Quetiapine
drugOn this page
Also known as Atrolak xlBiquelle xlBrancico xlEbesque xlMintreleq xlNorsicNSC-758918Psyquet xlQuetiapinaQuetiapine extended releaseSeotiapim xlSeroquelSeroquel xlSondate xlTenprolide xlZaluron xlSID26749928SID29215183SID49666155
Summary
Quetiapine (CHEMBL716) is an approved small-molecule serotonergic antagonist (ATC N05AH04) targeting HTR1A, DRD2, and HRH1; indicated across 30 conditions including psychotic disorder and schizoaffective disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05AH04
- Targets: 8 (HTR1A, DRD2, HRH1…)
- Indications: 30 conditions
- Clinical trials: 253
- Chemistry: 383.5 Da · C21H25N3O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL716 |
| Name | Quetiapine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5002 |
| ChEBI | CHEBI:8707 |
| ATC | N05AH04 |
| Molecular formula | C21H25N3O2S |
| Molecular weight | 383.5 |
| InChIKey | URKOMYMAXPYINW-UHFFFAOYSA-N |
SMILES: C1CN(CCN1CCOCCO)C2=NC3=CC=CC=C3SC4=CC=CC=C42
IUPAC name: 2-[2-(4-benzo[b][1,4]benzothiazepin-6-ylpiperazin-1-yl)ethoxy]ethanol
Pharmacological roles (ChEBI): serotonergic antagonist, dopaminergic antagonist, histamine antagonist, adrenergic antagonist, second generation antipsychotic.
Also known as: Atrolak xl, Biquelle xl, Brancico xl, Ebesque xl, Mintreleq xl, Norsic, NSC-758918, Psyquet xl, Quetiapina, Quetiapine, Quetiapine extended release, Seotiapim xl
Parent form; salt/anhydrous children: CHEMBL1200911, CHEMBL3188993
Patent coverage: 7,009 distinct patent families (26,465 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 26,309 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR1A | 5-HT1A receptor | Full agonist | 6.6 | 0% | P08908 |
| DRD2 | D2 receptor | Antagonist | 7.2 | 0% | P14416 |
| HRH1 | H1 receptor | Antagonist | 8.7 | 0% | P35367 |
| HTR1D | 5-HT1D receptor | Full agonist | 5.7 | 0% | P28221 |
| HTR1E | 5-ht1e receptor | Full agonist | 5.9 | 0% | P28566 |
| HTR1F | 5-HT1F receptor | Full agonist | 5.6 | 0.1% | P30939 |
| HTR2A | 5-HT2A receptor | Full agonist | 7 | 0% | P28223 |
| SLC6A2 | NET | Inhibition | 6.03 | 0.4% | P23975 |
Broader ChEMBL bioactivity targets: 45 (assay-derived). Sample: Prelamin-A/C, Muscarinic acetylcholine receptor M4, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Histamine H2 receptor, Alpha-2B adrenergic receptor, Sodium channel protein type 5 subunit alpha, Beta-lactamase.
Bioactivity
ChEMBL activities: 158 potent at pChembl ≥ 5 of 168 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRA1D | 8.35 | Ki | 4.5 | nM | CHEMBL_ACT_673743 |
| HRH1 | 8.34 | Ki | 4.6 | nM | CHEMBL_ACT_7741714 |
| ADRA1D | 8.15 | Ki | 7 | nM | CHEMBL_ACT_22435773 |
| HRH1 | 8.06 | Ki | 8.7 | nM | CHEMBL_ACT_2556769 |
| HRH1 | 8 | Ki | 10 | nM | CHEMBL_ACT_14543255 |
| HRH1 | 8 | Ki | 10 | nM | CHEMBL_ACT_16272774 |
| HRH1 | 7.96 | Ki | 11 | nM | CHEMBL_ACT_22435767 |
| P15823 | 7.9 | Ki | 12.59 | nM | CHEMBL_ACT_1925450 |
| P15823 | 7.87 | Ki | 13.6 | nM | CHEMBL_ACT_7741608 |
| HRH1 | 7.72 | Ki | 19 | nM | CHEMBL_ACT_437386 |
| ADRA1A | 7.7 | Ki | 20 | nM | CHEMBL_ACT_16356858 |
| HRH1 | 7.68 | Ki | 21 | nM | CHEMBL_ACT_673746 |
| P15823 | 7.61 | IC50 | 24.5 | nM | CHEMBL_ACT_7741607 |
| HRH1 | 7.58 | AC50 | 26 | nM | CHEMBL_ACT_25212960 |
| HTR2A | 7.51 | Ki | 31 | nM | CHEMBL_ACT_19101889 |
| HTR2A | 7.47 | Ki | 33.6 | nM | CHEMBL_ACT_7743865 |
| P43140 | 7.46 | Ki | 34.9 | nM | CHEMBL_ACT_7741606 |
| P31389 | 7.4 | Ki | 39.81 | nM | CHEMBL_ACT_1925476 |
| P31390 | 7.4 | IC50 | 40 | nM | CHEMBL_ACT_2147482 |
| HRH1 | 7.4 | IC50 | 39.6 | nM | CHEMBL_ACT_7741713 |
| ADRA2B | 7.34 | Ki | 45.8 | nM | CHEMBL_ACT_7741614 |
| ADRA1D | 7.32 | Ki | 47.5 | nM | CHEMBL_ACT_7741610 |
| CHRM1 | 7.25 | Ki | 56 | nM | CHEMBL_ACT_673745 |
| ADRA1D | 7.24 | Ki | 58 | nM | CHEMBL_ACT_437383 |
| ADRA1A | 7.22 | AC50 | 60.7 | nM | CHEMBL_ACT_25138503 |
| ADRA2C | 7.21 | Ki | 61.1 | nM | CHEMBL_ACT_7741616 |
| HTR2A | 7.2 | Ki | 63.1 | nM | CHEMBL_ACT_1925234 |
| HTR7 | 7.2 | Ki | 63.1 | nM | CHEMBL_ACT_1925394 |
| DRD2 | 7.2 | Ki | 63.1 | nM | CHEMBL_ACT_288601 |
| DRD2 | 7.16 | Ki | 69 | nM | CHEMBL_ACT_673737 |
Target pathways
Aggregated over 8 target gene(s): HTR1A, DRD2, HRH1, HTR1D, HTR1E, HTR1F, HTR2A, SLC6A2.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 5 | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| Signaling by GPCR | 5 | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| Class A/1 (Rhodopsin-like receptors) | 5 | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| Amine ligand-binding receptors | 5 | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| Serotonin receptors | 5 | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| GPCR ligand binding | 5 | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| GPCR downstream signalling | 4 | HTR1D, HTR1E, HTR1F, HTR2A |
| G alpha (i) signalling events | 3 | HTR1D, HTR1E, HTR1F |
| G alpha (q) signalling events | 2 | HRH1, HTR2A |
| Disease | 1 | SLC6A2 |
| Transport of small molecules | 1 | SLC6A2 |
| Histamine receptors | 1 | HRH1 |
| Dopamine receptors | 1 | DRD2 |
| R-HSA-425366 | 1 | SLC6A2 |
| SLC-mediated transmembrane transport | 1 | SLC6A2 |
| SLC-mediated transport of neurotransmitters | 1 | SLC6A2 |
| SLC transporter disorders | 1 | SLC6A2 |
| Defective SLC6A2 causes orthostatic intolerance (OI) | 1 | SLC6A2 |
| Disorders of transmembrane transporters | 1 | SLC6A2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 7 |
| chemical synaptic transmission | 7 |
| signal transduction | 7 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 6 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 4 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 4 |
| response to xenobiotic stimulus | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 3 |
| serotonin receptor signaling pathway | 2 |
| positive regulation of cell population proliferation | 2 |
| adult behavior | 2 |
| regulation of behavior | 2 |
| G protein-coupled serotonin receptor signaling pathway | 2 |
| temperature homeostasis | 2 |
| intracellular calcium ion homeostasis | 2 |
Indications & clinical
Indications
30 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 4 | MONDO:0005485 | EFO:0005407 |
| schizoaffective disorder | 4 | MONDO:0005487 | EFO:0005411 |
| mood disorder | 3 | MONDO:0005371 | EFO:0004247 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| mental disorder | 3 | MONDO:0005084 | EFO:0000677 |
| social phobia | 3 | MONDO:0001247 | EFO:1001917 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| borderline personality disorder | 3 | MONDO:0001156 | HP:0012076 |
| delirium | 3 | MONDO:0045057 | EFO:0009267 |
| major depressive disorder | 3 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| bipolar disorder | 3 | MONDO:0004985 | EFO:0009963 |
| insomnia | 2 | MONDO:0013600 | EFO:0004698 |
| postpartum depression | 2 | MONDO:0005929 | EFO:0007453 |
| obsessive-compulsive disorder | 2 | MONDO:0008114 | EFO:0004242 |
| attention deficit-hyperactivity disorder | 2 | MONDO:0007743 | EFO:0003888 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| obstructive sleep apnea syndrome | 2 | MONDO:0007147 | EFO:0003918 |
| Parkinson disease | 2 | MONDO:0005180 | MONDO:0005180 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0007079 |
| anorexia nervosa | 2 | MONDO:0005351 | MONDO:0005351 |
| cocaine dependence | 1 | MONDO:0005186 | EFO:0002610 |
| drug-induced dyskinesia | 1 | MONDO:0006732 | EFO:1000904 |
| chronic kidney disease | 1 | MONDO:0005300 | EFO:0003884 |
| methamphetamine dependence | 0 | MONDO:0005419 | EFO:0004701 |
5 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 253.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 95 |
| PHASE3 | 69 |
| Not specified | 45 |
| PHASE2 | 18 |
| PHASE1 | 14 |
| PHASE2/PHASE3 | 7 |
| EARLY_PHASE1 | 3 |
| PHASE1/PHASE2 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04373317 | PHASE4 | RECRUITING | Pimavanserin vs. Quetiapine for Treatment of Parkinson’s Psychosis |
| NCT05590637 | PHASE4 | RECRUITING | Comparing Antipsychotic Medications in LBD Over Time |
| NCT06433635 | PHASE4 | ACTIVE_NOT_RECRUITING | Sequential Multiple Assignment Randomized Trial for Bipolar Depression |
| NCT00014001 | PHASE4 | COMPLETED | CATIE- Schizophrenia Trial |
| NCT00018668 | PHASE4 | COMPLETED | Antipsychotic Response in Schizophrenia |
| NCT00043849 | PHASE4 | COMPLETED | Treatment of Agitation/Psychosis in Dementia/Parkinsonism (TAP/DAP) |
| NCT00044655 | PHASE4 | COMPLETED | Switching Medication to Treat Schizophrenia |
| NCT00048802 | PHASE4 | COMPLETED | Treatment and Outcome of Early Onset Bipolar Disorder |
| NCT00061802 | PHASE4 | COMPLETED | Efficacy and Safety of Two Atypical Antipsychotics vs. Placebo in Patients With an Acute Exacerbation of Either Schizophrenia or Schizoaffective Disorder |
| NCT00090012 | PHASE4 | COMPLETED | Comparison of Continuing Olanzapine to Switching to Quetiapine in Overweight or Obese Patients With Schizophrenia and Schizoaffective Disorder |
| NCT00113295 | PHASE4 | COMPLETED | Combination of Paroxetine CR and Quetiapine for the Treatment of Refractory Generalized Anxiety Disorder |
| NCT00139074 | PHASE4 | TERMINATED | Seroquel in Acute Mania: Study to Investigate if Valproate Add-On Therapy is Superior to Quetiapine Monotherapy in Acutely Manic Patients |
| NCT00156715 | PHASE4 | COMPLETED | Efficacy of Quetiapine in the Treatment of Patients With Schizophrenia and a Comorbid Substance Use Disorder |
| NCT00181883 | PHASE4 | COMPLETED | Quetiapine for Mania In Preschool Children 4 to 6 Years of Age With Bipolar Disorder |
| NCT00182013 | PHASE4 | COMPLETED | Open-Label Comparative Study of Risperidone Versus Olanzapine Versus Quetiapine for Mania in Children and Adolescents With Bipolar I and Bipolar II Disorder |
| NCT00182442 | PHASE4 | COMPLETED | Cognition, Functioning and Quality of Life |
| NCT00186043 | PHASE4 | COMPLETED | Seroquel in the Treatment of Dysphoric Hypomania in Bipolar II |
| NCT00206102 | PHASE4 | COMPLETED | A Study of the Cataractogenic Potential of Seroquel and Risperdal in the Treatment of Participants With Schizophrenia or Schizoaffective Disorder |
| NCT00208143 | PHASE4 | COMPLETED | Seroquel Therapy for Substance Use Disorders Comorbid With Schizophrenia |
| NCT00208819 | PHASE4 | COMPLETED | A Comparison of Two Standard Therapies in the Management of Dementia With Agitation |
| NCT00214578 | PHASE4 | COMPLETED | Seroquel on Glucose Metabolism |
| NCT00223210 | PHASE4 | COMPLETED | An Add-On Trial of Quetiapine in Patients With Bipolar Disorder and Cocaine Dependence |
| NCT00223249 | PHASE4 | COMPLETED | Quetiapine in Patients With Bipolar and Alcohol Abuse/Dependence |
| NCT00232336 | PHASE4 | COMPLETED | Quetiapine for Cocaine Use and Cravings |
| NCT00237393 | PHASE4 | COMPLETED | Quetiapine Treatment for Post-Traumatic Stress Disorder (PTSD) |
| NCT00237861 | PHASE4 | COMPLETED | Effectiveness of Atypical Versus Conventional Antipsychotics in Treating Schizophrenia |
| NCT00253266 | PHASE4 | COMPLETED | Venlafaxine Augmentation in Treatment Resistant Depression |
| NCT00254241 | PHASE4 | COMPLETED | Safety and Efficacy of Seroquel in First Episode Schizophrenia |
| NCT00255515 | PHASE4 | COMPLETED | Seroquel® Combined With Cognitive Remediation Therapy to Conventional Treatment in Patients With Schizophrenia |
| NCT00292370 | PHASE4 | COMPLETED | Quetiapine Augmentation for Treatment-resistant PTSD |
| NCT00295412 | PHASE4 | COMPLETED | The Impact of Quetiapine on the Drug Abuse Patterns of Addicted Schizophrenic Patients |
| NCT00304616 | PHASE4 | COMPLETED | SWitching to Abilify Trial (SWAT) |
| NCT00330863 | PHASE4 | COMPLETED | Preventing Relapse in Schizophrenia: Oral Antipsychotics Compared To Injectables: Evaluating Efficacy |
| NCT00334035 | PHASE4 | COMPLETED | Antipsychotic Therapy and First Episode |
| NCT00370500 | PHASE4 | COMPLETED | Quetiapine and the Dopaminergic Epigenetic Control |
| NCT00375557 | PHASE4 | WITHDRAWN | Safety and Efficacy of Divalproex and Quetiapine in Elderly Alzheimer’s Dementia Patients |
| NCT00393978 | PHASE4 | COMPLETED | Efficacy Study of Quetiapine Plus Topiramate for Reducing Cannabis Consumption and Bipolar Mania |
| NCT00397020 | PHASE4 | COMPLETED | Naturalistic Study, Comparison of Divalproex Extended Release (ER) and Quetiapine for Adults With Acute Mania or Mixed Episodes |
| NCT00407199 | PHASE4 | COMPLETED | The Use of Quetiapine (Seroquel) in the Treatment of Social Phobia: Public Speaking Environment |
| NCT00423878 | PHASE4 | COMPLETED | Comparison of Antipsychotics for Metabolic Problems in Schizophrenia or Schizoaffective Disorder |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (2) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for quetiapine and CYP2D6 | DPWG | CYP2D6 | ||
| Annotation of DPWG Guideline for quetiapine and CYP3A4 | DPWG | CYP3A4 | yes | yes |
PharmGKB also curates 21 clinical and 99 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
878 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR1E, HTR1F, HTR2A, SLC6A2 |
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR1E, HTR1F, HTR2A, SLC6A2 |
| RISPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR1E, HTR1F, HTR2A, SLC6A2 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR1F, HTR2A, SLC6A2 |
| CYPROHEPTADINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR1F, HTR2A, SLC6A2 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR1E, HTR2A, SLC6A2 |
| ASENAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR2A, SLC6A2 |
| ERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| METHYLERGONOVINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR1F, HTR2A |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR1F, HTR2A |
| RIZATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| ZIPRASIDONE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR2A, SLC6A2 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A, SLC6A2 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1D, HTR1E, HTR2A, SLC6A2 |
| CINACALCET | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A, SLC6A2 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A, SLC6A2 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A, SLC6A2 |
| YOHIMBINE | ChEMBL + PubChem | Phase 3 (approved) | DRD2, HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| LYSERGIDE | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR1D, HTR1E, HTR2A |
| PENFLURIDOL | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR1D, HTR2A, SLC6A2 |
| RITANSERIN | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR1E, HTR2A, SLC6A2 |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| CANNABIDIOL | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HTR1A, HTR1E, HTR2A, SLC6A2 |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR2A |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| SUMATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| ZOLMITRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1D, HTR1E, HTR1F, HTR2A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| DULOXETINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| EBASTINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| IPRINDOLE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A |
| LOXAPINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| LURASIDONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| MAPROTILINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| NAFTOPIDIL | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| OXYPERTINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| PERPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| PHENOXYBENZAMINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, SLC6A2 |
Related Atlas pages
- Genes: HTR1A, DRD2, HRH1, HTR1D, HTR1E, HTR1F, HTR2A, SLC6A2
- Diseases: psychotic disorder, schizoaffective disorder, mood disorder, anxiety, mental disorder, social phobia, dementia, borderline personality disorder, delirium, major depressive disorder, depressive disorder, bipolar disorder
- Drugs: Dihydroergotamine, Imipramine, Risperidone, Clozapine, Cyproheptadine, Brexpiprazole, Asenapine, Ergotamine, Methylergonovine, Olanzapine, Rizatriptan, Ziprasidone, Aripiprazole, Azelastine, Cinacalcet, Mianserin, Nefazodone, Yohimbine, Amitriptyline, Cannabidiol, Desloratadine, Fidaxomicin, Pramipexole, Propoxyphene, Sumatriptan, Zolmitriptan, Acetophenazine, Amoxapine, Astemizole, Benperidol, Bromperidol, Cabergoline, Cariprazine, Chlorpromazine, Cinnarizine, Clemastine, Clomipramine, Cyclobenzaprine, Dibenzepin, Domperidone, Doxepin, Duloxetine, Ebastine, Fluphenazine, Haloperidol, Iloperidone, Iprindole, Ketanserin, Loxapine, Lurasidone, Maprotiline, Naftopidil, Nortriptyline, Oxypertine, Perphenazine, Phenoxybenzamine, Pimozide