Raloxifene
drugOn this page
Also known as EvidenJ22.982BKeoxifeneLY-139481NSC-747974RaloxifenoRaloxipheneRaxetoSID11111733SID11111734SID26755239SID90341181SID104171230SID50105675SID144209801SID174007256
Summary
Raloxifene (CHEMBL81) is an approved small-molecule bone density conservation agent (ATC G03XC01) targeting GPER1, AOX1, and ESR1; indicated across 13 conditions including polycystic ovary syndrome and postmenopausal osteoporosis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G03XC01
- Targets: 4 (GPER1, AOX1, ESR1…)
- Indications: 13 conditions
- Clinical trials: 55
- Chemistry: 473.6 Da · C28H27NO4S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL81 |
| Name | Raloxifene |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5035 |
| ChEBI | CHEBI:8772 |
| ATC | G03XC01 |
| Molecular formula | C28H27NO4S |
| Molecular weight | 473.6 |
| InChIKey | GZUITABIAKMVPG-UHFFFAOYSA-N |
SMILES: C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=C(SC4=C3C=CC(=C4)O)C5=CC=C(C=C5)O
IUPAC name: [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone
ChEBI definition: A member of the class of 1-benzothiophenes that is 1-benzothiophene in which the hydrogens at positions 2, 3, and 6 have been replaced by p-hydroxyphenyl, p-[2-(piperidin-1-yl)ethoxy]benzoyl, and hydroxy groups, respectively.
Pharmacological roles (ChEBI): bone density conservation agent, estrogen receptor modulator, estrogen antagonist.
Also known as: Eviden, J22.982B, Keoxifene, LY-139481, NSC-747974, Raloxifene, Raloxifeno, Raloxiphene, Raxeto, raloxifene, SID11111733, SID11111734
Parent form; salt/anhydrous children: CHEMBL1116
Patent coverage: 18,759 distinct patent families (78,049 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 78,045 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GPER1 | GPER | Full agonist | 7 | 0.2% | Q99527 |
| AOX1 | aldehyde oxidase 1 | Inhibition | 7.35 | 0% | Q06278 |
| ESR1 | Estrogen receptor-α | Agonist | 9.5 | 1.7% | P03372 |
| ESR2 | Estrogen receptor-β | Antagonist | 8 | 0.2% | Q92731 |
Broader ChEMBL bioactivity targets: 76 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Microtubule-associated protein tau, Ubiquitin carboxyl-terminal hydrolase 2, Nuclear receptor ROR-gamma, Prelamin-A/C, ATP-dependent DNA helicase Q1, Thrombopoietin, Aldehyde oxidase 1, Aldehyde oxidase 1, Aldehyde oxidase 1.
Bioactivity
ChEMBL activities: 209 potent at pChembl ≥ 5 of 245 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ESR1 | 10.52 | Ki | 0.03 | nM | CHEMBL_ACT_1608726 |
| ESR1 | 9.8 | Ki | 0.16 | nM | CHEMBL_ACT_7819519 |
| ESR1 | 9.74 | IC50 | 0.18 | nM | CHEMBL_ACT_19211882 |
| ESR1 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_1054228 |
| ESR1 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_1130490 |
| ESR1 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_148589 |
| ESR1 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_433162 |
| ESR1 | 9.66 | Ki | 0.22 | nM | CHEMBL_ACT_285977 |
| ESR1 | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_3424191 |
| ESR1 | 9.47 | IC50 | 0.34 | nM | CHEMBL_ACT_1299460 |
| ESR1 | 9.43 | Ki | 0.37 | nM | CHEMBL_ACT_10939214 |
| ESR1 | 9.42 | Ki | 0.38 | nM | CHEMBL_ACT_10939228 |
| ESR1 | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_148587 |
| ESR1 | 9.37 | Ki | 0.43 | nM | CHEMBL_ACT_16450044 |
| ESR1 | 9.34 | IC50 | 0.46 | nM | CHEMBL_ACT_2551541 |
| ESR1 | 9.33 | IC50 | 0.47 | nM | CHEMBL_ACT_16588392 |
| ESR1 | 9.26 | IC50 | 0.55 | nM | CHEMBL_ACT_7819518 |
| ESR1 | 9.18 | EC50 | 0.66 | nM | CHEMBL_ACT_19211889 |
| P06211 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_1157543 |
| ESR1 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_519293 |
| ESR1 | 9.14 | IC50 | 0.73 | nM | CHEMBL_ACT_1425879 |
| ESR1 | 9.14 | IC50 | 0.72 | nM | CHEMBL_ACT_993613 |
| ESR1 | 9.13 | IC50 | 0.74 | nM | CHEMBL_ACT_24751371 |
| ESR1 | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_1437052 |
| ESR2 | 9.1 | AC50 | 0.8 | nM | CHEMBL_ACT_25175286 |
| AOX1 | 9.06 | Ki | 0.87 | nM | CHEMBL_ACT_15459136 |
| AOX1 | 9.06 | Ki | 0.87 | nM | CHEMBL_ACT_24342107 |
| AOX1 | 9.06 | Ki | 0.87 | nM | CHEMBL_ACT_24342108 |
| AOX1 | 9.06 | Ki | 0.87 | nM | CHEMBL_ACT_24342109 |
| ESR1 | 9.05 | IC50 | 0.89 | nM | CHEMBL_ACT_1523959 |
Target pathways
Aggregated over 4 target gene(s): GPER1, AOX1, ESR1, ESR2.
Top Reactome pathways
24 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 2 | ESR1, ESR2 |
| Constitutive Signaling by Aberrant PI3K in Cancer | 2 | ESR1, ESR2 |
| Nuclear Receptor transcription pathway | 2 | ESR1, ESR2 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 2 | ESR1, ESR2 |
| ESR-mediated signaling | 2 | ESR1, ESR2 |
| Extra-nuclear estrogen signaling | 2 | ESR1, ESR2 |
| Nuclear signaling by ERBB4 | 1 | ESR1 |
| Metabolism | 1 | AOX1 |
| Metabolism of water-soluble vitamins and cofactors | 1 | AOX1 |
| Metabolism of vitamins and cofactors | 1 | AOX1 |
| Peptide ligand-binding receptors | 1 | GPER1 |
| SUMOylation of intracellular receptors | 1 | ESR1 |
| G alpha (i) signalling events | 1 | GPER1 |
| Ovarian tumor domain proteases | 1 | ESR1 |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | ESR1 |
| RUNX1 regulates estrogen receptor mediated transcription | 1 | ESR1 |
| RUNX1 regulates transcription of genes involved in WNT signaling | 1 | ESR1 |
| Regulation of RUNX2 expression and activity | 1 | ESR1 |
| Estrogen-dependent gene expression | 1 | ESR1 |
| GPER1 signaling | 1 | GPER1 |
| Vitamin B6 activation to pyridoxal phosphate | 1 | AOX1 |
| Mitochondrial unfolded protein response (UPRmt) | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Luminal Epithelial Cells | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Alveolar Cells | 1 | ESR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| positive regulation of transcription by RNA polymerase II | 3 |
| cellular response to estradiol stimulus | 3 |
| signal transduction | 3 |
| positive regulation of cytosolic calcium ion concentration | 2 |
| negative regulation of gene expression | 2 |
| nuclear receptor-mediated steroid hormone signaling pathway | 2 |
| steroid hormone receptor signaling pathway | 2 |
| negative regulation of transcription by RNA polymerase II | 2 |
| regulation of DNA-templated transcription | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| estrogen receptor signaling pathway | 2 |
| positive regulation of DNA-templated transcription | 2 |
| obsolete positive regulation of DNA-binding transcription factor activity | 2 |
| cellular response to oxygen-containing compound | 2 |
| positive regulation of protein phosphorylation | 1 |
Indications & clinical
Indications
13 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| polycystic ovary syndrome | 3 | MONDO:0008487 | EFO:0000660 |
| postmenopausal osteoporosis | 3 | MONDO:0008159 | EFO:0003854 |
| osteoporosis | 3 | MONDO:0005298 | EFO:0003882 |
| schizoaffective disorder | 3 | MONDO:0005487 | EFO:0005411 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| endometrium neoplasm | 2 | MONDO:0021251 | MONDO:0011962 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | EFO:0000694 |
| Alzheimer disease | 2 | MONDO:0004975 | MONDO:0004975 |
| prostate adenocarcinoma | 0 | MONDO:0005082 | EFO:0000673 |
4 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 55.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 15 |
| PHASE3 | 12 |
| Not specified | 11 |
| PHASE2 | 9 |
| PHASE1 | 5 |
| PHASE2/PHASE3 | 2 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03623633 | PHASE4 | ACTIVE_NOT_RECRUITING | Comparative Antiresorptive Efficacy Discontinuation of Denosumab |
| NCT00030147 | PHASE4 | COMPLETED | Raloxifene and Rimostil for Perimenopause-Related Depression |
| NCT00079924 | PHASE4 | COMPLETED | Effects of Teriparatide in Postmenopausal Women With Osteoporosis |
| NCT00108238 | PHASE4 | COMPLETED | Estrogen Alternatives Study |
| NCT00191425 | PHASE4 | COMPLETED | 2-Year Therapy With Teriparatide vs 1-yr Therapy Followed by 1-Year of Raloxifene or Calcium/Vit D in Severe Postmenopausal Osteoporosis |
| NCT00371956 | PHASE4 | COMPLETED | Raloxifene for Prevention of Bone Loss in Postmenopausal Patients Receiving Chronic Corticosteroid Therapy |
| NCT00431444 | PHASE4 | COMPLETED | Effects of Zoledronic Acid and Raloxifene on Bone Turnover Markers in Postmenopausal Women With Low Bone Mineral Density |
| NCT00532246 | PHASE4 | COMPLETED | Carotid Artery Intima-Media Thickness Following Exposure to Raloxifene or Placebo |
| NCT00532428 | PHASE4 | COMPLETED | Long Term Effects of Raloxifene Treatment on Bone Quality |
| NCT00790101 | PHASE4 | TERMINATED | Risedronate vs Raloxifene in Hormone Replacement Therapy Discontinuation |
| NCT01041092 | PHASE4 | COMPLETED | Double Blind, Placebo-controlled Study of Raloxifene for Negative Symptoms of Schizophrenia in Postmenopausal Women |
| NCT01166958 | PHASE4 | COMPLETED | Enhancing Osteoporosis Therapy: Can We Open the Anabolic Window? |
| NCT01535027 | PHASE4 | COMPLETED | Combined Administration of Teripapartide and Antiresorptive Agents in Postmenopausal Osteoporosis |
| NCT01544894 | PHASE4 | COMPLETED | Clinical Study of Raloxifene and Strontium Ranelate in Postmenopausal Osteoporosis |
| NCT03006003 | PHASE4 | UNKNOWN | Osteoporosis Treatment in Post-menopausal Women |
| NCT00003906 | PHASE3 | COMPLETED | Study of Tamoxifen and Raloxifene (STAR) for the Prevention of Breast Cancer in Postmenopausal Women |
| NCT00046137 | PHASE3 | COMPLETED | Combined Use of Teriparatide and Raloxifene in Postmenopausal Women With Osteoporosis |
| NCT00065767 | PHASE2/PHASE3 | COMPLETED | Cognitive and Neurophysiological Effects of Raloxifene in Alzheimer’s Disease |
| NCT00163137 | PHASE3 | COMPLETED | Comparison of Raloxifene and Lasofoxifene - A Randomized, Blinded Study of These Drugs and Placebo on Bone Loss |
| NCT00190593 | PHASE3 | COMPLETED | Raloxifene Use for The Heart |
| NCT00310531 | PHASE3 | COMPLETED | 3-year Study of Menostar Versus Evista to Prevent Osteoporosis in Post-menopausal Women |
| NCT00383422 | PHASE3 | COMPLETED | Study Comparing Arzoxifene With Raloxifene in Women After Menopause With Osteoporosis |
| NCT00427700 | PHASE3 | COMPLETED | Induction of Ovulation With Raloxifene or Clomiphene Citrate in Polycystic Ovarian Syndrome |
| NCT00675688 | PHASE3 | COMPLETED | Study Evaluating Safety and Efficacy of Bazedoxifene/Conjugated Estrogens Combinations in Postmenopausal Women |
| NCT00687102 | PHASE3 | COMPLETED | Cognition in the Study of Tamoxifen and Raloxifene |
| NCT01280305 | PHASE3 | UNKNOWN | Raloxifene in Treatment of Schizophrenia and Schizoaffective Disorder |
| NCT01573637 | PHASE3 | COMPLETED | Raloxifene as an Adjuvant Treatment of the Negative Symptoms of Schizophrenia in Post-menopausal Women |
| NCT03043820 | PHASE3 | COMPLETED | Raloxifene Augmentation in Patients With a Schizophrenia Spectrum Disorder |
| NCT05172050 | PHASE2/PHASE3 | COMPLETED | Multicenter Double Blind, Parallel-group Phase 2/3 Trial, to Study Raloxifene in Adult COVID-19 Patients. |
| NCT06944145 | PHASE2 | RECRUITING | New Treatment Strategies and Epigenetic Biomarker for Management of Benign Prostatic Hyperplasia |
| NCT07470606 | PHASE2 | NOT_YET_RECRUITING | Memantine +/- Raloxifene for Cognitive Preservation After Radiation Therapy to the Brain |
| NCT00001848 | PHASE2 | COMPLETED | The Safety and Effectiveness of Surgery With or Without Raloxifene for the Treatment of Pelvic Pain Caused by Endometriosis |
| NCT00004915 | PHASE2 | COMPLETED | Raloxifene in Treating Patients With Persistent or Recurrent Endometrial Cancer |
| NCT00019500 | PHASE2 | COMPLETED | Raloxifene in Preventing Breast Cancer in Premenopausal Women |
| NCT00149604 | PHASE2 | COMPLETED | AFTER: Altering Fat Through Estrogen and Raloxifene |
| NCT00206557 | PHASE2 | COMPLETED | The Use of Selective Estrogen Receptor Modulators in the Treatment of Schizophrenia- a Pilot Study |
| NCT00332553 | PHASE2 | COMPLETED | Study of Hot Flashes and Night Sweats in Postmenopausal Women Receiving Combination Raloxifene and Oral Estrogen |
| NCT00368459 | PHASE2 | COMPLETED | Raloxifene for Women With Alzheimer’s Disease |
| NCT02654093 | PHASE1 | COMPLETED | A Drug-drug Interaction Study of DP-R213 |
| NCT02762643 | PHASE1 | COMPLETED | DP-R213 Pharmacokinetics Study |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 6 clinical and 22 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
198 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ESTRADIOL | ChEMBL + PubChem | Phase 4 (approved) | AOX1, ESR1, ESR2, GPER1 |
| Tamoxifen | ChEMBL + PubChem | Phase 4 (approved) | AOX1, ESR1, ESR2, GPER1 |
| DIETHYLSTILBESTROL | ChEMBL + PubChem | Phase 4 (approved) | AOX1, ESR1, ESR2 |
| ETHINYL ESTRADIOL | ChEMBL + PubChem | Phase 4 (approved) | AOX1, ESR1, ESR2 |
| Fulvestrant | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2, GPER1 |
| GENISTEIN | ChEMBL + PubChem | Phase 2 (approved) | AOX1, ESR1, ESR2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| CISPLATIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ELACESTRANT | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTETROL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| PHENOLPHTHALEIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ACOLBIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AFIMOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AMCENESTRANT | ChEMBL | Phase 3 | ESR1, ESR2 |
| ARZOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| BENSERAZIDE | ChEMBL | Phase 3 | ESR1, ESR2 |
| PYRIDOXAL | ChEMBL | Phase 3 | AOX1, ESR1 |
| ALFATRADIOL | ChEMBL | Phase 2 | ESR1, ESR2 |
| AUS-131 | ChEMBL | Phase 2 | ESR1, ESR2 |
| BRILANESTRANT | ChEMBL | Phase 2 | ESR1, ESR2 |
| DAIDZEIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| ERTEBEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| GTX-758 | ChEMBL | Phase 2 | ESR1, ESR2 |
| IDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| LEVORMELOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| MOXESTROL | ChEMBL | Phase 2 | ESR1, ESR2 |
| PIPENDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| PRINABEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| STALLIMYCIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| Bosentan | PubChem | Approved | ESR1, ESR2 |
| Dihydroergotamine | PubChem | Approved | ESR1, ESR2 |
| Fidaxomicin | PubChem | Approved | ESR1, ESR2 |
| Propoxyphene | PubChem | Approved | ESR1, ESR2 |
| Pyrazinamide | PubChem | Approved | ESR1, ESR2 |
| CHLORPROMAZINE | ChEMBL + PubChem | Phase 4 (approved) | AOX1 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | AOX1 |
| DOMPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | AOX1 |
| HYDRALAZINE | ChEMBL + PubChem | Phase 4 (approved) | AOX1 |
| MENADIONE | ChEMBL + PubChem | Phase 4 (approved) | AOX1 |
| PERPHENAZINE | ChEMBL + PubChem | Phase 4 (approved) | AOX1 |
| ZALEPLON | ChEMBL + PubChem | Phase 4 (approved) | AOX1 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ESR1 |
| AMSACRINE | ChEMBL | Phase 4 (approved) | AOX1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | ESR1 |
| AZTREONAM | ChEMBL | Phase 4 (approved) | ESR1 |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | ESR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ESR1 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | ESR1 |
| BISACODYL | ChEMBL | Phase 4 (approved) | ESR1 |
Related Atlas pages
- Genes: GPER1, AOX1, ESR1, ESR2
- Diseases: polycystic ovary syndrome, postmenopausal osteoporosis, osteoporosis, schizoaffective disorder, breast neoplasm
- Drugs: Estradiol, Tamoxifen, Diethylstilbestrol, Ethinyl Estradiol, Fulvestrant, Bazedoxifene, Bithionol, Cisplatin, Elacestrant, Estetrol, Estriol, Estrone, Hexachlorophene, Lasofoxifene, Medroxyprogesterone, Mifepristone, Phenolphthalein, Spironolactone, Acolbifene, Afimoxifene, Amcenestrant, Arzoxifene, Benserazide, Pyridoxal, Bosentan, Dihydroergotamine, Fidaxomicin, Propoxyphene, Pyrazinamide, Chlorpromazine, Clozapine, Domperidone, Hydralazine, Menadione, Perphenazine, Zaleplon, Acetophenazine, Alectinib, Amsacrine, Apomorphine, Aripiprazole, Aspirin, Aztreonam, Belinostat, Benzbromarone, Bexarotene, Bisacodyl