Saralasin
drugOn this page
Also known as Sar-arg-val-tyr-val-his-pro-alaSaralasinaSaralasine
Summary
Saralasin (CHEMBL938) is an approved protein targeting AGTR2.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Protein
- Targets: 1 (AGTR2)
- Chemistry: 912 Da · C42H65N13O10
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL938 |
| Name | Saralasin |
| Type | Protein |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 6324663 |
| Molecular formula | C42H65N13O10 |
| Molecular weight | 912 |
| InChIKey | PFGWGEPQIUAZME-NXSMLHPHSA-N |
SMILES: C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC2=CN=CN2)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC3=CC=C(C=C3)O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC
IUPAC name: (2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-(methylamino)acetyl]amino]pentanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]propanoic acid
Also known as: Sar-arg-val-tyr-val-his-pro-ala, Saralasin, Saralasina, Saralasine, Sar-Arg-Val-Tyr-Val-His-Pro-Ala, SARALASIN
Parent form; salt/anhydrous children: CHEMBL1200670
Patent coverage: 1,896 distinct patent families (7,408 SureChEMBL compound mentions), from 3 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AGTR2 | AT2 receptor | Antagonist | 9 | 0.1% | P50052 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Angiotensin II receptor, Angiotensin II receptor (AT-1) type-1, Angiotensin II receptor, Type-1 angiotensin II receptor, Type-1 angiotensin II receptor B, Type-1 angiotensin II receptor A, Type-2 angiotensin II receptor.
Bioactivity
ChEMBL activities: 25 potent at pChembl ≥ 5 of 25 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| AGTR1 | 10.18 | IC50 | 0.07 | nM | CHEMBL_ACT_438911 |
| AGTR2 | 9.82 | Ki | 0.15 | nM | CHEMBL_ACT_2381366 |
| AGTR1 | 9.77 | Ki | 0.17 | nM | CHEMBL_ACT_13342045 |
| AGTR1 | 9.66 | Ki | 0.22 | nM | CHEMBL_ACT_15097701 |
| P25095 | 9.63 | Kd | 0.23 | nM | CHEMBL_ACT_1074916 |
| AGTR1 | 9.62 | Ki | 0.24 | nM | CHEMBL_ACT_26333254 |
| AGTR1 | 9.48 | Ki | 0.33 | nM | CHEMBL_ACT_2381365 |
| AGTR1 | 9.46 | IC50 | 0.35 | nM | CHEMBL_ACT_13342117 |
| AGTR2 | 9.42 | Ki | 0.38 | nM | CHEMBL_ACT_15097697 |
| AGTR2 | 9.42 | Ki | 0.38 | nM | CHEMBL_ACT_16466557 |
| AGTR1 | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_16501837 |
| AGTR1 | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_16838405 |
| AGTR1 | 9.39 | IC50 | 0.41 | nM | CHEMBL_ACT_26333199 |
| AGTR2 | 9.35 | IC50 | 0.45 | nM | CHEMBL_ACT_2381344 |
| AGTR2 | 9.28 | IC50 | 0.53 | nM | CHEMBL_ACT_5166011 |
| AGTR1 | 9.24 | IC50 | 0.57 | nM | CHEMBL_ACT_5165965 |
| AGTR1 | 9.22 | IC50 | 0.6 | nM | CHEMBL_ACT_13336213 |
| AGTR1 | 9.17 | IC50 | 0.67 | nM | CHEMBL_ACT_2381343 |
| AGTR1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_2573319 |
| AGTR2 | 8.88 | IC50 | 1.32 | nM | CHEMBL_ACT_71130 |
| P25095 | 8.77 | IC50 | 1.69 | nM | CHEMBL_ACT_71129 |
| P29089 | 8.62 | IC50 | 2.4 | nM | CHEMBL_ACT_337042 |
| P25095 | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_19462440 |
| P25095 | 8.12 | EC50 | 7.5 | nM | CHEMBL_ACT_19462281 |
| AGTR1 | 7.96 | EC50 | 11 | nM | CHEMBL_ACT_19462127 |
Target pathways
Aggregated over 1 target gene(s): AGTR2.
Top Reactome pathways
7 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | AGTR2 |
| Signaling by GPCR | 1 | AGTR2 |
| Class A/1 (Rhodopsin-like receptors) | 1 | AGTR2 |
| Peptide ligand-binding receptors | 1 | AGTR2 |
| GPCR downstream signalling | 1 | AGTR2 |
| G alpha (i) signalling events | 1 | AGTR2 |
| GPCR ligand binding | 1 | AGTR2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| blood vessel remodeling | 1 |
| regulation of systemic arterial blood pressure by circulatory renin-angiotensin | 1 |
| angiotensin-mediated vasodilation involved in regulation of systemic arterial blood pressure | 1 |
| brain renin-angiotensin system | 1 |
| inflammatory response | 1 |
| cell surface receptor signaling pathway | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| G protein-coupled receptor signaling pathway coupled to cGMP nucleotide second messenger | 1 |
| brain development | 1 |
| regulation of blood pressure | 1 |
| negative regulation of heart rate | 1 |
| negative regulation of cell growth | 1 |
| regulation of metanephros size | 1 |
| exploration behavior | 1 |
| nitric oxide-cGMP-mediated signaling | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
19 molecules share ≥1 primary target. Top 19 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| LOSARTAN | ChEMBL + PubChem | Phase 4 (approved) | AGTR2 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | AGTR2 |
| ANGIOTENSIN II | ChEMBL | Phase 4 (approved) | AGTR2 |
| AZILSARTAN MEDOXOMIL | ChEMBL | Phase 4 (approved) | AGTR2 |
| BENAZEPRIL | ChEMBL | Phase 4 (approved) | AGTR2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | AGTR2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | AGTR2 |
| IRBESARTAN | ChEMBL | Phase 4 (approved) | AGTR2 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | AGTR2 |
| TELMISARTAN | ChEMBL | Phase 4 (approved) | AGTR2 |
| OLMESARTAN | ChEMBL + PubChem | Phase 3 (approved) | AGTR2 |
| ANGIOTENSIN | ChEMBL | Phase 3 | AGTR2 |
| CANDESARTAN | ChEMBL | Phase 3 | AGTR2 |
| FORASARTAN | ChEMBL | Phase 2 | AGTR2 |
| OLODANRIGAN | ChEMBL | Phase 2 | AGTR2 |
| PRATOSARTAN | ChEMBL | Phase 2 | AGTR2 |
| TASOSARTAN | ChEMBL | Phase 2 | AGTR2 |
| Amiloride | PubChem | Approved | AGTR2 |
| Anagrelide | PubChem | Approved | AGTR2 |