Ritonavir
drugOn this page
Also known as A-84538ABBOTT-84538ABT-538EmpetusNorvirNSC-693184RitomuneRitonavir component of kaletraRitonavir component of paxlovidRitonavir component of technivieRitonavir component of viekiraxRitonavir component of xiannuoxinRitonavir mylanRitonavir related compounds mixtureRitonavirumRitovirViekiraxViritonRitomavir
Summary
Ritonavir (CHEMBL163) is an approved small-molecule antiviral drug (ATC J05AE03) targeting CYP3A4, CYP3A5, and UGT1A1; indicated across 38 conditions including chronic hepatitis c virus infection and hiv infectious disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: J05AE03
- Targets: 6 (CYP3A4, CYP3A5, UGT1A1…)
- Indications: 38 conditions
- Clinical trials: 593
- Chemistry: 720.9 Da · C37H48N6O5S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL163 |
| Name | Ritonavir |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 392622 |
| ChEBI | CHEBI:45409 |
| ATC | J05AE03 |
| Molecular formula | C37H48N6O5S2 |
| Molecular weight | 720.9 |
| InChIKey | NCDNCNXCDXHOMX-XGKFQTDJSA-N |
SMILES: CC(C)C1=NC(=CS1)CN(C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC2=CC=CC=C2)C[C@@H]([C@H](CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)O
IUPAC name: 1,3-thiazol-5-ylmethyl N-[(2S,3S,5S)-3-hydroxy-5-[[(2S)-3-methyl-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoyl]amino]-1,6-diphenylhexan-2-yl]carbamate
ChEBI definition: An L-valine derivative that is L-valinamide in which α-amino group has been acylated by a [(2-isopropyl-1,3-thiazol-4-yl)methyl]methylcarbamoyl group and in which a hydrogen of the carboxamide amino group has been replaced by a (2R,4S,5S)-4-hydroxy-1,6-diphenyl-5-{[(1,3-thiazol-5-ylmethoxy)carbonyl]amino}hexan-2-yl group. A CYP3A inhibitor and antiretroviral drug from the protease inhibitor class used to treat HIV infection and AIDS, it is often used as a fixed-dose combination with another protease inhibitor, lopinavir. Also used in combination with dasabuvir sodium hydrate, ombitasvir and paritaprevir (under the trade name Viekira Pak) for treatment of chronic hepatitis C virus genotype 1 infection as well as cirrhosis of the liver.
Pharmacological roles (ChEBI): antiviral drug, HIV protease inhibitor.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: A-84538, ABBOTT-84538, ABT-538, Empetus, Norvir, NSC-693184, Ritomune, Ritonavir, Ritonavir component of kaletra, Ritonavir component of paxlovid, Ritonavir component of technivie, Ritonavir component of viekirax
Patent coverage: 14,327 distinct patent families (53,773 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CYP3A4 | CYP3A4 | Inhibition | 7 | 0% | P08684 |
| CYP3A5 | CYP3A5 | Inhibition | 6.92 | 0.2% | P20815 |
| UGT1A1 | UDP glucuronosyltransferase family 1 member A1 | Inhibition | 5.77 | 0% | P22309 |
| TAS2R1 | TAS2R1 | Agonist | 0% | Q9NYW7 | |
| TAS2R8 | TAS2R8 | Agonist | 0% | Q9NYW2 | |
| TAS2R14 | TAS2R14 | Agonist | 0.1% | Q9NYV8 |
Broader ChEMBL bioactivity targets: 54 (assay-derived). Sample: UDP-glucuronosyltransferase 1A1, Microtubule-associated protein tau, Nuclear receptor ROR-gamma, Ferritin light chain, Solute carrier organic anion transporter family member 1B1, Solute carrier organic anion transporter family member 1B3, Solute carrier family 22 member 2, Solute carrier organic anion transporter family member 2B1, Multidrug and toxin extrusion protein 1, Multidrug and toxin extrusion protein 2.
Bioactivity
ChEMBL activities: 60 potent at pChembl ≥ 5 of 101 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CYP3A4 | 7.89 | Ki | 13 | nM | CHEMBL_ACT_25708379 |
| CYP2C9 | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_7809133 |
| CYP3A4 | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_7809139 |
| CYP3A4 | 7.72 | Ki | 19 | nM | CHEMBL_ACT_25708373 |
| CYP3A4 | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_1167663 |
| CYP3A4 | 7.3 | IC50 | 50 | nM | CHEMBL_ACT_3230667 |
| TBXAS1 | 7.12 | IC50 | 76 | nM | CHEMBL_ACT_7813336 |
| SLC47A1 | 7.1 | IC50 | 80 | nM | CHEMBL_ACT_12636136 |
| CYP3A4 | 7 | IC50 | 100 | nM | CHEMBL_ACT_10926484 |
| CYP3A4 | 7 | Ki | 100 | nM | CHEMBL_ACT_6075106 |
| CYP3A4 | 6.96 | IC50 | 110 | nM | CHEMBL_ACT_13913757 |
| CYP3A5 | 6.92 | Ki | 120 | nM | CHEMBL_ACT_6075240 |
| CYP3A4 | 6.89 | IC50 | 130 | nM | CHEMBL_ACT_20657649 |
| CYP3A4 | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_25708382 |
| CYP3A4 | 6.77 | Ki | 170 | nM | CHEMBL_ACT_12163653 |
| CYP3A4 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_598943 |
| CYP3A4 | 6.26 | IC50 | 550 | nM | CHEMBL_ACT_12719306 |
| SLCO1B1 | 6.16 | IC50 | 700 | nM | CHEMBL_ACT_15448329 |
| TACR2 | 6.06 | Ki | 874 | nM | CHEMBL_ACT_7813333 |
| SLCO1B1 | 6 | IC50 | 1000 | nM | CHEMBL_ACT_15448319 |
| CYP3A4 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_25708381 |
| TACR1 | 5.94 | AC50 | 1144 | nM | CHEMBL_ACT_25128730 |
| SLCO1B1 | 5.89 | Ki | 1300 | nM | CHEMBL_ACT_12088873 |
| SLCO1B1 | 5.89 | IC50 | 1300 | nM | CHEMBL_ACT_12088874 |
| NR1I2 | 5.85 | AC50 | 1400 | nM | CHEMBL_ACT_25188117 |
| ABCB1 | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_1167666 |
| UGT1A1 | 5.77 | IC50 | 1700 | nM | CHEMBL_ACT_15454222 |
| P15207 | 5.77 | AC50 | 1700 | nM | CHEMBL_ACT_25187405 |
| ABCB11 | 5.76 | IC50 | 1740 | nM | CHEMBL_ACT_18129083 |
| CYP2B6 | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_3496280 |
Target pathways
Aggregated over 6 target gene(s): CYP3A4, CYP3A5, UGT1A1, TAS2R1, TAS2R8, TAS2R14.
Top Reactome pathways
20 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 3 | TAS2R1, TAS2R14, TAS2R8 |
| Signaling by GPCR | 3 | TAS2R1, TAS2R14, TAS2R8 |
| GPCR downstream signalling | 3 | TAS2R1, TAS2R14, TAS2R8 |
| G alpha (i) signalling events | 3 | TAS2R1, TAS2R14, TAS2R8 |
| Class C/3 (Metabotropic glutamate/pheromone receptors) | 3 | TAS2R1, TAS2R14, TAS2R8 |
| GPCR ligand binding | 3 | TAS2R1, TAS2R14, TAS2R8 |
| Sensory Perception | 3 | TAS2R1, TAS2R14, TAS2R8 |
| Sensory perception of taste | 3 | TAS2R1, TAS2R14, TAS2R8 |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 3 | TAS2R1, TAS2R14, TAS2R8 |
| Xenobiotics | 2 | CYP3A4, CYP3A5 |
| Aflatoxin activation and detoxification | 2 | CYP3A4, CYP3A5 |
| Aspirin ADME | 2 | CYP3A4, UGT1A1 |
| Glucuronidation | 1 | UGT1A1 |
| Heme degradation | 1 | UGT1A1 |
| Phase I - Functionalization of compounds | 1 | CYP3A4 |
| Defective UGT1A1 causes hyperbilirubinemia | 1 | UGT1A1 |
| Biosynthesis of maresin-like SPMs | 1 | CYP3A4 |
| Paracetamol ADME | 1 | UGT1A1 |
| Atorvastatin ADME | 1 | CYP3A4 |
| Prednisone ADME | 1 | CYP3A4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| lipid metabolic process | 3 |
| xenobiotic metabolic process | 3 |
| steroid metabolic process | 3 |
| estrogen metabolic process | 3 |
| retinoic acid metabolic process | 3 |
| detection of chemical stimulus involved in sensory perception of bitter taste | 3 |
| signal transduction | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| sensory perception of taste | 3 |
| lipid hydroxylation | 2 |
| alkaloid catabolic process | 2 |
| xenobiotic catabolic process | 2 |
| retinol metabolic process | 2 |
| aflatoxin metabolic process | 2 |
| oxidative demethylation | 2 |
Indications & clinical
Indications
38 indications (5 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| chronic hepatitis C virus infection | 4 | MONDO:0005354 | EFO:0004220 |
| HIV infectious disease | 4 | MONDO:0005109 | EFO:0000764 |
| hepatitis C virus infection | 4 | MONDO:0005231 | EFO:0003047 |
| viral infectious disease | 4 | MONDO:0005108 | EFO:0000763 |
| hepatitis D virus infection | 3 | MONDO:0005789 | EFO:0007304 |
| AIDS | 3 | MONDO:0012268 | EFO:0000765 |
| Orthocoronavirinae infectious disease | 3 | MONDO:0020753 | MONDO:0100116 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | EFO:0000694 |
| pneumonia | 3 | MONDO:0005249 | EFO:0003106 |
| influenza | 3 | MONDO:0005812 | EFO:0007328 |
| Kaposi’s sarcoma | 2 | MONDO:0005055 | EFO:0000558 |
| sarcoma | 2 | MONDO:0005089 | EFO:0000691 |
| hepatitis B virus infection | 2 | MONDO:0005344 | EFO:0004197 |
| Mycobacterium avium complex disease | 2 | MONDO:0005866 | EFO:0007386 |
| neoplasm | 2 | MONDO:0005070 | MONDO:0004992 |
| long COVID-19 | 2 | MONDO:0100233 | MONDO:0100233 |
| pulmonary arterial hypertension | 1 | MONDO:0015924 | EFO:0001361 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| hypertensive disorder | 1 | MONDO:0005044 | EFO:0000537 |
| malaria | 1 | MONDO:0005136 | EFO:0001068 |
| erectile dysfunction | 1 | MONDO:0005362 | EFO:0004234 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| acute respiratory distress syndrome | 1 | MONDO:0006502 | EFO:1000637 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
| anus neoplasm | 1 | MONDO:0003046 | EFO:0003835 |
| amyotrophic lateral sclerosis | 1 | MONDO:0004976 | MONDO:0004976 |
| tuberculosis | 1 | MONDO:0018076 | MONDO:0018076 |
| prostate adenocarcinoma | 1 | MONDO:0005082 | EFO:0000673 |
| glioma | 1 | MONDO:0021042 | MONDO:0100342 |
9 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 593.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 179 |
| PHASE2 | 130 |
| PHASE3 | 89 |
| PHASE4 | 81 |
| Not specified | 79 |
| PHASE1/PHASE2 | 19 |
| PHASE2/PHASE3 | 13 |
| EARLY_PHASE1 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02460133 | PHASE4 | ACTIVE_NOT_RECRUITING | Understanding HCV Reinfection Rates in an Incarcerated Population After Cure With Interferon Free HCV Treatment |
| NCT06792214 | PHASE4 | RECRUITING | Antiviral Strategies in the Prevention of Long-term Cardiovascular Outcomes Following COVID-19: The paxloviD/Remdesivir Effectiveness For the prEvention of loNg coviD Clinical Trial |
| NCT00005017 | PHASE4 | UNKNOWN | Effectiveness and Safety of Epivir/Ziagen/Zerit (3TC/ABC/d4T) Versus Epivir/Ziagen/Sustiva (3TC/ABC/EFV) Versus Epivir/Ziagen/Agenerase/Norvir (3TC/ABC/APV/RTV) in HIV Patients Who Have Never Received Treatment |
| NCT00055120 | PHASE4 | COMPLETED | When to Start Anti-HIV Drugs in Patients With Opportunistic Infections |
| NCT00148785 | PHASE4 | COMPLETED | A Pharmacokinetic (PK) Study of a Combination of Indinavir, Ritonavir, and Amprenavir |
| NCT00162643 | PHASE4 | UNKNOWN | PI Vs. NNRTI Based Therapy for HIV Advanced Disease |
| NCT00192660 | PHASE4 | COMPLETED | HIV Infection And Metabolic Abnormalities Protocol 1 (HAMA001) |
| NCT00207142 | PHASE4 | COMPLETED | Induction-Maintenance With Atazanavir in HIV Naïve Patients (The INDUMA Study) |
| NCT00224445 | PHASE4 | COMPLETED | Boosted Atazanavir and Truvada Given Once-Daily - BATON Study |
| NCT00234962 | PHASE4 | TERMINATED | Study of Adherence Effects and Clinical Outcomes of Kaletra Based HIV Antiviral Therapy |
| NCT00234975 | PHASE4 | COMPLETED | Safety of Lopinavir/Ritonavir (Kaletra) in HIV/HCV Co-infected Subjects vs Baseline Liver Biopsy Metavir Score |
| NCT00281606 | PHASE4 | COMPLETED | A Multicenter Study to Assess the Tolerability of Once Daily Lopinavir/Ritonavir (LPV/r) Liquid Versus Capsules |
| NCT00335270 | PHASE4 | COMPLETED | A Randomized, Prospective Study of the Efficacy, Safety and Tolerability of Two Doses of GW433908Ritonavir Given With Abacavir/Lamivudine Fixed Dose Combination |
| NCT00342355 | PHASE4 | COMPLETED | Antiretroviral Therapy for Advanced HIV Disease in South Africa |
| NCT00355719 | PHASE4 | COMPLETED | Study to Evaluate the Influence of Nevirapine to Atazanavir in Steady State Equilibrium in HIV Patients |
| NCT00384904 | PHASE4 | COMPLETED | Drug Interaction Study of Famotidine and Atazanavir With Ritonavir in HIV-Infected Patients |
| NCT00386659 | PHASE4 | TERMINATED | Immune Reconstitution in naïve HIV Patients With CD4 <100 Cells/mL When Treated With Lopinavir or Efavirenz. |
| NCT00389402 | PHASE4 | COMPLETED | BASIC: Boosted Atazanavir or Saquinavir Induced Lipid Changes |
| NCT00420355 | PHASE4 | TERMINATED | Pharmacokinetic Study of Two HIV Protease Inhibitors in Patients |
| NCT00426296 | PHASE4 | UNKNOWN | SHARE: Simple HAART With Abacavir, Reyataz, and Epivir |
| NCT00531557 | PHASE4 | COMPLETED | Double Protease Inhibitor to Darunavir Switch Study |
| NCT00540137 | PHASE4 | COMPLETED | The CogNaive Study: Assessing Changes in Neurocognitive Function in Treatment Naïve HIV-1 Positive Subjects |
| NCT00544128 | PHASE4 | COMPLETED | Comparison of Epzicom and Truvada for the Initial Once Daily HIV Treatment |
| NCT00552240 | PHASE4 | COMPLETED | Nevirapine vs. Atazanavir Boosted With Ritonavir on a Background of Truvada in Human Immunodeficiency Virus (HIV) Infected Naive Patients (NEwArT) |
| NCT00564772 | PHASE4 | COMPLETED | Raltegravir Kaletra Pharmacokinetics |
| NCT00605098 | PHASE4 | COMPLETED | Pharmacokinetics of the Tablet Formulation of Lopinavir/r as Standard and Increased Dosage During Pregnancy |
| NCT00630734 | PHASE4 | COMPLETED | Genetic Predictors of Variability in the Drug-drug Interaction Between Darunavir/Ritonavir and Pravastatin |
| NCT00632970 | PHASE4 | TERMINATED | Raltegravir vs. Lopinavir/Ritonavir, Both in Combination With Truvada, in HIV+ Treatment Naive Individuals |
| NCT00648999 | PHASE4 | COMPLETED | Safety and Efficacy of Kaletra in ARV Therapy Experienced Patients |
| NCT00661349 | PHASE4 | TERMINATED | Trial About Hepatic Security of Antiretroviral Treatment Based on Kaletra Versus Nevirapine in Co-infected HIV/HCV Patients |
| NCT00677300 | PHASE4 | COMPLETED | Raltegravir And Darunavir Antiretroviral in Antiretroviral Naive Patients |
| NCT00717067 | PHASE4 | COMPLETED | Pharmacokinetics, Safety And Toleration Of Maraviroc Administered To Subjects With Various Degrees Of Renal Impaired And Normal Renal Function |
| NCT00757783 | PHASE4 | COMPLETED | Changes in Triglyceride and Other Lipids (Levels of Fats Found in Blood) When Taking Darunavir Compared to Atazanavir in HIV-infected Patients That Have Never Received Treatment |
| NCT00759070 | PHASE4 | UNKNOWN | Effects of 2 Initial Standard Antiretroviral Combinations Therapies on Lipid Metabolism |
| NCT00765154 | PHASE4 | TERMINATED | NNRTI/PI Toxicity Switch to Darunavir Study |
| NCT00855413 | PHASE4 | TERMINATED | HIV Viremia and Persistence in Acutely HIV-Infected Patients Treated With Darunavir/Ritonavir and Etravirine |
| NCT00866021 | PHASE4 | COMPLETED | Treatment of HIV/HCV Coinfection With Peg-IFN and Ribavirin in Patients Receiving ART Monotherapy With Lopinavir/r |
| NCT00869960 | PHASE4 | COMPLETED | Impact of Menstrual Cycle on Antiretroviral Pharmacokinetics in Healthy Women |
| NCT00885482 | PHASE4 | COMPLETED | Atazanavir and Lamivudine for Treatment Simplification |
| NCT00994344 | PHASE4 | COMPLETED | Clinical Study to Evaluate the Efficacy and Safety of Lopinavir/Ritonavir Monotherapy Versus Darunavir/Ritonavir Monotherapies as Simplification Switching Strategies of PI/NNRTI-Triple Therapy Based-Regimens |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 19 clinical and 74 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
658 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CYCLOSPORINE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5, UGT1A1 |
| Diclofenac | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5, UGT1A1 |
| KETOCONAZOLE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5, UGT1A1 |
| MIDAZOLAM | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5, UGT1A1 |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | TAS2R1, TAS2R14, TAS2R8 |
| QUERCETIN | ChEMBL + PubChem | Phase 3 (approved) | CYP3A4, CYP3A5, UGT1A1 |
| ACETAMINOPHEN | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| AMIODARONE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| Amitriptyline | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| Ampicillin | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| APREPITANT | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| BUDESONIDE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| CARFILZOMIB | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| CHLORAMPHENICOL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| CHOLECALCIFEROL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| CLOBETASOL PROPIONATE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| DAPSONE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| DAUNORUBICIN | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| DIETHYLSTILBESTROL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| DOLUTEGRAVIR | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| Doxorubicin | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| ESTRADIOL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| ESTRONE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| ETHINYL ESTRADIOL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| EZETIMIBE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| FLUCONAZOLE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| HALOPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| HYDRALAZINE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| KETOPROFEN | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| LAPATINIB | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| MITOXANTRONE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| PACLITAXEL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| Pazopanib | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| Pioglitazone | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| POSACONAZOLE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| PROPOFOL | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| QUINIDINE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| SAQUINAVIR | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| SAXAGLIPTIN | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| Tacrolimus | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| TELITHROMYCIN | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, CYP3A5 |
| TESTOSTERONE | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| TRETINOIN | ChEMBL + PubChem | Phase 4 (approved) | CYP3A4, UGT1A1 |
| AMPRENAVIR | ChEMBL | Phase 4 (approved) | CYP3A4, CYP3A5 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | CYP3A4, CYP3A5 |
| NELFINAVIR | ChEMBL | Phase 4 (approved) | CYP3A4, CYP3A5 |
| VORICONAZOLE | ChEMBL | Phase 4 (approved) | CYP3A4, CYP3A5 |
| SEROTONIN | ChEMBL + PubChem | Phase 3 (approved) | CYP3A4, UGT1A1 |
| RELACORILANT | ChEMBL | Phase 3 | CYP3A4, CYP3A5 |
| GENISTEIN | ChEMBL + PubChem | Phase 2 (approved) | CYP3A4, CYP3A5 |
| COFROGLIPTIN | ChEMBL | Phase 2 | CYP3A4, CYP3A5 |
| GLECIRASIB | ChEMBL | Phase 2 | CYP3A4, CYP3A5 |
| NIFLUMIC ACID | ChEMBL | Phase 2 | CYP3A4, UGT1A1 |
| Bosentan | PubChem | Approved | CYP3A4, CYP3A5 |
| Carbamazepine | PubChem | Approved | CYP3A5, UGT1A1 |
| Phenobarbital | PubChem | Approved | CYP3A5, UGT1A1 |
| rifampin | PubChem | Approved | CYP3A5, UGT1A1 |
| Vorapaxar | PubChem | Approved | CYP3A4, CYP3A5 |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | UGT1A1 |
Related Atlas pages
- Genes: CYP3A4, CYP3A5, TAS2R1, TAS2R8, TAS2R14
- Diseases: chronic hepatitis C virus infection, HIV infectious disease, hepatitis C virus infection, viral infectious disease, hepatitis D virus infection, AIDS, Orthocoronavirinae infectious disease, severe acute respiratory syndrome, pneumonia, influenza
- Drugs: Cyclosporine, Diclofenac, Ketoconazole, Midazolam, Isoproterenol, Quercetin, Acetaminophen, Amiodarone, Amitriptyline, Ampicillin, Aprepitant, Budesonide, Carfilzomib, Chloramphenicol, Cholecalciferol, Clobetasol Propionate, Clozapine, Dapsone, Daunorubicin, Diethylstilbestrol, Dolutegravir, Doxorubicin, Estradiol, Estrone, Ethinyl Estradiol, Ezetimibe, Fluconazole, Haloperidol, Hydralazine, Ketoprofen, Lapatinib, Mitoxantrone, Paclitaxel, Pazopanib, Pioglitazone, Posaconazole, Propofol, Quinidine, Saquinavir, Saxagliptin, Tacrolimus, Telithromycin, Testosterone, Tretinoin, Amprenavir, Cannabidiol, Nelfinavir, Voriconazole, Serotonin, Relacorilant, Bosentan, Carbamazepine, Phenobarbital, rifampin, Vorapaxar, Atazanavir