Propranolol
drugOn this page
Also known as .beta.-propranololBetalongDl-propranololEuprovasinInderide-40/25Inderide-80/25ProprasylytReducorO-Butyl-hydroxylaminepropanololSID26755283SID90341556SID26751802SID50104497R-PropanololSID124881056Propranol(+/-)-Propranololrac-Propranolol
Summary
Propranolol (CHEMBL27) is an approved small-molecule β-adrenergic antagonist (ATC C07AA05) targeting ADRB2 and ADRB3; indicated across 76 conditions including cardiovascular disorder and portal hypertension.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C07AA05
- Targets: 2 (ADRB2, ADRB3)
- Indications: 76 conditions
- Clinical trials: 299
- Chemistry: 259.34 Da · C16H21NO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL27 |
| Name | Propranolol |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4946 |
| ChEBI | CHEBI:8499 |
| ATC | C07AA05 |
| Molecular formula | C16H21NO2 |
| Molecular weight | 259.34 |
| InChIKey | AQHHHDLHHXJYJD-UHFFFAOYSA-N |
SMILES: CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O
IUPAC name: 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol
ChEBI definition: A propanolamine that is propan-2-ol substituted by a propan-2-ylamino group at position 1 and a naphthalen-1-yloxy group at position 3.
Pharmacological roles (ChEBI): β-adrenergic antagonist, anxiolytic drug, anti-arrhythmia drug, vasodilator agent, antihypertensive agent.
Other ChEBI roles (chemical / environmental): xenobiotic, environmental contaminant, human blood serum metabolite.
Also known as: .beta.-propranolol, Betalong, Dl-propranolol, Euprovasin, Inderide-40/25, Inderide-80/25, Propranolol, Proprasylyt, Reducor, O-Butyl-hydroxylamine, propranolol, propanolol
Parent form; salt/anhydrous children: CHEMBL1671
Patent coverage: 23,983 distinct patent families (85,886 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 85,539 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRB2 | β2-adrenoceptor | Antagonist | 9.5 | 0.4% | P07550 |
| ADRB3 | β3-adrenoceptor | Antagonist | 7.2 | 0.1% | P13945 |
Broader ChEMBL bioactivity targets: 37 (assay-derived). Sample: 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2C adrenergic receptor, Voltage-dependent L-type calcium channel subunit alpha-1C, Nuclear receptor subfamily 2 group E member 1, Sodium channel protein type 5 subunit alpha, Adrenergic receptor beta, Adrenergic receptor beta, Beta-2 adrenergic receptor, Beta-1 adrenergic receptor.
Bioactivity
ChEMBL activities: 107 potent at pChembl ≥ 5 of 126 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRB2 | 10 | Kd | 0.1 | nM | CHEMBL_ACT_19403978 |
| ADRB2 | 9.62 | Kd | 0.24 | nM | CHEMBL_ACT_6360499 |
| ADRB2 | 9.49 | Ki | 0.32 | nM | CHEMBL_ACT_19255932 |
| ADRB2 | 9.34 | Ki | 0.46 | nM | CHEMBL_ACT_13871672 |
| ADRB2 | 9.32 | IC50 | 0.48 | nM | CHEMBL_ACT_20717206 |
| ADRB2 | 9.26 | IC50 | 0.55 | nM | CHEMBL_ACT_20717202 |
| ADRB2 | 9.22 | Kd | 0.6 | nM | CHEMBL_ACT_6360568 |
| ADRB2 | 9.12 | Ki | 0.77 | nM | CHEMBL_ACT_7741503 |
| ADRB2 | 9.1 | Kd | 0.79 | nM | CHEMBL_ACT_2688156 |
| Q8K4Z4 | 9.01 | Kd | 0.98 | nM | CHEMBL_ACT_1065557 |
| ADRB2 | 8.95 | IC50 | 1.12 | nM | CHEMBL_ACT_7741502 |
| Q8K4Z4 | 8.9 | Kd | 1.26 | nM | CHEMBL_ACT_127932 |
| ADRB2 | 8.9 | Kd | 1.26 | nM | CHEMBL_ACT_247416 |
| Q8K4Z4 | 8.86 | Kd | 1.38 | nM | CHEMBL_ACT_14606308 |
| ADRB1 | 8.85 | Ki | 1.4 | nM | CHEMBL_ACT_19255916 |
| ADRB1 | 8.83 | Ki | 1.47 | nM | CHEMBL_ACT_7741501 |
| ADRB2 | 8.76 | Ki | 1.74 | nM | CHEMBL_ACT_18377937 |
| P54833 | 8.75 | Kd | 1.78 | nM | CHEMBL_ACT_444586 |
| ADRB1 | 8.74 | Kd | 1.82 | nM | CHEMBL_ACT_6360534 |
| ADRB2 | 8.7 | Kd | 2 | nM | CHEMBL_ACT_247415 |
| ADRB1 | 8.64 | Ki | 2.3 | nM | CHEMBL_ACT_114510 |
| P10608 | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_127696 |
| P34971 | 8.62 | Ki | 2.4 | nM | CHEMBL_ACT_19255911 |
| P18090 | 8.62 | Kd | 2.4 | nM | CHEMBL_ACT_577314 |
| ADRB2 | 8.62 | Kd | 2.4 | nM | CHEMBL_ACT_87015 |
| ADRB1 | 8.6 | IC50 | 2.54 | nM | CHEMBL_ACT_7741500 |
| Q8K4Z4 | 8.57 | Kd | 2.69 | nM | CHEMBL_ACT_18290263 |
| P18090 | 8.52 | Ki | 3 | nM | CHEMBL_ACT_12472573 |
| Q8K4Z4 | 8.52 | Kd | 3.02 | nM | CHEMBL_ACT_530300 |
| P10608 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_577307 |
Target pathways
Aggregated over 2 target gene(s): ADRB2, ADRB3.
Top Reactome pathways
16 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | ADRB2, ADRB3 |
| Signaling by GPCR | 2 | ADRB2, ADRB3 |
| Class A/1 (Rhodopsin-like receptors) | 2 | ADRB2, ADRB3 |
| Amine ligand-binding receptors | 2 | ADRB2, ADRB3 |
| GPCR downstream signalling | 2 | ADRB2, ADRB3 |
| Adrenoceptors | 2 | ADRB2, ADRB3 |
| G alpha (s) signalling events | 2 | ADRB2, ADRB3 |
| GPCR ligand binding | 2 | ADRB2, ADRB3 |
| Membrane Trafficking | 1 | ADRB2 |
| Metabolism of proteins | 1 | ADRB2 |
| Vesicle-mediated transport | 1 | ADRB2 |
| Deubiquitination | 1 | ADRB2 |
| Ub-specific processing proteases | 1 | ADRB2 |
| Post-translational protein modification | 1 | ADRB2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | ADRB2 |
| Clathrin-mediated endocytosis | 1 | ADRB2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| diet induced thermogenesis | 2 |
| norepinephrine-epinephrine-mediated vasodilation involved in regulation of systemic arterial blood pressure | 2 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 2 |
| response to cold | 2 |
| heat generation | 2 |
| negative regulation of multicellular organism growth | 2 |
| positive regulation of MAPK cascade | 2 |
| negative regulation of smooth muscle contraction | 2 |
| brown fat cell differentiation | 2 |
| adrenergic receptor signaling pathway | 2 |
| adenylate cyclase-activating adrenergic receptor signaling pathway | 2 |
| adenylate cyclase-inhibiting adrenergic receptor signaling pathway | 2 |
| positive regulation of cold-induced thermogenesis | 2 |
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
Indications & clinical
Indications
76 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| portal hypertension | 3 | MONDO:0005080 | EFO:0000666 |
| post-traumatic stress disorder | 3 | MONDO:0005146 | EFO:0001358 |
| cirrhosis of liver | 3 | MONDO:0005155 | EFO:0001422 |
| colorectal neoplasm | 3 | MONDO:0005335 | EFO:0004142 |
| hemangioma | 3 | MONDO:0006500 | EFO:1000635 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| ventricular fibrillation | 3 | MONDO:0000190 | EFO:0004287 |
| myocardial ischemia | 3 | MONDO:0024644 | EFO:1001375 |
| esophageal varices | 3 | MONDO:0001221 | EFO:0009545 |
| brain injury | 3 | MONDO:0043510 | MONDO:0043510 |
| migraine disorder | 3 | MONDO:0005277 | MONDO:0005277 |
| hereditary hemorrhagic telangiectasia | 3 | MONDO:0019180 | MONDO:0019180 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| hypertensive disorder | 2 | MONDO:0005044 | EFO:0000537 |
| injury | 2 | MONDO:0021178 | EFO:0000546 |
| renal cell carcinoma | 2 | MONDO:0005086 | EFO:0000681 |
| stroke disorder | 2 | MONDO:0005098 | EFO:0000712 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| obstructive sleep apnea syndrome | 2 | MONDO:0007147 | EFO:0003918 |
| angiosarcoma | 2 | MONDO:0016982 | EFO:0003968 |
| panic disorder | 2 | MONDO:0005383 | EFO:0004262 |
| anxiety | 2 | MONDO:0011918 | EFO:0005230 |
| orthostatic hypotension | 2 | MONDO:0005469 | EFO:0005252 |
| dystocia | 2 | MONDO:0006737 | EFO:1000911 |
| retinopathy of prematurity | 2 | MONDO:0006952 | EFO:1001158 |
| pancreatic neoplasm | 2 | MONDO:0021040 | EFO:0003860 |
| burn | 2 | MONDO:0043519 | EFO:0009516 |
| gastric neoplasm | 2 | MONDO:0021085 | MONDO:0001056 |
| papilloma | 2 | MONDO:0002363 | MONDO:0002363 |
| substance-related disorder | 2 | MONDO:0002494 | MONDO:0004938 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| hypotensive disorder | 2 | MONDO:0005468 | EFO:0005251 |
| age-related macular degeneration | 2 | MONDO:0005150 | EFO:0001365 |
| acute stress disorder | 2 | MONDO:0003763 | EFO:0005223 |
| asthma | 2 | MONDO:0004979 | MONDO:0004979 |
| type 1 diabetes mellitus | 2 | MONDO:0005147 | MONDO:0005147 |
| migraine with aura | 2 | MONDO:0005475 | MONDO:0005475 |
| Marfan syndrome | 2 | MONDO:0007947 | MONDO:0007947 |
| sickle cell disease | 2 | MONDO:0011382 | MONDO:0011382 |
| lymphedema | 2 | MONDO:0019297 | MONDO:0019297 |
| migraine without aura | 2 | MONDO:0100431 | MONDO:0100431 |
| Kaposi’s sarcoma | 2 | MONDO:0005055 | EFO:0000558 |
| triple-negative breast carcinoma | 2 | MONDO:0005494 | EFO:0005537 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| anxiety disorder | 2 | MONDO:0005618 | EFO:0006788 |
| chronic obstructive pulmonary disease | 1 | MONDO:0005002 | EFO:0000341 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
| fibromyalgia | 1 | MONDO:0005546 | EFO:0005687 |
| postural orthostatic tachycardia syndrome | 1 | MONDO:0011479 | EFO:1000645 |
| major depressive disorder | 1 | MONDO:0002009 | MONDO:0002009 |
| autism spectrum disorder | 0 | MONDO:0005258 | EFO:0003756 |
| osteoporosis | 0 | MONDO:0005298 | EFO:0003882 |
| hypoglycemia | 0 | MONDO:0004946 | HP:0001943 |
| aphasia | 0 | MONDO:0000598 | HP:0002381 |
17 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 299.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 80 |
| PHASE4 | 55 |
| Not specified | 55 |
| PHASE1 | 34 |
| PHASE3 | 26 |
| PHASE2/PHASE3 | 22 |
| EARLY_PHASE1 | 18 |
| PHASE1/PHASE2 | 9 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05587361 | PHASE4 | RECRUITING | Beta-Adrenergic Modulation of Drug Cue Reactivity |
| NCT05853627 | PHASE4 | RECRUITING | Mismatch vs. Standard Intervention During Memory Reconsolidation Blockade With Propranolol: Effect on Psychophysiological Reactivity During Traumatic Imagery |
| NCT05997732 | PHASE4 | RECRUITING | Sympathetic Neurovascular Transduction: Role of Adrenergic Receptors and Sex Differences |
| NCT06263452 | PHASE4 | RECRUITING | Beta-Blocker Influences on Inflammatory and Neural Responses to Stress |
| NCT06485726 | PHASE4 | RECRUITING | Valproate Versus Propranolol in Migraine |
| NCT06499116 | PHASE4 | NOT_YET_RECRUITING | Comparison of the Effectiveness of First-line Preventive Treatment of Migraine in Primary Care |
| NCT06972056 | PHASE4 | RECRUITING | Comparative Effectiveness of Migraine Preventive Medications: The APT Comparison Study |
| NCT06982183 | PHASE4 | RECRUITING | The Effects of Propranolol and Hydrocortisone on Military-Relevant Performance Outcomes |
| NCT07352228 | PHASE4 | ENROLLING_BY_INVITATION | Carvedilol vs. Propranolol for Preventing Rebleeding After Endoscopic Treatment of Cirrhotic Varices |
| NCT07583134 | PHASE4 | NOT_YET_RECRUITING | Impact of Propranolol Strategies on Myocardial Injury After Breast Cancer Surgery |
| NCT00060866 | PHASE4 | COMPLETED | Propranolol to Treat Fainting Due to Sympathoadrenal Imbalance |
| NCT00158262 | PHASE4 | COMPLETED | Effect of Propranolol on Preventing Posttraumatic Stress Disorder |
| NCT00332904 | PHASE4 | UNKNOWN | Effect of Betablocker or Aldosterone Antagonist Therapy on Patients With Liver Cirrhosis |
| NCT00645450 | PHASE4 | TERMINATED | PTSD Symptom Reduction by Propranolol Given After Trauma Memory Activation |
| NCT00648375 | PHASE4 | TERMINATED | Effectiveness of Propranolol For Treating People With Post-Traumatic Stress Disorder |
| NCT00709735 | PHASE4 | COMPLETED | A Psychophysiologic Study of Weakening Traumatic Combat Memories With Post-Reactivation Propranolol |
| NCT00862095 | PHASE4 | TERMINATED | Medical Therapies for Chronic Post-Traumatic Headaches |
| NCT00965900 | PHASE4 | UNKNOWN | Endoscopic Band Ligation (EBL) Versus Propranolol for Primary Prophylaxis of Variceal Bleeding |
| NCT00966082 | PHASE4 | UNKNOWN | EBL Versus EBL and Propranolol for the Prevention of Variceal Rebleeding in Pts With Previous Variceal Treatment |
| NCT00966121 | PHASE4 | UNKNOWN | Endoscopic Band Ligation (EBL) Versus Endoscopic Band Ligation and Propranolol for the Prevention of Variceal Rebleeding |
| NCT01059396 | PHASE4 | COMPLETED | Study on B-blockers to Prevent Decompensation of Cirrhosis With HTPortal |
| NCT01060111 | PHASE4 | COMPLETED | An Efficacy and Tolerability Study of Topiramate in Participants With Migraine |
| NCT01298271 | PHASE4 | UNKNOWN | A Randomized Trial of GVS Alone vs. Propranolol |
| NCT01298284 | PHASE4 | UNKNOWN | A Trial of EVL\GVS Alone vs. EVL\GVS Combined Propranolol |
| NCT01451658 | PHASE4 | UNKNOWN | A Trial of EVL\GVS Alone vs. EVL\GVS Combined Propranolol (S-HCC) |
| NCT01458600 | PHASE4 | COMPLETED | Adjuvant Treatment of Graves´ Ophthalmopathy With NSAID (aGO Study) |
| NCT01631682 | PHASE4 | COMPLETED | Pilot Study of Pharmaceutical and Behavioral Interventions to Treat Anxiety Disorders |
| NCT01655303 | PHASE4 | COMPLETED | Rate Control in Atrial Fibrillation |
| NCT01893541 | PHASE4 | COMPLETED | PROPRANOLOL PLUS LIGATION REDUCES RECURRENCE OF ESOPHAGEAL VARICES? |
| NCT01908972 | PHASE4 | COMPLETED | The Safety and Efficiency of Propranolol as an Initial Treatment for Pediatric Hemangioma |
| NCT01970748 | PHASE4 | UNKNOWN | Primary Prevention of Patients With Hepatocellular Carcinoma and Concomitant Esophageal Varices |
| NCT02032758 | PHASE4 | COMPLETED | Study of Arm and Putter Movement in Golfers With Golfer’s Cramp |
| NCT02111369 | PHASE4 | COMPLETED | Propranolol and Botulinum Toxin for Essential Vocal Tremor |
| NCT02153944 | PHASE4 | COMPLETED | Cognitive vs. Emotional Psychopharmacological Manipulations of Fear vs. Anxiety |
| NCT02171988 | PHASE4 | COMPLETED | Effect of Medical Treatment and Prognosis of Postural Orthostatic Tachycardia Syndrome (POTS) |
| NCT02350985 | PHASE4 | COMPLETED | Comparison of Propranolol and Venlafaxine in Treatment of Vestibular Migraine |
| NCT02385422 | PHASE4 | UNKNOWN | The Effect of Carvedilol Vs Propranolol in Cirrhotic Patients With Variceal Bleeding |
| NCT02495883 | PHASE4 | COMPLETED | Functional Imaging of Tremor Circuits and Mechanisms of Treatment Response |
| NCT02740166 | PHASE4 | UNKNOWN | Preventing Recurrent Bleeding After Eradication of Esophageal Varices |
| NCT02790710 | PHASE4 | WITHDRAWN | Brief Intervention for OCD Fears |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (3) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for acebutolol, betaxolol, bisoprolol, ca | CPIC | CYP2D6 | ||
| Annotation of CPIC Guideline for acebutolol, atenolol, betaxolol, biso | CPIC | ADRA2C;ADRB1;GRK4;GRK5 | ||
| Annotation of CPIC Guideline for carvedilol, labetalol, nadolol, pindo | CPIC | ADRB2 |
PharmGKB also curates 3 clinical and 15 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
238 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| Crizotinib | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| BISOPROLOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| EPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| FENOTEROL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| FORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| LABETALOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| LEVOBUNOLOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| NOREPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| PHENYLEPHRINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| PINDOLOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| PRACTOLOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| PROPAFENONE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| SOTALOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| TIMOLOL | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| ALPRENOLOL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| BOPINDOLOL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| CIMATEROL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| FLESTOLOL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| LEVISOPRENALINE | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| LEVOPROPRANOLOL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| MILVETEROL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| RAFABEGRON | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| SOLABEGRON | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| TRETOQUINOL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| XAMOTEROL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| ZENIDOLOL | ChEMBL | Phase 2 | ADRB2, ADRB3 |
| Alogliptin | PubChem | Approved | ADRB2, ADRB3 |
| Bosentan | PubChem | Approved | ADRB2, ADRB3 |
| Fidaxomicin | PubChem | Approved | ADRB2, ADRB3 |
| Glycopyrrolate | PubChem | Approved | ADRB2, ADRB3 |
| Linagliptin | PubChem | Approved | ADRB2, ADRB3 |
| Methotrexate | PubChem | Approved | ADRB2, ADRB3 |
| Propoxyphene | PubChem | Approved | ADRB2, ADRB3 |
| Pyrazinamide | PubChem | Approved | ADRB2, ADRB3 |
| Selumetinib | PubChem | Approved | ADRB2, ADRB3 |
| Tiotropium Bromide Monohydrate | PubChem | Approved | ADRB2, ADRB3 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRB2 |
| ACEBUTOLOL | ChEMBL | Phase 4 (approved) | ADRB2 |
| ADENOSINE | ChEMBL | Phase 4 (approved) | ADRB2 |
| ALBUTEROL | ChEMBL | Phase 4 (approved) | ADRB2 |
Related Atlas pages
- Genes: ADRB2, ADRB3
- Diseases: cardiovascular disorder, portal hypertension, post-traumatic stress disorder, cirrhosis of liver, colorectal neoplasm, hemangioma, myocardial infarction, ventricular fibrillation, myocardial ischemia, esophageal varices, brain injury, migraine disorder, hereditary hemorrhagic telangiectasia, coronary artery disorder, heart disorder
- Drugs: Clozapine, Crizotinib, Desloratadine, Dihydroergotamine, Olanzapine, Pramipexole, Rifampin, Tegaserod, Amlodipine, Aripiprazole, Bisoprolol, Bromocriptine, Carvedilol, Clotrimazole, Doxazosin, Epinephrine, Fenoterol, Formoterol, Haloperidol, Isoproterenol, Labetalol, Levobunolol, Montelukast, Norepinephrine, Phenylephrine, Pimozide, Pindolol, Practolol, Propafenone, Salmeterol, Sotalol, Tamoxifen, Thioridazine, Timolol, Alogliptin, Bosentan, Fidaxomicin, Glycopyrrolate, Linagliptin, Methotrexate, Propoxyphene, Pyrazinamide, Selumetinib, Olodaterol, Acebutolol, Adenosine, Albuterol