Rifamycin
drugOn this page
Also known as M-14RifamicinaRifamicine svRifamycineRifomycinRifomycin svrifamycin SVRifamycin SVdRIFAMYCIN SV SODIUM
Summary
Rifamycin (CHEMBL437765) is an approved small-molecule antimicrobial agent (ATC S02AA12) targeting SLCO1A2, SLCO1B1, and SLCO1B3; indicated across 5 conditions including eye infectious disorder and tuberculosis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: S02AA12 (+4 more)
- Targets: 4 (SLCO1A2, SLCO1B1, SLCO1B3…)
- Indications: 5 conditions
- Clinical trials: 5
- Chemistry: 697.8 Da · C37H47NO12
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL437765 |
| Name | Rifamycin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 6324616 |
| ChEBI | CHEBI:29673 |
| ATC | S02AA12, A07AA13, J04AB03, D06AX15, S01AA16 |
| Molecular formula | C37H47NO12 |
| Molecular weight | 697.8 |
| InChIKey | HJYYPODYNSCCOU-ODRIEIDWSA-N |
SMILES: C[C@H]1/C=C/C=C(\C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)[C@](O4)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C)O)O)/C
IUPAC name: [(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,27,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
ChEBI definition: A member of the class of rifamycins that exhibits antibiotic and antitubercular properties.
Pharmacological roles (ChEBI): antimicrobial agent, antitubercular agent.
Other ChEBI roles (chemical / environmental): bacterial metabolite.
Also known as: M-14, Rifamicina, Rifamicine sv, Rifamycin, Rifamycine, Rifomycin, Rifomycin sv, rifamycin, rifamycin SV, Rifamycin SV, Rifamycin SVd, RIFAMYCIN
Parent form; salt/anhydrous children: CHEMBL2105680
Patent coverage: 1,221 distinct patent families (2,798 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 2,075 (74%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLCO1A2 | OATP1A2 | Inhibition | 4.96 | 0.2% | P46721 |
| SLCO1B1 | OATP1B1 | Inhibition | 5.7 | 0% | Q9Y6L6 |
| SLCO1B3 | OATP1B3 | Inhibition | 0% | Q9NPD5 | |
| SLCO2B1 | OATP2B1 | Inhibition | 0% | O94956 |
Broader ChEMBL bioactivity targets: 12 (assay-derived). Sample: Solute carrier organic anion transporter family member 1B1, Solute carrier organic anion transporter family member 1B3, Solute carrier organic anion transporter family member 1A2, Solute carrier organic anion transporter family member 2B1, Solute carrier organic anion transporter family member 1A1, Solute carrier organic anion transporter family member 1A4, Thromboxane A2 receptor, Bile salt export pump, Muscarinic acetylcholine receptor M1, Prostaglandin G/H synthase 1.
Bioactivity
ChEMBL activities: 12 potent at pChembl ≥ 5 of 17 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SLCO1B1 | 6.64 | IC50 | 230 | nM | CHEMBL_ACT_11000850 |
| SLCO1B1 | 5.7 | Ki | 2000 | nM | CHEMBL_ACT_11002855 |
| SLCO1B3 | 5.52 | Ki | 3000 | nM | CHEMBL_ACT_11003101 |
| SLCO2B1 | 5.52 | Ki | 3000 | nM | CHEMBL_ACT_11003102 |
| O70127 | 5.51 | IC50 | 3100 | nM | CHEMBL_ACT_15449951 |
| O70127 | 5.42 | Ki | 3800 | nM | CHEMBL_ACT_11002871 |
| ABCB11 | 5.2 | IC50 | 6300 | nM | CHEMBL_ACT_15460419 |
| P46720 | 5.18 | Ki | 6600 | nM | CHEMBL_ACT_11003219 |
| O35913 | 5.14 | Ki | 7300 | nM | CHEMBL_ACT_11003245 |
| ADRA1A | 5.09 | AC50 | 8131 | nM | CHEMBL_ACT_25208621 |
| TBXA2R | 5.06 | AC50 | 8767 | nM | CHEMBL_ACT_25211194 |
| ABCB11 | 5.02 | IC50 | 9500 | nM | CHEMBL_ACT_18051960 |
Target pathways
Aggregated over 4 target gene(s): SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1.
Top Reactome pathways
20 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Transport of small molecules | 4 | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Transport of vitamins, nucleosides, and related molecules | 4 | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| SLC-mediated transmembrane transport | 4 | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Organic anion transport by SLCO transporters | 4 | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Metabolism | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Recycling of bile acids and salts | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Heme degradation | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Bile acid and bile salt metabolism | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Metabolism of lipids | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Metabolism of steroids | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Drug ADME | 3 | SLCO1A2, SLCO1B1, SLCO1B3 |
| Atorvastatin ADME | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Disease | 2 | SLCO1B1, SLCO1B3 |
| Metabolism of porphyrins | 2 | SLCO1B1, SLCO1B3 |
| SLC transporter disorders | 2 | SLCO1B1, SLCO1B3 |
| Disorders of transmembrane transporters | 2 | SLCO1B1, SLCO1B3 |
| Defective SLCO1B3 causes hyperbilirubinemia, Rotor type (HBLRR) | 1 | SLCO1B3 |
| Defective SLCO1B1 causes hyperbilirubinemia, Rotor type (HBLRR) | 1 | SLCO1B1 |
| Aspirin ADME | 1 | SLCO2B1 |
| Ciprofloxacin ADME | 1 | SLCO1A2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| xenobiotic metabolic process | 4 |
| monoatomic ion transport | 4 |
| obsolete organic anion transport | 4 |
| bile acid and bile salt transport | 4 |
| sodium-independent organic anion transport | 4 |
| transmembrane transport | 4 |
| lipid transport | 3 |
| heme catabolic process | 3 |
| prostaglandin transport | 2 |
| obsolete organic cation transport | 1 |
| thyroid hormone transport | 1 |
| transport across blood-brain barrier | 1 |
Indications & clinical
Indications
5 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| eye infectious disorder | 4 | MONDO:0043885 | EFO:1001888 |
| tuberculosis | 4 | MONDO:0018076 | MONDO:0018076 |
| diarrheal disease | 3 | MONDO:0001673 | HP:0002014 |
| irritable bowel syndrome | 2 | MONDO:0005052 | EFO:0000555 |
| dysentery | 2 | MONDO:0001517 | EFO:1001869 |
Clinical trials
Total trials: 5.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE4 | 1 |
| PHASE2 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04349579 | PHASE4 | UNKNOWN | Evaluation of the Effects of Irrigation of the Extraction Socket With Rifamycine |
| NCT01208922 | PHASE3 | COMPLETED | Rifamycin SV-MMX® Tablets Versus Ciprofloxacin Capsules in Acute Traveller’s Diarrhoea |
| NCT05575518 | PHASE3 | UNKNOWN | A Pragmatic Trial With Optimized Dose of Rifampicin and Moxifloxacin for the Treatment of Drug Susceptible Pulmonary Tuberculosis |
| NCT04026984 | PHASE2 | UNKNOWN | Evaluate Safety and Efficacy of Rifamycin SV MMX in the Treatment of Traveler’s Diarrhea in Children Age 6 to 11 Years |
| NCT03528915 | Not specified | COMPLETED | Prevalence of Conjunctivitis and Indentification of Risk Factors With and Without Prophylactic Antibiotic Treatment in Neonates |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
308 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Digoxin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Pravastatin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Ritonavir | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Verapamil | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Glycyrrhizin | ChEMBL + PubChem | Phase 2 (approved) | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Dexamethasone | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Erythromycin | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| Methotrexate | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1 |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| ATORVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| CLARITHROMYCIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| CYCLOSPORINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| ERLOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| GEMFIBROZIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| INDOMETHACIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| Lovastatin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| PACLITAXEL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| TELMISARTAN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| VINBLASTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| VINCRISTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| ELTROMBOPAG | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| SULFASALAZINE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| SILYBIN A | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| GENISTEIN | ChEMBL + PubChem | Phase 2 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| SILICRISTIN | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Acyclovir | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Allopurinol | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Amantadine | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| aminohippuric acid | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Amitriptyline | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Atenolol | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| chenodiol | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO1B3 |
| Cholic Acid | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Ezetimibe | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Metformin | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Phenytoin | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Sildenafil | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| theophylline | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Valacyclovir | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| CANDESARTAN CILEXETIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| DOXORUBICIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B3, SLCO2B1 |
| ETOPOSIDE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B3, SLCO2B1 |
| GLYBURIDE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| HYDROXYZINE PAMOATE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| MITOXANTRONE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B3, SLCO2B1 |
| SIMVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| TANNIC ACID | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| BETA CAROTENE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| DICLOXACILLIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ESTOLATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ETHYLSUCCINATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| LOSARTAN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| MOMETASONE FUROATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| NONOXYNOL 9 | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| TELITHROMYCIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ADMILPARANT | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| ALISPORIVIR | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
Related Atlas pages
- Genes: SLCO1A2, SLCO1B1, SLCO1B3, SLCO2B1
- Diseases: eye infectious disorder, tuberculosis, diarrheal disease
- Drugs: Digoxin, Pravastatin, Rifampin, Ritonavir, Verapamil, Dexamethasone, Erythromycin, Methotrexate, Atazanavir, Atorvastatin, Clarithromycin, Cyclosporine, Erlotinib, Gemfibrozil, Indomethacin, Lovastatin, Olmesartan Medoxomil, Paclitaxel, Telmisartan, Vinblastine, Vincristine, Eltrombopag, Sulfasalazine, Silybin A, Acyclovir, Allopurinol, Amantadine, aminohippuric acid, Amitriptyline, Atenolol, chenodiol, Cholic Acid, Ezetimibe, Metformin, Phenytoin, Sildenafil, theophylline, Valacyclovir, Candesartan Cilexetil, Doxorubicin, Etoposide, Glyburide, Hydroxyzine Pamoate, Mitoxantrone, Simvastatin, Tannic Acid, Beta Carotene, Carbenoxolone, Dicloxacillin, Erythromycin Estolate, Erythromycin Ethylsuccinate, Losartan, Mometasone Furoate, NONOXYNOL 9, Telithromycin, Admilparant, Alisporivir