |
| NCT01123538 | PHASE4 | UNKNOWN | Progestagen Type in Postmenopausal Hormone Therapy and Blood Gene Expression Profile |
| NCT01225835 | PHASE4 | COMPLETED | Progesterone Serum Levels in Subfertile Female Patients Undergoing in Vitro Fertilisation (IVF) |
| NCT01237535 | PHASE4 | UNKNOWN | Luteal Phase Support With Progesterone Versus Estrogen and Progesterone on Pregnancy Rates |
| NCT01286246 | PHASE4 | TERMINATED | Randomized Controlled Trial of Vaginal Progesterone in Women With Threatened Preterm Labor |
| NCT01465373 | PHASE4 | COMPLETED | Vaginal Progesterone Versus Progesterone in Oil in Donor Egg Recipient In Vitro Fertilization Cycles Utilizing Vitrified Donor Eggs |
| NCT01670929 | PHASE4 | COMPLETED | Pr-conceptional Progesterone for Unexplained Recurrent Miscarriage |
| NCT01809639 | PHASE4 | COMPLETED | Does Oral Micronized Progesterone Shorten Time of Symptoms From Concussion |
| NCT01888744 | PHASE4 | COMPLETED | Preimplantation Genetic Diagnosis (PGD) With Gonadotropin-releasing Hormone (GnRH) Agonist Versus Antagonist |
| NCT01927029 | PHASE4 | UNKNOWN | Preterm Delivery Prevention in Twins With Progesterone |
| NCT01940653 | PHASE4 | COMPLETED | Optimal Length of Progesterone Supplementation Before the Transfer of Cryopreserved (Frozen)-Thawed Day 3 Embryos in an Artificial Cycle With Exogenous Estrogen and Progesterone |
| NCT01954966 | PHASE4 | COMPLETED | Progesterone and Brain Imaging Study |
| NCT01966575 | PHASE4 | WITHDRAWN | Effect of Progestin-Induced Withdrawal Bleed on Ovulation Induction Cycles With Clomiphene Citrate |
| NCT01980680 | PHASE4 | COMPLETED | The Exogenous Progesterone Free Luteal Phase After GnRHa Trigger - a Pilot Study in Normo-responder IVF Patients |
| NCT02032797 | PHASE4 | COMPLETED | Optimal Length of Progesterone Supplementation Before the Transfer of Cryopreserved(Frozen)-Thawed Embryos in an Artificial Cycle With Exogenous Estrogen and Progesterone. |
| NCT02255175 | PHASE4 | COMPLETED | Perimenopausal Effects of Estradiol on Reward Responsiveness |
| NCT02316626 | PHASE4 | COMPLETED | Subcutaneous Progesterone Versus Vaginal Progesterone Gel for Luteal Phase Support |
| NCT02338830 | PHASE4 | COMPLETED | Vaginal Progesterone for Prevention of Preterm Labor in Asymptomatic Twin Pregnancies With Sonographic Short Cervix |
| NCT02363127 | PHASE4 | COMPLETED | Subcutaneous Progesterone Versus Vaginal Progesterone for Endometrial Preparation in Fresh Donated Oocytes Recipients |
| NCT02372942 | PHASE4 | UNKNOWN | Lactoferrin or Progesterone for Prevention of Preterm Delivery |
| NCT02511574 | PHASE4 | COMPLETED | Comparison Between Natural Progesterone and Vaginal Pessary for the Prevention of Spontaneous Preterm Birth |
| NCT02513940 | PHASE4 | COMPLETED | Influence of Testosterone Administration on Drug-Induced QT Interval Prolongation and Torsades de Pointes |
| NCT02567552 | PHASE4 | COMPLETED | Clinical Trial Comparing Endometrial Transformation With Subcutaneous Progesterone Versus Intramuscular Progesterone |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 3 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
301 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| dinoprostone | ChEMBL + PubChem | Phase 4 (approved) | CATSPER1, CATSPER4, PGR |
| Enzalutamide | ChEMBL + PubChem | Phase 4 (approved) | NR3C2, PGR |
| EPLERENONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C2, PGR |
| Fludrocortisone | ChEMBL + PubChem | Phase 4 (approved) | NR3C2, PGR |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| HYDROCORTISONE BUTYRATE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| PREDNISOLONE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | NR3C2, PGR |
| QUERCETIN | ChEMBL + PubChem | Phase 3 (approved) | PGR, TRPC5 |
| ASOPRISNIL | ChEMBL | Phase 3 | NR3C2, PGR |
| METRIBOLONE | ChEMBL | Phase 2 | NR3C2, PGR |
| ONAPRISTONE | ChEMBL | Phase 2 | NR3C2, PGR |
| STANOLONE | ChEMBL | Phase 2 | NR3C2, PGR |
| TUROFEXORATE ISOPROPYL | ChEMBL | Phase 2 | NR3C2, PGR |
| Alprostadil | PubChem | Approved | CATSPER1, CATSPER4 |
| FIDAXOMICIN | ChEMBL + PubChem | Phase 4 (approved) | PGR |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | PGR |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | PGR |
| ABIRATERONE | ChEMBL | Phase 4 (approved) | PGR |
| ACETYLCHOLINE | ChEMBL | Phase 4 (approved) | PGR |
| ADAPALENE | ChEMBL | Phase 4 (approved) | PGR |
| ALCLOMETASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | PGR |
| ALECTINIB | ChEMBL | Phase 4 (approved) | PGR |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | PGR |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | PGR |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | PGR |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | PGR |
| AZATHIOPRINE | ChEMBL | Phase 4 (approved) | PGR |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | PGR |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | PGR |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | PGR |
| BENZIODARONE | ChEMBL | Phase 4 (approved) | PGR |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | PGR |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | PGR |
| BETAMETHASONE VALERATE | ChEMBL | Phase 4 (approved) | PGR |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | PGR |
| BICALUTAMIDE | ChEMBL | Phase 4 (approved) | PGR |
| BIFONAZOLE | ChEMBL | Phase 4 (approved) | PGR |
| BITHIONOL | ChEMBL | Phase 4 (approved) | PGR |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | PGR |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | PGR |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | PGR |
| CALCIPOTRIENE | ChEMBL | Phase 4 (approved) | PGR |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | PGR |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | PGR |
| CANRENONE | ChEMBL | Phase 4 (approved) | PGR |
| CARBARIL | ChEMBL | Phase 4 (approved) | PGR |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | PGR |
| CEFAMANDOLE | ChEMBL | Phase 4 (approved) | PGR |
| CEFMENOXIME | ChEMBL | Phase 4 (approved) | PGR |
| CEFTAZIDIME | ChEMBL | Phase 4 (approved) | PGR |
| CEFTIZOXIME | ChEMBL | Phase 4 (approved) | PGR |
| CEFTRIAXONE | ChEMBL | Phase 4 (approved) | PGR |
| CEFUROXIME | ChEMBL | Phase 4 (approved) | PGR |
Related Atlas pages
- Genes: CATSPER1, CATSPER2, CATSPER3, CATSPER4, TRPC5, NR3C2, PGR
- Diseases: amenorrhea, atypical endometrial hyperplasia, infertility disorder, breast neoplasm, epilepsy, uterine corpus leiomyoma, female infertility, diabetes mellitus, hypertensive disorder, osteoporosis, intermediate coronary syndrome, myocardial ischemia, thrombotic disease, brain injury, coronary artery disorder, ovarian neoplasm, Alzheimer disease, ovarian hyperstimulation syndrome, breast carcinoma, cardiovascular disorder, bone disorder
- Drugs: dinoprostone, Enzalutamide, Eplerenone, Fludrocortisone, Budesonide, Dexamethasone, Fluticasone Furoate, Fluticasone Propionate, Hydrocortisone, Hydrocortisone Butyrate, Medroxyprogesterone, Mifepristone, Prednisolone, Spironolactone, Quercetin, Asoprisnil, Alprostadil, Fidaxomicin, Fulvestrant, Abiraterone, Acetylcholine, Adapalene, Alclometasone Dipropionate, Alectinib, Amcinonide, Apomorphine, Arformoterol, Aripiprazole, Azathioprine, Beclomethasone Dipropionate, Benperidol, Benzbromarone, Benziodarone, Betamethasone, Betamethasone Dipropionate, Betamethasone Valerate, Bexarotene, Bicalutamide, Bifonazole, Bithionol, Bosutinib, Butoconazole, Cabozantinib, Calcipotriene, Calcitriol, Candesartan Cilexetil, Canrenone, Carbaril, Caspofungin, Cefamandole, Cefmenoxime, Ceftazidime, Ceftizoxime, Ceftriaxone, Cefuroxime