Resatorvid
drugOn this page
Also known as Cli-095Tak-242TAK-242 S enantiomer
Summary
Resatorvid (CHEMBL225157) is a phase-3 clinical-stage small molecule targeting TLR4; indicated across 2 conditions.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (TLR4)
- Indications: 2 conditions
- Clinical trials: 4
- Chemistry: 361.8 Da · C15H17ClFNO4S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL225157 |
| Name | Resatorvid |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 11703255 |
| Molecular formula | C15H17ClFNO4S |
| Molecular weight | 361.8 |
| InChIKey | LEEIJTHMHDMWLJ-CQSZACIVSA-N |
SMILES: CCOC(=O)C1=CCCC[C@H]1S(=O)(=O)NC2=C(C=C(C=C2)F)Cl
IUPAC name: ethyl (6R)-6-[(2-chloro-4-fluorophenyl)sulfamoyl]cyclohexene-1-carboxylate
Also known as: Cli-095, Resatorvid, Tak-242, RESATORVID, TAK-242 S enantiomer
Parent form; salt/anhydrous children: CHEMBL3527013
Patent coverage: 215 distinct patent families (420 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 412 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| TLR4 | TLR4 | Antagonist | 0% | O00206 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: Toll-like receptor 4, Toll-like receptor 4.
Bioactivity
ChEMBL activities: 7 potent at pChembl ≥ 5 of 7 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| Q9QUK6 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_25535230 |
| Q9QUK6 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_25535228 |
| Q9QUK6 | 8.72 | IC50 | 1.9 | nM | CHEMBL_ACT_25535229 |
| Q9QUK6 | 8.24 | IC50 | 5.7 | nM | CHEMBL_ACT_16519811 |
| TLR4 | 7.33 | IC50 | 47 | nM | CHEMBL_ACT_29127063 |
| TLR4 | 7.22 | IC50 | 60 | nM | CHEMBL_ACT_29127085 |
| TLR4 | 6.17 | IC50 | 680 | nM | CHEMBL_ACT_18571503 |
Target pathways
Aggregated over 1 target gene(s): TLR4.
Top Reactome pathways
18 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| ER-Phagosome pathway | 1 | TLR4 |
| Caspase activation via Death Receptors in the presence of ligand | 1 | TLR4 |
| Toll Like Receptor 4 (TLR4) Cascade | 1 | TLR4 |
| MyD88:MAL(TIRAP) cascade initiated on plasma membrane | 1 | TLR4 |
| MyD88-independent TLR4 cascade | 1 | TLR4 |
| TRIF-mediated programmed cell death | 1 | TLR4 |
| MyD88 deficiency (TLR2/4) | 1 | TLR4 |
| IRAK4 deficiency (TLR2/4) | 1 | TLR4 |
| Regulation of TLR by endogenous ligand | 1 | TLR4 |
| Activation of IRF3, IRF7 mediated by TBK1, IKKε (IKBKE) | 1 | TLR4 |
| IKK complex recruitment mediated by RIP1 | 1 | TLR4 |
| TRAF6-mediated induction of TAK1 complex within TLR4 complex | 1 | TLR4 |
| Heme signaling | 1 | TLR4 |
| IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation | 1 | TLR4 |
| Respiratory syncytial virus (RSV) attachment and entry | 1 | TLR4 |
| Regulation of TBK1, IKKε (IKBKE)-mediated activation of IRF3, IRF7 | 1 | TLR4 |
| RSV-host interactions | 1 | TLR4 |
| Dengue Virus-Host Interactions | 1 | TLR4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| toll-like receptor signaling pathway | 1 |
| wound healing involved in inflammatory response | 1 |
| B cell proliferation involved in immune response | 1 |
| nitric oxide production involved in inflammatory response | 1 |
| regulation of dendritic cell cytokine production | 1 |
| MyD88-dependent toll-like receptor signaling pathway | 1 |
| growth plate cartilage morphogenesis | 1 |
| nitric oxide biosynthetic process | 1 |
| phagocytosis | 1 |
| inflammatory response | 1 |
| immune response | 1 |
| JNK cascade | 1 |
| gene expression | 1 |
| positive regulation of platelet activation | 1 |
| positive regulation of gene expression | 1 |
Indications & clinical
Indications
2 indications (0 at ChEMBL trial phase 4).
The 2 indication records carry no mapped disease name (EFO/MeSH-only); none shown.
Clinical trials
Total trials: 4.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE2 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00143611 | PHASE3 | COMPLETED | Efficacy & Safety of Resatorvid in Adults With Severe Sepsis |
| NCT00633477 | PHASE3 | TERMINATED | Efficacy and Safety of Resatorvid in Patients With Sepsis-induced Cardiovascular and Respiratory Failure |
| NCT06890039 | PHASE2 | NOT_YET_RECRUITING | A-TANGO Phase 2 Study |
| NCT04620148 | PHASE2 | UNKNOWN | TAK-242 in Patients With Acute Alcoholic Hepatitis |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
5 molecules share ≥1 primary target. Top 5 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CARVEDILOL | ChEMBL + PubChem | Phase 4 (approved) | TLR4 |
| METHOTREXATE | ChEMBL + PubChem | Phase 4 (approved) | TLR4 |
| POLYMYXIN B | ChEMBL | Phase 4 (approved) | TLR4 |
| ERITORAN | ChEMBL | Phase 3 | TLR4 |
| ERITORAN TETRASODIUM | ChEMBL | Phase 3 | TLR4 |
Related Atlas pages
- Genes: TLR4
- Drugs: Carvedilol, Methotrexate, Polymyxin B, Eritoran