Proglumide
drugOn this page
Also known as BinosideCR-242Dl-proglumideGastrotopicMidelidMilidNSC-757841NulsaProglumidaPromidUlcutinW-5219XydeXylamideSID26747589SID50106676SID56463359SID90341320SID144204108
Summary
Proglumide (CHEMBL316561) is an approved small-molecule cholinergic antagonist (ATC A02BX06) targeting CCKAR; indicated across 5 conditions including peptic ulcer disease and gastroesophageal reflux disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A02BX06
- Targets: 1 (CCKAR)
- Indications: 5 conditions
- Clinical trials: 4
- Chemistry: 334.4 Da · C18H26N2O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL316561 |
| Name | Proglumide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4922 |
| ChEBI | CHEBI:32058 |
| ATC | A02BX06 |
| Molecular formula | C18H26N2O4 |
| Molecular weight | 334.4 |
| InChIKey | DGMKFQYCZXERLX-UHFFFAOYSA-N |
SMILES: CCCN(CCC)C(=O)C(CCC(=O)O)NC(=O)C1=CC=CC=C1
IUPAC name: 4-benzamido-5-(dipropylamino)-5-oxopentanoic acid
ChEBI definition: A racemate composed of equal amounts of (R)- and (S)-proglumide. A non-selective CCK antagonist that was used primarily for treatment of stomach ulcers, but has been replaced by newer drugs.
Pharmacological roles (ChEBI): cholinergic antagonist, anti-ulcer drug, cholecystokinin antagonist, gastrointestinal drug, δ-opioid receptor agonist, opioid analgesic.
Other ChEBI roles (chemical / environmental): drug metabolite, xenobiotic metabolite.
Also known as: Binoside, CR-242, Dl-proglumide, Gastrotopic, Midelid, Milid, NSC-757841, Nulsa, Proglumida, Proglumide, Promid, Ulcutin
Parent form; salt/anhydrous children: CHEMBL1345380
Patent coverage: 1,199 distinct patent families (3,510 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CCKAR | CCK1 receptor | Antagonist | 2.2 | 0% | P32238 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Endonuclease 4, Beta-lactamase, Histamine H2 receptor.
Bioactivity
ChEMBL activities: 1 potent at pChembl ≥ 5 of 4 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P00811 | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_4695511 |
Target pathways
Aggregated over 1 target gene(s): CCKAR.
Top Reactome pathways
7 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | CCKAR |
| Signaling by GPCR | 1 | CCKAR |
| Class A/1 (Rhodopsin-like receptors) | 1 | CCKAR |
| Peptide ligand-binding receptors | 1 | CCKAR |
| GPCR downstream signalling | 1 | CCKAR |
| G alpha (q) signalling events | 1 | CCKAR |
| GPCR ligand binding | 1 | CCKAR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| neuron migration | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| axonogenesis | 1 |
| forebrain development | 1 |
| cellular response to hormone stimulus | 1 |
| cholecystokinin signaling pathway | 1 |
| regulation of hormone secretion | 1 |
| signal transduction | 1 |
Indications & clinical
Indications
5 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| peptic ulcer disease | 4 | MONDO:0004247 | HP:0004398 |
| gastroesophageal reflux disease | 4 | MONDO:0007186 | EFO:0003948 |
| metabolic dysfunction-associated steatohepatitis | 1 | MONDO:0007027 | EFO:1001249 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| cirrhosis of liver | 0 | MONDO:0005155 | EFO:0001422 |
Clinical trials
Total trials: 4.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1/PHASE2 | 1 |
| PHASE2 | 1 |
| PHASE1 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05551858 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Role of a CCK Receptor Antagonist Proglumide in Management of Chronic Pancreatitis |
| NCT05827055 | PHASE2 | ACTIVE_NOT_RECRUITING | Proglumide and Chemotherapy for Metastatic Pancreatic Cancer |
| NCT04152473 | PHASE1 | COMPLETED | Safety and Tolerability of Oral Proglumide for NASH |
| NCT04814602 | EARLY_PHASE1 | COMPLETED | Single-dose PK Assessment of Oral Proglumide in Those With Hepatic Impairment |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
101 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | CCKAR |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | CCKAR |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | CCKAR |
| AMSACRINE | ChEMBL | Phase 4 (approved) | CCKAR |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | CCKAR |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | CCKAR |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | CCKAR |
| CHLORDIAZEPOXIDE | ChEMBL | Phase 4 (approved) | CCKAR |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | CCKAR |
| DASATINIB | ChEMBL | Phase 4 (approved) | CCKAR |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | CCKAR |
| DESERPIDINE | ChEMBL | Phase 4 (approved) | CCKAR |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | CCKAR |
| FLUVASTATIN | ChEMBL | Phase 4 (approved) | CCKAR |
| HYDROXOCOBALAMIN | ChEMBL | Phase 4 (approved) | CCKAR |
| INDOCYANINE GREEN ACID FORM | ChEMBL | Phase 4 (approved) | CCKAR |
| LETERMOVIR | ChEMBL | Phase 4 (approved) | CCKAR |
| LURASIDONE | ChEMBL | Phase 4 (approved) | CCKAR |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | CCKAR |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | CCKAR |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | CCKAR |
| OSIMERTINIB | ChEMBL | Phase 4 (approved) | CCKAR |
| PACLITAXEL | ChEMBL | Phase 4 (approved) | CCKAR |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | CCKAR |
| RAMATROBAN | ChEMBL | Phase 4 (approved) | CCKAR |
| RIFAXIMIN | ChEMBL | Phase 4 (approved) | CCKAR |
| RIMONABANT | ChEMBL | Phase 4 (approved) | CCKAR |
| RITONAVIR | ChEMBL | Phase 4 (approved) | CCKAR |
| SINCALIDE | ChEMBL | Phase 4 (approved) | CCKAR |
| SUNITINIB | ChEMBL | Phase 4 (approved) | CCKAR |
| TELMISARTAN | ChEMBL | Phase 4 (approved) | CCKAR |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | CCKAR |
| TELOTRISTAT ETHYL | ChEMBL | Phase 4 (approved) | CCKAR |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | CCKAR |
| CE-326597 | ChEMBL | Phase 2 | CCKAR |
| DEVAZEPIDE | ChEMBL | Phase 2 | CCKAR |
| DIPERODON | ChEMBL | Phase 2 | CCKAR |
| LINTITRIPT | ChEMBL | Phase 2 | CCKAR |
| LOXIGLUMIDE | ChEMBL | Phase 2 | CCKAR |
| NETAZEPIDE | ChEMBL | Phase 2 | CCKAR |
| PIRENOXINE | ChEMBL | Phase 2 | CCKAR |
| Abiraterone | PubChem | Approved | CCKAR |
| acetylcysteine | PubChem | Approved | CCKAR |
| Aclidinium Bromide | PubChem | Approved | CCKAR |
| Acyclovir | PubChem | Approved | CCKAR |
| Allopurinol | PubChem | Approved | CCKAR |
| Almotriptan | PubChem | Approved | CCKAR |
| Alogliptin | PubChem | Approved | CCKAR |
| aminolevulinic acid | PubChem | Approved | CCKAR |
| Anagrelide | PubChem | Approved | CCKAR |
| Apixaban | PubChem | Approved | CCKAR |
| Apremilast | PubChem | Approved | CCKAR |
| Aprepitant | PubChem | Approved | CCKAR |
| Binimetinib | PubChem | Approved | CCKAR |
| Bosentan | PubChem | Approved | CCKAR |
| Capsaicin | PubChem | Approved | CCKAR |
| chenodiol | PubChem | Approved | CCKAR |
| Cinacalcet | PubChem | Approved | CCKAR |
| Clofarabine | PubChem | Approved | CCKAR |
| Clozapine | PubChem | Approved | CCKAR |
Related Atlas pages
- Genes: CCKAR
- Diseases: peptic ulcer disease, gastroesophageal reflux disease
- Drugs: Afatinib, Atazanavir, Rifampin, Amsacrine, Bepridil, Candesartan Cilexetil, Cannabidiol, Chlordiazepoxide, Chlorhexidine, Dasatinib, Daunorubicin, Deserpidine, Erlotinib, Fluvastatin, Hydroxocobalamin, Indocyanine Green Acid Form, Letermovir, Lurasidone, Nefazodone, Nimesulide, Nitazoxanide, Osimertinib, Paclitaxel, Pimozide, Ramatroban, Rifaximin, Rimonabant, Ritonavir, Sincalide, Sunitinib, Telmisartan, Telotristat, Telotristat Ethyl, Tipranavir, Abiraterone, acetylcysteine, Aclidinium Bromide, Acyclovir, Allopurinol, Almotriptan, Alogliptin, aminolevulinic acid, Anagrelide, Apixaban, Apremilast, Aprepitant, Binimetinib, Bosentan, Capsaicin, chenodiol, Cinacalcet, Clofarabine, Clozapine