Propafenone
drugOn this page
Also known as GNF-Pf-4594Propafenon hexalPropafenonaSID26752315SID90341088SID104171212SID26752316SID50105251SID50105252rac-PropafenoneSID124881115SID144203779SID170464755C0165063
Summary
Propafenone (CHEMBL631) is an approved small-molecule anti-arrhythmia drug (ATC C01BC03) targeting ADRB1, ADRB2, and KCNA5; indicated across 6 conditions including atrial fibrillation and heart failure.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C01BC03
- Targets: 3 (ADRB1, ADRB2, KCNA5)
- Indications: 6 conditions
- Clinical trials: 17
- Chemistry: 341.4 Da · C21H27NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL631 |
| Name | Propafenone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4932 |
| ChEBI | CHEBI:63619 |
| ATC | C01BC03 |
| Molecular formula | C21H27NO3 |
| Molecular weight | 341.4 |
| InChIKey | JWHAUXFOSRPERK-UHFFFAOYSA-N |
SMILES: CCCNCC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O
IUPAC name: 1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]-3-phenylpropan-1-one
ChEBI definition: An aromatic ketone that is 3-(propylamino)propane-1,2-diol in which the hydrogen of the primary hydroxy group is replaced by a 2-(3-phenylpropanoyl)phenyl group. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used as the hydrochloride salt in the management of supraventricular and ventricular arrhythmias.
Pharmacological roles (ChEBI): anti-arrhythmia drug.
Also known as: GNF-Pf-4594, Propafenon hexal, Propafenona, Propafenone, propafenone, SID26752315, SID90341088, SID104171212, SID26752316, SID50105251, SID50105252, rac-Propafenone
Parent form; salt/anhydrous children: CHEMBL1201063
Patent coverage: 3,770 distinct patent families (12,711 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 12,574 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRB1 | β1-adrenoceptor | Antagonist | 6.7 | 0% | P08588 |
| ADRB2 | β2-adrenoceptor | Antagonist | 7.44 | 0.4% | P07550 |
| KCNA5 | Kv1.5 | 4.4 | 0.2% | P22460 |
Broader ChEMBL bioactivity targets: 33 (assay-derived). Sample: Survival motor neuron protein, Prelamin-A/C, 5-hydroxytryptamine receptor 2B, Alpha-2C adrenergic receptor, Voltage-dependent L-type calcium channel subunit alpha-1C, Nuclear receptor subfamily 2 group E member 1, Sodium channel protein type 5 subunit alpha, Sulfonylurea receptor 2, Kir6.2, Beta-2 adrenergic receptor, Beta-1 adrenergic receptor.
Bioactivity
ChEMBL activities: 54 potent at pChembl ≥ 5 of 64 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRB2 | 7.44 | Ki | 36 | nM | CHEMBL_ACT_7728662 |
| ADRB2 | 7.28 | IC50 | 52 | nM | CHEMBL_ACT_7728661 |
| HTR2B | 7.24 | Ki | 58 | nM | CHEMBL_ACT_7730861 |
| HTR2B | 7.04 | IC50 | 92 | nM | CHEMBL_ACT_7730860 |
| HTR2A | 6.73 | Ki | 187 | nM | CHEMBL_ACT_7730859 |
| HTR2C | 6.7 | Ki | 201 | nM | CHEMBL_ACT_7730863 |
| ADRB1 | 6.69 | Ki | 205 | nM | CHEMBL_ACT_7728660 |
| ABCB1 | 6.5 | EC50 | 320 | nM | CHEMBL_ACT_1019441 |
| ADRB3 | 6.5 | Ki | 318 | nM | CHEMBL_ACT_7728664 |
| ABCB1 | 6.48 | IC50 | 331.1 | nM | CHEMBL_ACT_10954681 |
| ABCB1 | 6.48 | EC50 | 331.1 | nM | CHEMBL_ACT_13518282 |
| ABCB1 | 6.48 | EC50 | 329 | nM | CHEMBL_ACT_1832763 |
| ADRB1 | 6.45 | IC50 | 354 | nM | CHEMBL_ACT_7728659 |
| ADRB1 | 6.42 | AC50 | 380 | nM | CHEMBL_ACT_25121439 |
| HTR2C | 6.42 | IC50 | 384 | nM | CHEMBL_ACT_7730862 |
| ADRB3 | 6.37 | IC50 | 424 | nM | CHEMBL_ACT_7728663 |
| KCNH2 | 6.36 | IC50 | 440 | nM | CHEMBL_ACT_15257969 |
| KCNH2 | 6.18 | AC50 | 660 | nM | CHEMBL_ACT_25117343 |
| HTR2A | 6.18 | IC50 | 654 | nM | CHEMBL_ACT_7730858 |
| KCNH2 | 6.1 | IC50 | 800 | nM | CHEMBL_ACT_1449631 |
| HTR6 | 6.06 | Ki | 865 | nM | CHEMBL_ACT_7732862 |
| P19327 | 6.03 | Ki | 935 | nM | CHEMBL_ACT_7730855 |
| SIGMAR1 | 5.96 | Ki | 1097 | nM | CHEMBL_ACT_7732866 |
| SCN5A | 5.92 | IC50 | 1190 | nM | CHEMBL_ACT_15257910 |
| P15823 | 5.85 | Ki | 1416 | nM | CHEMBL_ACT_7728650 |
| SLC6A3 | 5.83 | Ki | 1484 | nM | CHEMBL_ACT_7728730 |
| P19327 | 5.79 | IC50 | 1637 | nM | CHEMBL_ACT_7730854 |
| O35505 | 5.75 | IC50 | 1800 | nM | CHEMBL_ACT_15257939 |
| O35505 | 5.75 | IC50 | 1800 | nM | CHEMBL_ACT_15373276 |
| SLC6A3 | 5.73 | IC50 | 1868 | nM | CHEMBL_ACT_7728729 |
Target pathways
Aggregated over 3 target gene(s): ADRB1, ADRB2, KCNA5.
Top Reactome pathways
22 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | ADRB1, ADRB2 |
| Signaling by GPCR | 2 | ADRB1, ADRB2 |
| Class A/1 (Rhodopsin-like receptors) | 2 | ADRB1, ADRB2 |
| Amine ligand-binding receptors | 2 | ADRB1, ADRB2 |
| GPCR downstream signalling | 2 | ADRB1, ADRB2 |
| Adrenoceptors | 2 | ADRB1, ADRB2 |
| G alpha (s) signalling events | 2 | ADRB1, ADRB2 |
| GPCR ligand binding | 2 | ADRB1, ADRB2 |
| Neuronal System | 1 | KCNA5 |
| Potassium Channels | 1 | KCNA5 |
| Voltage gated Potassium channels | 1 | KCNA5 |
| Membrane Trafficking | 1 | ADRB2 |
| Metabolism of proteins | 1 | ADRB2 |
| Muscle contraction | 1 | KCNA5 |
| Phase 3 - rapid repolarisation | 1 | KCNA5 |
| Cardiac conduction | 1 | KCNA5 |
| Vesicle-mediated transport | 1 | ADRB2 |
| Deubiquitination | 1 | ADRB2 |
| Ub-specific processing proteases | 1 | ADRB2 |
| Post-translational protein modification | 1 | ADRB2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | ADRB2 |
| Clathrin-mediated endocytosis | 1 | ADRB2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| diet induced thermogenesis | 2 |
| norepinephrine-epinephrine-mediated vasodilation involved in regulation of systemic arterial blood pressure | 2 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 2 |
| response to cold | 2 |
| positive regulation of cardiac muscle cell apoptotic process | 2 |
| heat generation | 2 |
| negative regulation of multicellular organism growth | 2 |
| positive regulation of MAPK cascade | 2 |
| brown fat cell differentiation | 2 |
| adenylate cyclase-activating adrenergic receptor signaling pathway | 2 |
| positive regulation of cold-induced thermogenesis | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| positive regulation of heart rate by epinephrine-norepinephrine | 1 |
| positive regulation of the force of heart contraction by epinephrine-norepinephrine | 1 |
Indications & clinical
Indications
6 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| atrial fibrillation | 3 | MONDO:0004981 | EFO:0000275 |
| heart failure | 3 | MONDO:0005252 | EFO:0003144 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| ventricular fibrillation | 3 | MONDO:0000190 | EFO:0004287 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 17.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 7 |
| PHASE4 | 5 |
| PHASE3 | 3 |
| PHASE1 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07270848 | PHASE4 | NOT_YET_RECRUITING | Dronedarone Rhythm Intervention for Early Atrial Fibrillation |
| NCT02145546 | PHASE4 | UNKNOWN | Antiarrhythmic Drugs Assessment in Preventing Atrial Fibrillation |
| NCT03029169 | PHASE4 | COMPLETED | Propafenone Versus Amiodarone in Septic Shock |
| NCT03895411 | PHASE4 | UNKNOWN | Efficacy and Safety of Sotalol in Children With Arrhythmia |
| NCT05720572 | PHASE4 | UNKNOWN | Antazoline in Comparison to Propafenone in Pharmacological Cardioversion of Atrial Fibrillation. |
| NCT00000464 | PHASE3 | COMPLETED | Cardiac Arrest in Seattle: Conventional Versus Amiodarone Drug Evaluation (CASCADE) |
| NCT00000556 | PHASE3 | COMPLETED | Atrial Fibrillation Follow-up Investigation of Rhythm Management (AFFIRM) |
| NCT00392106 | PHASE3 | SUSPENDED | High Intensity Focused Ultrasound (HIFU) Ablation System Study |
| NCT01956487 | PHASE1 | COMPLETED | Bioequivalence of RYTHMOL SR® Manufactured at Two Different Sites |
| NCT03915340 | PHASE1 | COMPLETED | Bioequivalence Study of Two Formulations of Propafenone 300 mg Film-coated Tablets in Healthy Adult Volunteers After a Single Oral Dose Administration Under Fasting Conditions |
| NCT00933634 | Not specified | COMPLETED | Efficacy and Safety of Electrical Versus Pharmacological Cardioversion in Early Atrial Fibrillation |
| NCT01991119 | Not specified | COMPLETED | Efficacy of Propafenone Versus Dronedarone for the Maintenance of Sinus Rhythm in Patients With Atrial Fibrillation |
| NCT02294955 | Not specified | UNKNOWN | Catheter Ablation Compared With Pharmacological Therapy for Atrial Fibrillation (CAPTAF Trial) |
| NCT02633774 | Not specified | UNKNOWN | Comparison of Brain Perfusion in Rhythm Control and Rate Control of Persistent Atrial Fibrillation |
| NCT03561935 | Not specified | WITHDRAWN | Beta-blocker vs. Ic Antiarrhythmic Drug for PVC |
| NCT03674658 | Not specified | COMPLETED | Propafenone in the Treatment of Atrial Fibrillation |
| NCT05463614 | Not specified | UNKNOWN | Population Pharmacokinetics of Propafenone and Propranolol in Children Patients |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for propafenone and CYP2D6 | DPWG | CYP2D6 | yes | yes |
PharmGKB also curates 2 clinical and 12 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
248 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Desloratadine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| Pramipexole | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| ACEBUTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ALBUTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ATENOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BETAXOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BISOPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CARTEOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CELIPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| EPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ESMOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| FENOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| FORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| INDACATEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| LABETALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| LEVOBUNOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| METOPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NADOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NEBIVOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NOREPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| OXPRENOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PHENYLEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PINDOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PRACTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PRENYLAMINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RANOLAZINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RIFAMPIN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RIFAXIMIN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| RITODRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | ADRB1, KCNA5 |
| SOTALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
Related Atlas pages
- Genes: ADRB1, ADRB2, KCNA5
- Diseases: atrial fibrillation, heart failure, myocardial infarction, ventricular fibrillation
- Drugs: Desloratadine, Dihydroergotamine, Olodaterol, Pramipexole, Tamsulosin, Acebutolol, Albuterol, Amitriptyline, Arformoterol, Aripiprazole, Atenolol, Benperidol, Betaxolol, Bisoprolol, Brexpiprazole, Bromocriptine, Candesartan Cilexetil, Carteolol, Carvedilol, Celiprolol, Chlorhexidine, Clemastine, Clomipramine, Clotrimazole, Darifenacin, Dobutamine, Domperidone, Epinephrine, Ergotamine, Esmolol, Fenoterol, Fluspirilene, Formoterol, Indacaterol, Isoproterenol, Labetalol, Levobunolol, Metoprolol, Montelukast, Nadolol, Nebivolol, Nitazoxanide, Norepinephrine, Nortriptyline, Oxprenolol, Phenylephrine, Pimozide, Pindolol, Practolol, Prenylamine, Primaquine, Propranolol, Ranolazine, Rifampin, Rifaximin, Ritodrine, Salmeterol, Sertindole, Sotalol, Sunitinib