Ribociclib
drugOn this page
Also known as Lee-011LEE-011ALEE011LEE011ANVP-LEE011US8962630, 74RibocicilibRIBOCICLIB (LEE011)RibociclibKisqali
Summary
Ribociclib (CHEMBL3545110) is an approved small molecule targeting CDK4; indicated across 36 conditions including breast carcinoma and breast neoplasm; with CIViC clinical evidence for 10 variant-indication associations (e.g. CCND1 Amplification in cancer).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 1 (CDK4)
- Indications: 36 conditions
- Clinical trials: 165
- Precision-oncology evidence (CIViC): 10 variant–indication associations
- Chemistry: 434.5 Da · C23H30N8O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL3545110 |
| Name | Ribociclib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 44631912 |
| Molecular formula | C23H30N8O |
| Molecular weight | 434.5 |
| InChIKey | RHXHGRAEPCAFML-UHFFFAOYSA-N |
SMILES: CN(C)C(=O)C1=CC2=CN=C(N=C2N1C3CCCC3)NC4=NC=C(C=C4)N5CCNCC5
IUPAC name: 7-cyclopentyl-N,N-dimethyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide
Also known as: Lee-011, LEE-011, LEE-011A, LEE011, LEE011A, NVP-LEE011, Ribociclib, RIBOCICLIB, US8962630, 74, Ribocicilib, RIBOCICLIB (LEE011), Ribociclib; Kisqali
Parent form; salt/anhydrous children: CHEMBL3707266, CHEMBL4468983
Patent coverage: 3,338 distinct patent families (8,018 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 7,689 (96%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CDK4 | cyclin dependent kinase 4 | Inhibition | 8 | 58% | P11802 |
Broader ChEMBL bioactivity targets: 19 (assay-derived). Sample: Cyclin-dependent kinase 4/cyclin D1, CDK9/cyclin T1, CDK6/cyclin D3, CDK6/cyclin D1, Cyclin-dependent kinase 6, Calcium/calmodulin-dependent protein kinase type II subunit delta, Cyclin-dependent kinase 2, CDK2/Cyclin A2, CDK4/Cyclin D3, Cyclin-dependent kinase 9.
Bioactivity
ChEMBL activities: 51 potent at pChembl ≥ 5 of 56 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CDK4 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_18784863 |
| CDK4 | 8.67 | IC50 | 2.14 | nM | CHEMBL_ACT_27913460 |
| CDK6 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_18784867 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_15678965 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_17669115 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_19027213 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_19027230 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_24862060 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_24954270 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_24984405 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_26023244 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_26214034 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_29144566 |
| CDK4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_29252813 |
| CDK6 | 7.91 | IC50 | 12.23 | nM | CHEMBL_ACT_29310543 |
| CDK4 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_18112224 |
| CDK4 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_18260674 |
| CDK4 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_19144125 |
| CCND1 | 7.71 | IC50 | 19.5 | nM | CHEMBL_ACT_22443526 |
| CDK4 | 7.65 | IC50 | 22.5 | nM | CHEMBL_ACT_22443557 |
| CDK4 | 7.63 | IC50 | 23.62 | nM | CHEMBL_ACT_29310545 |
| CDK6 | 7.57 | IC50 | 26.9 | nM | CHEMBL_ACT_27913463 |
| CCND3 | 7.55 | IC50 | 28 | nM | CHEMBL_ACT_18693873 |
| CDK4 | 7.54 | IC50 | 29 | nM | CHEMBL_ACT_22912954 |
| CDK4 | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_18870878 |
| CDK4 | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_22930719 |
| CDK6 | 7.41 | IC50 | 39 | nM | CHEMBL_ACT_15678966 |
| CDK6 | 7.41 | IC50 | 39 | nM | CHEMBL_ACT_19027219 |
| CDK6 | 7.41 | IC50 | 39 | nM | CHEMBL_ACT_24862062 |
| CDK6 | 7.41 | IC50 | 39 | nM | CHEMBL_ACT_24954271 |
Target pathways
Aggregated over 1 target gene(s): CDK4.
Top Reactome pathways
50 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Developmental Biology | 1 | CDK4 |
| Reproduction | 1 | CDK4 |
| Meiosis | 1 | CDK4 |
| Signal Transduction | 1 | CDK4 |
| Cell Cycle | 1 | CDK4 |
| Disease | 1 | CDK4 |
| SCF(Skp2)-mediated degradation of p27/p21 | 1 | CDK4 |
| Generic Transcription Pathway | 1 | CDK4 |
| Cellular responses to stress | 1 | CDK4 |
| Oxidative Stress Induced Senescence | 1 | CDK4 |
| Senescence-Associated Secretory Phenotype (SASP) | 1 | CDK4 |
| Cellular Senescence | 1 | CDK4 |
| Oncogene Induced Senescence | 1 | CDK4 |
| RMTs methylate histone arginines | 1 | CDK4 |
| Chromatin modifying enzymes | 1 | CDK4 |
| Transcriptional regulation of white adipocyte differentiation | 1 | CDK4 |
| Mitotic G1 phase and G1/S transition | 1 | CDK4 |
| Chromatin organization | 1 | CDK4 |
| Cyclin E associated events during G1/S transition | 1 | CDK4 |
| G1/S Transition | 1 | CDK4 |
| Cyclin D associated events in G1 | 1 | CDK4 |
| G1 Phase | 1 | CDK4 |
| S Phase | 1 | CDK4 |
| Cell Cycle, Mitotic | 1 | CDK4 |
| Cyclin A:Cdk2-associated events at S phase entry | 1 | CDK4 |
| RNA Polymerase II Transcription | 1 | CDK4 |
| Gene expression (Transcription) | 1 | CDK4 |
| Ubiquitin-dependent degradation of Cyclin D | 1 | CDK4 |
| Signaling by PTK6 | 1 | CDK4 |
| PTK6 Regulates Cell Cycle | 1 | CDK4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G1/S transition of mitotic cell cycle | 1 |
| signal transduction | 1 |
| positive regulation of cell population proliferation | 1 |
| response to xenobiotic stimulus | 1 |
| regulation of G2/M transition of mitotic cell cycle | 1 |
| regulation of gene expression | 1 |
| positive regulation of G2/M transition of mitotic cell cycle | 1 |
| positive regulation of fibroblast proliferation | 1 |
| cell division | 1 |
| regulation of cell cycle | 1 |
| regulation of transcription initiation by RNA polymerase II | 1 |
| regulation of type B pancreatic cell proliferation | 1 |
| cellular response to lipopolysaccharide | 1 |
| cellular response to interleukin-4 | 1 |
| cellular response to phorbol 13-acetate 12-myristate | 1 |
Indications & clinical
Indications
36 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| breast carcinoma | 3 | MONDO:0004989 | EFO:0000305 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| liposarcoma | 2 | MONDO:0005060 | EFO:0000569 |
| neoplasm | 2 | MONDO:0005070 | EFO:0000616 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| ovarian carcinoma | 2 | MONDO:0005140 | EFO:0001075 |
| dedifferentiated liposarcoma | 2 | MONDO:0020563 | EFO:0003085 |
| tumor of uterus | 2 | MONDO:0021353 | EFO:0003859 |
| fallopian tube carcinoma | 2 | MONDO:0006206 | EFO:1000251 |
| soft tissue sarcoma | 2 | MONDO:0018078 | EFO:1001968 |
| carcinoma | 2 | MONDO:0004993 | EFO:0000313 |
| thymus neoplasm | 2 | MONDO:0005197 | EFO:0002626 |
| lung neuroendocrine neoplasm | 2 | MONDO:0005454 | EFO:0005220 |
| neuroendocrine neoplasm | 2 | MONDO:0019496 | EFO:1001901 |
| fallopian tube neoplasm | 2 | MONDO:0021092 | MONDO:0002158 |
| teratoma | 2 | MONDO:0002601 | MONDO:0002601 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| lymphoma | 1 | MONDO:0005062 | EFO:0000574 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| head and neck squamous cell carcinoma | 1 | MONDO:0010150 | EFO:0000181 |
| metastatic prostate carcinoma | 1 | MONDO:0004956 | EFO:0000196 |
| neuroblastoma | 1 | MONDO:0005072 | EFO:0000621 |
| anaplastic astrocytoma | 1 | MONDO:0016684 | EFO:0002499 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| rhabdoid tumor | 1 | MONDO:0002728 | EFO:0005701 |
| acute lymphoblastic leukemia | 1 | MONDO:0004967 | EFO:0000220 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
| diffuse intrinsic pontine glioma | 1 | MONDO:0006033 | EFO:1000026 |
| primary myelofibrosis | 1 | MONDO:0009692 | MONDO:0044903 |
| paraganglioma | 1 | MONDO:0000448 | EFO:1000453 |
| colorectal neoplasm | 1 | MONDO:0005335 | MONDO:0005575 |
| glioma | 1 | MONDO:0021042 | MONDO:0100342 |
3 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 165.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 47 |
| PHASE2 | 44 |
| PHASE3 | 24 |
| PHASE1/PHASE2 | 24 |
| Not specified | 18 |
| PHASE4 | 5 |
| EARLY_PHASE1 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05161195 | PHASE4 | ACTIVE_NOT_RECRUITING | Roll-over Study to Allow Continued Access to Ribociclib |
| NCT05203172 | PHASE4 | RECRUITING | The FLOTILLA Study: Providing Continued Access to The Study Medicines Encorafenib and Binimetinib for Participants in Prior Clinical Trials |
| NCT05452213 | PHASE4 | RECRUITING | Comprehensive Analysis of Spatial, Temporal and Molecular Patterns of Ribociclib Efficacy and Resistance in Advanced Breast Cancer Patients |
| NCT04657679 | PHASE4 | TERMINATED | Pharmacokinetics and Pharmacogenomics of Ribociclib in Race-based Cohorts |
| NCT07487129 | PHASE4 | COMPLETED | Clinical and Pharmacoeconomic Assessment of CDK4/6 Inhibitors for Treatment of Breast Cancer in Egypt |
| NCT02344472 | PHASE3 | ACTIVE_NOT_RECRUITING | Detect V / CHEVENDO (Chemo vs. Endo) |
| NCT03701334 | PHASE3 | ACTIVE_NOT_RECRUITING | A Trial to Evaluate Efficacy and Safety of Ribociclib With Endocrine Therapy as Adjuvant Treatment in Patients With HR+/HER2- Early Breast Cancer |
| NCT04862663 | PHASE3 | RECRUITING | Capivasertib + CDK4/6i + Fulvestrant for Advanced/Metastatic HR+/HER2- Breast Cancer (CAPItello-292) |
| NCT04964934 | PHASE3 | ACTIVE_NOT_RECRUITING | Phase III Study to Assess AZD9833+ CDK4/6 Inhibitor in HR+/HER2-MBC With Detectable ESR1m Before Progression (SERENA-6) |
| NCT05207709 | PHASE3 | ACTIVE_NOT_RECRUITING | Ribociclib vs. Palbociclib in Patients With Advanced Breast Cancer Within the HER2-Enriched Intrinsic Subtype |
| NCT05827081 | PHASE3 | RECRUITING | Phase IIIb Study of Ribociclib + ET in Early Breast Cancer |
| NCT06065748 | PHASE3 | RECRUITING | A Study to Evaluate Efficacy and Safety of Giredestrant Compared With Fulvestrant (Plus a CDK4/6 Inhibitor), in Participants With ER-Positive, HER2-Negative Advanced Breast Cancer Resistant to Adjuvant Endocrine Therapy (pionERA Breast Cancer) |
| NCT06377852 | PHASE3 | RECRUITING | The CDK4/6 Inhibitor Dosing Knowledge (CDK) Study |
| NCT06380751 | PHASE3 | RECRUITING | Saruparib (AZD5305) Plus Camizestrant Compared With CDK4/6 Inhibitor Plus Endocrine Therapy or Plus Camizestrant in HR-Positive, HER2-Negative (IHC 0, 1+, 2+/ ISH Non-amplified), BRCA1, BRCA2, or PALB2m Advanced Breast Cancer |
| NCT06760637 | PHASE3 | ACTIVE_NOT_RECRUITING | Study of PF-07220060 With Letrozole in Adults With HR-positive HER2-negative Breast Cancer Who Have Not Received Anticancer Treatment for Advanced/Metastatic Disease |
| NCT07085767 | PHASE3 | RECRUITING | Palazestrant in Combination With Ribociclib for the First-line Treatment of ER+/HER2- Advanced Breast Cancer |
| NCT07174336 | PHASE3 | RECRUITING | A Study of Tersolisib (LY4064809/STX-478) With Other Anti-Cancer Treatments in Participants With Advanced Breast Cancer With a Genetic Change (PIK3CA) |
| NCT07340658 | PHASE3 | NOT_YET_RECRUITING | A Study to Investigate the Efficacy and Safety of Letrozole SIE Compared With Femara® (Both Combined With the CDK4/6 Inhibitor Ribociclib) in Postmenopausal Women With HR-Positive, HER2-Negative, Inoperable Locally Advanced or Metastatic Breast Cancer |
| NCT07492641 | PHASE3 | RECRUITING | BGB-43395 Plus Letrozole Versus CDK4/6i Plus Letrozole for Patients With Advanced or Metastatic HR+/HER2- Breast Cancer Who Have Not Received Prior Treatment for Advanced or Metastatic Disease |
| NCT01958021 | PHASE3 | COMPLETED | Study of Efficacy and Safety of LEE011 in Postmenopausal Women With Advanced Breast Cancer |
| NCT02278120 | PHASE3 | COMPLETED | Study of Efficacy and Safety in Premenopausal Women With Hormone Receptor Positive, HER2-negative Advanced Breast Cancer |
| NCT02422615 | PHASE3 | COMPLETED | Study of Efficacy and Safety of LEE011 in Men and Postmenopausal Women With Advanced Breast Cancer. |
| NCT02941926 | PHASE3 | COMPLETED | Study to Assess the Safety and Efficacy of Ribociclib (LEE011) in Combination With Letrozole for the Treatment of Men and Pre/Postmenopausal Women With HR+ HER2- aBC |
| NCT03050398 | PHASE3 | TERMINATED | A Companion Sample Collection Protocol to Support the Discovery of Breast Cancer Aberrations With Treatment of CDK4/6 Therapy/LEE011/Ribociclib |
| NCT03081234 | PHASE3 | WITHDRAWN | Adjuvant Ribociclib With Endocrine Therapy in Hormone Receptor+/HER2- Intermediate Risk Early Breast Cancer |
| NCT03096847 | PHASE3 | COMPLETED | Study for Women and Men With Hormone-receptor Positive Locally Advanced or Metastatic Breast Cancer |
| NCT03439046 | PHASE3 | COMPLETED | Study of the Molecular Features of Postmenopausal Women With HR+ HER2-negative aBC on First-line Treatment With Ribociclib and Letrozole and, in Patients With a PIK3CA Mutation, on Second-line Treatment With Alpelisib Plus Fulvestrant |
| NCT03462251 | PHASE3 | COMPLETED | Ribociclib and Endocrine Therapy or Chemotherapy With or Without Bevacizumab for Metastatic Breast Cancer in First Line |
| NCT03905343 | PHASE3 | TERMINATED | Ribociclib-endocrine Combination Therapy Versus Chemotherapy as 1st Line in Visceral mBC |
| NCT01872260 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Study of LEE011, BYL719 and Letrozole in Advanced ER+ Breast Cancer |
| NCT02712723 | PHASE2 | ACTIVE_NOT_RECRUITING | Letrozole Plus Ribociclib or Placebo as Neo-adjuvant Therapy in ER-positive, HER2-negative Early Breast Cancer |
| NCT02813135 | PHASE1/PHASE2 | RECRUITING | European Proof-of-Concept Therapeutic Stratification Trial of Molecular Anomalies in Relapsed or Refractory Tumors |
| NCT02925234 | PHASE2 | RECRUITING | The Drug Rediscovery Protocol (DRUP Trial) |
| NCT02934568 | PHASE2 | ACTIVE_NOT_RECRUITING | Ribociclib (LEE011) Rollover Study for Continued Access |
| NCT03008408 | PHASE2 | ACTIVE_NOT_RECRUITING | A Phase II, Two-Arm Study of Everolimus and Letrozole, +/- Ribociclib (Lee011) in Patients With Advanced or Recurrent Endometrial Carcinoma |
| NCT03090165 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Ribociclib and Bicalutamide in AR+ TNBC |
| NCT03114527 | PHASE2 | ACTIVE_NOT_RECRUITING | Phase II Trial of Ribociclib and Everolimus in Advanced Dedifferentiated Liposarcoma (DDL) and Leiomyosarcoma (LMS) |
| NCT03285412 | PHASE2 | ACTIVE_NOT_RECRUITING | CDK 4/6 Inhibitor, Ribociclib, With Adjuvant Endocrine Therapy for ER-positive Breast Cancer |
| NCT03673124 | PHASE2 | ACTIVE_NOT_RECRUITING | Ribociclib and Letrozole Treatment in Ovarian Cancer |
| NCT03944434 | PHASE2 | ACTIVE_NOT_RECRUITING | FACILE: FeAsibility of First-line RiboCIclib in OLdEr Patients with Advanced Breast Cancer |
Clinical evidence (CIViC)
Variant × indication × effect (10 predictive associations from 10 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| CCND1 Amplification | Cancer | Sensitivity/Response | Ribociclib | CIViC B | EID7789 |
| NRAS Mutation | Skin Melanoma | Sensitivity/Response | Ribociclib + Binimetinib | CIViC B | EID2931 |
| FGFR1 Amplification AND ZNF703 Amplification | Breast Cancer | Resistance | Ribociclib + Letrozole | CIViC B | EID12531 |
| RB1 Mutation | Breast Cancer | Resistance | Palbociclib + Ribociclib | CIViC C | EID6097 |
| CCND1 Overexpression | Anaplastic Thyroid Carcinoma | Sensitivity/Response | Ribociclib | CIViC D | EID7790 |
| CDK4 EXPRESSION | Childhood B-cell Acute Lymphoblastic Leukemia | Sensitivity/Response | Ribociclib + Dexamethasone | CIViC D | EID7798 |
| CDK6 EXPRESSION | Childhood B-cell Acute Lymphoblastic Leukemia | Sensitivity/Response | Dexamethasone + Ribociclib | CIViC D | EID7801 |
| PIK3CA Mutation | Breast Cancer | Sensitivity/Response | Ribociclib + Phosphatidylinositide 3-Kinase Inhibitor | CIViC D | EID1600 |
| SMARCA4 Loss | Ovarian Small Cell Carcinoma | Sensitivity/Response | Palbociclib + Ribociclib + Abemaciclib | CIViC D | EID7154 |
| CDK4 Overexpression | Alveolar Rhabdomyosarcoma | Resistance | Ribociclib + Palbociclib | CIViC D | EID7138 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 3 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
57 molecules share ≥1 primary target. Top 57 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | CDK4 |
| CERITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | CDK4 |
| ENCORAFENIB | ChEMBL | Phase 4 (approved) | CDK4 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | CDK4 |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | CDK4 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| TRILACICLIB | ChEMBL | Phase 4 (approved) | CDK4 |
| ALVOCIDIB | ChEMBL | Phase 3 | CDK4 |
| DALPICICLIB | ChEMBL | Phase 3 | CDK4 |
| DINACICLIB | ChEMBL | Phase 3 | CDK4 |
| DOVITINIB | ChEMBL | Phase 3 | CDK4 |
| LEROCICLIB | ChEMBL | Phase 3 | CDK4 |
| LESTAURTINIB | ChEMBL | Phase 3 | CDK4 |
| QUERCETIN | ChEMBL | Phase 3 | CDK4 |
| RUBOXISTAURIN | ChEMBL | Phase 3 | CDK4 |
| AT-7519 | ChEMBL | Phase 2 | CDK4 |
| AT-9283 | ChEMBL | Phase 2 | CDK4 |
| ATIRMOCICLIB | ChEMBL | Phase 2 | CDK4 |
| BI-2536 | ChEMBL | Phase 2 | CDK4 |
| CROZBACICLIB | ChEMBL | Phase 2 | CDK4 |
| CT-7001 | ChEMBL | Phase 2 | CDK4 |
| CULMERCICLIB | ChEMBL | Phase 2 | CDK4 |
| CYC-065 | ChEMBL | Phase 2 | CDK4 |
| EBVACICLIB | ChEMBL | Phase 2 | CDK4 |
| ECIRUCICLIB | ChEMBL | Phase 2 | CDK4 |
| ELLAGIC ACID | ChEMBL | Phase 2 | CDK4 |
| INDIRUBIN | ChEMBL | Phase 2 | CDK4 |
| INIXACICLIB | ChEMBL | Phase 2 | CDK4 |
| ISTISOCICLIB | ChEMBL | Phase 2 | CDK4 |
| LY-2090314 | ChEMBL | Phase 2 | CDK4 |
| MILCICLIB | ChEMBL | Phase 2 | CDK4 |
| NARAZACICLIB | ChEMBL | Phase 2 | CDK4 |
| REBASTINIB | ChEMBL | Phase 2 | CDK4 |
| RG-547 | ChEMBL | Phase 2 | CDK4 |
| RIVICICLIB | ChEMBL | Phase 2 | CDK4 |
| RONICICLIB | ChEMBL | Phase 2 | CDK4 |
| SELICICLIB | ChEMBL | Phase 2 | CDK4 |
| SU-014813 | ChEMBL | Phase 2 | CDK4 |
| TEGTOCICLIB | ChEMBL | Phase 2 | CDK4 |
| ULECACICLIB | ChEMBL | Phase 2 | CDK4 |
| VORUCICLIB | ChEMBL | Phase 2 | CDK4 |
| ZEMIRCICLIB | ChEMBL | Phase 2 | CDK4 |
| Afatinib | PubChem | Approved | CDK4 |
| Binimetinib | PubChem | Approved | CDK4 |
| Crizotinib | PubChem | Approved | CDK4 |
| dacomitinib | PubChem | Approved | CDK4 |
| Fostamatinib | PubChem | Approved | CDK4 |
| Gefitinib | PubChem | Approved | CDK4 |
| Idelalisib | PubChem | Approved | CDK4 |
| Pazopanib | PubChem | Approved | CDK4 |
| Pomalidomide | PubChem | Approved | CDK4 |
| regorafenib | PubChem | Approved | CDK4 |
| Selumetinib | PubChem | Approved | CDK4 |
| Trametinib | PubChem | Approved | CDK4 |
Related Atlas pages
- Genes: CDK4
- Diseases: breast carcinoma, breast neoplasm, cancer, cutaneous melanoma, thyroid gland undifferentiated (anaplastic) carcinoma, ovarian small cell carcinoma, alveolar rhabdomyosarcoma
- Drugs: Abemaciclib, Ceritinib, Dabrafenib, Encorafenib, Fedratinib, Gilteritinib, Nintedanib, Palbociclib, Sunitinib, Trilaciclib, Alvocidib, Dalpiciclib, Dinaciclib, Dovitinib, Lerociclib, Lestaurtinib, Quercetin, Ruboxistaurin, Afatinib, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Pazopanib, Pomalidomide, regorafenib, Selumetinib, Trametinib
- Biomarker genes: CCND1