Reminertant
drugOn this page
Also known as MeclinertantSR-48692Sr48692SID124950704Merclinertant
Summary
Reminertant (CHEMBL506981) is a phase-3 clinical-stage small molecule targeting NTSR1 and NTSR2; indicated across 3 conditions including small cell lung carcinoma and lung neoplasm.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (NTSR1, NTSR2)
- Indications: 3 conditions
- Clinical trials: 1
- Chemistry: 587.1 Da · C32H31ClN4O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL506981 |
| Name | Reminertant |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 119192 |
| Molecular formula | C32H31ClN4O5 |
| Molecular weight | 587.1 |
| InChIKey | DYLJVOXRWLXDIG-UHFFFAOYSA-N |
SMILES: COC1=C(C(=CC=C1)OC)C2=CC(=NN2C3=C4C=CC(=CC4=NC=C3)Cl)C(=O)NC5(C6CC7CC(C6)CC5C7)C(=O)O
IUPAC name: 2-[[1-(7-chloroquinolin-4-yl)-5-(2,6-dimethoxyphenyl)pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid
Also known as: Meclinertant, Reminertant, SR-48692, Sr48692, SID124950704, Merclinertant, REMINERTANT, MECLINERTANT, meclinertant
Patent coverage: 89 distinct patent families (235 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 194 (83%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NTSR1 | NTS1 receptor | Antagonist | 8.4 | 0% | P30989 |
| NTSR2 | NTS2 receptor | Full agonist | 6.4 | 0.3% | O95665 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Neurotensin receptor type 2, Neurotensin receptor type 1, Sortilin, G-protein coupled receptor 183, Neurotensin receptor type 1, Neurotensin receptor type 2, N-formyl peptide receptor 3.
Bioactivity
ChEMBL activities: 17 potent at pChembl ≥ 5 of 18 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NTSR1 | 9 | IC50 | 0.99 | nM | CHEMBL_ACT_2275331 |
| P20789 | 8.59 | Ki | 2.6 | nM | CHEMBL_ACT_13374528 |
| NTSR1 | 8.08 | Kd | 8.4 | nM | CHEMBL_ACT_2487017 |
| NTSR1 | 8.05 | Kd | 8.9 | nM | CHEMBL_ACT_2487015 |
| NTSR1 | 8.04 | Kd | 9.2 | nM | CHEMBL_ACT_2487018 |
| NTSR1 | 7.72 | Kd | 19 | nM | CHEMBL_ACT_2487016 |
| NTSR1 | 7.64 | Kd | 23 | nM | CHEMBL_ACT_2487019 |
| NTSR1 | 7.57 | Kd | 27 | nM | CHEMBL_ACT_2487021 |
| NTSR1 | 7.48 | Kd | 33 | nM | CHEMBL_ACT_2487020 |
| Q63384 | 7.21 | Ki | 62 | nM | CHEMBL_ACT_14734772 |
| NTSR1 | 7.09 | IC50 | 82 | nM | CHEMBL_ACT_15011316 |
| P20789 | 7.09 | IC50 | 82 | nM | CHEMBL_ACT_19133768 |
| Q63384 | 6.92 | EC50 | 120 | nM | CHEMBL_ACT_14734724 |
| SORT1 | 6.62 | IC50 | 238 | nM | CHEMBL_ACT_13374526 |
| NTSR2 | 6.38 | Ki | 418 | nM | CHEMBL_ACT_13374527 |
| FPR3 | 5.3 | IC50 | 4991 | nM | CHEMBL_ACT_25751158 |
| GPR183 | 5.2 | IC50 | 6269 | nM | CHEMBL_ACT_25751159 |
Target pathways
Aggregated over 2 target gene(s): NTSR1, NTSR2.
Top Reactome pathways
2 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Peptide ligand-binding receptors | 2 | NTSR1, NTSR2 |
| G alpha (q) signalling events | 2 | NTSR1, NTSR2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 2 |
| neuropeptide signaling pathway | 2 |
| signal transduction | 2 |
| temperature homeostasis | 1 |
| negative regulation of systemic arterial blood pressure | 1 |
| regulation of membrane depolarization | 1 |
| cAMP biosynthetic process | 1 |
| response to stress | 1 |
| chemical synaptic transmission | 1 |
| adult locomotory behavior | 1 |
| positive regulation of gene expression | 1 |
| positive regulation of glutamate secretion | 1 |
| positive regulation of gamma-aminobutyric acid secretion | 1 |
| response to food | 1 |
| regulation of inositol trisphosphate biosynthetic process | 1 |
Indications & clinical
Indications
3 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| small cell lung carcinoma | 2 | MONDO:0008433 | EFO:0000702 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2/PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00290953 | PHASE2/PHASE3 | COMPLETED | Evaluation of the Overall Survival of Meclinertant Versus Placebo After a First Line Chemotherapy With Cisplatin + Etoposide |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
155 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CAFFEINE | ChEMBL + PubChem | Phase 4 (approved) | NTSR1 |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | NTSR1 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | NTSR1 |
| SORAFENIB TOSYLATE | ChEMBL | Phase 4 (approved) | NTSR1 |
| TETRACAINE | ChEMBL | Phase 4 (approved) | NTSR1 |
| THIMEROSAL | ChEMBL | Phase 3 | NTSR1 |
| NORDAZEPAM | ChEMBL | Phase 2 | NTSR1 |
| Acetylcholine | PubChem | Approved | NTSR1 |
| Aclidinium Bromide | PubChem | Approved | NTSR1 |
| Acyclovir | PubChem | Approved | NTSR1 |
| Alendronic Acid | PubChem | Approved | NTSR1 |
| Allopurinol | PubChem | Approved | NTSR1 |
| Alogliptin | PubChem | Approved | NTSR1 |
| Alprazolam | PubChem | Approved | NTSR1 |
| Amiloride | PubChem | Approved | NTSR1 |
| Amitriptyline | PubChem | Approved | NTSR1 |
| Amlodipine | PubChem | Approved | NTSR1 |
| Amoxapine | PubChem | Approved | NTSR1 |
| Amoxicillin | PubChem | Approved | NTSR1 |
| Amphetamine | PubChem | Approved | NTSR1 |
| Aspirin | PubChem | Approved | NTSR1 |
| Azathioprine | PubChem | Approved | NTSR1 |
| azithromycin, unspecified form | PubChem | Approved | NTSR1 |
| Baclofen | PubChem | Approved | NTSR1 |
| Beclomethasone | PubChem | Approved | NTSR1 |
| Beclomethasone Dipropionate | PubChem | Approved | NTSR1 |
| Belzutifan | PubChem | Approved | NTSR1 |
| Bicalutamide | PubChem | Approved | NTSR1 |
| Bisoprolol | PubChem | Approved | NTSR1 |
| Bosentan | PubChem | Approved | NTSR1 |
| Bromocriptine | PubChem | Approved | NTSR1 |
| Bumetanide | PubChem | Approved | NTSR1 |
| Bupropion | PubChem | Approved | NTSR1 |
| Candesartan | PubChem | Approved | NTSR1 |
| Candesartan Cilexetil | PubChem | Approved | NTSR1 |
| Carisoprodol | PubChem | Approved | NTSR1 |
| Carvedilol | PubChem | Approved | NTSR1 |
| Celecoxib | PubChem | Approved | NTSR1 |
| cephalexin | PubChem | Approved | NTSR1 |
| Cetirizine | PubChem | Approved | NTSR1 |
| chlorpheniramine | PubChem | Approved | NTSR1 |
| Chlorpromazine | PubChem | Approved | NTSR1 |
| Cimetidine | PubChem | Approved | NTSR1 |
| Ciprofloxacin | PubChem | Approved | NTSR1 |
| Citalopram | PubChem | Approved | NTSR1 |
| Clindamycin | PubChem | Approved | NTSR1 |
| Clonazepam | PubChem | Approved | NTSR1 |
| Clonidine | PubChem | Approved | NTSR1 |
| Clotrimazole | PubChem | Approved | NTSR1 |
| Clozapine | PubChem | Approved | NTSR1 |
| Cyclobenzaprine | PubChem | Approved | NTSR1 |
| Desloratadine | PubChem | Approved | NTSR1 |
| dexamethasone | PubChem | Approved | NTSR1 |
| Diazepam | PubChem | Approved | NTSR1 |
| Diclofenac | PubChem | Approved | NTSR1 |
| Diethylstilbestrol | PubChem | Approved | NTSR1 |
| Dihydroergotamine | PubChem | Approved | NTSR1 |
| Diltiazem | PubChem | Approved | NTSR1 |
| Diphenhydramine | PubChem | Approved | NTSR1 |
| Dipyridamole | PubChem | Approved | NTSR1 |
Related Atlas pages
- Genes: NTSR1, NTSR2
- Drugs: Caffeine, Dextrothyroxine, Nilotinib, Sorafenib Tosylate, Tetracaine, Thimerosal, Acetylcholine, Aclidinium Bromide, Acyclovir, Alendronic Acid, Allopurinol, Alogliptin, Alprazolam, Amiloride, Amitriptyline, Amlodipine, Amoxapine, Amoxicillin, Amphetamine, Aspirin, Azathioprine, Baclofen, Beclomethasone, Belzutifan, Bicalutamide, Bisoprolol, Bosentan, Bromocriptine, Bumetanide, Bupropion, Candesartan, Candesartan Cilexetil, Carisoprodol, Carvedilol, Celecoxib, cephalexin, Cetirizine, chlorpheniramine, Chlorpromazine, Cimetidine, Ciprofloxacin, Citalopram, Clindamycin, Clonazepam, Clonidine, Clotrimazole, Clozapine, Cyclobenzaprine, Desloratadine, dexamethasone, Diazepam, Diclofenac, Diethylstilbestrol, Dihydroergotamine, Diltiazem, Diphenhydramine, Dipyridamole