Resveratrol
drugOn this page
Also known as (e)-resveratrol3,5,4'-trihydroxy-trans-stilbeneBiofortCa 1201CuspidatinJotrolMelinjo resveratrol 20NSC-327430PolygoninResveratrol p 5Resveratrol(e)-formResvidaSrt 501mTrans-resveratrol4,3',5'-trihydroxystilbeneresveratrotrans-3,5,4'-trihydroxystilbene3',4,5'-trihydroxystilbene3,5,4'-trans-trihydroxystibene
Summary
Resveratrol (CHEMBL165) is an approved small-molecule quorum sensing inhibitor targeting PTGS2, PPARG, and TAS2R14; indicated across 39 conditions including metabolic syndrome x and chronic obstructive pulmonary disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 3 (PTGS2, PPARG, TAS2R14)
- Indications: 39 conditions
- Clinical trials: 139
- Chemistry: 228.24 Da · C14H12O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL165 |
| Name | Resveratrol |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | yes |
| PubChem CID | 445154 |
| ChEBI | CHEBI:45713 |
| Molecular formula | C14H12O3 |
| Molecular weight | 228.24 |
| InChIKey | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
SMILES: C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O)O)O
IUPAC name: 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol
ChEBI definition: A resveratrol in which the double bond has E configuration.
Pharmacological roles (ChEBI): antioxidant, phytoalexin, radical scavenger, quorum sensing inhibitor.
Other ChEBI roles (chemical / environmental): plant metabolite.
Also known as: (e)-resveratrol, 3,5,4’-trihydroxy-trans-stilbene, Biofort, Ca 1201, Cuspidatin, Jotrol, Melinjo resveratrol 20, NSC-327430, Polygonin, Resveratrol, Resveratrol p 5, Resveratrol(e)-form
Patent coverage: 25,199 distinct patent families (60,144 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PTGS2 | COX-2 | Inhibition | 6.12 | 0% | P35354 |
| PPARG | Peroxisome proliferator-activated receptor-γ | Antagonist | 5.85 | 2.6% | P37231 |
| TAS2R14 | TAS2R14 | Agonist | 4.52 | 0.1% | Q9NYV8 |
Broader ChEMBL bioactivity targets: 91 (assay-derived). Sample: Nuclear factor erythroid 2-related factor 2, Myc proto-oncogene protein, Microtubule-associated protein tau, Lysine-specific demethylase 4E, Nuclear receptor ROR-gamma, Survival motor neuron protein, Prelamin-A/C, RecQ-like DNA helicase BLM, Inositol monophosphatase 1, 15-hydroxyprostaglandin dehydrogenase [NAD(+)].
Bioactivity
ChEMBL activities: 119 potent at pChembl ≥ 5 of 233 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DPP4 | 9.22 | IC50 | 0.6 | nM | CHEMBL_ACT_18662268 |
| LMNA | 8.3 | Potency | 5 | nM | CHEMBL_ACT_3628175 |
| NQO2 | 7.27 | Kd | 54 | nM | CHEMBL_ACT_13446519 |
| P08659 | 7.23 | IC50 | 58.88 | nM | CHEMBL_ACT_12665974 |
| NQO2 | 7.06 | Ki | 88 | nM | CHEMBL_ACT_13446567 |
| O02747 | 6.77 | Ki | 169 | nM | CHEMBL_ACT_1419643 |
| CYP1A1 | 6.64 | IC50 | 230 | nM | CHEMBL_ACT_25005360 |
| PIK3CA | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_14553315 |
| P05979 | 6.42 | IC50 | 380 | nM | CHEMBL_ACT_1759901 |
| NQO2 | 6.35 | IC50 | 450 | nM | CHEMBL_ACT_3110609 |
| NQO2 | 6.35 | IC50 | 450 | nM | CHEMBL_ACT_3274536 |
| MAOA | 6.35 | IC50 | 449 | nM | CHEMBL_ACT_7806805 |
| TTR | 6.33 | Kd | 470 | nM | CHEMBL_ACT_18091496 |
| PIK3CB | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_14553320 |
| P05979 | 6.27 | IC50 | 535 | nM | CHEMBL_ACT_16465904 |
| P05979 | 6.27 | IC50 | 535 | nM | CHEMBL_ACT_1888137 |
| CYP3A4 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_7804732 |
| PTGS1 | 6.2 | IC50 | 625 | nM | CHEMBL_ACT_7804716 |
| Q6RI86 | 6.12 | IC50 | 750 | nM | CHEMBL_ACT_16433392 |
| TRPA1 | 6.12 | IC50 | 750 | nM | CHEMBL_ACT_18105526 |
| CYP1B1 | 6.12 | Ki | 750 | nM | CHEMBL_ACT_18948702 |
| PTGS2 | 6.12 | IC50 | 750 | nM | CHEMBL_ACT_3362248 |
| ESR1 | 6.11 | Ki | 785 | nM | CHEMBL_ACT_1419644 |
| CYP1B1 | 6.1 | Ki | 800 | nM | CHEMBL_ACT_18157527 |
| NQO2 | 6.1 | IC50 | 790 | nM | CHEMBL_ACT_29197581 |
| CA9 | 6.09 | Ki | 810 | nM | CHEMBL_ACT_3426903 |
| PTGS1 | 6.08 | IC50 | 830 | nM | CHEMBL_ACT_2507715 |
| CA14 | 6.08 | Ki | 830 | nM | CHEMBL_ACT_3426924 |
| NQO2 | 6.05 | IC50 | 900 | nM | CHEMBL_ACT_19082051 |
| NQO2 | 6.04 | IC50 | 913 | nM | CHEMBL_ACT_16492598 |
Target pathways
Aggregated over 3 target gene(s): PTGS2, PPARG, TAS2R14.
Top Reactome pathways
25 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | TAS2R14 |
| PPARA activates gene expression | 1 | PPARG |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 1 | PTGS2 |
| Signaling by GPCR | 1 | TAS2R14 |
| Transcriptional regulation of white adipocyte differentiation | 1 | PPARG |
| Nuclear Receptor transcription pathway | 1 | PPARG |
| GPCR downstream signalling | 1 | TAS2R14 |
| SUMOylation of intracellular receptors | 1 | PPARG |
| G alpha (i) signalling events | 1 | TAS2R14 |
| Class C/3 (Metabotropic glutamate/pheromone receptors) | 1 | TAS2R14 |
| GPCR ligand binding | 1 | TAS2R14 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Regulation of PTEN gene transcription | 1 | PPARG |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| MECP2 regulates transcription factors | 1 | PPARG |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
| Sensory Perception | 1 | TAS2R14 |
| Sensory perception of taste | 1 | TAS2R14 |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 1 | TAS2R14 |
| MLL4 and MLL3 complexes regulate expression of PPARG target genes in adipogenesis and hepatic steatosis | 1 | PPARG |
| Transcriptional regulation of brown and beige adipocyte differentiation by EBF2 | 1 | PPARG |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of blood pressure | 2 |
| brown fat cell differentiation | 2 |
| cellular response to hypoxia | 2 |
| fatty acid metabolic process | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| prostaglandin biosynthetic process | 1 |
| response to oxidative stress | 1 |
| embryo implantation | 1 |
| response to nematode | 1 |
| response to selenium ion | 1 |
| positive regulation of vascular endothelial growth factor production | 1 |
| cyclooxygenase pathway | 1 |
| lipoxygenase pathway | 1 |
| positive regulation of prostaglandin biosynthetic process | 1 |
| positive regulation of fever generation | 1 |
Indications & clinical
Indications
39 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| metabolic syndrome X | 3 | MONDO:0011565 | EFO:0000195 |
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| dilated cardiomyopathy | 3 | MONDO:0005021 | EFO:0000407 |
| infertility disorder | 3 | MONDO:0005047 | EFO:0000545 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| seasonal allergic rhinitis | 3 | MONDO:0005324 | EFO:0003956 |
| peripheral arterial disease | 3 | MONDO:0005386 | EFO:0004265 |
| Huntington disease | 3 | MONDO:0007739 | MONDO:0007739 |
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| paraplegia | 2 | MONDO:0003757 | HP:0001258 |
| metabolic dysfunction-associated steatotic liver disease | 2 | MONDO:0013209 | EFO:0003095 |
| follicular lymphoma | 2 | MONDO:0018906 | MONDO:0018906 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | EFO:0000694 |
| polycystic ovary syndrome | 2 | MONDO:0008487 | EFO:0000660 |
| age-related macular degeneration | 2 | MONDO:0005150 | EFO:0001365 |
| Alzheimer disease | 2 | MONDO:0004975 | MONDO:0004975 |
| type 2 diabetes mellitus | 2 | MONDO:0005148 | MONDO:0005148 |
| lymphangioleiomyomatosis | 2 | MONDO:0011705 | MONDO:0011705 |
| Friedreich ataxia | 2 | MONDO:0100339 | MONDO:0100339 |
| diabetic neuropathy | 2 | MONDO:0006626 | EFO:1000783 |
| cardiovascular disorder | 1 | MONDO:0004995 | EFO:0000319 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| colorectal adenocarcinoma | 1 | MONDO:0005008 | EFO:0000365 |
| hypertensive disorder | 1 | MONDO:0005044 | EFO:0000537 |
| rectal cancer | 1 | MONDO:0006519 | EFO:1000657 |
| colonic neoplasm | 1 | MONDO:0005401 | MONDO:0021063 |
| Parkinson disease | 1 | MONDO:0005180 | MONDO:0005180 |
| diabetic kidney disease | 0 | MONDO:0005016 | EFO:0000401 |
| type 1 diabetes mellitus | 0 | MONDO:0005147 | MONDO:0005147 |
| cystic fibrosis | 0 | MONDO:0009061 | MONDO:0009061 |
9 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 139.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 76 |
| PHASE2 | 23 |
| PHASE1 | 13 |
| PHASE3 | 10 |
| PHASE1/PHASE2 | 5 |
| PHASE4 | 4 |
| PHASE2/PHASE3 | 4 |
| EARLY_PHASE1 | 4 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01997762 | PHASE4 | UNKNOWN | Can Resveratrol Improve Insulin Sensitivity and Preserve Beta Cell Function Following Gestational Diabetes? |
| NCT02475564 | PHASE4 | COMPLETED | Resveratrol for Pain Due to Endometriosis |
| NCT02947932 | PHASE4 | UNKNOWN | Oral Resveratrol to Prevent Post-ERCP Pancreatitis |
| NCT03384329 | PHASE4 | COMPLETED | Efficacy of Resveratrol in Depression |
| NCT06882564 | PHASE3 | RECRUITING | Efficacy of Resveratrol Containing Mouthwash in Reducing Halitosis Related Porphyrymonas Gingivalis. |
| NCT00996229 | PHASE3 | UNKNOWN | Effects of Dietary Interventions on the Aging Brain |
| NCT01219244 | PHASE2/PHASE3 | COMPLETED | Effects of Dietary Interventions on the Brain in Mild Cognitive Impairment (MCI) |
| NCT01492114 | PHASE3 | COMPLETED | Anti-inflammatory and Antioxidant Effects of Resveratrol on Healthy Adults. |
| NCT01914081 | PHASE3 | UNKNOWN | Resveratrol: A Potential Anti- Remodeling Agent in Heart Failure, From Bench to Bedside |
| NCT02030977 | PHASE2/PHASE3 | COMPLETED | The Effects of Resveratrol Supplement on Biochemical Factors and Hepatic Fibrosis in Patients With Nonalcoholic Steatohepatitis |
| NCT02216552 | PHASE2/PHASE3 | COMPLETED | Resveratrol for the Treatment of Non Alcoholic Fatty Liver Disease and Insulin Resistance in Overweight Adolescents |
| NCT02244879 | PHASE3 | COMPLETED | Effects of Resveratrol on Inflammation in Type 2 Diabetic Patients |
| NCT02433925 | PHASE3 | COMPLETED | Resveratrol’s Effects on Inflammation and Oxidative Stress in Chronic Kidney Disease |
| NCT02905799 | PHASE3 | COMPLETED | Resveratrol in Knee Osteoarthritis |
| NCT03446625 | PHASE3 | COMPLETED | Resveratrol as a Preventive Treatment of OHSS |
| NCT03683108 | PHASE3 | COMPLETED | Efficacy and Safety of Resveratrol and Carbossimetyl Beta Glucan in Treatment of Upper Airways Disease in Infancy |
| NCT03743636 | PHASE3 | COMPLETED | Nicotinamide Riboside With and Without Resveratrol to Improve Functioning in Peripheral Artery Disease |
| NCT07332819 | PHASE2/PHASE3 | COMPLETED | Resveratol in Diabetic Nephropathy |
| NCT07592767 | PHASE2 | NOT_YET_RECRUITING | RESvEraTrol in Parkinson’s Disease (RESET) |
| NCT00654667 | PHASE2 | WITHDRAWN | Mechanisms of Metabolic Regulation of Resveratrol on Humans With Metabolic Syndrome |
| NCT01321151 | PHASE1/PHASE2 | COMPLETED | Use of Resveratrol to Decrease Acute Secondary Brain Injury Following Sports-Related Concussions in Boxers |
| NCT01339884 | PHASE1/PHASE2 | COMPLETED | A Study of Resveratrol as Treatment for Friedreich Ataxia |
| NCT01354977 | PHASE2 | COMPLETED | Effect of Resveratrol on Age-related Insulin Resistance and Inflammation in Humans |
| NCT01451918 | PHASE2 | COMPLETED | Regulation of Intestinal and Hepatic Lipoprotein Secretion by Resveratrol |
| NCT01504854 | PHASE2 | COMPLETED | Resveratrol for Alzheimer’s Disease |
| NCT01564381 | PHASE1/PHASE2 | COMPLETED | Effects of Resveratrol Supplements on Vascular Health in Postmenopausal Women |
| NCT01615445 | PHASE2 | COMPLETED | Resveratrol Supplementation on Exercise in Healthy Sedentary Adults |
| NCT01842399 | PHASE1/PHASE2 | TERMINATED | Resveratrol and Cardiovascular Health in the Elderly |
| NCT02062190 | PHASE2 | COMPLETED | Resveratrol, Cardiovascular Risk Markers And Cognitive Performance In Patients With Schizophrenia |
| NCT02114892 | PHASE2 | COMPLETED | Effect of Resveratrol Administration on Metabolic Syndrome, Insulin Sensitivity and Insulin Secretion |
| NCT02123121 | PHASE2 | COMPLETED | Resveratrol to Enhance Vitality and Vigor in Elders |
| NCT02247596 | PHASE2 | COMPLETED | Effects of High-Dose Resveratrol in Non-Diabetic Obese Males |
| NCT02261844 | PHASE1/PHASE2 | WITHDRAWN | Resveratrol and Human Hepatocyte Function in Cancer |
| NCT02314208 | PHASE2 | COMPLETED | Therapeutic Metabolic Intervention in Patients With Spastic Paraplegia SPG5 |
| NCT02409537 | PHASE2 | COMPLETED | Effects of Dietary Antioxidants to Prevent Cardiovascular Disease |
| NCT02523274 | PHASE2 | COMPLETED | Resveratrol and Exercise to Treat Functional Limitations in Late Life |
| NCT02549924 | PHASE2 | TERMINATED | Effect of Administration of Resveratrol on Glycemic Variability in Individuals With Type 2 Diabetes Mellitus |
| NCT03253913 | PHASE2 | COMPLETED | Resveratrol and Sirolimus in Lymphangioleiomyomatosis Trial |
| NCT03525379 | PHASE2 | COMPLETED | Evaluating the Clinical Efficacy of Resveratrol in Improving Metabolic and Skeletal Muscle Function in Patients With Heart Failure |
| NCT03665740 | PHASE2 | UNKNOWN | Multimodal Investigation of the Neuroprotective Effects of Resveratrol (MINER) |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
268 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Fulvestrant | ChEMBL + PubChem | Phase 4 (approved) | PPARG, PTGS2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| LEVOTHYROXINE | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| SULINDAC | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| QUERCETIN | ChEMBL | Phase 3 | PPARG, PTGS2 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | PTGS2, TAS2R14 |
| Afatinib | PubChem | Approved | PPARG, PTGS2 |
| Apixaban | PubChem | Approved | PPARG, PTGS2 |
| Binimetinib | PubChem | Approved | PPARG, PTGS2 |
| chenodiol | PubChem | Approved | PPARG, PTGS2 |
| Imipenem | PubChem | Approved | PPARG, PTGS2 |
| FIDAXOMICIN | ChEMBL + PubChem | Phase 4 (approved) | PTGS2 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS2 |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | PTGS2 |
| ACALABRUTINIB | ChEMBL | Phase 4 (approved) | PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS2 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | PTGS2 |
| ACETYLCYSTEINE | ChEMBL | Phase 4 (approved) | PTGS2 |
| ACRIVASTINE | ChEMBL | Phase 4 (approved) | PTGS2 |
| AMODIAQUINE | ChEMBL | Phase 4 (approved) | PTGS2 |
| AMPHOTERICIN B | ChEMBL | Phase 4 (approved) | PTGS2 |
| AMSACRINE | ChEMBL | Phase 4 (approved) | PTGS2 |
| ANISINDIONE | ChEMBL | Phase 4 (approved) | PTGS2 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | PTGS2 |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | PTGS2 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | PPARG |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | PTGS2 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | PTGS2 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | PPARG |
| BIPERIDEN | ChEMBL | Phase 4 (approved) | PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS2 |
| CALCIPOTRIENE | ChEMBL | Phase 4 (approved) | PTGS2 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS2 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | PPARG |
| CEFAMANDOLE | ChEMBL | Phase 4 (approved) | PPARG |
| CEFAZOLIN | ChEMBL | Phase 4 (approved) | PTGS2 |
| CEFOTAXIME | ChEMBL | Phase 4 (approved) | PPARG |
| CEFOXITIN | ChEMBL | Phase 4 (approved) | PPARG |
| CEFTAZIDIME | ChEMBL | Phase 4 (approved) | PPARG |
| CEFTIZOXIME | ChEMBL | Phase 4 (approved) | PTGS2 |
| CEFTRIAXONE | ChEMBL | Phase 4 (approved) | PPARG |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS2 |
| CEPHRADINE | ChEMBL | Phase 4 (approved) | PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS2 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | PPARG |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | PTGS2 |
| CRIZOTINIB | ChEMBL | Phase 4 (approved) | PTGS2 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | PTGS2 |
Related Atlas pages
- Genes: PTGS2, PPARG, TAS2R14
- Diseases: metabolic syndrome X, chronic obstructive pulmonary disease, dilated cardiomyopathy, infertility disorder, chronic kidney disease, seasonal allergic rhinitis, peripheral arterial disease, Huntington disease, osteoarthritis, knee
- Drugs: Fulvestrant, Candesartan Cilexetil, Cannabidiol, Indomethacin, Lasofoxifene, Levothyroxine, Lumiracoxib, Masoprocol, Sulindac, Tipranavir, Troglitazone, Quercetin, Afatinib, Apixaban, Binimetinib, chenodiol, Imipenem, Fidaxomicin, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Abemaciclib, Acalabrutinib, Acemetacin, Acetophenazine, Acetylcysteine, Acrivastine, Amodiaquine, Amphotericin B, Amsacrine, Anisindione, Apomorphine, Arformoterol, Aspirin, Bazedoxifene, Benzbromarone, Benzquinamide, Bepridil, Bexarotene, Biperiden, Bromfenac, Calcipotriene, Calcitriol, Capsaicin, Captopril, Carprofen, Carvedilol, Cefamandole, Cefazolin, Cefotaxime, Cefoxitin, Ceftazidime, Ceftizoxime, Ceftriaxone, Celecoxib, Cephradine, Cianidanol, Clobetasol Propionate, Clotrimazole, Crizotinib, Daunorubicin