Rizatriptan
drugOn this page
Also known as L-705126MaxaltMK-462 FREE BASESID174007052SID144205087Rizatriptan Benzoate (Maxalt)
Summary
Rizatriptan (CHEMBL905) is an approved small-molecule serotonergic agonist (ATC N02CC04) targeting HTR1A, HTR1B, and HTR1D; indicated across 3 conditions including migraine disorder and migraine with aura.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N02CC04
- Targets: 5 (HTR1A, HTR1B, HTR1D…)
- Indications: 3 conditions
- Clinical trials: 12
- Chemistry: 269.34 Da · C15H19N5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL905 |
| Name | Rizatriptan |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5078 |
| ChEBI | CHEBI:48273 |
| ATC | N02CC04 |
| Molecular formula | C15H19N5 |
| Molecular weight | 269.34 |
| InChIKey | ULFRLSNUDGIQQP-UHFFFAOYSA-N |
SMILES: CN(C)CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3
IUPAC name: N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine
Pharmacological roles (ChEBI): serotonergic agonist, vasoconstrictor agent, anti-inflammatory drug.
Also known as: L-705126, Maxalt, MK-462 FREE BASE, Rizatriptan, rizatriptan, SID174007052, SID144205087, RIZATRIPTAN, Rizatriptan Benzoate (Maxalt)
Parent form; salt/anhydrous children: CHEMBL1201032, CHEMBL3989629
Patent coverage: 3,335 distinct patent families (13,722 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 13,717 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR1A | 5-HT1A receptor | Full agonist | 6.4 | 0% | P08908 |
| HTR1B | 5-HT1B receptor | Partial agonist | 6.9 | 0.2% | P28222 |
| HTR1D | 5-HT1D receptor | Full agonist | 7.9 | 0% | P28221 |
| HTR1E | 5-ht1e receptor | Full agonist | 6.8 | 0% | P28566 |
| HTR1F | 5-HT1F receptor | Full agonist | 6.8 | 0.1% | P30939 |
Broader ChEMBL bioactivity targets: 11 (assay-derived). Sample: 5-hydroxytryptamine receptor 2B, 5-hydroxytryptamine receptor 1B, Alpha-2C adrenergic receptor, 5-hydroxytryptamine receptor 1D, Serotonin 3 (5-HT3) receptor, 5-hydroxytryptamine receptor 1A, 5-hydroxytryptamine receptor 2A, 5-hydroxytryptamine receptor 2C, Histamine H1 receptor, 5-hydroxytryptamine receptor 2A.
Bioactivity
ChEMBL activities: 24 potent at pChembl ≥ 5 of 28 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR1B | 8.52 | Ki | 3 | nM | CHEMBL_ACT_25553869 |
| HTR1D | 8.52 | Ki | 3 | nM | CHEMBL_ACT_25553874 |
| HTR1D | 8.52 | EC50 | 3 | nM | CHEMBL_ACT_786215 |
| HTR1D | 8.37 | Ki | 4.3 | nM | CHEMBL_ACT_786212 |
| HTR1D | 8.08 | EC50 | 8.4 | nM | CHEMBL_ACT_773047 |
| HTR1B | 8 | Ki | 10.1 | nM | CHEMBL_ACT_786214 |
| HTR1D | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_773045 |
| HTR1D | 7.87 | Ki | 13.5 | nM | CHEMBL_ACT_463418 |
| HTR1D | 7.4 | Ki | 40 | nM | CHEMBL_ACT_463419 |
| HTR1B | 7.39 | IC50 | 41 | nM | CHEMBL_ACT_773046 |
| P79400 | 7.3 | IC50 | 50.12 | nM | CHEMBL_ACT_89500 |
| HTR1D | 7.1 | IC50 | 79.43 | nM | CHEMBL_ACT_89508 |
| HTR1A | 6.85 | Ki | 140 | nM | CHEMBL_ACT_786213 |
| HTR1A | 6.53 | Ki | 293 | nM | CHEMBL_ACT_463420 |
| HTR1A | 6.5 | IC50 | 316.2 | nM | CHEMBL_ACT_89502 |
| HTR1A | 6.4 | IC50 | 398.1 | nM | CHEMBL_ACT_89509 |
| HTR1A | 5.75 | AC50 | 1776 | nM | CHEMBL_ACT_25164341 |
| HTR1A | 5.5 | AC50 | 3200 | nM | CHEMBL_ACT_25216515 |
| P35563 | 5.4 | IC50 | 3981 | nM | CHEMBL_ACT_89505 |
| HRH1 | 5.24 | AC50 | 5795 | nM | CHEMBL_ACT_25211977 |
| P14842 | 5.2 | IC50 | 6310 | nM | CHEMBL_ACT_89504 |
| HTR2A | 5.11 | AC50 | 7746 | nM | CHEMBL_ACT_25225831 |
| HTR2C | 5.1 | IC50 | 7943 | nM | CHEMBL_ACT_89503 |
| HTR2A | 5.1 | IC50 | 7943 | nM | CHEMBL_ACT_89511 |
Target pathways
Aggregated over 5 target gene(s): HTR1A, HTR1B, HTR1D, HTR1E, HTR1F.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 5 | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| Signaling by GPCR | 5 | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| Class A/1 (Rhodopsin-like receptors) | 5 | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| Amine ligand-binding receptors | 5 | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| Serotonin receptors | 5 | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| GPCR ligand binding | 5 | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| GPCR downstream signalling | 4 | HTR1B, HTR1D, HTR1E, HTR1F |
| G alpha (i) signalling events | 4 | HTR1B, HTR1D, HTR1E, HTR1F |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 5 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 5 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 5 |
| chemical synaptic transmission | 5 |
| signal transduction | 5 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 4 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 4 |
| regulation of behavior | 3 |
| vasoconstriction | 2 |
| behavioral fear response | 1 |
| serotonin receptor signaling pathway | 1 |
| gamma-aminobutyric acid signaling pathway | 1 |
| positive regulation of cell population proliferation | 1 |
| regulation of serotonin secretion | 1 |
| regulation of vasoconstriction | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| migraine disorder | 4 | MONDO:0005277 | MONDO:0005277 |
| migraine with aura | 3 | MONDO:0005475 | MONDO:0005475 |
| migraine without aura | 3 | MONDO:0100431 | MONDO:0100431 |
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 5 |
| PHASE4 | 3 |
| Not specified | 2 |
| PHASE2/PHASE3 | 1 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00397254 | PHASE4 | COMPLETED | Two Rizatriptan Prescribing Portions for Treatment of Migraine |
| NCT00719134 | PHASE4 | COMPLETED | The Effects of Expectation and Knowledge on Rizatriptan and Placebo Treatment of Acute Migraine Headache |
| NCT01057160 | PHASE4 | COMPLETED | Rizatriptan 10 MG RPD in the Treatment of Acute Migraine |
| NCT00250458 | PHASE3 | COMPLETED | Study to Test a Marketed Product in the Treatment of Migraine-associated Nausea |
| NCT00894556 | PHASE3 | COMPLETED | A Study to Evaluate the Efficacy and Tolerability of Rizatriptan for Treatment of Acute Migraine (0462-087) |
| NCT01001234 | PHASE3 | COMPLETED | A Study to Evaluate the Efficacy and Tolerability of Rizatriptan for Treatment of Acute Migraine in Children and Adolescents (MK-0462-082 AM7) |
| NCT01286207 | PHASE3 | COMPLETED | Long-Term Exposure to Rizatriptan 5-mg and 10-mg Oral Tablet (Combined Extension Protocols MK-0462-022, MK-0462-025, MK-0462-029) |
| NCT02447991 | PHASE2/PHASE3 | COMPLETED | Rizatriptan for Episodic Dizziness in Vestibular Migraine |
| NCT03896009 | PHASE3 | COMPLETED | Maximizing Outcomes in Treating Acute Migraine |
| NCT00246337 | PHASE2 | COMPLETED | A Dose-Finding Study of MK0974 in Acute Migraine (MK0974-004) |
| NCT00360282 | Not specified | COMPLETED | Does a Migraine Medication Decrease Rotational Motion Sickness in People Suffering From Migraines? |
| NCT01306266 | Not specified | WITHDRAWN | Study of Rizatriptan in the Treatment of Acute Attacks of Post-traumatic Headache in U.S. Military Troops |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 12 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
415 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| ERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| NARATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| RISPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| SUMATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| ZOLMITRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| SEROTONIN | ChEMBL + PubChem | Phase 3 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| YOHIMBINE | ChEMBL + PubChem | Phase 3 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| MEBUFOTENIN | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1D, HTR1E, HTR1F |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1E, HTR1F |
| ELETRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1E, HTR1F |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1E, HTR1F |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E |
| FROVATRIPTAN | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E |
| PSILOCIN | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1D, HTR1E |
| CYPROHEPTADINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1E, HTR1F |
| LASMIDITAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1D, HTR1E, HTR1F |
| METHYLERGONOVINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1E, HTR1F |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1E |
| QUETIAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1E, HTR1F |
| SORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1E, HTR1F |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR1B, HTR1D, HTR1E |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| OXYMETAZOLINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| SALMETEROL | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| SILODOSIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| VILAZODONE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| XYLOMETAZOLINE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B, HTR1D |
| ACETRYPTINE | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1D |
| GSK163090 | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1D |
| LYSERGIDE | ChEMBL | Phase 2 | HTR1A, HTR1D, HTR1E |
| RITANSERIN | ChEMBL | Phase 2 | HTR1A, HTR1B, HTR1E |
| ASENAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1E |
| CANNABIDIOL | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1E |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | HTR1B, HTR1D |
| ZIPRASIDONE | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1E |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR1A, HTR1D |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1D |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR1D |
| PINDOLOL | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B |
| PRAZOSIN | ChEMBL | Phase 4 (approved) | HTR1A, HTR1D |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | HTR1A, HTR1B |
| TEGASEROD | ChEMBL | Phase 4 (approved) | HTR1A, HTR1D |
| LATREPIRDINE | ChEMBL | Phase 3 | HTR1D, HTR1E |
| ALNIDITAN | ChEMBL | Phase 2 | HTR1A, HTR1D |
| MAZAPERTINE | ChEMBL | Phase 2 | HTR1A, HTR1B |
| NIGULDIPINE | ChEMBL | Phase 2 | HTR1A, HTR1B |
| PENFLURIDOL | ChEMBL | Phase 2 | HTR1A, HTR1D |
| SPIRAMIDE | ChEMBL | Phase 2 | HTR1A, HTR1D |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | HTR1A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | HTR1A |
| ACETYLCHOLINE | ChEMBL | Phase 4 (approved) | HTR1A |
| ALMOTRIPTAN | ChEMBL | Phase 4 (approved) | HTR1A |
| AMILORIDE | ChEMBL | Phase 4 (approved) | HTR1A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR1A |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | HTR1A |
Related Atlas pages
- Genes: HTR1A, HTR1B, HTR1D, HTR1E, HTR1F
- Diseases: migraine disorder, migraine with aura, migraine without aura
- Drugs: Dihydroergotamine, Ergotamine, Imipramine, Naratriptan, Risperidone, Sumatriptan, Zolmitriptan, Serotonin, Yohimbine, Clozapine, Eletriptan, Olanzapine, Brexpiprazole, Frovatriptan, Cyproheptadine, Lasmiditan, Methylergonovine, Pramipexole, Quetiapine, Sorafenib, Aripiprazole, Azelastine, Cariprazine, Ketanserin, Nefazodone, Oxymetazoline, Salmeterol, Silodosin, Vilazodone, Xylometazoline, Asenapine, Cannabidiol, Paliperidone, Ziprasidone, Cinacalcet, Loperamide, Mianserin, Pindolol, Prazosin, Sertindole, Tegaserod, Latrepirdine, Acemetacin, Acetophenazine, Acetylcholine, Almotriptan, Amiloride, Amitriptyline, Amlodipine