Rifampin
drugOn this page
Also known as AbrifamBA 41166/EBA 411661EBA-41166/EBA-41166EEremfatL-5103L-5103 LEPETITNIH-10782NSC-113926RifaRifadinRifadineRifaldazineRifaldinRifampicinRifampicinaRifampicineRifampicinum
Summary
Rifampin (CHEMBL374478) is an approved small-molecule EC 2.7.7.6 (RNA polymerase) inhibitor (ATC J04AB02) targeting SLCO1A2, SLCO1B1, and SLCO1B3; indicated across 56 conditions including pulmonary tuberculosis and tuberculosis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: J04AB02
- Targets: 4 (SLCO1A2, SLCO1B1, SLCO1B3…)
- Indications: 56 conditions
- Clinical trials: 367
- Chemistry: 822.9 Da · C43H58N4O12
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL374478 |
| Name | Rifampin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 135398735 |
| ChEBI | CHEBI:28077 |
| ATC | J04AB02 |
| Molecular formula | C43H58N4O12 |
| Molecular weight | 822.9 |
| InChIKey | JQXXHWHPUNPDRT-WLSIYKJHSA-N |
SMILES: C[C@H]1/C=C/C=C(\C(=O)NC2=C(C(=C3C(=C2O)C(=C(C4=C3C(=O)[C@](O4)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C)O)O)/C=N/N5CCN(CC5)C)/C
IUPAC name: [(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,27,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-26-[(E)-(4-methylpiperazin-1-yl)iminomethyl]-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
ChEBI definition: A member of the class of rifamycins that is a a semisynthetic antibiotic derived from Amycolatopsis rifamycinica (previously known as Amycolatopsis mediterranei and Streptomyces mediterranei).
Pharmacological roles (ChEBI): EC 2.7.7.6 (RNA polymerase) inhibitor, DNA synthesis inhibitor, antitubercular agent, leprostatic drug, protein synthesis inhibitor, neuroprotective agent, angiogenesis inhibitor, pregnane X receptor agonist, antineoplastic agent, antiamoebic agent, geroprotector.
Other ChEBI roles (chemical / environmental): Escherichia coli metabolite.
Also known as: Abrifam, BA 41166/E, BA 411661E, BA-41166/E, BA-41166E, Eremfat, L-5103, L-5103 LEPETIT, NIH-10782, NSC-113926, Rifa, Rifadin
Patent coverage: 31,040 distinct patent families (93,834 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 92,670 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLCO1A2 | OATP1A2 | Inhibition | 4.29 | 0.2% | P46721 |
| SLCO1B1 | OATP1B1 | Inhibition | 5.96 | 0% | Q9Y6L6 |
| SLCO1B3 | OATP1B3 | Inhibition | 5.8 | 0% | Q9NPD5 |
| NR1I2 | Pregnane X receptor | Agonist | 6 | 0.3% | O75469 |
Broader ChEMBL bioactivity targets: 63 (assay-derived). Sample: Microtubule-associated protein tau, Solute carrier organic anion transporter family member 1B1, Solute carrier organic anion transporter family member 1B3, Solute carrier organic anion transporter family member 1A2, Solute carrier organic anion transporter family member 2B1, ATP-binding cassette sub-family C member 4, Solute carrier organic anion transporter family member 1A1, Solute carrier organic anion transporter family member 1A4, Vasopressin V2 receptor, Enoyl-[acyl-carrier-protein] reductase [NADH].
Bioactivity
ChEMBL activities: 40 potent at pChembl ≥ 5 of 94 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P9WGR1 | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_15041284 |
| NR1I2 | 6.72 | EC50 | 190 | nM | CHEMBL_ACT_16636988 |
| NR1I2 | 6.7 | EC50 | 200 | nM | CHEMBL_ACT_15448139 |
| NR1I2 | 6.65 | EC50 | 226 | nM | CHEMBL_ACT_17979140 |
| SLCO1B1 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_15448330 |
| NR1I2 | 6.25 | EC50 | 564 | nM | CHEMBL_ACT_29256827 |
| P00811 | 6.15 | Potency | 707.9 | nM | CHEMBL_ACT_4689205 |
| NR1I2 | 6 | EC50 | 1000 | nM | CHEMBL_ACT_26335897 |
| SLCO1B1 | 5.96 | Ki | 1100 | nM | CHEMBL_ACT_12088879 |
| NR1I2 | 5.96 | EC50 | 1100 | nM | CHEMBL_ACT_16516710 |
| NR1I2 | 5.93 | EC50 | 1170 | nM | CHEMBL_ACT_25021795 |
| SLCO1B1 | 5.92 | IC50 | 1200 | nM | CHEMBL_ACT_12088880 |
| NR1I2 | 5.92 | EC50 | 1190 | nM | CHEMBL_ACT_25049966 |
| CYP2B6 | 5.89 | EC50 | 1300 | nM | CHEMBL_ACT_15457873 |
| O35913 | 5.85 | Ki | 1400 | nM | CHEMBL_ACT_11002329 |
| SLCO1B3 | 5.85 | Ki | 1400 | nM | CHEMBL_ACT_12088877 |
| NR1I2 | 5.85 | EC50 | 1400 | nM | CHEMBL_ACT_23266659 |
| O35913 | 5.84 | Ki | 1460 | nM | CHEMBL_ACT_11002325 |
| NR1I2 | 5.84 | EC50 | 1440 | nM | CHEMBL_ACT_25691869 |
| SLCO1B3 | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_12088878 |
| NR1I2 | 5.7 | EC50 | 2000 | nM | CHEMBL_ACT_18674058 |
| SLCO1B1 | 5.66 | IC50 | 2200 | nM | CHEMBL_ACT_15448320 |
| NR1I2 | 5.64 | EC50 | 2300 | nM | CHEMBL_ACT_10936319 |
| SLCO1B1 | 5.64 | IC50 | 2300 | nM | CHEMBL_ACT_15448336 |
| ADRA1A | 5.63 | AC50 | 2332 | nM | CHEMBL_ACT_25137969 |
| P12530 | 5.53 | IC50 | 2949 | nM | CHEMBL_ACT_7819675 |
| NR1I2 | 5.5 | EC50 | 3200 | nM | CHEMBL_ACT_15463730 |
| NR1I2 | 5.46 | EC50 | 3500 | nM | CHEMBL_ACT_15463723 |
| SLCO1B3 | 5.3 | Ki | 5000 | nM | CHEMBL_ACT_11003207 |
| HTR3A | 5.28 | AC50 | 5200 | nM | CHEMBL_ACT_25149181 |
Target pathways
Aggregated over 4 target gene(s): SLCO1A2, SLCO1B1, SLCO1B3, NR1I2.
Top Reactome pathways
21 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Recycling of bile acids and salts | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Bile acid and bile salt metabolism | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Transport of small molecules | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Transport of vitamins, nucleosides, and related molecules | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| SLC-mediated transmembrane transport | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Metabolism of lipids | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Organic anion transport by SLCO transporters | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Metabolism of steroids | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Drug ADME | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Disease | 2 | SLCO1B1, SLCO1B3 |
| Metabolism of porphyrins | 2 | SLCO1B1, SLCO1B3 |
| Heme degradation | 2 | SLCO1B1, SLCO1B3 |
| SLC transporter disorders | 2 | SLCO1B1, SLCO1B3 |
| Disorders of transmembrane transporters | 2 | SLCO1B1, SLCO1B3 |
| Atorvastatin ADME | 2 | SLCO1B1, SLCO1B3 |
| Nuclear Receptor transcription pathway | 1 | NR1I2 |
| SUMOylation of intracellular receptors | 1 | NR1I2 |
| Defective SLCO1B3 causes hyperbilirubinemia, Rotor type (HBLRR) | 1 | SLCO1B3 |
| Defective SLCO1B1 causes hyperbilirubinemia, Rotor type (HBLRR) | 1 | SLCO1B1 |
| Ciprofloxacin ADME | 1 | SLCO1A2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| xenobiotic metabolic process | 4 |
| monoatomic ion transport | 3 |
| obsolete organic anion transport | 3 |
| bile acid and bile salt transport | 3 |
| sodium-independent organic anion transport | 3 |
| lipid transport | 3 |
| transmembrane transport | 3 |
| heme catabolic process | 2 |
| obsolete organic cation transport | 1 |
| prostaglandin transport | 1 |
| thyroid hormone transport | 1 |
| negative regulation of transcription by RNA polymerase II | 1 |
| regulation of DNA-templated transcription | 1 |
| signal transduction | 1 |
| steroid metabolic process | 1 |
Indications & clinical
Indications
56 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| pulmonary tuberculosis | 4 | MONDO:0006052 | EFO:1000049 |
| tuberculosis | 4 | MONDO:0018076 | MONDO:0018076 |
| multiple system atrophy | 3 | MONDO:0007803 | EFO:1001050 |
| reactive arthritis | 3 | MONDO:0017376 | EFO:0007460 |
| leprosy | 3 | MONDO:0005124 | EFO:0001054 |
| endocarditis | 3 | MONDO:0005025 | MONDO:0000565 |
| Clostridium difficile colitis | 3 | MONDO:0000705 | EFO:1001314 |
| diarrheal disease | 3 | MONDO:0001673 | HP:0002014 |
| meningitis | 3 | MONDO:0021108 | MONDO:0021108 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| AIDS | 2 | MONDO:0012268 | EFO:0000765 |
| Mycobacterium avium complex disease | 2 | MONDO:0005866 | EFO:0007386 |
| onchocerciasis | 2 | MONDO:0017137 | EFO:0007402 |
| Buruli ulcer disease | 2 | MONDO:0000327 | MONDO:0000327 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| cystic fibrosis | 2 | MONDO:0009061 | MONDO:0009061 |
| sarcoidosis | 2 | MONDO:0019338 | MONDO:0019338 |
| melanoma | 1 | MONDO:0005105 | EFO:0000756 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| constipation disorder | 1 | MONDO:0002203 | HP:0002019 |
| lymphoma | 1 | MONDO:0005062 | EFO:0000574 |
| B-cell chronic lymphocytic leukemia | 1 | MONDO:0004948 | EFO:0000095 |
| Hodgkins lymphoma | 1 | MONDO:0004952 | EFO:0000183 |
| diabetes mellitus | 1 | MONDO:0005015 | EFO:0000400 |
| rheumatoid arthritis | 1 | MONDO:0008383 | EFO:0000685 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| endometriosis | 1 | MONDO:0005133 | EFO:0001065 |
| pulmonary arterial hypertension | 1 | MONDO:0015924 | EFO:0001361 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
| non-Hodgkin lymphoma | 1 | MONDO:0018908 | EFO:0005952 |
| rhinoscleroma | 1 | MONDO:0005945 | EFO:0007470 |
| metabolic dysfunction-associated steatohepatitis | 1 | MONDO:0007027 | EFO:1001249 |
| respiratory syncytial virus infectious disease | 1 | MONDO:0001577 | EFO:1001413 |
| chronic hepatitis B virus infection | 1 | MONDO:0005366 | EFO:0004239 |
| kidney failure | 1 | MONDO:0001106 | HP:0000083 |
| thrombotic disease | 1 | MONDO:0000831 | MONDO:0000831 |
| fungal infectious disease | 1 | MONDO:0002041 | MONDO:0002041 |
| coronary artery disorder | 1 | MONDO:0005010 | EFO:0001645 |
| chronic kidney disease | 1 | MONDO:0005300 | EFO:0003884 |
| essential hypertension | 1 | MONDO:0001134 | MONDO:0001134 |
| type 2 diabetes mellitus | 1 | MONDO:0005148 | MONDO:0005148 |
| Parkinson disease | 1 | MONDO:0005180 | MONDO:0005180 |
| hypercalcemia disease | 1 | MONDO:0001566 | HP:0003072 |
| severe acute respiratory syndrome | 1 | MONDO:0005091 | MONDO:0100096 |
| erectile dysfunction | 1 | MONDO:0005362 | EFO:0004234 |
| anti-neutrophil antibody associated vasculitis | 1 | MONDO:0005435 | EFO:0004826 |
| hematopoietic and lymphoid system neoplasm | 1 | MONDO:0002334 | MONDO:0044881 |
| primary myelofibrosis | 1 | MONDO:0009692 | MONDO:0044903 |
| osteomyelitis | 0 | MONDO:0005246 | EFO:0003102 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 367.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 222 |
| PHASE2 | 41 |
| PHASE3 | 34 |
| Not specified | 31 |
| PHASE4 | 28 |
| PHASE2/PHASE3 | 6 |
| EARLY_PHASE1 | 3 |
| PHASE1/PHASE2 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04921943 | PHASE4 | RECRUITING | Hypertonic Saline for MAC |
| NCT06172010 | PHASE4 | RECRUITING | Rifampicin Combination Therapy Versus Monotherapy for Staphylococcal Prosthetic Joint Infection |
| NCT07084402 | PHASE4 | RECRUITING | Short-term Bactericidal Effect of Contezolid in MAC-PD |
| NCT07330531 | PHASE4 | NOT_YET_RECRUITING | Drug-drug Interaction Study of Rifampin and Anaprazole Sodium |
| NCT00598962 | PHASE4 | COMPLETED | Use of Azithromycin and Rifabutin Administered 3 Times Weekly for the Treatment of M. Avium Complex (MAC) Lung Disease |
| NCT00620438 | PHASE4 | UNKNOWN | Drug Interaction Between Coartem® and Nevirapine, Efavirenz or Rifampicin in HIV Positive Ugandan Patients |
| NCT00711854 | PHASE4 | COMPLETED | Randomized Clinical Trial to Compare a Regimen of Trimethoprim-sulfamethoxazole Plus Rifampicin With a Regimen of Linezolid in the Treatment of Methicillin-Resistant Staphylococcus Aureus (MRSA) Infection |
| NCT00985270 | PHASE4 | COMPLETED | Pregnane X Receptor (PXR) Agonist Rifampicin Effects on Glucose, Lipid and Hormone Homeostasis |
| NCT01293422 | PHASE4 | COMPLETED | Effects of Pregnane X Receptor (PXR) Activation on Human Glucose, Lipid and Hormone Homeostasis |
| NCT01363765 | PHASE4 | COMPLETED | Xpert MTB/Rif, a New Tool for the Diagnosis of Pulmonary Tuberculosis in Two Municipalities in Brazil |
| NCT01380080 | PHASE4 | COMPLETED | REMEMBER: Reducing Early Mortality & Morbidity by Empiric Tuberculosis (TB) Treatment |
| NCT01395654 | PHASE4 | UNKNOWN | Reintroduction Regimens After Hepatitis During Anti-tuberculosis Treatment |
| NCT01690104 | PHASE4 | COMPLETED | The Effect of PXR Activation on Blood Pressure Regulation |
| NCT01782950 | PHASE4 | UNKNOWN | Evaluation of the Pharmacokinetics of Antituberculosis Drugs and Tuberculosis Treatment Outcomes |
| NCT01854489 | PHASE4 | COMPLETED | Effects of Rifampicin on the Pharmacokinetics and Pharmacodynamics of Sublingual and Intravenous Buprenorphine |
| NCT02057796 | PHASE4 | COMPLETED | Systematic Empirical vs. Test-guided Anti-TB Treatment Impact in Severely Immunosuppressed HIV-infected Adults Initiating ART With CD4 Cell Counts <100/mm3 |
| NCT02200978 | PHASE4 | COMPLETED | A Study for Improving the Outcome of Childhood Acute Promyeloid Leukemia |
| NCT02329405 | PHASE4 | COMPLETED | The Effects of PXR Activation on Hepatic Fat Content |
| NCT02477852 | PHASE4 | UNKNOWN | The Optimal Duration of Preoperative Anti-tuberculosis Treatment of Spinal Tuberculosis |
| NCT02547116 | PHASE4 | WITHDRAWN | Epidemiology and Treatment of Small-colony Variant Staphylococcus Aureus in Cystic Fibrosis |
| NCT02576366 | PHASE4 | COMPLETED | Phenotypic Drug Probes as Predictors of Drug-drug Interactions With Tacrolimus |
| NCT02599493 | PHASE4 | COMPLETED | EVRIOS : Comparative Evaluation of Low Versus High Doses of Rifampicin |
| NCT02901288 | PHASE4 | UNKNOWN | Shortened Regimens for Drug-susceptible Pulmonary Tuberculosis |
| NCT03012529 | PHASE4 | COMPLETED | Investigation of Rifampin to Reduce Pedal Amputations for Osteomyelitis in Diabetics |
| NCT04006353 | PHASE4 | COMPLETED | The Drug Interaction Between Albuvirtide (ABT) and Rifampin(RIF) in Healthy Adult Subjects |
| NCT04463680 | PHASE4 | COMPLETED | Rifampin and the Contraceptive Implant |
| NCT05021731 | PHASE4 | UNKNOWN | Short-course Rifamycin-based Regimens for Latent Tuberculosis in Patients With End-stage Kidney Disease |
| NCT05156437 | PHASE4 | TERMINATED | Postoperative Antibiotic Management Duration Following Surgery for Intravenous Drug Abuse (IVDA) Endocarditis (OPTIMAL) |
| NCT03236987 | PHASE3 | RECRUITING | CLArithromycin Versus AZIthromycin in the Treatment of Mycobacterium Avium Complex (MAC) Lung Infections |
| NCT03474029 | PHASE2/PHASE3 | RECRUITING | Assessment of the Safety, Tolerability, and Effectiveness of Rifapentine Given Daily for LTBI |
| NCT04485156 | PHASE3 | NOT_YET_RECRUITING | Treatment Shortening of Drug-Sensitive Pulmonary Tuberculosis Using High Dose Rifampicin (Hi-DoRi-3) |
| NCT04672525 | PHASE3 | RECRUITING | Rifabutin Versus Rifampicin for Treatment of Staphylococcal PJI Treated With DAIR |
| NCT04951986 | PHASE3 | ACTIVE_NOT_RECRUITING | Testing New Strategies for Patients Hospitalised With HIV-associated Disseminated Tuberculosis |
| NCT05454345 | PHASE3 | NOT_YET_RECRUITING | Sitafloxacin-containing Regimens for Shortening Tuberculosis Treatment |
| NCT05597280 | PHASE3 | RECRUITING | Bedaquiline Enhanced Post ExpOsure Prophylaxis for Leprosy |
| NCT05766267 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | Short-course Regimens for the Treatment of Pulmonary Tuberculosis |
| NCT05821478 | PHASE3 | RECRUITING | Efficacy of an Adapted Antibiotherapy in Hurley Stage 2 Hidradenitis Suppurativa Patients |
| NCT05902221 | PHASE3 | NOT_YET_RECRUITING | Impact of Rifampicin in Treatment Outcome of Cutibacterium Acnes Prosthetic Joint Infections |
| NCT05917340 | PHASE3 | NOT_YET_RECRUITING | Intensified Short Course Regimen for TBM in Adults |
| NCT05994742 | PHASE3 | ACTIVE_NOT_RECRUITING | An Adaptive Multi-arm Trial to Improve Clinical Outcomes Among Children Recovering From Complicated SAM |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
455 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Ritonavir | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1A2, SLCO1B1, SLCO1B3 |
| chenodiol | PubChem | Approved | NR1I2, SLCO1A2, SLCO1B1, SLCO1B3 |
| Erythromycin | PubChem | Approved | NR1I2, SLCO1A2, SLCO1B1, SLCO1B3 |
| Methotrexate | PubChem | Approved | NR1I2, SLCO1A2, SLCO1B1, SLCO1B3 |
| Acetaminophen | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| CANDESARTAN CILEXETIL | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| CEFOTAXIME | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| CEFOXITIN | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| CEFUROXIME | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| CEPHAPIRIN | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| Digoxin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3 |
| Hetacillin | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| Hydroxyprogesterone Caproate | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| Pravastatin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3 |
| RIFAMYCIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| Verapamil | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3 |
| ATORVASTATIN | ChEMBL | Phase 4 (approved) | NR1I2, SLCO1B1, SLCO1B3 |
| Glycyrrhizin | ChEMBL + PubChem | Phase 2 (approved) | SLCO1A2, SLCO1B1, SLCO1B3 |
| acetylcysteine | PubChem | Approved | NR1I2, SLCO1B1, SLCO1B3 |
| Almotriptan | PubChem | Approved | NR1I2, SLCO1B1, SLCO1B3 |
| Dexamethasone | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO1B3 |
| Pyrazinamide | PubChem | Approved | NR1I2, SLCO1B1, SLCO1B3 |
| dinoprostone | ChEMBL + PubChem | Phase 4 (approved) | NR1I2, SLCO1A2 |
| ERLOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| HYDROXYZINE PAMOATE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| Lovastatin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| TANNIC ACID | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| VINBLASTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| BETA CAROTENE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CLARITHROMYCIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CYCLOSPORINE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| DICLOXACILLIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ELTROMBOPAG | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ESTOLATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ETHYLSUCCINATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| GEMFIBROZIL | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| LOSARTAN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| MOMETASONE FUROATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| NONOXYNOL 9 | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| PACLITAXEL | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| SIMVASTATIN | ChEMBL | Phase 4 (approved) | NR1I2, SLCO1B1 |
| SIROLIMUS | ChEMBL | Phase 4 (approved) | NR1I2, SLCO1B1 |
| SULFASALAZINE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| TACROLIMUS | ChEMBL | Phase 4 (approved) | NR1I2, SLCO1B1 |
| TELITHROMYCIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| TELMISARTAN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| VINCRISTINE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ADMILPARANT | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| ALISPORIVIR | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| FASIGLIFAM | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| GOSSYPOL | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| PAMIPARIB | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| SILIBININ | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| SILYBIN A | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| BMS-986020 | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3 |
Related Atlas pages
- Genes: SLCO1A2, SLCO1B1, SLCO1B3, NR1I2
- Diseases: pulmonary tuberculosis, tuberculosis, multiple system atrophy, reactive arthritis, leprosy, endocarditis, Clostridium difficile colitis, diarrheal disease, meningitis, Alzheimer disease
- Drugs: Ritonavir, chenodiol, Erythromycin, Methotrexate, Acetaminophen, Atazanavir, Candesartan Cilexetil, Cefotaxime, Cefoxitin, Cefuroxime, Cephapirin, Digoxin, Hetacillin, Hydroxyprogesterone Caproate, Pravastatin, Rifamycin, Tegaserod, Verapamil, Atorvastatin, acetylcysteine, Almotriptan, Dexamethasone, Pyrazinamide, dinoprostone, Erlotinib, Hydroxyzine Pamoate, Lovastatin, Olmesartan Medoxomil, Tannic Acid, Vinblastine, Beta Carotene, Carbenoxolone, Clarithromycin, Cyclosporine, Dicloxacillin, Eltrombopag, Erythromycin Estolate, Erythromycin Ethylsuccinate, Gemfibrozil, Indomethacin, Losartan, Mometasone Furoate, NONOXYNOL 9, Paclitaxel, Simvastatin, Sirolimus, Sulfasalazine, Tacrolimus, Telithromycin, Telmisartan, Vincristine, Admilparant, Alisporivir, Fasiglifam, Gossypol, Pamiparib, Silibinin